Account for bidi text in combined display/username label

Closes #522

Artwork/Tusker no shadow.svg

@@ -0,0 +1,157 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<svg
+   xmlns:dc="http://purl.org/dc/elements/1.1/"
+   xmlns:cc="http://creativecommons.org/ns#"
+   xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#"
+   xmlns:svg="http://www.w3.org/2000/svg"
+   xmlns="http://www.w3.org/2000/svg"
+   xmlns:xlink="http://www.w3.org/1999/xlink"
+   xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
+   xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
+   sodipodi:docname="Tusker.svg"
+   inkscape:version="1.0beta2 (2b71d25, 2019-12-03)"
+   inkscape:export-ydpi="11.52"
+   inkscape:export-xdpi="11.52"
+   inkscape:export-filename="/Users/shadowfacts/Desktop/60x60@2x.png"
+   id="svg8"
+   version="1.1"
+   viewBox="0 0 264.58333 264.58333"
+   height="1000"
+   width="1000">
+  <defs
+     id="defs2">
+    <inkscape:path-effect
+       bendpath1-nodetypes="cc"
+       bendpath4="M 27.271345,85.808468 V 178.94843"
+       bendpath3="M 27.271345,178.94843 H 242.39013"
+       bendpath2="M 242.39013,85.808468 V 178.94843"
+       bendpath1="M 26.897168,85.995557 242.39013,85.808468"
+       xx="true"
+       yy="true"
+       lpeversion="1"
+       is_visible="true"
+       id="path-effect1345"
+       effect="envelope" />
+    <inkscape:path-effect
+       allow_transforms="true"
+       css_properties=""
+       attributes=""
+       method="d"
+       linkeditem=""
+       lpeversion="1"
+       is_visible="true"
+       id="path-effect38"
+       effect="clone_original" />
+    <inkscape:path-effect
+       scale_y_rel="false"
+       prop_scale="1"
+       strokepath="M0,0 L1,0"
+       endpoint_spacing_variation="0;1"
+       endpoint_edge_variation="0;1"
+       startpoint_spacing_variation="0;1"
+       startpoint_edge_variation="0;1"
+       count="5"
+       lpeversion="1"
+       is_visible="true"
+       id="path-effect32"
+       effect="curvestitching" />
+    <filter
+       height="1.3500000000000001"
+       width="1.2"
+       id="filter1277"
+       inkscape:label="Drop Shadow"
+       style="color-interpolation-filters:sRGB;">
+      <feFlood
+         id="feFlood1267"
+         result="flood"
+         flood-color="rgb(0,0,0)"
+         flood-opacity="0.321569" />
+      <feComposite
+         id="feComposite1269"
+         result="composite1"
+         operator="in"
+         in2="SourceGraphic"
+         in="flood" />
+      <feGaussianBlur
+         id="feGaussianBlur1271"
+         result="blur"
+         stdDeviation="5"
+         in="composite1" />
+      <feOffset
+         id="feOffset1273"
+         result="offset"
+         dy="5"
+         dx="-2.5" />
+      <feComposite
+         id="feComposite1275"
+         result="composite2"
+         operator="over"
+         in2="offset"
+         in="SourceGraphic" />
+    </filter>
+  </defs>
+  <sodipodi:namedview
+     inkscape:window-maximized="0"
+     inkscape:window-y="23"
+     inkscape:window-x="1920"
+     inkscape:window-height="1395"
+     inkscape:window-width="1902"
+     units="px"
+     showgrid="false"
+     inkscape:document-rotation="0"
+     inkscape:current-layer="layer2"
+     inkscape:document-units="px"
+     inkscape:cy="496.39379"
+     inkscape:cx="442.66632"
+     inkscape:zoom="1.4142136"
+     inkscape:pageshadow="2"
+     inkscape:pageopacity="0.0"
+     borderopacity="1.0"
+     bordercolor="#666666"
+     pagecolor="#ffffff"
+     id="base" />
+  <metadata
+     id="metadata5">
+    <rdf:RDF>
+      <cc:Work
+         rdf:about="">
+        <dc:format>image/svg+xml</dc:format>
+        <dc:type
+           rdf:resource="http://purl.org/dc/dcmitype/StillImage" />
+        <dc:title></dc:title>
+      </cc:Work>
+    </rdf:RDF>
+  </metadata>
+  <g
+     inkscape:label="Layer 2"
+     id="layer2"
+     inkscape:groupmode="layer">
+    <rect
+       y="-0.14500916"
+       x="-0.14500916"
+       height="264.87335"
+       width="264.87335"
+       id="rect865"
+       style="fill:#75e04e;fill-opacity:1;stroke:#75e04e;stroke-width:0.239149;stroke-opacity:1" />
+  </g>
+  <g
+     style="display:none"
+     id="layer1"
+     inkscape:groupmode="layer"
+     inkscape:label="Layer 1">
+    <path
+       inkscape:connector-curvature="0"
+       d="m 63.595661,96.781172 c 2.610557,8.549728 11.109144,14.261728 18.221441,19.677268 14.285995,10.87784 30.777538,19.16253 47.836068,24.76819 12.08516,3.97134 24.9714,5.89737 37.69211,5.9756 11.75058,0.0723 23.533,-2.04773 34.88282,-5.09124 8.49997,-2.27931 17.13306,-4.99674 24.52676,-9.76937 5.59427,-3.6111 11.35542,-7.93448 14.37737,-13.86775 0.73693,-1.44688 2.00968,-3.90176 0.67356,-4.82442 -4.90929,-3.39011 -10.18592,6.31619 -15.70026,8.59349 -8.68681,3.58745 -17.81526,6.26681 -27.07782,7.85916 -11.94219,2.05301 -24.25018,3.46797 -36.29097,2.10779 -12.7013,-1.4348 -25.14557,-5.50493 -36.82103,-10.70737 -8.48127,-3.77914 -16.22058,-9.14294 -23.66896,-14.68689 C 96.49438,102.53405 91.950513,96.75601 86.13513,92.560411 82.533585,89.96202 79.028923,86.323649 74.610572,85.8754 c -3.438589,-0.34885 -7.602338,0.653715 -9.831133,3.295317 -1.655568,1.962204 -1.933509,5.155042 -1.183778,7.610455 z m -36.276154,1.911751 c 1.000129,9.935377 9.068818,18.042637 15.683118,25.523487 13.285704,15.02628 29.55205,27.69127 47.022482,37.54435 12.376983,6.98044 26.073563,11.90937 39.996973,14.7475 13.12015,2.67439 26.76072,2.8433 40.12178,1.96426 10.02366,-0.65947 20.39718,-1.4876 29.64741,-5.40445 6.55654,-2.77625 13.10939,-6.72368 17.37506,-12.42454 1.08663,-1.45223 3.06381,-3.85048 1.78759,-5.13927 -4.73249,-4.77911 -12.53753,5.06785 -19.12154,6.4416 -10.27704,2.1443 -20.88256,2.99026 -31.37744,2.71972 -13.53101,-0.3488 -27.32398,-1.47627 -40.22043,-5.58617 -13.6039,-4.33535 -26.35283,-11.50217 -38.013078,-19.74231 -8.470214,-5.98579 -15.782756,-13.54635 -22.737346,-21.24101 -5.371021,-5.94258 -9.092383,-13.26181 -14.551151,-19.123884 -3.38068,-3.630455 -6.428954,-8.379273 -11.172348,-9.831658 -3.691559,-1.130322 -8.47165,-0.937751 -11.488322,1.47159 -2.240814,1.789682 -3.239987,5.227417 -2.952758,8.080785 z"
+       style="fill:#f9f7f3;fill-opacity:1;stroke:#d0c1a2;stroke-width:0.565786px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;filter:url(#filter1277)"
+       id="path28" />
+  </g>
+  <g
+     inkscape:label="Layer 1 copy"
+     inkscape:groupmode="layer"
+     id="g1343">
+    <path
+       id="path1341"
+       style="fill:#f9f7f3;fill-opacity:1;stroke:#d0c1a2;stroke-width:0.56578600000000001px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
+       d="m 63.595661,96.781172 c 2.610557,8.549728 11.109144,14.261728 18.221441,19.677268 14.285995,10.87784 30.777538,19.16253 47.836068,24.76819 12.08516,3.97134 24.9714,5.89737 37.69211,5.9756 11.75058,0.0723 23.533,-2.04773 34.88282,-5.09124 8.49997,-2.27931 17.13306,-4.99674 24.52676,-9.76937 5.59427,-3.6111 11.35542,-7.93448 14.37737,-13.86775 0.73693,-1.44688 2.00968,-3.90176 0.67356,-4.82442 -4.90929,-3.39011 -10.18592,6.31619 -15.70026,8.59349 -8.68681,3.58745 -17.81526,6.26681 -27.07782,7.85916 -11.94219,2.05301 -24.25018,3.46797 -36.29097,2.10779 -12.7013,-1.4348 -25.14557,-5.50493 -36.82103,-10.70737 -8.48127,-3.77914 -16.22058,-9.14294 -23.66896,-14.68689 C 96.49438,102.53405 91.950513,96.75601 86.13513,92.560411 82.533585,89.96202 79.028923,86.323649 74.610572,85.8754 c -3.438589,-0.34885 -7.602338,0.653715 -9.831133,3.295317 -1.655568,1.962204 -1.933509,5.155042 -1.183778,7.610455 z m -36.276154,1.911751 c 1.000129,9.935377 9.068818,18.042637 15.683118,25.523487 13.285704,15.02628 29.55205,27.69127 47.022482,37.54435 12.376983,6.98044 26.073563,11.90937 39.996973,14.7475 13.12015,2.67439 26.76072,2.8433 40.12178,1.96426 10.02366,-0.65947 20.39718,-1.4876 29.64741,-5.40445 6.55654,-2.77625 13.10939,-6.72368 17.37506,-12.42454 1.08663,-1.45223 3.06381,-3.85048 1.78759,-5.13927 -4.73249,-4.77911 -12.53753,5.06785 -19.12154,6.4416 -10.27704,2.1443 -20.88256,2.99026 -31.37744,2.71972 -13.53101,-0.3488 -27.32398,-1.47627 -40.22043,-5.58617 -13.6039,-4.33535 -26.35283,-11.50217 -38.013078,-19.74231 -8.470214,-5.98579 -15.782756,-13.54635 -22.737346,-21.24101 -5.371021,-5.94258 -9.092383,-13.26181 -14.551151,-19.123884 -3.38068,-3.630455 -6.428954,-8.379273 -11.172348,-9.831658 -3.691559,-1.130322 -8.47165,-0.937751 -11.488322,1.47159 -2.240814,1.789682 -3.239987,5.227417 -2.952758,8.080785 z" />
+  </g>
+</svg>

Artwork/Tusker transparent.svg

@@ -0,0 +1,153 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<svg
+   sodipodi:docname="Tusker transparent.svg"
+   inkscape:version="1.3.2 (091e20e, 2023-11-25)"
+   inkscape:export-ydpi="98.304001"
+   inkscape:export-xdpi="98.304001"
+   inkscape:export-filename="../Desktop/1024x1024-dark@1x.png"
+   id="svg8"
+   version="1.1"
+   viewBox="0 0 264.58333 264.58333"
+   height="1000"
+   width="1000"
+   xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
+   xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
+   xmlns:xlink="http://www.w3.org/1999/xlink"
+   xmlns="http://www.w3.org/2000/svg"
+   xmlns:svg="http://www.w3.org/2000/svg"
+   xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#"
+   xmlns:cc="http://creativecommons.org/ns#"
+   xmlns:dc="http://purl.org/dc/elements/1.1/">
+  <defs
+     id="defs2">
+    <inkscape:path-effect
+       bendpath1-nodetypes="cc"
+       bendpath4="M 27.271345,85.808468 V 178.94843"
+       bendpath3="M 27.271345,178.94843 H 242.39013"
+       bendpath2="M 242.39013,85.808468 V 178.94843"
+       bendpath1="M 26.897168,85.995557 242.39013,85.808468"
+       xx="true"
+       yy="true"
+       lpeversion="1"
+       is_visible="true"
+       id="path-effect1345"
+       effect="envelope" />
+    <inkscape:path-effect
+       allow_transforms="true"
+       css_properties=""
+       attributes=""
+       method="d"
+       linkeditem=""
+       lpeversion="1"
+       is_visible="true"
+       id="path-effect38"
+       effect="clone_original" />
+    <inkscape:path-effect
+       scale_y_rel="false"
+       prop_scale="1"
+       strokepath="M0,0 L1,0"
+       endpoint_spacing_variation="0;1"
+       endpoint_edge_variation="0;1"
+       startpoint_spacing_variation="0;1"
+       startpoint_edge_variation="0;1"
+       count="5"
+       lpeversion="1"
+       is_visible="true"
+       id="path-effect32"
+       effect="curvestitching" />
+    <filter
+       height="1.317445"
+       width="1.1258237"
+       id="filter1277"
+       inkscape:label="Drop Shadow"
+       style="color-interpolation-filters:sRGB;"
+       x="-0.068723437"
+       y="-0.1318855">
+      <feFlood
+         id="feFlood1267"
+         result="flood"
+         flood-color="rgb(0,0,0)"
+         flood-opacity="0.321569" />
+      <feComposite
+         id="feComposite1269"
+         result="composite1"
+         operator="in"
+         in2="SourceGraphic"
+         in="flood" />
+      <feGaussianBlur
+         id="feGaussianBlur1271"
+         result="blur"
+         stdDeviation="5"
+         in="composite1" />
+      <feOffset
+         id="feOffset1273"
+         result="offset"
+         dy="5"
+         dx="-2.5" />
+      <feComposite
+         id="feComposite1275"
+         result="composite2"
+         operator="over"
+         in2="offset"
+         in="SourceGraphic" />
+    </filter>
+  </defs>
+  <sodipodi:namedview
+     inkscape:window-maximized="0"
+     inkscape:window-y="25"
+     inkscape:window-x="1280"
+     inkscape:window-height="1387"
+     inkscape:window-width="1280"
+     units="px"
+     showgrid="false"
+     inkscape:document-rotation="0"
+     inkscape:current-layer="layer2"
+     inkscape:document-units="px"
+     inkscape:cy="404.46507"
+     inkscape:cx="442.29528"
+     inkscape:zoom="1.4142136"
+     inkscape:pageshadow="2"
+     inkscape:pageopacity="0.0"
+     borderopacity="1.0"
+     bordercolor="#666666"
+     pagecolor="#ffffff"
+     id="base"
+     inkscape:showpageshadow="2"
+     inkscape:pagecheckerboard="0"
+     inkscape:deskcolor="#d1d1d1" />
+  <metadata
+     id="metadata5">
+    <rdf:RDF>
+      <cc:Work
+         rdf:about="">
+        <dc:format>image/svg+xml</dc:format>
+        <dc:type
+           rdf:resource="http://purl.org/dc/dcmitype/StillImage" />
+      </cc:Work>
+    </rdf:RDF>
+  </metadata>
+  <g
+     inkscape:label="Layer 2"
+     id="layer2"
+     inkscape:groupmode="layer" />
+  <g
+     style="display:none"
+     id="layer1"
+     inkscape:groupmode="layer"
+     inkscape:label="Layer 1">
+    <path
+       inkscape:connector-curvature="0"
+       d="m 63.595661,96.781172 c 2.610557,8.549728 11.109144,14.261728 18.221441,19.677268 14.285995,10.87784 30.777538,19.16253 47.836068,24.76819 12.08516,3.97134 24.9714,5.89737 37.69211,5.9756 11.75058,0.0723 23.533,-2.04773 34.88282,-5.09124 8.49997,-2.27931 17.13306,-4.99674 24.52676,-9.76937 5.59427,-3.6111 11.35542,-7.93448 14.37737,-13.86775 0.73693,-1.44688 2.00968,-3.90176 0.67356,-4.82442 -4.90929,-3.39011 -10.18592,6.31619 -15.70026,8.59349 -8.68681,3.58745 -17.81526,6.26681 -27.07782,7.85916 -11.94219,2.05301 -24.25018,3.46797 -36.29097,2.10779 -12.7013,-1.4348 -25.14557,-5.50493 -36.82103,-10.70737 -8.48127,-3.77914 -16.22058,-9.14294 -23.66896,-14.68689 C 96.49438,102.53405 91.950513,96.75601 86.13513,92.560411 82.533585,89.96202 79.028923,86.323649 74.610572,85.8754 c -3.438589,-0.34885 -7.602338,0.653715 -9.831133,3.295317 -1.655568,1.962204 -1.933509,5.155042 -1.183778,7.610455 z m -36.276154,1.911751 c 1.000129,9.935377 9.068818,18.042637 15.683118,25.523487 13.285704,15.02628 29.55205,27.69127 47.022482,37.54435 12.376983,6.98044 26.073563,11.90937 39.996973,14.7475 13.12015,2.67439 26.76072,2.8433 40.12178,1.96426 10.02366,-0.65947 20.39718,-1.4876 29.64741,-5.40445 6.55654,-2.77625 13.10939,-6.72368 17.37506,-12.42454 1.08663,-1.45223 3.06381,-3.85048 1.78759,-5.13927 -4.73249,-4.77911 -12.53753,5.06785 -19.12154,6.4416 -10.27704,2.1443 -20.88256,2.99026 -31.37744,2.71972 -13.53101,-0.3488 -27.32398,-1.47627 -40.22043,-5.58617 -13.6039,-4.33535 -26.35283,-11.50217 -38.013078,-19.74231 -8.470214,-5.98579 -15.782756,-13.54635 -22.737346,-21.24101 -5.371021,-5.94258 -9.092383,-13.26181 -14.551151,-19.123884 -3.38068,-3.630455 -6.428954,-8.379273 -11.172348,-9.831658 -3.691559,-1.130322 -8.47165,-0.937751 -11.488322,1.47159 -2.240814,1.789682 -3.239987,5.227417 -2.952758,8.080785 z"
+       style="fill:#f9f7f3;fill-opacity:1;stroke:#d0c1a2;stroke-width:0.565786px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;filter:url(#filter1277)"
+       id="path28" />
+  </g>
+  <g
+     inkscape:label="Layer 1 copy"
+     inkscape:groupmode="layer"
+     id="g1343">
+    <path
+       id="path1341"
+       style="fill:#75e04e;fill-opacity:1;stroke:#74e04d;stroke-width:0.565786px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
+       d="m 63.595661,96.781172 c 2.610557,8.549728 11.109144,14.261728 18.221441,19.677268 14.285995,10.87784 30.777538,19.16253 47.836068,24.76819 12.08516,3.97134 24.9714,5.89737 37.69211,5.9756 11.75058,0.0723 23.533,-2.04773 34.88282,-5.09124 8.49997,-2.27931 17.13306,-4.99674 24.52676,-9.76937 5.59427,-3.6111 11.35542,-7.93448 14.37737,-13.86775 0.73693,-1.44688 2.00968,-3.90176 0.67356,-4.82442 -4.90929,-3.39011 -10.18592,6.31619 -15.70026,8.59349 -8.68681,3.58745 -17.81526,6.26681 -27.07782,7.85916 -11.94219,2.05301 -24.25018,3.46797 -36.29097,2.10779 -12.7013,-1.4348 -25.14557,-5.50493 -36.82103,-10.70737 -8.48127,-3.77914 -16.22058,-9.14294 -23.66896,-14.68689 C 96.49438,102.53405 91.950513,96.75601 86.13513,92.560411 82.533585,89.96202 79.028923,86.323649 74.610572,85.8754 c -3.438589,-0.34885 -7.602338,0.653715 -9.831133,3.295317 -1.655568,1.962204 -1.933509,5.155042 -1.183778,7.610455 z m -36.276154,1.911751 c 1.000129,9.935377 9.068818,18.042637 15.683118,25.523487 13.285704,15.02628 29.55205,27.69127 47.022482,37.54435 12.376983,6.98044 26.073563,11.90937 39.996973,14.7475 13.12015,2.67439 26.76072,2.8433 40.12178,1.96426 10.02366,-0.65947 20.39718,-1.4876 29.64741,-5.40445 6.55654,-2.77625 13.10939,-6.72368 17.37506,-12.42454 1.08663,-1.45223 3.06381,-3.85048 1.78759,-5.13927 -4.73249,-4.77911 -12.53753,5.06785 -19.12154,6.4416 -10.27704,2.1443 -20.88256,2.99026 -31.37744,2.71972 -13.53101,-0.3488 -27.32398,-1.47627 -40.22043,-5.58617 -13.6039,-4.33535 -26.35283,-11.50217 -38.013078,-19.74231 -8.470214,-5.98579 -15.782756,-13.54635 -22.737346,-21.24101 -5.371021,-5.94258 -9.092383,-13.26181 -14.551151,-19.123884 -3.38068,-3.630455 -6.428954,-8.379273 -11.172348,-9.831658 -3.691559,-1.130322 -8.47165,-0.937751 -11.488322,1.47159 -2.240814,1.789682 -3.239987,5.227417 -2.952758,8.080785 z" />
+  </g>
+</svg>

Artwork/Tusker.svg

@@ -0,0 +1,162 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<svg
+   sodipodi:docname="Tusker.svg"
+   inkscape:version="1.3.2 (091e20e, 2023-11-25)"
+   inkscape:export-ydpi="98.304001"
+   inkscape:export-xdpi="98.304001"
+   inkscape:export-filename="../Desktop/1024x1024@1x.png"
+   id="svg8"
+   version="1.1"
+   viewBox="0 0 264.58333 264.58333"
+   height="1000"
+   width="1000"
+   xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
+   xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
+   xmlns:xlink="http://www.w3.org/1999/xlink"
+   xmlns="http://www.w3.org/2000/svg"
+   xmlns:svg="http://www.w3.org/2000/svg"
+   xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#"
+   xmlns:cc="http://creativecommons.org/ns#"
+   xmlns:dc="http://purl.org/dc/elements/1.1/">
+  <defs
+     id="defs2">
+    <inkscape:path-effect
+       bendpath1-nodetypes="cc"
+       bendpath4="M 27.271345,85.808468 V 178.94843"
+       bendpath3="M 27.271345,178.94843 H 242.39013"
+       bendpath2="M 242.39013,85.808468 V 178.94843"
+       bendpath1="M 26.897168,85.995557 242.39013,85.808468"
+       xx="true"
+       yy="true"
+       lpeversion="1"
+       is_visible="true"
+       id="path-effect1345"
+       effect="envelope" />
+    <inkscape:path-effect
+       allow_transforms="true"
+       css_properties=""
+       attributes=""
+       method="d"
+       linkeditem=""
+       lpeversion="1"
+       is_visible="true"
+       id="path-effect38"
+       effect="clone_original" />
+    <inkscape:path-effect
+       scale_y_rel="false"
+       prop_scale="1"
+       strokepath="M0,0 L1,0"
+       endpoint_spacing_variation="0;1"
+       endpoint_edge_variation="0;1"
+       startpoint_spacing_variation="0;1"
+       startpoint_edge_variation="0;1"
+       count="5"
+       lpeversion="1"
+       is_visible="true"
+       id="path-effect32"
+       effect="curvestitching" />
+    <filter
+       height="1.317445"
+       width="1.1258237"
+       id="filter1277"
+       inkscape:label="Drop Shadow"
+       style="color-interpolation-filters:sRGB;"
+       x="-0.068723437"
+       y="-0.1318855">
+      <feFlood
+         id="feFlood1267"
+         result="flood"
+         flood-color="rgb(0,0,0)"
+         flood-opacity="0.321569" />
+      <feComposite
+         id="feComposite1269"
+         result="composite1"
+         operator="in"
+         in2="SourceGraphic"
+         in="flood" />
+      <feGaussianBlur
+         id="feGaussianBlur1271"
+         result="blur"
+         stdDeviation="5"
+         in="composite1" />
+      <feOffset
+         id="feOffset1273"
+         result="offset"
+         dy="5"
+         dx="-2.5" />
+      <feComposite
+         id="feComposite1275"
+         result="composite2"
+         operator="over"
+         in2="offset"
+         in="SourceGraphic" />
+    </filter>
+  </defs>
+  <sodipodi:namedview
+     inkscape:window-maximized="0"
+     inkscape:window-y="25"
+     inkscape:window-x="1280"
+     inkscape:window-height="1387"
+     inkscape:window-width="1280"
+     units="px"
+     showgrid="false"
+     inkscape:document-rotation="0"
+     inkscape:current-layer="layer2"
+     inkscape:document-units="px"
+     inkscape:cy="496.38895"
+     inkscape:cx="442.29528"
+     inkscape:zoom="1.4142136"
+     inkscape:pageshadow="2"
+     inkscape:pageopacity="0.0"
+     borderopacity="1.0"
+     bordercolor="#666666"
+     pagecolor="#ffffff"
+     id="base"
+     inkscape:showpageshadow="2"
+     inkscape:pagecheckerboard="0"
+     inkscape:deskcolor="#d1d1d1" />
+  <metadata
+     id="metadata5">
+    <rdf:RDF>
+      <cc:Work
+         rdf:about="">
+        <dc:format>image/svg+xml</dc:format>
+        <dc:type
+           rdf:resource="http://purl.org/dc/dcmitype/StillImage" />
+        <dc:title />
+      </cc:Work>
+    </rdf:RDF>
+  </metadata>
+  <g
+     inkscape:label="Layer 2"
+     id="layer2"
+     inkscape:groupmode="layer">
+    <rect
+       y="-0.14500916"
+       x="-0.14500916"
+       height="264.87335"
+       width="264.87335"
+       id="rect865"
+       style="fill:#75e04e;fill-opacity:1;stroke:#75e04e;stroke-width:0.239149;stroke-opacity:1" />
+  </g>
+  <g
+     style="display:none"
+     id="layer1"
+     inkscape:groupmode="layer"
+     inkscape:label="Layer 1">
+    <path
+       inkscape:connector-curvature="0"
+       d="m 63.595661,96.781172 c 2.610557,8.549728 11.109144,14.261728 18.221441,19.677268 14.285995,10.87784 30.777538,19.16253 47.836068,24.76819 12.08516,3.97134 24.9714,5.89737 37.69211,5.9756 11.75058,0.0723 23.533,-2.04773 34.88282,-5.09124 8.49997,-2.27931 17.13306,-4.99674 24.52676,-9.76937 5.59427,-3.6111 11.35542,-7.93448 14.37737,-13.86775 0.73693,-1.44688 2.00968,-3.90176 0.67356,-4.82442 -4.90929,-3.39011 -10.18592,6.31619 -15.70026,8.59349 -8.68681,3.58745 -17.81526,6.26681 -27.07782,7.85916 -11.94219,2.05301 -24.25018,3.46797 -36.29097,2.10779 -12.7013,-1.4348 -25.14557,-5.50493 -36.82103,-10.70737 -8.48127,-3.77914 -16.22058,-9.14294 -23.66896,-14.68689 C 96.49438,102.53405 91.950513,96.75601 86.13513,92.560411 82.533585,89.96202 79.028923,86.323649 74.610572,85.8754 c -3.438589,-0.34885 -7.602338,0.653715 -9.831133,3.295317 -1.655568,1.962204 -1.933509,5.155042 -1.183778,7.610455 z m -36.276154,1.911751 c 1.000129,9.935377 9.068818,18.042637 15.683118,25.523487 13.285704,15.02628 29.55205,27.69127 47.022482,37.54435 12.376983,6.98044 26.073563,11.90937 39.996973,14.7475 13.12015,2.67439 26.76072,2.8433 40.12178,1.96426 10.02366,-0.65947 20.39718,-1.4876 29.64741,-5.40445 6.55654,-2.77625 13.10939,-6.72368 17.37506,-12.42454 1.08663,-1.45223 3.06381,-3.85048 1.78759,-5.13927 -4.73249,-4.77911 -12.53753,5.06785 -19.12154,6.4416 -10.27704,2.1443 -20.88256,2.99026 -31.37744,2.71972 -13.53101,-0.3488 -27.32398,-1.47627 -40.22043,-5.58617 -13.6039,-4.33535 -26.35283,-11.50217 -38.013078,-19.74231 -8.470214,-5.98579 -15.782756,-13.54635 -22.737346,-21.24101 -5.371021,-5.94258 -9.092383,-13.26181 -14.551151,-19.123884 -3.38068,-3.630455 -6.428954,-8.379273 -11.172348,-9.831658 -3.691559,-1.130322 -8.47165,-0.937751 -11.488322,1.47159 -2.240814,1.789682 -3.239987,5.227417 -2.952758,8.080785 z"
+       style="fill:#f9f7f3;fill-opacity:1;stroke:#d0c1a2;stroke-width:0.565786px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;filter:url(#filter1277)"
+       id="path28" />
+  </g>
+  <g
+     inkscape:label="Layer 1 copy"
+     inkscape:groupmode="layer"
+     id="g1343">
+    <path
+       id="path1341"
+       style="fill:#f9f7f3;fill-opacity:1;stroke:#d0c1a2;stroke-width:0.56578600000000001px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;filter:url(#filter1277)"
+       d="m 63.595661,96.781172 c 2.610557,8.549728 11.109144,14.261728 18.221441,19.677268 14.285995,10.87784 30.777538,19.16253 47.836068,24.76819 12.08516,3.97134 24.9714,5.89737 37.69211,5.9756 11.75058,0.0723 23.533,-2.04773 34.88282,-5.09124 8.49997,-2.27931 17.13306,-4.99674 24.52676,-9.76937 5.59427,-3.6111 11.35542,-7.93448 14.37737,-13.86775 0.73693,-1.44688 2.00968,-3.90176 0.67356,-4.82442 -4.90929,-3.39011 -10.18592,6.31619 -15.70026,8.59349 -8.68681,3.58745 -17.81526,6.26681 -27.07782,7.85916 -11.94219,2.05301 -24.25018,3.46797 -36.29097,2.10779 -12.7013,-1.4348 -25.14557,-5.50493 -36.82103,-10.70737 -8.48127,-3.77914 -16.22058,-9.14294 -23.66896,-14.68689 C 96.49438,102.53405 91.950513,96.75601 86.13513,92.560411 82.533585,89.96202 79.028923,86.323649 74.610572,85.8754 c -3.438589,-0.34885 -7.602338,0.653715 -9.831133,3.295317 -1.655568,1.962204 -1.933509,5.155042 -1.183778,7.610455 z m -36.276154,1.911751 c 1.000129,9.935377 9.068818,18.042637 15.683118,25.523487 13.285704,15.02628 29.55205,27.69127 47.022482,37.54435 12.376983,6.98044 26.073563,11.90937 39.996973,14.7475 13.12015,2.67439 26.76072,2.8433 40.12178,1.96426 10.02366,-0.65947 20.39718,-1.4876 29.64741,-5.40445 6.55654,-2.77625 13.10939,-6.72368 17.37506,-12.42454 1.08663,-1.45223 3.06381,-3.85048 1.78759,-5.13927 -4.73249,-4.77911 -12.53753,5.06785 -19.12154,6.4416 -10.27704,2.1443 -20.88256,2.99026 -31.37744,2.71972 -13.53101,-0.3488 -27.32398,-1.47627 -40.22043,-5.58617 -13.6039,-4.33535 -26.35283,-11.50217 -38.013078,-19.74231 -8.470214,-5.98579 -15.782756,-13.54635 -22.737346,-21.24101 -5.371021,-5.94258 -9.092383,-13.26181 -14.551151,-19.123884 -3.38068,-3.630455 -6.428954,-8.379273 -11.172348,-9.831658 -3.691559,-1.130322 -8.47165,-0.937751 -11.488322,1.47159 -2.240814,1.789682 -3.239987,5.227417 -2.952758,8.080785 z" />
+  </g>
+</svg>

CHANGELOG-release.md

@@ -0,0 +1,268 @@
+## 2024.4
+This release introduces support for iOS 18, including a new sidebar/tab bar on iPad, as well as bugfixes and improvements.
+
+Features/Improvements:
+- Import image description when adding attachments from Photos if possible
+- iPadOS 18: New floating sidebar/tab bar
+
+Bugfixes:
+- Fix crash when viewing profiles in certain circumstances
+- Fix video controls in attachment gallery not auto-hiding
+- Fix crash if hashtag search results includes duplicates
+- Fix "no content" text not being removed from list timeline after refreshing
+- macOS: Fix video controls overlay being positioned incorrectly when Reduce Motion is on
+- macOS: Fix reselecting current item not navigating back
+
+## 2024.3
+This update includes a number of bugfixes and performance improvements. See below for a list of fixes.
+
+Bugfixes:
+- Fix an issue displaying rich text in certain cases
+- Fix crash when video attachment finishes playing
+- Fix video attachment thumbnails being flipped on Compose screen
+- Fix profile header images being blurry
+- Fix crash when opening push notifications in certain circumstances
+- Fix certain links in profile fields not being tappable
+- Fix gifv playback pausing audio from other apps
+- Fix gifv playback being paused when returning from background
+- Fix badges on gifv attachments not appearing
+- Fix excessive network traffic when opening profile pages
+- Fix controls visibility not matching across attachment gallery pages
+- Fix add hashtag/instance pinned timeline sheet in Customize Timelines dismissing instantly
+- Fix Dynamic Type not applying to status content
+- Fix mention/status push notifications not showing CW
+- Fix sensitive attachment thumbnails being shown in push notifications
+- Fix profile moved overlay visual and VoiceOver issues
+- Fix opening Mastodon remote status links
+- Fix reply author avatar on Compose screen not being pinned to top when scrolling while typing
+- Pleroma/Akkoma: Fix editing attachment descriptions not working
+- Pixelfed/Firefish: Fix error loading certain accounts
+- Pixelfed: Fix error loading relationships and follow/block/etc. actions
+- iPadOS: Fix pointer interactions throughout the app
+- iPadOS: Fix multiple close buttons being added in multi-column interface
+- iPadOS: Fix Cmd+1/etc. removing columns when returning to previous tab
+- iPadOS: Fix multi-column interface not animating for some actions
+- iPadOS: Fix selecting search results always adding new column
+
+## 2024.2
+This release introduces push notifications as well as an enhanced multi-column interface on iPadOS!
+
+Features/Improvements:
+- Push notifications
+- Add post preview to Appearance preferences
+- Show instance announcements in Notifications tab
+- Add subscription option to Tip Jar
+- iPadOS: Multi-column navigation
+- Pleroma/Akkoma: Emoji reaction notifications
+
+Bugfixes:
+- Fix fetching server info on some instances
+- Fix attachment captions not displaying while loading in gallery
+- macOS: Remove in-app Safari preferences
+- Pleroma: Handle posts with missing creation date
+
+## 2024.1
+This update includes a significant improvements for the attachment gallery and displaying rich text posts. See below for a full list of improvements and fixes.
+
+Features/Improvements:
+- Improve attachment gallery
+  - Improve animations
+  - Display video captions
+  - Support sharing/saving videos
+  - Resume music playback after playing videos
+- Improve rich text display in posts
+- Add See Results button to polls
+- Add Share and Save to Photos menu items to post attachments
+- Show verified links in account lists
+- Display message on empty list timelines
+- Add preference to indicate attachments lacking alt text
+- Mark notifications as read on Mastodon web frontend once displayed
+- iPadOS: Support tapping the selected sidebar item to scroll to top
+
+Bugfixes:
+- Fix issue changing scope after searching
+- Fix crash when searching "from:me"
+- Fix tapping Followers button on profile opening Following screen
+- Fix crash when removing poll option on Compose screen
+- Fix hang when sharing video/GIFV attachments
+- Fix stretched Save to Photos icon when sharing attachments
+- Fix GIFV playback preventing device sleep
+- Fix Notifications tab not scrolling to top when tab bar item tapped
+- Fix selection not clearing on Trending Hashtags
+- Fix fast account switcher overlapping iPhone sensor housing in landscape
+- Fix Edit List screen not updating when adding/removing accounts
+- Fix changing list reply policy not refreshing timeline
+- Pixelfed: Fix crash when there are multiple follow notifications from the same account
+- macOS: Fix attachment gallery displaying improperly when Reduce Motion is on
+
+## 2023.8
+This update adds support for search operators and post translation, and improves support for displaying rich-text posts. See below for a full list of improvements and fixes.
+
+Features/Improvements:
+- Show search operators on Mastodon 4.2
+- Use server-set preference for default post visibility, language, and (on Hometown) local-only
+- Allow changing list reply policy and exclusivity options on Edit List screen
+- Add Translate action to conversations (on supported Mastodon instances)
+- Style block quotes correclty in rich-text posts
+- Improve the appearance of lists in rich-text posts
+- Add preference to underline links
+- Compress uploaded video attachments to fit within instance limits
+- Add preference to hide attachments in timelines
+- Update visible timestamps after refresh notifications/timelines
+- iPadOS: Allow switching between split screen and fullscreen navigation modes
+- Pixelfed: Improve error message when uploading attachment fails
+- Akkoma: Enable composing local-only posts
+
+Bugfixes:
+- Fix older notifications not loading if all initiially-loaded ones are grouped together
+- Fix List timelines failing to refresh if they were initially empty
+- Fix replies to posts with CWs always showing confirmation dialog when cancelling
+- Fix Compose screen permitting setting the language to multiple/undefined
+- Fix crash when uploading attachments without file extensions
+- Fix Live Text button reappearing with swiping between attachment gallery pages
+- Fix avatars on certain notifications flickering when refreshing
+- Fix avatars on follow request notifications not being rounded
+- Fix timeline jump button appearing incorrectly when Button Shapes acccessibility setting is on
+- Fix public instance timeline screen not handling post deletion correctly
+- Fix post that's reblogged and contains a followed hashtag not showing the reblogger
+- Fix crash on launch when reblogged posts are visible
+- Fix crash when showing display names with custom emoji in certain places
+- Fix crash when showing trending hashtags without history data
+- Fix potential crash on instance selector screen
+- Fix potential crash if the app is dismissed while fast account switcher is animating
+- Fix potential crash after deleting List on the Eplore screen
+- Pixelfed: Fix error decoding certain posts
+- VoiceOver: Fix history entries on Edit History screen not having descriptions
+- iPadOS: Fix delay on app launch before "My Profile" sidebar item appears
+- iPadOS: Fix language picker button not highlighting when hovered with the cursor
+- macOS: Fix "New Post" window title appearing twice
+- macOS: Fix Cmd+W sometimes closing non-foreground windows
+- macOS: Fix visibility/local-only buttons not appearing in Compose toolbar
+- macOS: Fix images copied from Safari not pasting on Compose screen
+
+## 2023.7
+This update adds support for iOS 17 and includes some minor changes.
+
+Changes:
+- Support iOS 17
+- Indicate that edit history may be incomplete for remote posts
+- Fix crash when collapsing to tab-bar mode in certain circumstances
+- Fix potential crashes when using autocomplete on the Compose screen
+- Fix Iceshrimp instances not being detected
+
+## 2023.6
+This update fixes a number of bugs and improves stability throughout the app. See below for a list of fixes.
+
+Bugfixes:
+- Fix issues displaying main post in the Conversation screen
+- Fix crash when opening the Compose screen in certain locales
+- Fix issues when collapsing from sidebar to tab bar mode
+- Fix incorrect UI being displayed when accessing certain parts of the app immediately after launch
+- Fix link card images not being blurred on posts marked sensitive
+- Fix links appearing with incorrect accent color intermittently
+- Fix being unable to remove followed hashtags from the Explore screen
+- Akkoma: Fix not being able to follow hashtags
+- Pleroma: Fix refreshing Mentions failing
+- iPhone: Fix ducked Compose screen disappearing when rotating on large phones
+
+## 2023.5
+This update adds new several Compose-related features, including the ability to edit posts, a share sheet extension, and a post language picker. See below for the full list of improvements and bugfixes.
+
+Features/Improvements:
+- Edit posts
+- Indicate edited posts in timestamp
+- Show post edit history from Conversation screen
+- Add Share Sheet extension
+- Add expanded attachment view on Compose screen
+    - Add an attachment, select the description text field, then tap the expand button
+    - Expanded view allows you to see the attachment while writing the description
+    - Allows playing back videos while writing description
+    - iOS 16: Allows zooming in to the attachment
+- Add language picker to the Compose screen
+- Improve Compose screen ducking behavior
+- Show reblogger's avatar on reblogged posts
+- Use system photo picker instead of custom interface
+- Improve hashtag search UI in Customize Timelines
+- Improve status collapse/expand animation on Notifications screen
+- Apply filters to Notifications screen
+- Improve performance when scrolling through timeline
+- Improve error messages when editing filters
+- Change favorite/reblog button order to match Mastodon UI
+- Gracefully handle unknown attachment types
+- iPadOS: Persist sidebar visibility across
+
+Bugfixes:
+- Fix scroll-to-top not working in in-app Safari
+- Fix inaccruate titles in certain error popups
+- Fix error decoding post HTML
+- Fix replied-to account not being the first @-mention
+- Fix "No Content" message on profiles using wrong background color
+- Fix reblogged posts appearing in Bookmarks
+- Fix spurious errors when loading timeline
+- Fix crash when displaying certain profiles
+- Fix crash when the server returns invalid notifications
+- Fix link previews not appearing in Notifications
+- Fix Notifications screen taking a long time to load
+- Fix deleted posts not being removed from Notifications screen
+- Fix crashes when switching between sidebar/tab-bar modes
+- Fix instance features not being detected on IDNA domains
+- Fix list/hashtag timelines missing controls when opened in new window
+- Fix reblog button being enabled on the user's own direct posts
+- Fix main post in Conversation flickering
+- Fix link card images not loading on Mastodon
+- Fix crash when editing filter with the Hide action
+- Fix certain remote status links not being resolved
+- Fix Handoff to iPad/Mac presenting new screen modally
+- GoToSocial: Fix decoding certain posts
+- Calckey: Fix decoding certain posts
+- iPadOS: Fix Compose window lacking a title
+- iPadOS: Fix keyboard focus highlight not showing
+- macOS: Fix sidebar keyboard shortcuts not working
+
+## 2023.4
+Features/Improvements:
+- Add preference for non-pure-black dark mode
+- Add Jump to Present button to timelines on the home tab
+- Consolidate Trends into a single screen
+- Allow pinning instance public timelines to the Home tab
+- Add GIF/ALT badges to attachments (and preference to hide them)
+- Add action to show hide/show reblogs from specific accounts
+- Add preference to hide link preview cards
+- Hide placeholder image in link preview card for previews without images
+- Truncate links in posts
+- Move Drafts button in Compose screen to nav bar to reduce accidental presses
+- Load more posts/notifications on each page
+- Update Bookmarks screen when posts are bookmarked/unbookmarked
+- Add infinite scrolling to Bookmarks screen
+- Add Favorites screen to the Explore tab
+- Make attachment description text selectable in gallery
+- Add long press to copy username on profile screens
+- Optimize conversation loading
+- Apply server-configured poll limits in Compose screen
+- Add infinite scrolling to trending links/hashtags/posts
+- Add state restoration for more screens
+- Persist state when switching between accounts
+- Add Handoff support for various screens
+- Add preference to sync timeline position using Mastodon API, rather than iCloud
+- Show percentage of voters for multi-choice polls, rather than percentage of votes
+- Display message on remote profiles with no posts
+- Indicate moved profiles
+- Make Load More button on timelines more prominent
+- VoiceOver: Make fast account switcher accessible
+- VoiceOver: Improve labels for notifications
+- VoiceOver: Fix custom emoji picker not having labels
+
+Bugfixes:
+- Workaround for not being able to sign in to certain instances
+- Fix timeline position sync not working in certain circumstances
+- Fix local-only posts not being decodable when logged in to Akkoma instances
+- Fix Trends sometimes appearing in Explore/sidebar on non-Mastodon instances
+- Fix favoriters/rebloggers list not resizing on screen rotation
+- Fix crash when tapping My Profile tab immediately after app launch
+- Handle authentication required errors on instance public timelines
+- Fix follow request accept/reject buttons not matching accent color preference
+- Fix tapping reblog count in conversation main status showing favorites list
+- Fix crash when certain tags are present in post HTML
+- Fix crash when opening Report screen in certain circumstances
+- iPadOS: Fix crash when resizing window while on the Explore screen
+- iOS 15: Fix accent colors not being displayed in Preferences

CHANGELOG.md

@@ -1,5 +1,595 @@
 # Changelog
 
+## 2024.4 (136)
+Features/Improvements:
+- Import image description when adding attachments from Photos if possible
+- Reorganize toolbar buttons when adding saved hashtag
+- Show errors when loading video in attachment gallery fails
+
+Bugfixes:
+- Fix crash when viewing profiles in certain circumstances
+- Fix profile tab switching animation getting stuck
+- Fix video controls in attachment gallery not auto-hiding
+- Pleroma: Fix error when loading polls in some circumstances
+- iPadOS 18: Fix incorrect two-column layout when closing sidebar
+- macOS: Fix video controls overlay being positioned incorrectly when Reduce Motion is on
+- macOS: Fix reselecting current item not navigating back
+
+## 2024.4 (135)
+Features/Improvements:
+- iOS 18: New floating sidebar/tab bar
+
+Bugfixes:
+- Fix crash when hashtag search results include duplicates
+- Fix "no content" text not being removed from list timeline after refreshing
+
+## 2024.3 (133)
+- Add additional info to Tip Jar
+
+## 2024.3 (132)
+- Add ToS nag before signing in
+
+## 2024.3 (131)
+Bugfixes:
+- Fix Cmd+3 not correctly switching to Explore tab
+
+## 2024.3 (130)
+Bugfixes:
+- Fix reply author avatar on Compose screen not being pinned to top when scrolling while typing
+- Fix crash when dragging between buttons in reblog confirmation alert
+- Fix potential crash when displaying search results
+- Mac: Fix Post button not displaying on Compose screen
+
+## 2024.3 (129)
+Bugfixes:
+- Fix excessive network traffic on profile pages
+- Fix attachment gallery controls visibility not being synced between pages
+- Fix video attachments not restarting when play pressed while at ends
+- Fix profile field text being misaligned
+- Fix at sign in timeline statuses usernames sometimes clipping
+- Fix add hashtag/instance to Pinned Timelines sheets dismissing immediately when opened
+- Fix for display name being replaced with incorrect user in certain circumstances
+- Fix profile moved overlay view appearing behind avatar/header
+- Fix profile moved view accessibility with VoiceOver
+- Fix mention/status push notifications not showing content warning
+- Fix sensitive attachment thumbnails being shown in push notifications
+- Fix Dynamic Type not applying to status content
+- Fix expand all option in Conversation not transferring when opening ancestors
+- Fix not being able to resolve remote Mastodon status links in Conversation screen
+- Fix status indicator icons overlapping thread links when Dynamic Type is enabled
+
+## 2024.3 (128)
+Bugfixes:
+- Fix selecting poll option playing too much haptic feedback
+- Fix crash when displaying HTML in certain posts
+- Fix gifv playback pausing audio from other apps
+- Fix gifv playback not resuming after returning from background
+- Fix attachment badges not appearing on gifvs
+- iPadOS: Fix poll options not having pointer hover effects
+- iPadOS: Fix haptic feedback not working on new Magic Keyboard
+- iPadOS: Fix scrubbing video with pointer not letting you click to select position
+- iPadOS: Fix multi-column navigation not animating when replacing multiple columns
+
+## 2024.3 (127)
+Bugfixes:
+- Fix Remove Suggestion context menu action missing from Suggested Accounts screen
+- Fix profile header images being blurry
+- Fix dismissing gallery when presented from sheet
+- Fix potential crash in multi-column interface
+- Fix crash when opening push notification while sheet presented
+- Fix being able to block your own domain
+- Fix links in profile fields with other text not being interactable
+- Fix excessive CPU use immediately after app launch
+- Fix timeline failing to load when one status is malformed
+- iPadOS: Fix pointer interactions on conversation main status action buttons
+- iPadOS: Fix multiple close buttons being added in multi-column interface
+- iPadOS: Fix Cmd+1/etc. resetting navigation state when returning to previous column
+- iPadOS: Fix previous sidebar selection losing navigation state in some circumstances
+- iPadOS: Fix profile followers/following buttons not having pointer effect
+- iPadOS: Fix search token suggestions not having pointer effect
+- iPadOS: Fix conversation thread links appearing above avatar during pointer effect
+- iPadOS: Fix multi-column interface not animating scroll when replacing subsequent columns
+- iPadOS: Fix not being able to select text on conversation main status by double-clicking with cursor
+- iPadOS: Fix selecting search result always pushing new column rather than replacing
+- Pixelfed/Firefish: Fix error loading accounts in some circumstances
+- Pixelfed: Fix loading relationships and follow/block/etc. actions not working
+
+## 2024.3 (126)
+Bugfixes:
+- Fix an issue displaying post HTML in certain edge cases
+- Fix crash when video attachment playback ends
+- Fix excessive CPU usage when scrubbing video attachment
+- Fix video attachment thubmnails being flipped on Compose screen
+- Pleroma: Fix editing attachment descriptions not working
+
+## 2024.2 (124)
+Features/Improvements:
+- Add subscription option to Tip Jar
+
+Bugfixes:
+- Fix attachment captions not displaying while loading in gallery
+- Fix tapping follow request push notification not working
+- Pleroma: Handle posts with missing creation dates
+
+## 2024.2 (122)
+Features/Improvements:
+- Show instance announcements in Notifications
+- Pleroma/Akkoma: Display emoji reactions in Notifications
+- Pleroma/Akkoma: Add push notifications for emoji reactions
+
+Bugfixes:
+- Fix issue fetching server info on some instances
+- Fix Preferences background color not updating after changing Pure Black Dark Mode
+- Fix push subscription settings background using incorrect color with Pure Black Dark Mode off
+
+## 2024.2 (121)
+This build introduces a new multi-column navigation mode on iPad. You can revert to the old mode under Preferences -> Appearance.
+
+Features/Improvements:
+- iPadOS: Enable multi-column navigation
+- Add post preview to Appearance preferences
+- Consolidate Media preferences section with Appearance
+- Add icons to Preferences sections
+
+Bugfixes:
+- Fix push notifications not working on Pleroma/Akkoma and older Mastodon versions
+- Fix push notifications not working with certain accounts
+- Fix links on About screen not being aligned
+- macOS: Remove non-functional in-app Safari preferences
+
+## 2024.2 (120)
+This build adds push notifications, which can be enabled in Preferences -> Notifications.
+
+## 2024.1 (119)
+Features/Improvements:
+- Add Account Settings button to Preferences
+
+## 2024.1 (118)
+Bugfixes:
+- Fix music not pausing/resuming when video playback starts
+
+## 2024.1 (117)
+Features/Improvements:
+- Add See Results button to polls
+
+Bugfixes:
+- Fix race condition when presenting gallery for 4th of more than 4 attachments
+- Fix gallery interactive dismissal not working for 4th or later attachments on posts with more than 4 attachments
+- Pixelfed: Fix crash when there are multiple follow notifications from the same account
+- macOS: Fix gallery being positioned incorrectly when Reduce Motion is on
+
+## 2024.1 (116)
+Features/Improvements:
+- Display message on empty list timelines
+- Add preference to display badge for attachments that lack alt text
+- Mark notifications as read on the Mastodon web frontend once displayed
+- iPadOS: Support tapping the selected sidebar item to scroll to top
+
+Bugfixes:
+- Fix playing back GIFVs preventing the device sleeping
+- Fix incorrect cell separator insets followers/following lists
+- Fix memory leak in attachments gallery
+- Fix notifications tab not scrolling to top when tab bar item tapped
+- Fix Trending Hashtags screen not clearing selection
+- Fix fast account switcher overlapping sensor housing on landscape iPhones
+- Fix Edit List screen not updating when accounts are added/removed
+- Fix changing List reply policy not refreshing list timeline
+- macOS: Fix certain gallery attachments being incorrectly sized/positioned
+
+## 2024.1 (115)
+Features/Improvements:
+- Rewrite attachment gallery
+  - Fixes a number of long-standing issues
+  - Adds a custom video player that shows controls and caption
+  - Supports sharing/saving videos
+
+Bugfixes:
+- Fix hang when sharing video/gifv attachments
+- Fix stretched icon for Save to Photos action when sharing attachment
+- Fix crash when Compose screen is dismissed while adding attachments
+- Fix crash when sharing attachment from context menu on iPad
+
+## 2024.1 (113)
+Features/Improvements:
+- Add Share and Save to Photos context menu actions to attachments
+- Show verified link in account lists
+- Change cell separator appearance on posts
+
+Bugfixes:
+- Fix tapping Followers button on profiles opening Following screen
+- Fix crash when removing poll option on Compose screen
+- Fix leading indentation in post text being ignored
+- Fix crash when viewing posts containing HTML numeric character references
+- Fix paragraphs starting with links being combined with previous paragraph
+
+## 2024.1 (112)
+Bugfixes:
+- Fix profile field links not displaying
+- Fix various issues displaying rich text in posts
+- Fix issue changing scope after searching
+- Fix crash when searching for "from:me"
+
+## 2024.1 (111)
+This build contains a complete rewrite of the HTML parsing pipeline for displaying posts. If you notice any issues with how post text appears—especially when it differs from on the web—please report it!
+
+## 2023.8 (110)
+Bugfixes:
+- Fix potential crash after deleting List on Explore screen
+
+## 2023.8 (109)
+Features/Improvements:
+- Add Translate action to conversations (on supported Mastodon instances)
+- Improve share extension launch speed
+- Add preference for hiding attachments in timelines
+
+Bugfixes:
+- Fix crash during state restoration when reblogged statuses are present
+- Fix timeline state restoration using incorrect scroll position in certain circumstances
+- Fix status that is reblogged and contains a followed hashtag not showing reblogger label
+- macOS: Fix visibility/local-only buttons not appearing in Compose toolbar
+- macOS: Fix images copied from Safari not pasting on Compose screen
+
+## 2023.8 (107)
+Features/Improvements:
+- Style blockquotes in statuses
+- Use server language preference for search operator suggestions
+- Render IDN domains in the account switcher
+
+Bugfixes:
+- Fix crash when showing trending hashtags with improper history data
+- Fix crash when uploading attachment w/o file extension
+- Fix status deletions not being handled properly in logged out views
+- Fix status history entries not having VoiceOver descriptions
+- Fix avatars in follow request notifications not being rounded
+- Fix potential crash if the app is dismissed while fast account switcher is animating
+- Fix error decoding certain statuses on Pixelfed
+
+## 2023.8 (106)
+Bugfixes:
+- Fix being able to set post language to multiple/undefined
+- iPadOS: Fix language picker button not having a pointer effect
+- macOS: Fix Cmd+W sometimes closing the non-foreground window
+
+## 2023.8 (105)
+Features/Improvements:
+- Use server-set preference for default post visibility, language, and (on Hometown) local-only
+- Add preference to underline links
+- Allow changing list reply policy and exclusivity from menu on Edit List screen
+- Attribute network requests to user, rather than developer, when appropriate
+
+Bugfixes:
+- Fix older notifications not loading if all initially-loaded are grouped together
+- Fix list timelines failing to refresh if there were no statuses initially
+- Fix timeline jump button having a background when Button Shapes accessibility setting is on
+- Fix crash when relaunching app after not being launched in more than a week
+- Fix potential crash on instance selector screen
+- Fix crash when showing display names with custom emojis in certain places
+
+## 2023.8 (104)
+Features/Improvements:
+- Show search operators on Mastodon 4.2
+- Enable composing local-only posts on Akkoma
+- Update timestamps after refreshing notifications/timelines
+- Improve list appearance in rich text posts
+- Improve error message when uploading attachment to Pixelfed fails
+- Compress uploaded videos to fit within instance limits
+- iPad: Allow switching between split screen and full screen navigation
+
+Bugfixes:
+- Fix replies to posts with content warnings always showing confirmation dialog before closing
+- Fix Live Text control reappearing when swiping between attachment gallery pages
+- Fix avatars on certain notifications flickering when refreshing
+- iPad: Fix delay on app launch before "My Profile" sidebar item appears
+- macOS: Fix "New Post" window title appearing twice
+
+## 2023.7 (103)
+Features/Improvements:
+- Add support for iOS 17
+- Indicate that edit history may be incomplete for remote posts
+
+Bugfixes:
+- Fix crash when collapsing to tab-bar mode in certain circumstances
+- Fix potential crashes when using autocomplete on the Compose screen
+- Fix Iceshrimp instances not being detected
+
+## 2023.6 (100)
+Bugfixes:
+- Fix Conversation main post flashing incorrect background color when touched
+- Fix reblogs count button in Conversation main post not being left-aligned
+- Fix Conversation main post flickering when context loaded
+- Fix context menu not appearing when long pressing finished/voted poll
+- Fix Tip Jar button width changing while purchasing
+- Fix crash when opening Compose screen in certain locales
+- Fix potential issue with Recognize Text context menu action on attachments
+- Fix attachment deletion context menu action not working
+- Fix crash when collapsing from sidebar to tab bar mode
+- Fix crash when post deleted before Notifications screen is loaded
+- Fix race conditions when accessing certain parts of the app immediately upon launch
+- Fix crash when viewing invalid user post notifications
+- Fix non-square avatars not displaying correctly in various places
+- Fix incorrect context menu preview being shown on filtered posts
+- Fix link card images not being blurred on sensitive posts
+- Fix reblog confirmation alert showing incorrect visibilities for non-public posts
+- Fix Home/Notifications tab switchers being cut off with smaller than default Dynamic Type sizes
+- Fix posts using incorrect accent color for links in certain circumstances
+- Fix not being able to remove followed hashtags from Explore screen
+- Fix not being able to attach images from Markup share sheet or Shortcuts share action
+- Fix very wide attachments being untappably short
+- Fix double posting in poor network conditions
+- Fix crash when autocompleting emoji on instances with a large number of custom emoji
+- Akkoma: Fix not being able to follow hashtags
+- Pleroma: Fix refreshing Mentions failing
+- iPhone: Fix ducked Compose screen breaking when rotating on Plus/Max iPhone models
+- iPhone: Fix Compose toolbar not extending to the full width of the screen in landscape on iPhone
+- iPadOS: Fix closing app dismissing in-app Safari
+- iPadOS: Fix reblog confirmation alert not being centered in split view
+
+## 2023.5 (98)
+Bugfixes:
+- Fix broken animation when opening/closing expanded attachment view on Compose screen
+
+## 2023.5 (97)
+Features/Improvements:
+- Change favorite/reblog button order to match Mastodon
+- Use QuickLook as a fallback for uknown attachment types
+
+Bugfixes:
+- Fix crash when adding drawing attachment
+
+## 2023.5 (96)
+Features/Improvements:
+- Resolve Mastodon's remote status links
+
+Bugfixes:
+- Fix handoff to iPad/Mac presenting new screen modally rather than navigating
+- Fix crash if timeline gap cell is accessibility-activated after leaking
+- Fix various crashes when multiple Compose/Drafts screens are opened
+- Delete orphaned draft attachments
+- Fix deleted posts not getting removed from Notifications screen
+- Fix replied-to status not changing when selecting draft
+
+## 2023.5 (94)
+Features/Improvements:
+- Apply filters to Notifications screen
+
+Bugfixes:
+- Fix editing posts not working on Akkoma
+- Fix editing Markdown/HTML posts
+- Fix crash when editing filter with Hide action
+
+## 2023.5 (91)
+Features/Improvements:
+- Improve performance when scrolling through timeline
+- Improve error messages when editing filters
+- Enable editing posts on Pleroma 2.5+
+
+Bugfixes:
+- Fix share sheet extension not working with Apple News
+- Fix crash when sharing certain photos with share extension
+- Fix reblog button being enabled on Direct posts
+- Fix expanded statuses collapsing when opening Conversation
+- Fix main post in Conversation flickering when context loaded
+- Fix link card images not loading on Mastodon
+
+## 2023.5 (89)
+This build is a hotfix for an issue loading notifications in certain circumstances. The changelong for the previous build (adding post editing) is included below.
+
+## 2023.5 (85)
+This build adds support for editing posts and showing edit timestamps and history.
+
+Features/Improvements:
+- Post editing
+- Show post edit history
+- Improve rate limit exceeded error message
+- Shorten hashtag save/follow action subtitles so they fit in the context menu
+- Remove Hide/Show Reblogs action for accounts the user isn't following
+
+Bugfixes:
+- Fix nodeinfo not being fetched on instances with punycode domains
+- Fix potential crash with interactive push gesture
+- Fix list timelines opened in new window lacking Edit button
+- Fix hashtag timelines opened in new window lacking save/follow actions
+- Fix being able to scroll to top while fast account switcher is active
+- Fix decoding statuses lacking emojis on Calckey
+- Fix decoding polls on Calckey
+
+## 2023.5 (84)
+Bugfixes:
+- Fix notifications scrolling to top when refreshing
+- Fix decoding statuses failing on GoToSocial
+- Fix assorted issues when collapsing/expanding between sidebar and tab bar modes
+
+## 2023.5 (83)
+This build contains significant refactors to the notifications screen, please report any issues you encounter.
+
+Features/Improvements:
+- Tweak appearance of profile fields
+- Make language picker sheet half-height
+
+Bugfixes:
+- Fix crash when laying out profile fields on certain accounts
+- Fix other presented screens getting dismissed when opened after closing expanded attachment view
+- Fix janky status collapse/expand animation on notifications screen
+- Fix link previews not appearing in notifications
+
+## 2023.5 (81)
+Further improvements and fixes to the Compose screen, see below. Features are frozen for the upcoming release, please report any bugs you encounter!
+
+Features/Improvements:
+- Add expanded attachment view on Compose screen
+    - Add an attachment, select the description text field, and tap on the expand button on the attachment thumbnail
+    - Expanded attachment view allows you to view the attachment larger while writing the description
+    - Plays back videos while writing the description
+    - iOS 16: Allow zooming in to expanded attachment view
+- Add language picker to Compose screen
+- Persist sidebar visibility across app launches
+- Align link verification checkmarks to link rather than creen edge
+- Fully dismiss, rather than ducking, the Compose screen when swiped down with no content
+- Remove Automatically Save Drafts preference
+    - Drafts are always saved automatically, and the save/delete sheet is now always shown on dismiss
+
+Bugfixes:
+- Fix share sheet extension being unavailable on iOS 15
+- Fix crash when loading draft with poll from share sheet extension
+- Fix active draft being deleted when Compose screen ducked
+- Fix restored, ducked Compose screen lacking title
+- Fix error when reloading empty profile
+- Fix local attachments not being deleted upon draft deletion
+- Fix GIFs being converted to still images on upload
+- Fix crash on deleting draft with attachments in share extension
+- Fix deleted attachments in Compose screen reappearing
+- Fix spinner on Send Report button being misplaced
+- Fix crash on launch loop when migrating from previous version in certain circumstances
+
+## 2023.5 (80)
+This build adds a Share Sheet extension and introduces further Compose screen refactors.
+
+Features/Improvements:
+- Add Share Sheet extension
+- Show reblogger's avatar on reblogged posts
+
+Bugfixes:
+- Fix not being able to close Compose screen when Automatically Save Drafts preference is off
+- Fix Post button always being disabled when Require Attachment Descriptions preference is on
+- Fix crash when pasting screenshots
+- Fix not being able to paste gifs
+- Don't consider HTTP 206 responses to timeline requests to be errors
+- Fix crash when displaying menu for statuses missing URLs
+- Fix errors while posting not displaying useful error messages
+
+## 2023.5 (77)
+The Compose screen has been substantially refactored in this build, in preparation for upcoming features, so please report any issues you encounter!
+
+Features/Improvements:
+- Use system photo picker instead of custom interface
+- Improve Customize Timelines hashtag search UI
+
+Bugfixes:
+- Fix scroll-to-top not working in in-app Safari
+- Fix crash when decoding pinned timelines fails
+- Fix inaccurate titles in certain error popups
+- Fix crash when comments present in status HTML
+- Fix replied-to account not being the first mention
+- Fix Compose window not having title set initially
+- Fix crash when the API returns notifications that are missing statuses
+- Fix "No Content" cell on profiles not using non-pure-black background
+- Fix reblogged statuses appearing in the Bookmarks list
+- Fix keyboard focus highlight not showing
+- macOS: Fix sidebar item keyboard shortcuts not working
+
+## 2023.4 (76)
+App Store release
+
+## 2023.4 (75)
+This build contains tweaks to automatic error reporting for the timeline marker API. The previous build's changelog is included below.
+
+## 2023.4 (74)
+Features/Improvements:
+- Add state restoration for more screens
+- Persist state when switching between accounts
+- Add handoff for various screens
+- Add preference to hide GIF/ALT badges on attachments
+- Add preference to use Mastodon timeline marker API for syncing Home timeline position
+- Show percentage of voters for multi-choice poll results, rather than percentage of votes
+- Change search results view controller to dismiss keyboard on scroll
+- Only show inaccurate favorite/reblog count warning for posts from remote instances
+- Show message on remote profiles with no statuses
+- Add banner to profiles that have moved
+- Hide placeholder image for link cards without images
+- Don't check for present statuses when refreshing timeline
+- Make timeline Load More button more prominent
+- iOS 16.4: Use iOS-provided link previews in Share Sheet
+
+Bugfixes:
+- Fix tapping reblog count in conversation main status showing favorites list
+- Fix status favorite/reblog list not adjusting to non-pure-black dark mode
+- Fix non-pure-black dark mode not applying to auxiliary windows
+- Fix poll option tracking gesture unselecting options when touch location moves between options
+- Fix crash when tapping conversation "More Replies" cell
+- Fix crash when script/style tags are present in post HTML
+- Fix crash when opening Report screen in certain circumstances
+
+## 2023.4 (73)
+Features/Improvements:
+- Add preference for non-pure-black dark mode
+- Add Jump to Present button to timelines
+- Improve status collapse animation in search results screen
+- Add more trending links/hashtags/profiles buttons to Trends screen
+- Add infinite scrolling to trending links/hashtags screens
+- Add Share action to trending link context menu
+
+Bugfixes:
+- Fix icon in suggested profile popover not adjusting to dark mode
+
+## 2023.4 (72)
+Features/Improvements:
+- Consolidate Trends into a single screen
+- Make attachment description text selectable in gallery
+- Add long press to copy usernames on profile screen
+- Add Favorites screen to Explore tab
+- Optimize conversation loading when opening a conversation that is already fully-loaded
+- Apply Mastodon poll limits in Compose screen
+- VoiceOver: Fast account switcher improvements (make the screen modal, select the first account upon opening the switcher, make each account a single item)
+- VoiceOver: Improve labels for notifications
+- VoiceOver: Fix custom emoji picker buttons not having labels
+
+Bugfixes:
+- Fix trends sometimes appearing in Explore/sidebar on non-Mastodon instances
+- Fix status favorite/reblog accounts list not resizing on device rotation
+- Fix bookmarks screen sometimes going haywire
+- Fix trending statuses not being deselected upon navigating back
+- Fix crash when tapping My Profile tab too early in app lifecycle
+- Handle 401 errors on instance timelines properly
+- Fix potential crash when showing context menu previews for status
+- Fix follow request accept/reject buttons not matching accent color preference
+- iPadOS: Fix crash when switching between sidebar and tab bar while on the Explore screen
+- iOS 15: Fix accent colors not being disaplyed in Preferences
+
+## 2023.4 (71)
+Features/Improvements:
+- Allow pinning instance public timelines to the Home tab
+- Improve UI and retry mechanism when adding account
+- Increase page size to 40 on a bunch of screens
+- Update bookmarks screen when posts are bookmarked/unbookmarked
+- Allow loading older and refreshing bookmarks screen
+- Tweak follow count button color
+
+Bugfixes:
+- Fix timeline position sync not working in certain circumstances
+- iPadOS: Fix flicker when opening favorite/reblog list in notificationss
+
+## 2023.4 (70)
+Features/Improvements:
+- Add GIF/ALT badges to attachments
+- Add menu action to hide/show reblogs from specific accounts
+- Apply Mastodon's link truncation
+- Add preference to hide link preview cards
+- Tweak link preview card border color in dark mode
+- Unify haptic feedback across the app
+- Move Drafts button to the nav bar when the post doesn't have any content, to reduce accidental presses
+
+Bugfixes:
+- Fix status URLs with fragments not being resolved
+- Workaround for local-only posts not being decodable when logged in to Akkoma instances
+
+## 2023.3 (69)
+Features/Improvements:
+- Add Tip Jar under Preferences
+- Add scopes to search screen
+- Workarounds for logging in to mastodon.social being unreliable
+- Handle instance timeline authentication errors more gracefully
+- iPadOS: Add Trending Posts and Profile Suggestions to Explore screen
+
+Bugfixes:
+- Fix Open in Safari action not working
+- Fix notifications for posts from subscribed accounts not being shown
+- Detect Misskey status links
+- Fix trending hashtag cells not adjusting to Dynamic Type
+- Fix raw HTML being shown in link preview cards
+- iPadOS: Fix crash when expanding window size while showing trending statuses/hashtags/links screen
+- iPadOS: Fix preview actions not working on Explore screen
+- macOS: Fix not being able to right-click to remove pinned timelines
+
 ## 2023.2 (68)
 Bugfixes:
 - Fix crash when inserting present items in empty timeline

Documentation/Haptic Feedback.md

@@ -0,0 +1,7 @@
+# Haptic Feedback
+
+## Selection changed
+`UISelectionFeedbackGenerator`
+
+## Actions
+On success, `UIImpactFeedbackGenerator` with the `.light` style. On error, `UINotificationFeedbackGenerator` with the `.error` type.

NotificationExtension/Info.plist

@@ -0,0 +1,22 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>TuskerInfo</key>
+	<dict>
+		<key>PushProxyHost</key>
+		<string>$(TUSKER_PUSH_PROXY_HOST)</string>
+		<key>PushProxyScheme</key>
+		<string>$(TUSKER_PUSH_PROXY_SCHEME)</string>
+		<key>SentryDSN</key>
+		<string>$(SENTRY_DSN)</string>
+	</dict>
+	<key>NSExtension</key>
+	<dict>
+		<key>NSExtensionPointIdentifier</key>
+		<string>com.apple.usernotifications.service</string>
+		<key>NSExtensionPrincipalClass</key>
+		<string>$(PRODUCT_MODULE_NAME).NotificationService</string>
+	</dict>
+</dict>
+</plist>

NotificationExtension/NotificationExtension.entitlements

@@ -0,0 +1,14 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>com.apple.security.app-sandbox</key>
+	<true/>
+	<key>com.apple.security.application-groups</key>
+	<array>
+		<string>group.$(BUNDLE_ID_PREFIX).Tusker</string>
+	</array>
+	<key>com.apple.security.network.client</key>
+	<true/>
+</dict>
+</plist>

NotificationExtension/NotificationService.swift

@@ -0,0 +1,397 @@
+//
+//  NotificationService.swift
+//  NotificationExtension
+//
+//  Created by Shadowfacts on 4/9/24.
+//  Copyright © 2024 Shadowfacts. All rights reserved.
+//
+
+import UserNotifications
+import UserAccounts
+import PushNotifications
+import CryptoKit
+import OSLog
+import Pachyderm
+import Intents
+import HTMLStreamer
+import WebURL
+import UIKit
+import TuskerPreferences
+
+private let logger = Logger(subsystem: Bundle.main.bundleIdentifier!, category: "NotificationService")
+
+private let emojiRegex = try! NSRegularExpression(pattern: ":(\\w+):", options: [])
+
+class NotificationService: UNNotificationServiceExtension {
+    
+    private static let textConverter = TextConverter(configuration: .init(insertNewlines: false), callbacks: HTMLCallbacks.self)
+    
+    private var pendingRequest: (UNMutableNotificationContent, (UNNotificationContent) -> Void, Task<Void, Never>)?
+
+    override func didReceive(_ request: UNNotificationRequest, withContentHandler contentHandler: @escaping (UNNotificationContent) -> Void) {
+        guard let mutableContent = request.content.mutableCopy() as? UNMutableNotificationContent else {
+            logger.error("Couldn't get mutable content")
+            contentHandler(request.content)
+            return
+        }
+        
+        guard request.content.userInfo["v"] as? Int == 1,
+              let accountID = (request.content.userInfo["ctx"] as? String).flatMap(\.removingPercentEncoding),
+              let account = UserAccountsManager.shared.getAccount(id: accountID),
+              let subscription = getSubscription(account: account),
+              let encryptedBody = (request.content.userInfo["data"] as? String).flatMap({ Data(base64Encoded: $0) }),
+              let salt = (request.content.userInfo["salt"] as? String).flatMap(decodeBase64URL(_:)),
+              let serverPublicKeyData = (request.content.userInfo["pk"] as? String).flatMap(decodeBase64URL(_:)) else {
+            logger.error("Missing info from push notification")
+            contentHandler(request.content)
+            return
+        }
+        
+        guard let body = decryptNotification(subscription: subscription, serverPublicKeyData: serverPublicKeyData, salt: salt, encryptedBody: encryptedBody) else {
+            contentHandler(request.content)
+            return
+        }
+
+        let withoutPadding = body.dropFirst(2)
+        
+        let notification: PushNotification
+        do {
+            notification = try JSONDecoder().decode(PushNotification.self, from: withoutPadding)
+        } catch {
+            logger.error("Unable to decode push payload: \(String(describing: error))")
+            contentHandler(request.content)
+            return
+        }
+        
+        mutableContent.title = notification.title
+        mutableContent.body = notification.body
+        mutableContent.userInfo["notificationID"] = notification.notificationID
+        mutableContent.userInfo["accountID"] = accountID
+        mutableContent.targetContentIdentifier = accountID
+
+        let task = Task {
+            await updateNotificationContent(mutableContent, account: account, push: notification)
+            if !Task.isCancelled {
+                contentHandler(pendingRequest?.0 ?? mutableContent)
+                pendingRequest = nil
+            }
+        }
+        pendingRequest = (mutableContent, contentHandler, task)
+    }
+    
+    override func serviceExtensionTimeWillExpire() {
+        if let pendingRequest {
+            logger.debug("Expiring with pending request")
+            pendingRequest.2.cancel()
+            pendingRequest.1(pendingRequest.0)
+            self.pendingRequest = nil
+        } else {
+            logger.debug("Expiring without pending request")
+        }
+    }
+    
+    private func updateNotificationContent(_ content: UNMutableNotificationContent, account: UserAccountInfo, push: PushNotification) async {
+        let client = Client(baseURL: account.instanceURL, accessToken: account.accessToken)
+        let notification: Pachyderm.Notification
+        do {
+            notification = try await client.run(Client.getNotification(id: push.notificationID)).0
+        } catch {
+            logger.error("Error fetching notification: \(String(describing: error))")
+            return
+        }
+        
+        let kindStr: String?
+        switch notification.kind {
+        case .reblog:
+            kindStr = "🔁 Reblogged"
+        case .favourite:
+            kindStr = "⭐️ Favorited"
+        case .follow:
+            kindStr = "👤 Followed by @\(notification.account.acct)"
+        case .followRequest:
+            kindStr = "👤 Asked to follow by @\(notification.account.acct)"
+        case .poll:
+            kindStr = "📊 Poll finished"
+        case .update:
+            kindStr = "✏️ Edited"
+        case .emojiReaction:
+            if let emoji = notification.emoji {
+                kindStr = "\(emoji) Reacted"
+            } else {
+                kindStr = nil
+            }
+        default:
+            kindStr = nil
+        }
+        
+        let notificationContent: String?
+        if let status = notification.status {
+            if notification.kind == .mention || notification.kind == .status,
+               !status.spoilerText.isEmpty {
+                notificationContent = "⚠️ \(status.spoilerText)"
+            } else {
+                notificationContent = NotificationService.textConverter.convert(html: status.content)
+            }
+        } else if notification.kind == .follow || notification.kind == .followRequest {
+            notificationContent = nil
+        } else {
+            notificationContent = push.body
+        }
+        
+        content.body = [kindStr, notificationContent].compactMap { $0 }.joined(separator: "\n")
+        
+        let attachmentDataTask: Task<URL?, Never>?
+        // We deliberately don't include attachments for other types of notifications that have statuses (favs, etc.)
+        // because we risk just fetching the same thing a bunch of times for many senders.
+        if notification.kind == .mention || notification.kind == .status || notification.kind == .update,
+           let status = notification.status,
+           !status.sensitive,
+           let attachment = status.attachments.first {
+            let url = attachment.previewURL ?? attachment.url
+            attachmentDataTask = Task {
+                do {
+                    let data = try await URLSession.shared.data(from: url).0
+                    let localAttachmentURL = FileManager.default.temporaryDirectory.appendingPathComponent("attachment_\(attachment.id)").appendingPathExtension(url.pathExtension)
+                    try data.write(to: localAttachmentURL)
+                    return localAttachmentURL
+                } catch {
+                    logger.error("Error setting notification attachments: \(String(describing: error))")
+                    return nil
+                }
+            }
+        } else {
+            attachmentDataTask = nil
+        }
+        
+        let conversationIdentifier: String?
+        if let status = notification.status {
+            if let context = status.pleromaExtras?.context {
+                conversationIdentifier = "context:\(context)"
+            } else if [Notification.Kind.reblog, .favourite, .poll, .update].contains(notification.kind) {
+                conversationIdentifier = "status:\(status.id)"
+            } else {
+                conversationIdentifier = nil
+            }
+        } else {
+            conversationIdentifier = nil
+        }
+        
+        let account: Account?
+        switch notification.kind {
+        case .mention, .status:
+            account = notification.status?.account
+        default:
+            account = notification.account
+        }
+        let sender: INPerson?
+        if let account {
+            let handle = INPersonHandle(value: "@\(account.acct)", type: .unknown)
+            let image: INImage?
+            if let avatar = account.avatar,
+               let (data, resp) = try? await URLSession.shared.data(from: avatar),
+               let code = (resp as? HTTPURLResponse)?.statusCode,
+               (200...299).contains(code) {
+                image = INImage(imageData: data)
+            } else {
+                image = nil
+            }
+            sender = INPerson(
+                personHandle: handle,
+                nameComponents: nil,
+                displayName: account.displayName,
+                image: image,
+                contactIdentifier: nil,
+                customIdentifier: account.id
+            )
+        } else {
+            sender = nil
+        }
+
+        let intent = INSendMessageIntent(
+            recipients: nil,
+            outgoingMessageType: .outgoingMessageText,
+            content: notificationContent,
+            speakableGroupName: nil,
+            conversationIdentifier: conversationIdentifier,
+            serviceName: nil,
+            sender: sender,
+            attachments: nil
+        )
+        
+        let interaction = INInteraction(intent: intent, response: nil)
+        interaction.direction = .incoming
+        
+        do {
+            try await interaction.donate()
+        } catch {
+            logger.error("Error donating interaction: \(String(describing: error))")
+            return
+        }
+        
+        let updatedContent: UNMutableNotificationContent
+       
+        let contentProviding: any UNNotificationContentProviding
+        if #available(iOS 18.0, visionOS 2.0, *),
+           await Preferences.shared.hasFeatureFlag(.pushNotifCustomEmoji) {
+            let attributedString = NSMutableAttributedString(string: content.body)
+            
+            for match in emojiRegex.matches(in: content.body, range: NSRange(location: 0, length: content.body.utf16.count)).reversed() {
+                let emojiName = (content.body as NSString).substring(with: match.range(at: 1))
+                guard let emoji = notification.status?.emojis.first(where: { $0.shortcode == emojiName }),
+                      let url = URL(emoji.url),
+                      let (data, _) = try? await URLSession.shared.data(from: url),
+                      let image = UIImage(data: data) else {
+                    continue
+                }
+                let attachment = NSTextAttachment(image: image)
+                let attachmentStr = NSAttributedString(attachment: attachment)
+                attributedString.replaceCharacters(in: match.range, with: attachmentStr)
+            }
+            
+            let attributedCtx = UNNotificationAttributedMessageContext(sendMessageIntent: intent, attributedContent: attributedString)
+            contentProviding = attributedCtx
+        } else {
+            contentProviding = intent
+        }
+        
+        do {
+            let newContent = try content.updating(from: contentProviding)
+            if let newMutableContent = newContent.mutableCopy() as? UNMutableNotificationContent {
+                pendingRequest?.0 = newMutableContent
+                updatedContent = newMutableContent
+            } else {
+                updatedContent = content
+            }
+        } catch {
+            logger.error("Error updating notification from intent: \(String(describing: error))")
+            updatedContent = content
+        }
+        
+        if let localAttachmentURL = await attachmentDataTask?.value,
+           let attachment = try? UNNotificationAttachment(identifier: localAttachmentURL.lastPathComponent, url: localAttachmentURL) {
+            updatedContent.attachments = [
+                attachment
+            ]
+        }
+    }
+    
+    private func getSubscription(account: UserAccountInfo) -> PushNotifications.PushSubscription? {
+        DispatchQueue.main.sync {
+            // this is necessary because of a swift bug: https://github.com/apple/swift/pull/72507
+            MainActor.runUnsafely {
+                PushManager.shared.pushSubscription(account: account)
+            }
+        }
+    }
+    
+    private func decryptNotification(subscription: PushNotifications.PushSubscription, serverPublicKeyData: Data, salt: Data, encryptedBody: Data) -> Data? {
+        // See https://github.com/ClearlyClaire/webpush/blob/f14a4d52e201128b1b00245d11b6de80d6cfdcd9/lib/webpush/encryption.rb
+        
+        var context = Data()
+        context.append(0)
+        let clientPublicKey = subscription.secretKey.publicKey.x963Representation
+        let clientPublicKeyLength = UInt16(clientPublicKey.count)
+        context.append(UInt8((clientPublicKeyLength >> 8) & 0xFF))
+        context.append(UInt8(clientPublicKeyLength & 0xFF))
+        context.append(clientPublicKey)
+        let serverPublicKeyLength = UInt16(serverPublicKeyData.count)
+        context.append(UInt8((serverPublicKeyLength >> 8) & 0xFF))
+        context.append(UInt8(serverPublicKeyLength & 0xFF))
+        context.append(serverPublicKeyData)
+        
+        func info(encoding: String) -> Data {
+            var info = Data("Content-Encoding: \(encoding)\0P-256".utf8)
+            info.append(context)
+            return info
+        }
+
+        let sharedSecret: SharedSecret
+        do {
+            let serverPublicKey = try P256.KeyAgreement.PublicKey(x963Representation: serverPublicKeyData)
+            sharedSecret = try subscription.secretKey.sharedSecretFromKeyAgreement(with: serverPublicKey)
+        } catch {
+            logger.error("Error getting shared secret: \(String(describing: error))")
+            return nil
+        }
+        
+        let sharedInfo = Data("Content-Encoding: auth\0".utf8)
+        let pseudoRandomKey = sharedSecret.hkdfDerivedSymmetricKey(using: SHA256.self, salt: subscription.authSecret, sharedInfo: sharedInfo, outputByteCount: 32)
+        let contentEncryptionKeyInfo = info(encoding: "aesgcm")
+        let contentEncryptionKey = HKDF<SHA256>.deriveKey(inputKeyMaterial: pseudoRandomKey, salt: salt, info: contentEncryptionKeyInfo, outputByteCount: 16)
+        let nonceInfo = info(encoding: "nonce")
+        let nonce = HKDF<SHA256>.deriveKey(inputKeyMaterial: pseudoRandomKey, salt: salt, info: nonceInfo, outputByteCount: 12)
+        
+        let nonceAndEncryptedBody = nonce.withUnsafeBytes { noncePtr in
+            var data = Data(buffer: noncePtr.bindMemory(to: UInt8.self))
+            data.append(encryptedBody)
+            return data
+        }
+        do {
+            let sealedBox = try AES.GCM.SealedBox(combined: nonceAndEncryptedBody)
+            let decrypted = try AES.GCM.open(sealedBox, using: contentEncryptionKey)
+            return decrypted
+        } catch {
+            logger.error("Error decrypting push: \(String(describing: error))")
+            return nil
+        }
+    }
+
+}
+
+extension MainActor {
+    @_unavailableFromAsync
+    @available(macOS, obsoleted: 14.0)
+    @available(iOS, obsoleted: 17.0)
+    @available(watchOS, obsoleted: 10.0)
+    @available(tvOS, obsoleted: 17.0)
+    @available(visionOS 1.0, *)
+    static func runUnsafely<T>(_ body: @MainActor () throws -> T) rethrows -> T {
+        if #available(macOS 14.0, iOS 17.0, watchOS 10.0, tvOS 17.0, *) {
+            return try MainActor.assumeIsolated(body)
+        }
+        
+        dispatchPrecondition(condition: .onQueue(.main))
+        return try withoutActuallyEscaping(body) { fn in
+            try unsafeBitCast(fn, to: (() throws -> T).self)()
+        }
+    }
+}
+
+private func decodeBase64URL(_ s: String) -> Data? {
+    var str = s.replacingOccurrences(of: "-", with: "+").replacingOccurrences(of: "_", with: "/")
+    if str.count % 4 != 0 {
+        str.append(String(repeating: "=", count: 4 - str.count % 4))
+    }
+    return Data(base64Encoded: str)
+}
+
+// copied from HTMLConverter.Callbacks, blergh
+private struct HTMLCallbacks: HTMLConversionCallbacks {
+    static func makeURL(string: String) -> URL? {
+        // Converting WebURL to URL is a small but non-trivial expense (since it works by
+        // serializing the WebURL as a string and then having Foundation parse it again),
+        // so, if available, use the system parser which doesn't require another round trip.
+        if let url = try? URL.ParseStrategy().parse(string) {
+            url
+        } else if let web = WebURL(string),
+                  let url = URL(web) {
+            url
+        } else {
+            nil
+        }
+    }
+    
+    static func elementAction(name: String, attributes: [Attribute]) -> ElementAction {
+        guard name == "span" else {
+            return .default
+        }
+        let clazz = attributes.attributeValue(for: "class")
+        if clazz == "invisible" {
+            return .skip
+        } else if clazz == "ellipsis" {
+            return .append("…")
+        } else {
+            return .default
+        }
+    }
+}

NotificationExtension/PrivacyInfo.xcprivacy

@@ -0,0 +1,17 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>NSPrivacyAccessedAPITypes</key>
+	<array>
+		<dict>
+			<key>NSPrivacyAccessedAPITypeReasons</key>
+			<array>
+				<string>1C8F.1</string>
+			</array>
+			<key>NSPrivacyAccessedAPIType</key>
+			<string>NSPrivacyAccessedAPICategoryUserDefaults</string>
+		</dict>
+	</array>
+</dict>
+</plist>

OpenInTusker/ActionViewController.swift

@@ -8,6 +8,7 @@
 
 import UIKit
 import MobileCoreServices
+import UniformTypeIdentifiers
 
 class ActionViewController: UIViewController {
 
@@ -17,25 +18,29 @@ class ActionViewController: UIViewController {
         super.viewDidLoad()
         
         findURLFromWebPage { (components) in
-            if let components = components {
-                self.searchForURLInApp(components)
-            } else {
-                self.findURLItem { (components) in
-                    if let components = components {
-                        self.searchForURLInApp(components)
+            DispatchQueue.main.async {
+                if let components {
+                    self.searchForURLInApp(components)
+                } else {
+                    self.findURLItem { (components) in
+                        if let components {
+                            DispatchQueue.main.async {
+                                self.searchForURLInApp(components)
+                            }
+                        }
                     }
                 }
             }
         }
     }
     
-    private func findURLFromWebPage(completion: @escaping (URLComponents?) -> Void) {
+    private func findURLFromWebPage(completion: @escaping @Sendable (URLComponents?) -> Void) {
         for item in extensionContext!.inputItems as! [NSExtensionItem] {
             for provider in item.attachments! {
-                guard provider.hasItemConformingToTypeIdentifier(kUTTypePropertyList as String) else {
+                guard provider.hasItemConformingToTypeIdentifier(UTType.propertyList.identifier) else {
                     continue
                 }
-                provider.loadItem(forTypeIdentifier: kUTTypePropertyList as String, options: nil) { (result, error) in
+                provider.loadItem(forTypeIdentifier: UTType.propertyList.identifier, options: nil) { (result, error) in
                     guard let result = result as? [String: Any],
                           let jsResult = result[NSExtensionJavaScriptPreprocessingResultsKey] as? [String: Any],
                           let urlString = jsResult["activityPubURL"] as? String ?? jsResult["url"] as? String,
@@ -53,13 +58,13 @@ class ActionViewController: UIViewController {
         completion(nil)
     }
     
-    private func findURLItem(completion: @escaping (URLComponents?) -> Void) {
+    private func findURLItem(completion: @escaping @Sendable (URLComponents?) -> Void) {
         for item in extensionContext!.inputItems as! [NSExtensionItem] {
             for provider in item.attachments! {
-                guard provider.hasItemConformingToTypeIdentifier(kUTTypeURL as String) else {
+                guard provider.hasItemConformingToTypeIdentifier(UTType.url.identifier) else {
                     continue
                 }
-                provider.loadItem(forTypeIdentifier: kUTTypeURL as String, options: nil) { (result, error) in
+                provider.loadItem(forTypeIdentifier: UTType.url.identifier, options: nil) { (result, error) in
                     guard let result = result as? URL,
                           let components = URLComponents(url: result, resolvingAgainstBaseURL: false) else {
                         completion(nil)

OpenInTusker/Info.plist

@@ -24,6 +24,8 @@
 	<dict>
 		<key>NSExtensionAttributes</key>
 		<dict>
+			<key>NSExtensionServiceRoleType</key>
+			<string>NSExtensionServiceRoleTypeViewer</string>
 			<key>NSExtensionActivationRule</key>
 			<dict>
 				<key>NSExtensionActivationSupportsAttachmentsWithMinCount</key>

Packages/ComposeUI/.gitignore

@@ -0,0 +1,9 @@
+.DS_Store
+/.build
+/Packages
+/*.xcodeproj
+xcuserdata/
+DerivedData/
+.swiftpm/config/registries.json
+.swiftpm/xcode/package.xcworkspace/contents.xcworkspacedata
+.netrc

Packages/ComposeUI/Package.resolved

@@ -0,0 +1,23 @@
+{
+  "pins" : [
+    {
+      "identity" : "swift-system",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/apple/swift-system.git",
+      "state" : {
+        "revision" : "025bcb1165deab2e20d4eaba79967ce73013f496",
+        "version" : "1.2.1"
+      }
+    },
+    {
+      "identity" : "swift-url",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/karwa/swift-url.git",
+      "state" : {
+        "branch" : "main",
+        "revision" : "6f45f3cd6606f39c3753b302fe30aea980067b30"
+      }
+    }
+  ],
+  "version" : 2
+}

Packages/ComposeUI/Package.swift

@@ -0,0 +1,40 @@
+// swift-tools-version: 6.0
+// The swift-tools-version declares the minimum version of Swift required to build this package.
+
+import PackageDescription
+
+let package = Package(
+    name: "ComposeUI",
+    platforms: [
+        .iOS(.v16),
+    ],
+    products: [
+        // Products define the executables and libraries a package produces, and make them visible to other packages.
+        .library(
+            name: "ComposeUI",
+            targets: ["ComposeUI"]),
+    ],
+    dependencies: [
+        // Dependencies declare other packages that this package depends on.
+        .package(path: "../Pachyderm"),
+        .package(path: "../InstanceFeatures"),
+        .package(path: "../TuskerComponents"),
+        .package(path: "../MatchedGeometryPresentation"),
+    ],
+    targets: [
+        // Targets are the basic building blocks of a package. A target can define a module or a test suite.
+        // Targets can depend on other targets in this package, and on products in packages this package depends on.
+        .target(
+            name: "ComposeUI",
+            dependencies: ["Pachyderm", "InstanceFeatures", "TuskerComponents", "MatchedGeometryPresentation"],
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
+            ]),
+        .testTarget(
+            name: "ComposeUITests",
+            dependencies: ["ComposeUI"],
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
+            ]),
+    ]
+)

Packages/ComposeUI/README.md

@@ -0,0 +1,3 @@
+# ComposeUI
+
+A description of this package.

Packages/ComposeUI/Sources/ComposeUI/API/PostService.swift

@@ -0,0 +1,197 @@
+//
+//  PostService.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/27/22.
+//  Copyright © 2022 Shadowfacts. All rights reserved.
+//
+
+import Foundation
+import Pachyderm
+import UniformTypeIdentifiers
+
+@MainActor
+class PostService: ObservableObject {
+    private let mastodonController: ComposeMastodonContext
+    private let config: ComposeUIConfig
+    private let draft: Draft
+    
+    @Published var currentStep = 1
+    @Published private(set) var totalSteps = 2
+    
+    init(mastodonController: ComposeMastodonContext, config: ComposeUIConfig, draft: Draft) {
+        self.mastodonController = mastodonController
+        self.config = config
+        self.draft = draft
+    }
+    
+    func post() async throws {
+        guard draft.hasContent || draft.editedStatusID != nil else {
+            return
+        }
+        
+        // save before posting, so if a crash occurs during network request, the status won't be lost
+        DraftsPersistentContainer.shared.save()
+        
+        let uploadedAttachments = try await uploadAttachments()
+        
+        let contentWarning = draft.contentWarningEnabled ? draft.contentWarning : ""
+        let sensitive = !contentWarning.isEmpty
+        
+        let request: Request<Status>
+        
+        if let editedStatusID = draft.editedStatusID {
+            if mastodonController.instanceFeatures.needsEditAttachmentsInSeparateRequest {
+                await updateEditedAttachments()
+            }
+            
+            request = Client.editStatus(
+                id: editedStatusID,
+                text: textForPosting(),
+                contentType: config.contentType,
+                spoilerText: contentWarning,
+                sensitive: sensitive,
+                language: mastodonController.instanceFeatures.createStatusWithLanguage ? draft.language : nil,
+                mediaIDs: uploadedAttachments,
+                mediaAttributes: draft.draftAttachments.compactMap {
+                    if let id = $0.editedAttachmentID {
+                        return EditStatusMediaAttributes(id: id, description: $0.attachmentDescription, focus: nil)
+                    } else {
+                        return nil
+                    }
+                },
+                poll: draft.poll.map {
+                    EditPollParameters(options: $0.pollOptions.map(\.text), expiresIn: Int($0.duration), multiple: $0.multiple)
+                }
+            )
+        } else {
+            request = Client.createStatus(
+                text: textForPosting(),
+                contentType: config.contentType,
+                inReplyTo: draft.inReplyToID,
+                mediaIDs: uploadedAttachments,
+                sensitive: sensitive,
+                spoilerText: contentWarning,
+                visibility: draft.localOnly && mastodonController.instanceFeatures.localOnlyPostsVisibility ? Status.localPostVisibility : draft.visibility.rawValue,
+                language: mastodonController.instanceFeatures.createStatusWithLanguage ? draft.language : nil,
+                pollOptions: draft.poll?.pollOptions.map(\.text),
+                pollExpiresIn: draft.poll == nil ? nil : Int(draft.poll!.duration),
+                pollMultiple: draft.poll?.multiple,
+                localOnly: mastodonController.instanceFeatures.localOnlyPosts && !mastodonController.instanceFeatures.localOnlyPostsVisibility ? draft.localOnly : nil,
+                idempotencyKey: draft.id.uuidString
+            )
+        }
+        
+        do {
+            let (status, _) = try await mastodonController.run(request)
+            currentStep += 1
+            mastodonController.storeCreatedStatus(status)
+        } catch let error as Client.Error {
+            throw Error.posting(error)
+        }
+    }
+    
+    private func uploadAttachments() async throws -> [String] {
+        // 2 steps (request data, then upload) for each attachment
+        self.totalSteps += 2 * draft.attachments.count
+        
+        var attachments: [String] = []
+        attachments.reserveCapacity(draft.attachments.count)
+        for (index, attachment) in draft.draftAttachments.enumerated() {
+            // if this attachment already exists and is being edited, we don't do anything
+            // edits to the description are handled as part of the edit status request
+            if let editedAttachmentID = attachment.editedAttachmentID {
+                attachments.append(editedAttachmentID)
+                currentStep += 2
+                continue
+            }
+            
+            let data: Data
+            let utType: UTType
+            do {
+                (data, utType) = try await getData(for: attachment)
+                currentStep += 1
+            } catch let error as DraftAttachment.ExportError {
+                throw Error.attachmentData(index: index, cause: error)
+            }
+            let uploaded = try await uploadAttachment(index: index, data: data, utType: utType, description: attachment.attachmentDescription)
+            attachments.append(uploaded.id)
+            currentStep += 1
+        }
+        return attachments
+    }
+    
+    private func getData(for attachment: DraftAttachment) async throws -> (Data, UTType) {
+        return try await withCheckedThrowingContinuation { continuation in
+            attachment.getData(features: mastodonController.instanceFeatures) { result in
+                switch result {
+                case let .success(res):
+                    continuation.resume(returning: res)
+                case let .failure(error):
+                    continuation.resume(throwing: error)
+                }
+            }
+        }
+    }
+    
+    private func uploadAttachment(index: Int, data: Data, utType: UTType, description: String?) async throws -> Attachment {
+        guard let mimeType = utType.preferredMIMEType else {
+            throw Error.attachmentMissingMimeType(index: index, type: utType)
+        }
+        var filename = "file"
+        if let ext = utType.preferredFilenameExtension {
+            filename.append(".\(ext)")
+        }
+        let formAttachment = FormAttachment(mimeType: mimeType, data: data, fileName: filename)
+        let req = Client.upload(attachment: formAttachment, description: description)
+        do {
+            return try await mastodonController.run(req).0
+        } catch let error as Client.Error {
+            throw Error.attachmentUpload(index: index, cause: error)
+        }
+    }
+    
+    private func textForPosting() -> String {
+        var text = draft.text
+        // when using dictation, iOS sometimes leaves a U+FFFC OBJECT REPLACEMENT CHARACTER behind in the text,
+        // which we want to strip out before actually posting the status
+        text = text.replacingOccurrences(of: "\u{fffc}", with: "")
+        
+        if draft.localOnly && mastodonController.instanceFeatures.needsLocalOnlyEmojiHack {
+            text += " 👁"
+        }
+        
+        return text
+    }
+    
+    // only needed for akkoma, not used on regular mastodon
+    private func updateEditedAttachments() async {
+        for attachment in draft.draftAttachments {
+            guard let id = attachment.editedAttachmentID else {
+                continue
+            }
+            let req = Client.updateAttachment(id: id, description: attachment.attachmentDescription, focus: nil)
+            _ = try? await mastodonController.run(req)
+        }
+    }
+    
+    enum Error: Swift.Error, LocalizedError {
+        case attachmentData(index: Int, cause: DraftAttachment.ExportError)
+        case attachmentMissingMimeType(index: Int, type: UTType)
+        case attachmentUpload(index: Int, cause: Client.Error)
+        case posting(Client.Error)
+        
+        var localizedDescription: String {
+            switch self {
+            case let .attachmentData(index: index, cause: cause):
+                return "Attachment \(index + 1): \(cause.localizedDescription)"
+            case let .attachmentMissingMimeType(index: index, type: type):
+                return "Attachment \(index + 1): unknown MIME type for \(type.identifier)"
+            case let .attachmentUpload(index: index, cause: cause):
+                return "Attachment \(index + 1): \(cause.localizedDescription)"
+            case let .posting(error):
+                return error.localizedDescription
+            }
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/CharacterCounter.swift

@@ -1,24 +1,25 @@
 //
 //  CharacterCounter.swift
-//  Pachyderm
+//  ComposeUI
 //
 //  Created by Shadowfacts on 9/29/18.
 //  Copyright © 2018 Shadowfacts. All rights reserved.
 //
 
 import Foundation
+import InstanceFeatures
 
 public struct CharacterCounter {
     
-    static let linkDetector = try! NSDataDetector(types: NSTextCheckingResult.CheckingType.link.rawValue)
-    static let mention = try! NSRegularExpression(pattern: "(@[a-z0-9_]+)(?:@[a-z0-9\\-\\.]+[a-z0-9]+)?", options: .caseInsensitive)
+    private static let linkDetector = try! NSDataDetector(types: NSTextCheckingResult.CheckingType.link.rawValue)
+    private static let mention = try! NSRegularExpression(pattern: "(@[a-z0-9_]+)(?:@[a-z0-9\\-\\.]+[a-z0-9]+)?", options: .caseInsensitive)
     
-    public static func count(text: String, for instance: Instance? = nil) -> Int {
+    public static func count(text: String, for instanceFeatures: InstanceFeatures) -> Int {
         let mentionsRemoved = removeMentions(in: text)
         var count = mentionsRemoved.count
         for match in linkDetector.matches(in: mentionsRemoved, options: [], range: NSRange(location: 0, length: mentionsRemoved.utf16.count)) {
             count -= match.range.length
-            count += instance?.configuration?.statuses.charactersReservedPerURL ?? 23 // default Mastodon link length
+            count += instanceFeatures.charsReservedPerURL
         }
         return count
     }

Packages/ComposeUI/Sources/ComposeUI/ComposeInput.swift

@@ -0,0 +1,29 @@
+//
+//  ComposeInput.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/5/23.
+//
+
+import Foundation
+import Combine
+import UIKit
+
+protocol ComposeInput: AnyObject, ObservableObject {
+    var toolbarElements: [ToolbarElement] { get }
+    var textInputMode: UITextInputMode? { get }
+    
+    var autocompleteState: AutocompleteState? { get }
+    var autocompleteStatePublisher: Published<AutocompleteState?>.Publisher { get }
+    
+    func autocomplete(with string: String)
+    
+    func applyFormat(_ format: StatusFormat)
+    
+    func beginAutocompletingEmoji()
+}
+
+enum ToolbarElement {
+    case emojiPicker
+    case formattingButtons
+}

Packages/ComposeUI/Sources/ComposeUI/ComposeMastodonContext.swift

@@ -0,0 +1,29 @@
+//
+//  ComposeMastodonContext.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/5/23.
+//
+
+import Foundation
+import Pachyderm
+import InstanceFeatures
+import UserAccounts
+
+public protocol ComposeMastodonContext {
+    var accountInfo: UserAccountInfo? { get }
+    var instanceFeatures: InstanceFeatures { get }
+    
+    func run<Result: Sendable>(_ request: Request<Result>) async throws -> (Result, Pagination?)
+    
+    func getCustomEmojis() async -> [Emoji]
+    
+    @MainActor
+    func searchCachedAccounts(query: String) -> [AccountProtocol]
+    @MainActor
+    func cachedRelationship(for accountID: String) -> RelationshipProtocol?
+    @MainActor
+    func searchCachedHashtags(query: String) -> [Hashtag]
+    
+    func storeCreatedStatus(_ status: Status)
+}

Packages/ComposeUI/Sources/ComposeUI/ComposeUIConfig.swift

@@ -0,0 +1,42 @@
+//
+//  ComposeUIConfig.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/4/23.
+//
+
+import SwiftUI
+import Pachyderm
+import PhotosUI
+import PencilKit
+import TuskerComponents
+
+public struct ComposeUIConfig {
+    // Config
+    public var allowSwitchingDrafts = true
+    public var textSelectionStartsAtBeginning = false
+    
+    // Style
+    public var backgroundColor = Color(uiColor: .systemBackground)
+    public var groupedBackgroundColor = Color(uiColor: .systemGroupedBackground)
+    public var groupedCellBackgroundColor = Color(uiColor: .systemBackground)
+    public var fillColor = Color(uiColor: .systemFill)
+    public var avatarStyle = AvatarImageView.Style.roundRect
+    
+    // Preferences
+    public var useTwitterKeyboard = false
+    public var contentType = StatusContentType.plain
+    public var requireAttachmentDescriptions = false
+    
+    // Host callbacks
+    public var dismiss: @MainActor (DismissMode) -> Void = { _ in }
+    public var presentAssetPicker: ((@MainActor @escaping ([PHPickerResult]) -> Void) -> Void)?
+    public var presentDrawing: ((PKDrawing, @escaping (PKDrawing) -> Void) -> Void)?
+    public var userActivityForDraft: ((Draft) -> NSItemProvider?) = { _ in nil }
+    
+    public init() {
+    }
+}
+
+extension ComposeUIConfig {
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/AttachmentRowController.swift

@@ -0,0 +1,223 @@
+//
+//  AttachmentRowController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/12/23.
+//
+
+import SwiftUI
+import TuskerComponents
+import Vision
+import MatchedGeometryPresentation
+
+class AttachmentRowController: ViewController {
+    let parent: ComposeController
+    let attachment: DraftAttachment
+    
+    @Published var descriptionMode: DescriptionMode = .allowEntry
+    @Published var textRecognitionError: Error?
+    @Published var focusAttachmentOnTextEditorUnfocus = false
+    
+    let thumbnailController: AttachmentThumbnailController
+    
+    private var descriptionObservation: NSKeyValueObservation?
+    
+    init(parent: ComposeController, attachment: DraftAttachment) {
+        self.parent = parent
+        self.attachment = attachment
+        self.thumbnailController = AttachmentThumbnailController(attachment: attachment, parent: parent)
+        
+        descriptionObservation = attachment.observe(\.attachmentDescription, changeHandler: { [unowned self] _, _ in
+            // the faultingState is non-zero for objects that are being cascade deleted when the draft is deleted
+            if attachment.faultingState == 0 {
+                self.updateAttachmentDescriptionState()
+            }
+        })
+    }
+    
+    private func updateAttachmentDescriptionState() {
+        if attachment.attachmentDescription.isEmpty {
+            parent.attachmentsMissingDescriptions.insert(attachment.id)
+        } else {
+            parent.attachmentsMissingDescriptions.remove(attachment.id)
+        }
+    }
+    
+    var view: some View {
+        AttachmentView(attachment: attachment)
+    }
+    
+    private func removeAttachment() {
+        withAnimation {
+            var newAttachments = parent.draft.draftAttachments
+            newAttachments.removeAll(where: { $0.id == attachment.id })
+            parent.draft.attachments = NSMutableOrderedSet(array: newAttachments)
+        }
+    }
+    
+    private func editDrawing() {
+        guard case .drawing(let drawing) = attachment.data else {
+            return
+        }
+        parent.config.presentDrawing?(drawing) { newDrawing in
+            self.attachment.drawing = newDrawing
+        }
+    }
+    
+    private func focusAttachment() {
+        focusAttachmentOnTextEditorUnfocus = false
+        parent.focusedAttachment = (attachment, thumbnailController)
+    }
+    
+    private func recognizeText() {
+        descriptionMode = .recognizingText
+        
+        self.attachment.getData(features: self.parent.mastodonController.instanceFeatures, skipAllConversion: true) { result in
+            DispatchQueue.main.async {
+                let data: Data
+                switch result {
+                case .success((let d, _)):
+                    data = d
+                case .failure(let error):
+                    self.descriptionMode = .allowEntry
+                    self.textRecognitionError = error
+                    return
+                }
+                
+                let handler = VNImageRequestHandler(data: data)
+                let request = VNRecognizeTextRequest { request, error in
+                    DispatchQueue.main.async {
+                        if let results = request.results as? [VNRecognizedTextObservation] {
+                            var text = ""
+                            for observation in results {
+                                let result = observation.topCandidates(1).first!
+                                text.append(result.string)
+                                text.append("\n")
+                            }
+                            self.attachment.attachmentDescription = text
+                        }
+                        self.descriptionMode = .allowEntry
+                    }
+                }
+                request.recognitionLevel = .accurate
+                request.usesLanguageCorrection = true
+                DispatchQueue.global(qos: .userInitiated).async {
+                    do {
+                        try handler.perform([request])
+                    } catch let error as NSError where error.code == 1 {
+                        // The perform call throws an error with code 1 if the request is cancelled, which we don't want to show an alert for.
+                        return
+                    } catch {
+                        DispatchQueue.main.async {
+                            self.descriptionMode = .allowEntry
+                            self.textRecognitionError = error
+                        }
+                    }
+                }
+            }
+        }
+    }
+    
+    struct AttachmentView: View {
+        @ObservedObject private var attachment: DraftAttachment
+        @EnvironmentObject private var controller: AttachmentRowController
+        @FocusState private var textEditorFocused: Bool
+        
+        init(attachment: DraftAttachment) {
+            self.attachment = attachment
+        }
+        
+        var body: some View {
+            HStack(alignment: .center, spacing: 4) {
+                ControllerView(controller: { controller.thumbnailController })
+                    .clipShape(RoundedRectangle(cornerRadius: 8))
+                    .environment(\.attachmentThumbnailConfiguration, .init(contentMode: .fit, fullSize: false))
+                    .matchedGeometrySource(id: attachment.id, presentationID: attachment.id)
+                    .overlay {
+                        thumbnailFocusedOverlay
+                    }
+                    .frame(width: thumbnailSize, height: thumbnailSize)
+                    .onTapGesture {
+                        textEditorFocused = false
+                        // if we just focus the attachment immediately, the text editor doesn't actually unfocus
+                        controller.focusAttachmentOnTextEditorUnfocus = true
+                    }
+                    .contextMenu {
+                        if attachment.drawingData != nil {
+                            Button(action: controller.editDrawing) {
+                                Label("Edit Drawing", systemImage: "hand.draw")
+                            }
+                        } else if attachment.type == .image {
+                            Button(action: controller.recognizeText) {
+                                Label("Recognize Text", systemImage: "doc.text.viewfinder")
+                            }
+                        }
+
+                        Button(role: .destructive, action: controller.removeAttachment) {
+                            Label("Delete", systemImage: "trash")
+                        }
+                    } preview: {
+                        ControllerView(controller: { controller.thumbnailController })
+                    }
+                
+                switch controller.descriptionMode {
+                case .allowEntry:
+                    InlineAttachmentDescriptionView(attachment: attachment, minHeight: thumbnailSize)
+                        .matchedGeometrySource(id: AttachmentDescriptionTextViewID(attachment), presentationID: attachment.id)
+                        .focused($textEditorFocused)
+                    
+                case .recognizingText:
+                    ProgressView()
+                        .progressViewStyle(.circular)
+                }
+            }
+            .alertWithData("Text Recognition Failed", data: $controller.textRecognitionError) { _ in
+                Button("OK") {}
+            } message: { error in
+                Text(error.localizedDescription)
+            }
+            .onAppear(perform: controller.updateAttachmentDescriptionState)
+            #if os(visionOS)
+            .onChange(of: textEditorFocused) {
+                if !textEditorFocused && controller.focusAttachmentOnTextEditorUnfocus {
+                    controller.focusAttachment()
+                }
+            }
+            #else
+            .onChange(of: textEditorFocused) { newValue in
+                if !newValue && controller.focusAttachmentOnTextEditorUnfocus {
+                    controller.focusAttachment()
+                }
+            }
+            #endif
+        }
+        
+        private var thumbnailSize: CGFloat {
+            #if os(visionOS)
+            120
+            #else
+            80
+            #endif
+        }
+        
+        @ViewBuilder
+        private var thumbnailFocusedOverlay: some View {
+            Image(systemName: "arrow.up.backward.and.arrow.down.forward")
+                .foregroundColor(.white)
+                .frame(maxWidth: .infinity, maxHeight: .infinity)
+                .background(Color.black.opacity(0.35))
+                .clipShape(RoundedRectangle(cornerRadius: 8))
+                // use .opacity and an animation, because .transition doesn't seem to play nice with @FocusState
+                .opacity(textEditorFocused ? 1 : 0)
+                .animation(.linear(duration: 0.1), value: textEditorFocused)
+        }
+
+    }
+    
+}
+
+extension AttachmentRowController {
+    enum DescriptionMode {
+        case allowEntry, recognizingText
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/AttachmentThumbnailController.swift

@@ -0,0 +1,201 @@
+//
+//  AttachmentThumbnailController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 11/10/21.
+//  Copyright © 2021 Shadowfacts. All rights reserved.
+//
+
+import SwiftUI
+import Photos
+import TuskerComponents
+
+class AttachmentThumbnailController: ViewController {
+    unowned let parent: ComposeController
+    let attachment: DraftAttachment
+    
+    @Published private var image: UIImage?
+    @Published private var gifController: GIFController?
+    @Published private var fullSize: Bool = false
+    
+    init(attachment: DraftAttachment, parent: ComposeController) {
+        self.attachment = attachment
+        self.parent = parent
+    }
+    
+    func loadImageIfNecessary(fullSize: Bool) {
+        if (gifController != nil) || (image != nil && self.fullSize) {
+            return
+        }
+        self.fullSize = fullSize
+        
+        switch attachment.data {
+        case .editing(_, let kind, let url):
+            switch kind {
+            case .image:
+                Task { @MainActor in
+                    self.image = await parent.fetchAttachment(url)
+                }
+                
+            case .video, .gifv:
+                let asset = AVURLAsset(url: url)
+                let imageGenerator = AVAssetImageGenerator(asset: asset)
+                imageGenerator.appliesPreferredTrackTransform = true
+                #if os(visionOS)
+                #warning("Use async AVAssetImageGenerator.image(at:)")
+                #else
+                if let cgImage = try? imageGenerator.copyCGImage(at: .zero, actualTime: nil) {
+                    self.image = UIImage(cgImage: cgImage)
+                }
+                #endif
+
+            case .audio, .unknown:
+                break
+            }
+            
+        case .asset(let id):
+            guard let asset = PHAsset.fetchAssets(withLocalIdentifiers: [id], options: nil).firstObject else {
+                return
+            }
+            let isGIF = PHAssetResource.assetResources(for: asset).contains(where: { $0.uniformTypeIdentifier == UTType.gif.identifier })
+            if isGIF {
+                PHImageManager.default().requestImageDataAndOrientation(for: asset, options: nil) { data, typeIdentifier, orientation, info in
+                    guard let data else { return }
+                    if typeIdentifier == UTType.gif.identifier {
+                        self.gifController = GIFController(gifData: data)
+                    } else {
+                        let image = UIImage(data: data)
+                        DispatchQueue.main.async {
+                            self.image = image
+                        }
+                    }
+                }
+            } else {
+                let size: CGSize
+                if fullSize {
+                    size = PHImageManagerMaximumSize
+                } else {
+                    // currently only used as thumbnail in ComposeAttachmentRow
+                    size = CGSize(width: 80, height: 80)
+                }
+                PHImageManager.default().requestImage(for: asset, targetSize: size, contentMode: .aspectFill, options: nil) { (image, _) in
+                    DispatchQueue.main.async {
+                        self.image = image
+                    }
+                }
+            }
+            
+        case .drawing(let drawing):
+            image = drawing.imageInLightMode(from: drawing.bounds)
+
+        case .file(let url, let type):
+            if type.conforms(to: .movie) {
+                let asset = AVURLAsset(url: url)
+                let imageGenerator = AVAssetImageGenerator(asset: asset)
+                imageGenerator.appliesPreferredTrackTransform = true
+                #if os(visionOS)
+                #warning("Use async AVAssetImageGenerator.image(at:)")
+                #else
+                if let cgImage = try? imageGenerator.copyCGImage(at: .zero, actualTime: nil) {
+                    self.image = UIImage(cgImage: cgImage)
+                }
+                #endif
+            } else if let data = try? Data(contentsOf: url) {
+                if type == .gif {
+                    self.gifController = GIFController(gifData: data)
+                } else if type.conforms(to: .image),
+                   let image = UIImage(data: data) {
+                    // using prepareThumbnail on images from PHPicker results in extremely high memory usage,
+                    // crashing share extension. see FB12186346
+//                    if fullSize {
+                        image.prepareForDisplay { prepared in
+                            DispatchQueue.main.async {
+                                self.image = image
+                            }
+                        }
+//                    } else {
+//                        image.prepareThumbnail(of: CGSize(width: 80, height: 80)) { prepared in
+//                            DispatchQueue.main.async {
+//                                self.image = prepared
+//                            }
+//                        }
+//                    }
+                }
+            }
+            
+        case .none:
+            break
+        }
+    }
+    
+    var view: some SwiftUI.View {
+        View()
+    }
+    
+    struct View: SwiftUI.View {
+        @EnvironmentObject private var controller: AttachmentThumbnailController
+        @Environment(\.attachmentThumbnailConfiguration) private var config
+        
+        var body: some SwiftUI.View {
+            content
+                .onAppear {
+                    controller.loadImageIfNecessary(fullSize: config.fullSize)
+                }
+        }
+        
+        @ViewBuilder
+        private var content: some SwiftUI.View {
+            if let gifController = controller.gifController {
+                GIFViewWrapper(controller: gifController)
+            } else if let image = controller.image {
+                Image(uiImage: image)
+                    .resizable()
+                    .aspectRatio(config.aspectRatio, contentMode: config.contentMode)
+            } else {
+                Image(systemName: "photo")
+            }
+        }
+    }
+}
+
+struct AttachmentThumbnailConfiguration {
+    let aspectRatio: CGFloat?
+    let contentMode: ContentMode
+    let fullSize: Bool
+    
+    init(aspectRatio: CGFloat? = nil, contentMode: ContentMode = .fit, fullSize: Bool = false) {
+        self.aspectRatio = aspectRatio
+        self.contentMode = contentMode
+        self.fullSize = fullSize
+    }
+}
+
+private struct AttachmentThumbnailConfigurationEnvironmentKey: EnvironmentKey {
+    static let defaultValue = AttachmentThumbnailConfiguration()
+}
+
+extension EnvironmentValues {
+    var attachmentThumbnailConfiguration: AttachmentThumbnailConfiguration {
+        get { self[AttachmentThumbnailConfigurationEnvironmentKey.self] }
+        set { self[AttachmentThumbnailConfigurationEnvironmentKey.self] = newValue }
+    }
+}
+
+private struct GIFViewWrapper: UIViewRepresentable {
+    typealias UIViewType = GIFImageView
+
+    @State var controller: GIFController
+
+    func makeUIView(context: Context) -> GIFImageView {
+        let view = GIFImageView()
+        controller.attach(to: view)
+        controller.startAnimating()
+        view.contentMode = .scaleAspectFit
+        view.setContentCompressionResistancePriority(.defaultLow, for: .horizontal)
+        view.setContentCompressionResistancePriority(.defaultLow, for: .vertical)
+        return view
+    }
+
+    func updateUIView(_ uiView: GIFImageView, context: Context) {
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/AttachmentsListController.swift

@@ -0,0 +1,225 @@
+//
+//  AttachmentsListController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/8/23.
+//
+
+import SwiftUI
+import PhotosUI
+import PencilKit
+
+class AttachmentsListController: ViewController {
+    
+    unowned let parent: ComposeController
+    var draft: Draft { parent.draft }
+    
+    var isValid: Bool {
+        !requiresAttachmentDescriptions && validAttachmentCombination
+    }
+
+    private var requiresAttachmentDescriptions: Bool {
+        if parent.config.requireAttachmentDescriptions {
+            if draft.attachments.count == 0 {
+                return false
+            } else {
+                return !parent.attachmentsMissingDescriptions.isEmpty
+            }
+        } else {
+            return false
+        }
+    }
+    
+    var validAttachmentCombination: Bool {
+        if !parent.mastodonController.instanceFeatures.mastodonAttachmentRestrictions {
+            return true
+        } else if draft.attachments.count > 1,
+                  draft.draftAttachments.contains(where: { $0.type == .video }) {
+            return false
+        } else if draft.attachments.count > 4 {
+            return false
+        }
+        return true
+    }
+    
+    init(parent: ComposeController) {
+        self.parent = parent
+    }
+    
+    var canAddAttachment: Bool {
+        if parent.mastodonController.instanceFeatures.mastodonAttachmentRestrictions {
+            return draft.attachments.count < 4 && draft.draftAttachments.allSatisfy { $0.type == .image } && draft.poll == nil
+        } else {
+            return true
+        }
+    }
+    
+    private var canAddPoll: Bool {
+        if parent.mastodonController.instanceFeatures.pollsAndAttachments {
+            return true
+        } else {
+            return draft.attachments.count == 0
+        }
+    }
+    
+    var view: some View {
+        AttachmentsList()
+    }
+    
+    private func moveAttachments(from source: IndexSet, to destination: Int) {
+        // just using moveObjects(at:to:) on the draft.attachments NSMutableOrderedSet
+        // results in the order switching back to the previous order and then to the correct one
+        // on the subsequent 2 view updates. creating a new set with the proper order doesn't have that problem
+        var array = draft.draftAttachments
+        array.move(fromOffsets: source, toOffset: destination)
+        draft.attachments = NSMutableOrderedSet(array: array)
+    }
+    
+    private func deleteAttachments(at indices: IndexSet) {
+        var array = draft.draftAttachments
+        array.remove(atOffsets: indices)
+        draft.attachments = NSMutableOrderedSet(array: array)
+    }
+    
+    private func insertAttachments(at offset: Int, itemProviders: [NSItemProvider]) {
+        for provider in itemProviders where provider.canLoadObject(ofClass: DraftAttachment.self) {
+            provider.loadObject(ofClass: DraftAttachment.self) { object, error in
+                guard let attachment = object as? DraftAttachment else { return }
+                DispatchQueue.main.async { [weak self] in
+                    guard let self,
+                          self.canAddAttachment else {
+                        return
+                    }
+                    DraftsPersistentContainer.shared.viewContext.insert(attachment)
+                    attachment.draft = self.draft
+                    self.draft.attachments.add(attachment)
+                }
+            }
+        }
+    }
+    
+    private func addImage() {
+        parent.deleteDraftOnDisappear = false
+        parent.config.presentAssetPicker?({ results in
+            self.insertAttachments(at: self.draft.attachments.count, itemProviders: results.map(\.itemProvider))
+        })
+    }
+    
+    private func addDrawing() {
+        parent.deleteDraftOnDisappear = false
+        parent.config.presentDrawing?(PKDrawing()) { drawing in
+            let attachment = DraftAttachment(context: DraftsPersistentContainer.shared.viewContext)
+            attachment.id = UUID()
+            attachment.drawing = drawing
+            attachment.draft = self.draft
+            self.draft.attachments.add(attachment)
+        }
+    }
+    
+    private func togglePoll() {
+        UIApplication.shared.sendAction(#selector(UIView.resignFirstResponder), to: nil, from: nil, for: nil)
+        
+        withAnimation {
+            draft.poll = draft.poll == nil ? Poll(context: DraftsPersistentContainer.shared.viewContext) : nil
+        }
+    }
+    
+    struct AttachmentsList: View {
+        private let cellHeight: CGFloat = 80
+        private let cellPadding: CGFloat = 12
+        
+        @EnvironmentObject private var controller: AttachmentsListController
+        @EnvironmentObject private var draft: Draft
+        @Environment(\.colorScheme) private var colorScheme
+        @Environment(\.horizontalSizeClass) private var horizontalSizeClass
+        
+        var body: some View {
+            attachmentsList
+            
+            Group {
+                if controller.parent.config.presentAssetPicker != nil {
+                    addImageButton
+                        .listRowInsets(EdgeInsets(top: cellPadding / 2, leading: cellPadding / 2, bottom: cellPadding / 2, trailing: cellPadding / 2))
+                }
+                
+                if controller.parent.config.presentDrawing != nil {
+                    addDrawingButton
+                        .listRowInsets(EdgeInsets(top: cellPadding / 2, leading: cellPadding / 2, bottom: cellPadding / 2, trailing: cellPadding / 2))
+                }
+                
+                togglePollButton
+                    .listRowInsets(EdgeInsets(top: cellPadding / 2, leading: cellPadding / 2, bottom: cellPadding / 2, trailing: cellPadding / 2))
+            }
+            #if os(visionOS)
+            .buttonStyle(.bordered)
+            .labelStyle(AttachmentButtonLabelStyle())
+            #endif
+        }
+        
+        private var attachmentsList: some View {
+            ForEach(draft.attachments.array as! [DraftAttachment]) { attachment in
+                ControllerView(controller: { AttachmentRowController(parent: controller.parent, attachment: attachment) })
+                    .listRowInsets(EdgeInsets(top: cellPadding / 2, leading: cellPadding / 2, bottom: cellPadding / 2, trailing: cellPadding / 2))
+                    .id(attachment.id)
+            }
+            .onMove(perform: controller.moveAttachments)
+            .onDelete(perform: controller.deleteAttachments)
+            .conditionally(controller.canAddAttachment) {
+                $0.onInsert(of: DraftAttachment.readableTypeIdentifiersForItemProvider, perform: { offset, providers in
+                    controller.insertAttachments(at: offset, itemProviders: providers)
+                })
+            }
+            // only sort of works, see #240
+            .onDrop(of: DraftAttachment.readableTypeIdentifiersForItemProvider, isTargeted: nil) { providers in
+                controller.insertAttachments(at: 0, itemProviders: providers)
+                return true
+            }
+        }
+        
+        private var addImageButton: some View {
+            Button(action: controller.addImage) {
+                Label("Add photo or video", systemImage: colorScheme == .dark ? "photo.fill" : "photo")
+            }
+            .disabled(!controller.canAddAttachment)
+            .foregroundColor(.accentColor)
+            .frame(height: cellHeight / 2)
+        }
+        
+        private var addDrawingButton: some View {
+            Button(action: controller.addDrawing) {
+                Label("Draw something", systemImage: "hand.draw")
+            }
+            .disabled(!controller.canAddAttachment)
+            .foregroundColor(.accentColor)
+            .frame(height: cellHeight / 2)
+        }
+        
+        private var togglePollButton: some View {
+            Button(action: controller.togglePoll) {
+                Label(draft.poll == nil ? "Add a poll" : "Remove poll", systemImage: "chart.bar.doc.horizontal")
+            }
+            .disabled(!controller.canAddPoll)
+            .foregroundColor(.accentColor)
+            .frame(height: cellHeight / 2)
+        }
+    }
+}
+
+fileprivate extension View {
+    @ViewBuilder
+    func conditionally(_ condition: Bool, body: (Self) -> some View) -> some View {
+        if condition {
+            body(self)
+        } else {
+            self
+        }
+    }
+}
+
+@available(visionOS 1.0, *)
+fileprivate struct AttachmentButtonLabelStyle: LabelStyle {
+    func makeBody(configuration: Configuration) -> some View {
+        DefaultLabelStyle().makeBody(configuration: configuration)
+            .foregroundStyle(.white)
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/AutocompleteController.swift

@@ -0,0 +1,83 @@
+//
+//  AutocompleteController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/25/23.
+//
+
+import SwiftUI
+import Combine
+
+class AutocompleteController: ViewController {
+    
+    unowned let parent: ComposeController
+    
+    @Published var mode: Mode?
+    
+    init(parent: ComposeController) {
+        self.parent = parent
+        
+        parent.$currentInput
+            .compactMap { $0 }
+            .flatMap { $0.autocompleteStatePublisher }
+            .map {
+                switch $0 {
+                case .mention(_):
+                    return Mode.mention
+                case .emoji(_):
+                    return Mode.emoji
+                case .hashtag(_):
+                    return Mode.hashtag
+                case nil:
+                    return nil
+                }
+            }
+            .assign(to: &$mode)
+    }
+    
+    var view: some View {
+        AutocompleteView()
+    }
+    
+    struct AutocompleteView: View {
+        @EnvironmentObject private var parent: ComposeController
+        @EnvironmentObject private var controller: AutocompleteController
+        @Environment(\.colorScheme) private var colorScheme: ColorScheme
+        
+        var body: some View {
+            if let mode = controller.mode {
+                VStack(spacing: 0) {
+                    Divider()
+                    suggestionsView(mode: mode)
+                }
+                .background(backgroundColor)
+            }
+        }
+        
+        @ViewBuilder
+        private func suggestionsView(mode: Mode) -> some View {
+            switch mode {
+            case .mention:
+                ControllerView(controller: { AutocompleteMentionsController(composeController: parent) })
+            case .emoji:
+                ControllerView(controller: { AutocompleteEmojisController(composeController: parent) })
+            case .hashtag:
+                ControllerView(controller: { AutocompleteHashtagsController(composeController: parent) })
+            }
+        }
+        
+        private var backgroundColor: Color {
+            Color(white: colorScheme == .light ? 0.98 : 0.15)
+        }
+        
+        private var borderColor: Color {
+            Color(white: colorScheme == .light ? 0.85 : 0.25)
+        }
+    }
+    
+    enum Mode {
+        case mention
+        case emoji
+        case hashtag
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/AutocompleteEmojisController.swift

@@ -0,0 +1,188 @@
+//
+//  AutocompleteEmojisController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/26/23.
+//
+
+import SwiftUI
+import Pachyderm
+import Combine
+import TuskerComponents
+
+class AutocompleteEmojisController: ViewController {
+    unowned let composeController: ComposeController
+    var mastodonController: ComposeMastodonContext { composeController.mastodonController }
+    
+    private var stateCancellable: AnyCancellable?
+    private var searchTask: Task<Void, Never>?
+    
+    @Published var expanded = false
+    @Published var emojis: [Emoji] = []
+    @Published var emojisBySection: [String: [Emoji]] = [:]
+    
+    init(composeController: ComposeController) {
+        self.composeController = composeController
+        
+        stateCancellable = composeController.$currentInput
+            .compactMap { $0 }
+            .flatMap { $0.autocompleteStatePublisher }
+            .compactMap {
+                if case .emoji(let s) = $0 {
+                    return s
+                } else {
+                    return nil
+                }
+            }
+            .removeDuplicates()
+            .sink { [unowned self] query in
+                self.searchTask?.cancel()
+                self.searchTask = Task { [weak self] in
+                    await self?.queryChanged(query)
+                }
+            }
+    }
+    
+    @MainActor
+    private func queryChanged(_ query: String) async {
+        var emojis = await composeController.mastodonController.getCustomEmojis()
+        guard !Task.isCancelled else {
+            return
+        }
+        
+        if !query.isEmpty {
+            emojis =
+            emojis.map { emoji -> (Emoji, (matched: Bool, score: Int)) in
+                (emoji, FuzzyMatcher.match(pattern: query, str: emoji.shortcode))
+            }
+            .filter(\.1.matched)
+            .sorted { $0.1.score > $1.1.score }
+            .map(\.0)
+        }
+        
+        var shortcodes = Set<String>()
+        var newEmojis = [Emoji]()
+        var newEmojisBySection = [String: [Emoji]]()
+        for emoji in emojis where !shortcodes.contains(emoji.shortcode) {
+            newEmojis.append(emoji)
+            shortcodes.insert(emoji.shortcode)
+            
+            let category = emoji.category ?? ""
+            if newEmojisBySection.keys.contains(category) {
+                newEmojisBySection[category]!.append(emoji)
+            } else {
+                newEmojisBySection[category] = [emoji]
+            }
+        }
+        self.emojis = newEmojis
+        self.emojisBySection = newEmojisBySection
+    }
+    
+    private func toggleExpanded() {
+        withAnimation {
+            expanded.toggle()
+        }
+    }
+    
+    private func autocomplete(with emoji: Emoji) {
+        guard let input = composeController.currentInput else { return }
+        input.autocomplete(with: ":\(emoji.shortcode):")
+    }
+    
+    var view: some View {
+        AutocompleteEmojisView()
+    }
+    
+    struct AutocompleteEmojisView: View {
+        @EnvironmentObject private var composeController: ComposeController
+        @EnvironmentObject private var controller: AutocompleteEmojisController
+        @ScaledMetric private var emojiSize = 30
+        
+        var body: some View {
+            // When exapnded, the toggle button should be at the top. When collapsed, it should be centered.
+            HStack(alignment: controller.expanded ? .top : .center, spacing: 0) {
+                emojiList
+                    .transition(.move(edge: .bottom))
+                
+                toggleExpandedButton
+                    .padding(.trailing, 8)
+                    .padding(.top, controller.expanded ? 8 : 0)
+            }
+        }
+        
+        @ViewBuilder
+        private var emojiList: some View {
+            if controller.expanded {
+                verticalGrid
+                    .frame(height: 150)
+            } else {
+                horizontalScrollView
+            }
+        }
+        
+        private var verticalGrid: some View {
+            ScrollView {
+                LazyVGrid(columns: [GridItem(.adaptive(minimum: emojiSize), spacing: 4)]) {
+                    ForEach(controller.emojisBySection.keys.sorted(), id: \.self) { section in
+                        Section {
+                            ForEach(controller.emojisBySection[section]!, id: \.shortcode) { emoji in
+                                Button(action: { controller.autocomplete(with: emoji) }) {
+                                    composeController.emojiImageView(emoji)
+                                        .frame(height: emojiSize)
+                                }
+                                .accessibilityLabel(emoji.shortcode)
+                            }
+                        } header: {
+                            if !section.isEmpty {
+                                VStack(alignment: .leading, spacing: 2) {
+                                    Text(section)
+                                        .font(.caption)
+                                    
+                                    Divider()
+                                }
+                                .padding(.top, 4)
+                            }
+                        }
+                    }
+                }
+                .padding(.all, 8)
+                // the spacing between the grid sections doesn't seem to be taken into account by the ScrollView?
+                .padding(.bottom, CGFloat(controller.emojisBySection.keys.count) * 4)
+            }
+            .frame(maxWidth: .infinity)
+        }
+        
+        private var horizontalScrollView: some View {
+            ScrollView(.horizontal) {
+                LazyHStack(spacing: 8) {
+                    ForEach(controller.emojis, id: \.shortcode) { emoji in
+                        Button(action: { controller.autocomplete(with: emoji) }) {
+                            HStack(spacing: 4) {
+                                composeController.emojiImageView(emoji)
+                                    .frame(height: emojiSize)
+                                Text(verbatim: ":\(emoji.shortcode):")
+                                    .foregroundColor(.primary)
+                            }
+                        }
+                        .accessibilityLabel(emoji.shortcode)
+                        .frame(height: emojiSize)
+                    }
+                    .animation(.linear(duration: 0.2), value: controller.emojis)
+                }
+                .padding(.horizontal, 8)
+                .frame(height: emojiSize + 16)
+            }
+        }
+        
+        private var toggleExpandedButton: some View {
+            Button(action: controller.toggleExpanded) {
+                Image(systemName: "chevron.down")
+                    .resizable()
+                    .aspectRatio(contentMode: .fit)
+                    .rotationEffect(controller.expanded ? .zero : .degrees(180))
+            }
+            .accessibilityLabel(controller.expanded ? "Collapse" : "Expand")
+            .frame(width: 20, height: 20)
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/AutocompleteHashtagsController.swift

@@ -0,0 +1,125 @@
+//
+//  AutocompleteHashtagsController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/1/23.
+//
+
+import SwiftUI
+import Combine
+import Pachyderm
+import TuskerComponents
+
+class AutocompleteHashtagsController: ViewController {
+    unowned let composeController: ComposeController
+    var mastodonController: ComposeMastodonContext { composeController.mastodonController }
+    
+    private var stateCancellable: AnyCancellable?
+    private var searchTask: Task<Void, Never>?
+    
+    @Published var hashtags: [Hashtag] = []
+    
+    init(composeController: ComposeController) {
+        self.composeController = composeController
+        
+        stateCancellable = composeController.$currentInput
+            .compactMap { $0 }
+            .flatMap { $0.autocompleteStatePublisher }
+            .compactMap {
+                if case .hashtag(let s) = $0 {
+                    return s
+                } else {
+                    return nil
+                }
+            }
+            .debounce(for: .milliseconds(250), scheduler: DispatchQueue.main)
+            .sink { [unowned self] query in
+                self.searchTask?.cancel()
+                self.searchTask = Task { [weak self] in
+                    await self?.queryChanged(query)
+                }
+            }
+    }
+    
+    @MainActor
+    private func queryChanged(_ query: String) async {
+        guard !query.isEmpty else {
+            hashtags = []
+            return
+        }
+        
+        let localHashtags = mastodonController.searchCachedHashtags(query: query)
+        
+        var onlyLocalTagsTask: Task<Void, any Error>?
+        if !localHashtags.isEmpty {
+            onlyLocalTagsTask = Task {
+                // we only want to do the local-only search if the trends API call takes more than .25sec or it fails
+                try await Task.sleep(nanoseconds: 250 * NSEC_PER_MSEC)
+                self.updateHashtags(searchResults: [], trendingTags: [], localHashtags: localHashtags, query: query)
+            }
+        }
+        
+        async let trendingTags = try? mastodonController.run(Client.getTrendingHashtags()).0
+        async let searchResults = try? mastodonController.run(Client.search(query: "#\(query)", types: [.hashtags])).0.hashtags
+        
+        let trends = await trendingTags ?? []
+        let search = await searchResults ?? []
+        
+        onlyLocalTagsTask?.cancel()
+        guard !Task.isCancelled else { return }
+        
+        updateHashtags(searchResults: search, trendingTags: trends, localHashtags: localHashtags, query: query)
+    }
+    
+    @MainActor
+    private func updateHashtags(searchResults: [Hashtag], trendingTags: [Hashtag], localHashtags: [Hashtag], query: String) {
+        var addedHashtags = Set<String>()
+        var hashtags = [(Hashtag, Int)]()
+        for group in [searchResults, trendingTags, localHashtags] {
+            for tag in group where !addedHashtags.contains(tag.name) {
+                let (matched, score) = FuzzyMatcher.match(pattern: query, str: tag.name)
+                if matched {
+                    hashtags.append((tag, score))
+                    addedHashtags.insert(tag.name)
+                }
+            }
+        }
+        self.hashtags = hashtags
+            .sorted { $0.1 > $1.1 }
+            .map(\.0)
+    }
+    
+    private func autocomplete(with hashtag: Hashtag) {
+        guard let currentInput = composeController.currentInput else { return }
+        currentInput.autocomplete(with: "#\(hashtag.name)")
+    }
+    
+    var view: some View {
+        AutocompleteHashtagsView()
+    }
+    
+    struct AutocompleteHashtagsView: View {
+        @EnvironmentObject private var controller: AutocompleteHashtagsController
+        
+        var body: some View {
+            ScrollView(.horizontal) {
+                HStack(spacing: 8) {
+                    ForEach(controller.hashtags, id: \.name) { hashtag in
+                        Button(action: { controller.autocomplete(with: hashtag) }) {
+                            Text(verbatim: "#\(hashtag.name)")
+                                .foregroundColor(Color(uiColor: .label))
+                        }
+                        .frame(height: 30)
+                        .padding(.vertical, 8)
+                    }
+                    
+                    Spacer()
+                }
+                .padding(.horizontal, 8)
+                .animation(.linear(duration: 0.2), value: controller.hashtags)
+            }
+        }
+    }
+    
+    
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/AutocompleteMentionsController.swift

@@ -0,0 +1,179 @@
+//
+//  AutocompleteMentionsController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/25/23.
+//
+
+import SwiftUI
+import Combine
+import Pachyderm
+import TuskerComponents
+
+class AutocompleteMentionsController: ViewController {
+    
+    unowned let composeController: ComposeController
+    var mastodonController: ComposeMastodonContext { composeController.mastodonController }
+    
+    private var stateCancellable: AnyCancellable?
+    
+    @Published private var accounts: [AnyAccount] = []
+    private var searchTask: Task<Void, Never>?
+    
+    init(composeController: ComposeController) {
+        self.composeController = composeController
+        
+        stateCancellable = composeController.$currentInput
+            .compactMap { $0 }
+            .flatMap { $0.autocompleteStatePublisher }
+            .compactMap {
+                if case .mention(let s) = $0 {
+                    return s
+                } else {
+                    return nil
+                }
+            }
+            .debounce(for: .milliseconds(250), scheduler: DispatchQueue.main)
+            .sink { [unowned self] query in
+                self.searchTask?.cancel()
+                // weak in case the autocomplete controller is dealloc'd racing with the task starting
+                self.searchTask = Task { [weak self] in
+                    await self?.queryChanged(query)
+                }
+            }
+    }
+    
+    @MainActor
+    private func queryChanged(_ query: String) async {
+        guard !query.isEmpty else {
+            accounts = []
+            return
+        }
+        
+        let localSearchTask = Task {
+            // we only want to search locally if the search API call takes more than .25sec or it fails
+            try await Task.sleep(nanoseconds: 250 * NSEC_PER_MSEC)
+            
+            let results = self.mastodonController.searchCachedAccounts(query: query)
+            try Task.checkCancellation()
+            
+            if !results.isEmpty {
+                self.loadAccounts(results.map { .init(value: $0) }, query: query)
+            }
+        }
+        
+        let accounts = try? await mastodonController.run(Client.searchForAccount(query: query)).0
+        guard let accounts,
+              !Task.isCancelled else {
+            return
+        }
+        localSearchTask.cancel()
+        
+       loadAccounts(accounts.map { .init(value: $0) }, query: query)
+    }
+    
+    @MainActor
+    private func loadAccounts(_ accounts: [AnyAccount], query: String) {
+        guard case .mention(query) = composeController.currentInput?.autocompleteState else {
+            return
+        }
+        
+        // when sorting account suggestions, ignore the domain component of the acct unless the user is typing it themself
+        let ignoreDomain = !query.contains("@")
+        
+        self.accounts =
+            accounts.map { (account) -> (AnyAccount, (matched: Bool, score: Int)) in
+                let fuzzyStr = ignoreDomain ? String(account.value.acct.split(separator: "@").first!) : account.value.acct
+                let res = (account, FuzzyMatcher.match(pattern: query, str: fuzzyStr))
+                return res
+            }
+            .filter(\.1.matched)
+            .map { (account, res) -> (AnyAccount, Int) in
+                // give higher weight to accounts that the user follows or is followed by
+                var score = res.score
+                if let relationship = mastodonController.cachedRelationship(for: account.value.id) {
+                    if relationship.following {
+                        score += 3
+                    }
+                    if relationship.followedBy {
+                        score += 2
+                    }
+                }
+                return (account, score)
+            }
+            .sorted { $0.1 > $1.1 }
+            .map(\.0)
+    }
+    
+    private func autocomplete(with account: AnyAccount) {
+        guard let input = composeController.currentInput else {
+            return
+        }
+        input.autocomplete(with: "@\(account.value.acct)")
+    }
+    
+    var view: some View {
+        AutocompleteMentionsView()
+    }
+    
+    struct AutocompleteMentionsView: View {
+        @EnvironmentObject private var controller: AutocompleteMentionsController
+        
+        var body: some View {
+            ScrollView(.horizontal) {
+                HStack(spacing: 8) {
+                    ForEach(controller.accounts) { account in
+                        AutocompleteMentionButton(account: account)
+                    }
+                    
+                    Spacer()
+                }
+                .padding(.horizontal, 8)
+                .animation(.linear(duration: 0.2), value: controller.accounts)
+            }
+            .onDisappear {
+                controller.searchTask?.cancel()
+            }
+        }
+    }
+    
+    private struct AutocompleteMentionButton: View {
+        @EnvironmentObject private var composeController: ComposeController
+        @EnvironmentObject private var controller: AutocompleteMentionsController
+        let account: AnyAccount
+        
+        var body: some View {
+            Button(action: { controller.autocomplete(with: account) }) {
+                HStack(spacing: 4) {
+                    AvatarImageView(
+                        url: account.value.avatar,
+                        size: 30,
+                        style: composeController.config.avatarStyle,
+                        fetchAvatar: composeController.fetchAvatar
+                    )
+                    
+                    VStack(alignment: .leading) {
+                        controller.composeController.displayNameLabel(account.value, .subheadline, 14)
+                            .foregroundColor(.primary)
+                        
+                        Text(verbatim: "@\(account.value.acct)")
+                            .font(.caption)
+                            .foregroundColor(.primary)
+                    }
+                }
+            }
+            .frame(height: 30)
+            .padding(.vertical, 8)
+        }
+    }
+}
+
+fileprivate struct AnyAccount: Equatable, Identifiable {
+    let value: any AccountProtocol
+    
+    var id: String { value.id }
+    
+    static func ==(lhs: AnyAccount, rhs: AnyAccount) -> Bool {
+        return lhs.value.id == rhs.value.id
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/ComposeController.swift

@@ -0,0 +1,502 @@
+//
+//  ComposeController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/4/23.
+//
+
+import SwiftUI
+import Combine
+import Pachyderm
+import TuskerComponents
+import MatchedGeometryPresentation
+import CoreData
+
+public final class ComposeController: ViewController {
+    public typealias FetchAttachment = (URL) async  -> UIImage?
+    public typealias FetchStatus = (String) -> (any StatusProtocol)?
+    public typealias DisplayNameLabel = (any AccountProtocol, Font.TextStyle, CGFloat) -> AnyView
+    public typealias CurrentAccountContainerView = (AnyView) -> AnyView
+    public typealias ReplyContentView = (any StatusProtocol, @escaping (CGFloat) -> Void) -> AnyView
+    public typealias EmojiImageView = (Emoji) -> AnyView
+    
+    @Published public private(set) var draft: Draft {
+        didSet {
+            assert(draft.managedObjectContext == DraftsPersistentContainer.shared.viewContext)
+        }
+    }
+    @Published public var config: ComposeUIConfig
+    @Published public var mastodonController: ComposeMastodonContext
+    let fetchAvatar: AvatarImageView.FetchAvatar
+    let fetchAttachment: FetchAttachment
+    let fetchStatus: FetchStatus
+    let displayNameLabel: DisplayNameLabel
+    let currentAccountContainerView: CurrentAccountContainerView
+    let replyContentView: ReplyContentView
+    let emojiImageView: EmojiImageView
+    
+    @Published public var currentAccount: (any AccountProtocol)?
+    @Published public var showToolbar = true
+    @Published public var deleteDraftOnDisappear = true
+    
+    @Published var autocompleteController: AutocompleteController!
+    @Published var toolbarController: ToolbarController!
+    @Published var attachmentsListController: AttachmentsListController!
+    
+    // this property is here rather than on the AttachmentsListController so that the ComposeView
+    // updates when it changes, because changes to it may alter postButtonEnabled
+    @Published var attachmentsMissingDescriptions = Set<UUID>()
+    @Published var focusedAttachment: (DraftAttachment, AttachmentThumbnailController)?
+    let scrollToAttachment = PassthroughSubject<UUID, Never>()
+    @Published var contentWarningBecomeFirstResponder = false
+    @Published var mainComposeTextViewBecomeFirstResponder = false
+    @Published var currentInput: (any ComposeInput)? = nil
+    @Published var shouldEmojiAutocompletionBeginExpanded = false
+    @Published var isShowingSaveDraftSheet = false
+    @Published var isShowingDraftsList = false
+    @Published var poster: PostService?
+    @Published var postError: PostService.Error?
+    @Published public private(set) var didPostSuccessfully = false
+    @Published var hasChangedLanguageSelection = false
+    
+    private var isDisappearing = false
+    private var userConfirmedDelete = false
+    
+    public var isPosting: Bool {
+        poster != nil
+    }
+    
+    var charactersRemaining: Int {
+        let instanceFeatures = mastodonController.instanceFeatures
+        let limit = instanceFeatures.maxStatusChars
+        let cwCount = draft.contentWarningEnabled ? draft.contentWarning.count : 0
+        return limit - (cwCount + CharacterCounter.count(text: draft.text, for: instanceFeatures))
+    }
+    
+    var postButtonEnabled: Bool {
+        draft.editedStatusID != nil ||
+            (draft.hasContent
+                && charactersRemaining >= 0
+                && !isPosting
+                && attachmentsListController.isValid
+                && isPollValid)
+    }
+    
+    private var isPollValid: Bool {
+        draft.poll == nil || draft.poll!.pollOptions.allSatisfy { !$0.text.isEmpty }
+    }
+    
+    public var navigationTitle: String {
+        if let id = draft.inReplyToID,
+           let status = fetchStatus(id) {
+            return "Reply to @\(status.account.acct)"
+        } else if draft.editedStatusID != nil {
+            return "Edit Post"
+        } else {
+            return "New Post"
+        }
+    }
+    
+    public init(
+        draft: Draft,
+        config: ComposeUIConfig,
+        mastodonController: ComposeMastodonContext,
+        fetchAvatar: @escaping AvatarImageView.FetchAvatar,
+        fetchAttachment: @escaping FetchAttachment,
+        fetchStatus: @escaping FetchStatus,
+        displayNameLabel: @escaping DisplayNameLabel,
+        currentAccountContainerView: @escaping CurrentAccountContainerView = { $0 },
+        replyContentView: @escaping ReplyContentView,
+        emojiImageView: @escaping EmojiImageView
+    ) {
+        self.draft = draft
+        assert(draft.managedObjectContext == DraftsPersistentContainer.shared.viewContext)
+        self.config = config
+        self.mastodonController = mastodonController
+        self.fetchAvatar = fetchAvatar
+        self.fetchAttachment = fetchAttachment
+        self.fetchStatus = fetchStatus
+        self.displayNameLabel = displayNameLabel
+        self.currentAccountContainerView = currentAccountContainerView
+        self.replyContentView = replyContentView
+        self.emojiImageView = emojiImageView
+        
+        self.autocompleteController = AutocompleteController(parent: self)
+        self.toolbarController = ToolbarController(parent: self)
+        self.attachmentsListController = AttachmentsListController(parent: self)
+        
+        NotificationCenter.default.addObserver(self, selector: #selector(currentInputModeChanged), name: UITextInputMode.currentInputModeDidChangeNotification, object: nil)
+        NotificationCenter.default.addObserver(self, selector: #selector(managedObjectsDidChange), name: .NSManagedObjectContextObjectsDidChange, object: DraftsPersistentContainer.shared.viewContext)
+    }
+    
+    public var view: some View {
+        ComposeView(poster: poster)
+            .environment(\.managedObjectContext, DraftsPersistentContainer.shared.viewContext)
+            .environmentObject(draft)
+            .environmentObject(mastodonController.instanceFeatures)
+            .environment(\.composeUIConfig, config)
+    }
+    
+    @MainActor
+    @objc private func managedObjectsDidChange(_ notification: Foundation.Notification) {
+        if let deleted = notification.userInfo?[NSDeletedObjectsKey] as? Set<NSManagedObject>,
+           deleted.contains(where: { $0.objectID == self.draft.objectID }),
+           !isDisappearing {
+            self.config.dismiss(.cancel)
+        }
+    }
+    
+    public func canPaste(itemProviders: [NSItemProvider]) -> Bool {
+        guard itemProviders.allSatisfy({ $0.canLoadObject(ofClass: DraftAttachment.self) }) else {
+            return false
+        }
+        if mastodonController.instanceFeatures.mastodonAttachmentRestrictions {
+            if draft.draftAttachments.allSatisfy({ $0.type == .image }) {
+                // if providers are videos, this technically allows invalid video/image combinations
+                return itemProviders.count + draft.attachments.count <= 4
+            } else {
+                return false
+            }
+        } else {
+            return true
+        }
+    }
+    
+    public func paste(itemProviders: [NSItemProvider]) {
+        for provider in itemProviders where provider.canLoadObject(ofClass: DraftAttachment.self) {
+            provider.loadObject(ofClass: DraftAttachment.self) { object, error in
+                guard let attachment = object as? DraftAttachment else { return }
+                DispatchQueue.main.async {
+                    guard self.attachmentsListController.canAddAttachment else { return }
+                    DraftsPersistentContainer.shared.viewContext.insert(attachment)
+                    attachment.draft = self.draft
+                    self.draft.attachments.add(attachment)
+                }
+            }
+        }
+    }
+    
+    @MainActor
+    func cancel() {
+        if draft.hasContent {
+            isShowingSaveDraftSheet = true
+        } else {
+            deleteDraftOnDisappear = true
+            config.dismiss(.cancel)
+        }
+    }
+    
+    @MainActor
+    func cancel(deleteDraft: Bool) {
+        deleteDraftOnDisappear = true
+        userConfirmedDelete = deleteDraft
+        config.dismiss(.cancel)
+    }
+    
+    func postStatus() {
+        guard !isPosting,
+              draft.editedStatusID != nil || draft.hasContent else {
+            return
+        }
+        
+        Task { @MainActor in
+            let poster = PostService(mastodonController: mastodonController, config: config, draft: draft)
+            self.poster = poster
+            
+            // try to resign the first responder, if there is one.
+            // otherwise, the existence of the poster changes the .disabled modifier which causes the keyboard to hide
+            // and the first responder to change during a view update, which in turn triggers a bunch of state changes
+            UIApplication.shared.sendAction(#selector(UIResponder.resignFirstResponder), to: nil, from: nil, for: nil)
+            
+            do {
+                try await poster.post()
+                
+                deleteDraftOnDisappear = true
+                didPostSuccessfully = true
+                
+                // wait .25 seconds so the user can see the progress bar has completed
+                try? await Task.sleep(nanoseconds: 250_000_000)
+                
+                // don't unset the poster, so the ui remains disabled while dismissing
+                
+                config.dismiss(.post)
+                
+            } catch let error as PostService.Error {
+                self.postError = error
+                self.poster = nil
+            } catch {
+                fatalError("unreachable")
+            }
+        }
+    }
+    
+    func showDrafts() {
+        isShowingDraftsList = true
+    }
+    
+    func selectDraft(_ newDraft: Draft) {
+        let oldDraft = self.draft
+        self.draft = newDraft
+        
+        if !oldDraft.hasContent {
+            DraftsPersistentContainer.shared.viewContext.delete(oldDraft)
+        }
+        DraftsPersistentContainer.shared.save()
+    }
+    
+    func onDisappear() {
+        isDisappearing = true
+        if deleteDraftOnDisappear && (!draft.hasContent || didPostSuccessfully || userConfirmedDelete) {
+            DraftsPersistentContainer.shared.viewContext.delete(draft)
+        }
+        DraftsPersistentContainer.shared.save()
+    }
+    
+    func toggleContentWarning() {
+        draft.contentWarningEnabled.toggle()
+        if draft.contentWarningEnabled {
+            contentWarningBecomeFirstResponder = true
+        }
+    }
+    
+    @available(iOS 16.0, *)
+    @objc private func currentInputModeChanged() {
+        guard let mode = currentInput?.textInputMode,
+              let code = LanguagePicker.codeFromInputMode(mode),
+              !hasChangedLanguageSelection && !draft.hasContent else {
+            return
+        }
+        draft.language = code.identifier
+    }
+    
+    struct ComposeView: View {
+        @OptionalObservedObject var poster: PostService?
+        @EnvironmentObject var controller: ComposeController
+        @EnvironmentObject var draft: Draft
+        #if !os(visionOS)
+        @StateObject private var keyboardReader = KeyboardReader()
+        #endif
+        @State private var globalFrameOutsideList = CGRect.zero
+        
+        init(poster: PostService?) {
+            self.poster = poster
+        }
+        
+        var config: ComposeUIConfig {
+            controller.config
+        }
+        
+        var body: some View {
+            NavigationView {
+                navRoot
+            }
+            .navigationViewStyle(.stack)
+        }
+        
+        private var navRoot: some View {
+            ZStack(alignment: .top) {
+                // just using .background doesn't work; for some reason it gets inset immediately after the software keyboard is dismissed
+                config.backgroundColor
+                    .edgesIgnoringSafeArea(.all)
+                
+                ScrollViewReader { proxy in
+                    mainList
+                        .onReceive(controller.scrollToAttachment) { id in
+                            proxy.scrollTo(id, anchor: .center)
+                        }
+                }
+                
+                if let poster = poster {
+                    // can't use SwiftUI.ProgressView because there's no UIProgressView.Style.bar equivalent, see FB8587149
+                    WrappedProgressView(value: poster.currentStep, total: poster.totalSteps)
+                }
+            }
+            .safeAreaInset(edge: .bottom, spacing: 0) {
+                if controller.showToolbar {
+                    VStack(spacing: 0) {
+                        ControllerView(controller: { controller.autocompleteController })
+                            .transition(.move(edge: .bottom))
+                            .animation(.default, value: controller.currentInput?.autocompleteState)
+                        
+                        #if !os(visionOS)
+                        ControllerView(controller: { controller.toolbarController })
+                        #endif
+                    }
+                    .transition(.move(edge: .bottom))
+                }
+            }
+            .toolbar {
+                ToolbarItem(placement: .cancellationAction) { cancelButton }
+                #if targetEnvironment(macCatalyst)
+                ToolbarItem(placement: .topBarTrailing) { draftsButton }
+                ToolbarItem(placement: .confirmationAction) { postButton }
+                #else
+                ToolbarItem(placement: .confirmationAction) { postOrDraftsButton }
+                #endif
+                #if os(visionOS)
+                ToolbarItem(placement: .bottomOrnament) {
+                    ControllerView(controller: { controller.toolbarController })
+                }
+                #endif
+            }
+            .background(GeometryReader { proxy in
+                Color.clear
+                    .preference(key: GlobalFrameOutsideListPrefKey.self, value: proxy.frame(in: .global))
+                    .onPreferenceChange(GlobalFrameOutsideListPrefKey.self) { newValue in
+                        globalFrameOutsideList = newValue
+                    }
+            })
+            .sheet(isPresented: $controller.isShowingDraftsList) {
+                ControllerView(controller: { DraftsController(parent: controller, isPresented: $controller.isShowingDraftsList) })
+            }
+            .alertWithData("Error Posting", data: $controller.postError, actions: { _ in
+                Button("OK") {}
+            }, message: { error in
+                Text(error.localizedDescription)
+            })
+            .matchedGeometryPresentation(id: Binding(get: { () -> UUID?? in
+                let id = controller.focusedAttachment?.0.id
+                // this needs to be a double optional, since the type used for for the presentationID in the geom source is a UUID?
+                return id.map { Optional.some($0) }
+            }, set: {
+                if $0 == nil {
+                    controller.focusedAttachment = nil
+                } else {
+                    fatalError()
+                }
+            }), backgroundColor: .black) {
+                ControllerView(controller: {
+                    FocusedAttachmentController(
+                        parent: controller,
+                        attachment: controller.focusedAttachment!.0,
+                        thumbnailController: controller.focusedAttachment!.1
+                    )
+                })
+            }
+            .onDisappear(perform: controller.onDisappear)
+            .navigationTitle(controller.navigationTitle)
+            .navigationBarTitleDisplayMode(.inline)
+        }
+        
+        private var mainList: some View {
+            List {
+                if let id = draft.inReplyToID,
+                   let status = controller.fetchStatus(id) {
+                    ReplyStatusView(
+                        status: status,
+                        rowTopInset: 8,
+                        globalFrameOutsideList: globalFrameOutsideList
+                    )
+                    // i don't know why swiftui can't infer this from the status that's passed into the ReplyStatusView changing
+                    .id(id)
+                    .listRowInsets(EdgeInsets(top: 8, leading: 8, bottom: 4, trailing: 8))
+                    .listRowSeparator(.hidden)
+                    .listRowBackground(config.backgroundColor)
+                }
+                
+                HeaderView(currentAccount: controller.currentAccount, charsRemaining: controller.charactersRemaining)
+                    .listRowInsets(EdgeInsets(top: draft.inReplyToID == nil ? 8 : 4, leading: 8, bottom: 4, trailing: 8))
+                    .listRowSeparator(.hidden)
+                    .listRowBackground(config.backgroundColor)
+                
+                if draft.contentWarningEnabled {
+                    EmojiTextField(
+                        text: $draft.contentWarning,
+                        placeholder: "Write your warning here",
+                        maxLength: nil,
+                        becomeFirstResponder: $controller.contentWarningBecomeFirstResponder,
+                        focusNextView: $controller.mainComposeTextViewBecomeFirstResponder
+                    )
+                        .listRowInsets(EdgeInsets(top: 4, leading: 8, bottom: 4, trailing: 8))
+                        .listRowSeparator(.hidden)
+                        .listRowBackground(config.backgroundColor)
+                }
+                
+                MainTextView()
+                    .listRowInsets(EdgeInsets(top: 4, leading: 8, bottom: 4, trailing: 8))
+                    .listRowSeparator(.hidden)
+                    .listRowBackground(config.backgroundColor)
+                
+                if let poll = draft.poll {
+                    ControllerView(controller: { PollController(parent: controller, poll: poll) })
+                        .listRowInsets(EdgeInsets(top: 4, leading: 8, bottom: 8, trailing: 8))
+                        .listRowSeparator(.hidden)
+                        .listRowBackground(config.backgroundColor)
+                }
+                
+                ControllerView(controller: { controller.attachmentsListController })
+                    .listRowInsets(EdgeInsets(top: 4, leading: 8, bottom: 8, trailing: 8))
+                    .listRowBackground(config.backgroundColor)
+            }
+            .listStyle(.plain)
+            #if !os(visionOS)
+            .scrollDismissesKeyboard(.interactively)
+            #endif
+            .disabled(controller.isPosting)
+        }
+        
+        private var cancelButton: some View {
+            Button(action: controller.cancel) {
+                Text("Cancel")
+                    // otherwise all Buttons in the nav bar are made semibold
+                    .font(.system(size: 17, weight: .regular))
+            }
+            .disabled(controller.isPosting)
+            .confirmationDialog("Are you sure?", isPresented: $controller.isShowingSaveDraftSheet) {
+                // edit drafts can't be saved
+                if draft.editedStatusID == nil {
+                    Button(action: { controller.cancel(deleteDraft: false) }) {
+                        Text("Save Draft")
+                    }
+                    Button(role: .destructive, action: { controller.cancel(deleteDraft: true) }) {
+                        Text("Delete Draft")
+                    }
+                } else {
+                    Button(role: .destructive, action: { controller.cancel(deleteDraft: true) }) {
+                        Text("Cancel Edit")
+                    }
+                }
+            }
+        }
+        
+        @ViewBuilder
+        private var postOrDraftsButton: some View {
+            if draft.hasContent || draft.editedStatusID != nil || !controller.config.allowSwitchingDrafts {
+                postButton
+            } else {
+                draftsButton
+            }
+        }
+        
+        private var draftsButton: some View {
+            Button(action: controller.showDrafts) {
+                Text("Drafts")
+            }
+        }
+        
+        private var postButton: some View {
+            Button(action: controller.postStatus) {
+                Text(draft.editedStatusID == nil ? "Post" : "Edit")
+            }
+            .keyboardShortcut(.return, modifiers: .command)
+            .disabled(!controller.postButtonEnabled)
+        }
+    }
+}
+
+private struct GlobalFrameOutsideListPrefKey: PreferenceKey {
+    static var defaultValue: CGRect = .zero
+    static func reduce(value: inout CGRect, nextValue: () -> CGRect) {
+        value = nextValue()
+    }
+}
+
+private struct ComposeUIConfigEnvironmentKey: EnvironmentKey {
+    static let defaultValue = ComposeUIConfig()
+}
+extension EnvironmentValues {
+    var composeUIConfig: ComposeUIConfig {
+        get { self[ComposeUIConfigEnvironmentKey.self] }
+        set { self[ComposeUIConfigEnvironmentKey.self] = newValue }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/DraftsController.swift

@@ -0,0 +1,174 @@
+//
+//  DraftsController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/7/23.
+//
+
+import SwiftUI
+import TuskerComponents
+import CoreData
+
+class DraftsController: ViewController {
+    
+    unowned let parent: ComposeController
+    @Binding var isPresented: Bool
+    
+    @Published var draftForDifferentReply: Draft?
+    
+    init(parent: ComposeController, isPresented: Binding<Bool>) {
+        self.parent = parent
+        self._isPresented = isPresented
+    }
+    
+    var view: some View {
+        DraftsRepresentable()
+    }
+    
+    func maybeSelectDraft(_ draft: Draft) {
+        if draft.inReplyToID != parent.draft.inReplyToID,
+           parent.draft.hasContent {
+            draftForDifferentReply = draft
+        } else {
+            confirmSelectDraft(draft)
+        }
+    }
+    
+    func cancelSelectingDraft() {
+        draftForDifferentReply = nil
+    }
+    
+    func confirmSelectDraft(_ draft: Draft) {
+        parent.selectDraft(draft)
+        closeDrafts()
+    }
+    
+    func deleteDraft(_ draft: Draft) {
+        DraftsPersistentContainer.shared.viewContext.delete(draft)
+    }
+    
+    func closeDrafts() {
+        isPresented = false
+        DraftsPersistentContainer.shared.save()
+    }
+    
+    struct DraftsRepresentable: UIViewControllerRepresentable {
+        typealias UIViewControllerType = UIHostingController<DraftsView>
+        
+        func makeUIViewController(context: Context) -> UIHostingController<DraftsController.DraftsView> {
+            return UIHostingController(rootView: DraftsView())
+        }
+        
+        func updateUIViewController(_ uiViewController: UIHostingController<DraftsController.DraftsView>, context: Context) {
+        }
+    }
+    
+    struct DraftsView: View {
+        @EnvironmentObject private var controller: DraftsController
+        @EnvironmentObject private var currentDraft: Draft
+        @FetchRequest(sortDescriptors: [SortDescriptor(\Draft.lastModified, order: .reverse)]) private var drafts: FetchedResults<Draft>
+        
+        var body: some View {
+            NavigationView {
+                List {
+                    ForEach(drafts) { draft in
+                        Button(action: { controller.maybeSelectDraft(draft) }) {
+                            DraftRow(draft: draft)
+                        }
+                        .contextMenu {
+                            Button(role: .destructive, action: { controller.deleteDraft(draft) }) {
+                                Label("Delete Draft", systemImage: "trash")
+                            }
+                        }
+                        .ifLet(controller.parent.config.userActivityForDraft(draft), modify: { view, activity in
+                            view.onDrag { activity }
+                        })
+                    }
+                    .onDelete { indices in
+                        indices.map { drafts[$0] }.forEach(controller.deleteDraft)
+                    }
+                }
+                .listStyle(.plain)
+                .navigationTitle("Drafts")
+                .navigationBarTitleDisplayMode(.inline)
+                .toolbar {
+                    ToolbarItem(placement: .cancellationAction) { cancelButton }
+                }
+            }
+            .alertWithData("Different Reply", data: $controller.draftForDifferentReply) { draft in
+                Button(role: .cancel, action: controller.cancelSelectingDraft) {
+                    Text("Cancel")
+                }
+                Button(action: { controller.confirmSelectDraft(draft) }) {
+                    Text("Restore Draft")
+                }
+            } message: { _ in
+                Text("The selected draft is a reply to a different post, do you wish to use it?")
+            }
+            .onAppear {
+                drafts.nsPredicate = NSPredicate(format: "accountID == %@ AND id != %@ AND lastModified != nil", controller.parent.mastodonController.accountInfo!.id, currentDraft.id as NSUUID)
+            }
+        }
+        
+        private var cancelButton: some View {
+            Button(action: controller.closeDrafts) {
+                Text("Cancel")
+            }
+        }
+    }
+}
+
+private struct DraftRow: View {
+    @ObservedObject var draft: Draft
+    @EnvironmentObject private var controller: DraftsController
+    
+    var body: some View {
+        HStack {
+            VStack(alignment: .leading) {
+                if draft.editedStatusID != nil {
+                    // shouldn't happen unless the app crashed/was killed during an edit
+                    Text("Edit")
+                        .font(.body.bold())
+                        .foregroundColor(.orange)
+                }
+                
+                if draft.contentWarningEnabled {
+                    Text(draft.contentWarning)
+                        .font(.body.bold())
+                        .foregroundColor(.secondary)
+                }
+                
+                Text(draft.text)
+                    .font(.body)
+                
+                HStack(spacing: 8) {
+                    ForEach(draft.draftAttachments) { attachment in
+                        ControllerView(controller: { AttachmentThumbnailController(attachment: attachment, parent: controller.parent) })
+                            .aspectRatio(contentMode: .fit)
+                            .clipShape(RoundedRectangle(cornerRadius: 5))
+                            .frame(height: 50)
+                    }
+                }
+            }
+            
+            Spacer()
+            
+            if let lastModified = draft.lastModified {
+                Text(lastModified.formatted(.abbreviatedTimeAgo))
+                    .font(.body)
+                    .foregroundColor(.secondary)
+            }
+        }
+    }
+}
+
+private extension View {
+    @ViewBuilder
+    func ifLet<T, V: View>(_ value: T?, modify: (Self, T) -> V) -> some View {
+        if let value {
+            modify(self, value)
+        } else {
+            self
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/FocusedAttachmentController.swift

@@ -0,0 +1,119 @@
+//
+//  FocusedAttachmentController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/29/23.
+//
+
+import SwiftUI
+import MatchedGeometryPresentation
+import AVKit
+
+class FocusedAttachmentController: ViewController {
+    
+    unowned let parent: ComposeController
+    let attachment: DraftAttachment
+    let thumbnailController: AttachmentThumbnailController
+    private let player: AVPlayer?
+    
+    init(parent: ComposeController, attachment: DraftAttachment, thumbnailController: AttachmentThumbnailController) {
+        self.parent = parent
+        self.attachment = attachment
+        self.thumbnailController = thumbnailController
+        
+        if case let .file(url, type) = attachment.data,
+           type.conforms(to: .movie) {
+            self.player = AVPlayer(url: url)
+            self.player!.isMuted = true
+        } else {
+            self.player = nil
+        }
+    }
+    
+    var view: some View {
+        FocusedAttachmentView(attachment: attachment)
+    }
+    
+    struct FocusedAttachmentView: View {
+        @ObservedObject var attachment: DraftAttachment
+        @EnvironmentObject private var controller: FocusedAttachmentController
+        @Environment(\.dismiss) private var dismiss
+        @FocusState private var textEditorFocused: Bool
+        @EnvironmentObject private var matchedGeomState: MatchedGeometryState
+        
+        var body: some View {
+            VStack(spacing: 0) {
+                Spacer(minLength: 0)
+                
+                if let player = controller.player {
+                    VideoPlayer(player: player)
+                        .matchedGeometryDestination(id: attachment.id)
+                        .onAppear {
+                            player.play()
+                        }
+                } else {
+                    ZoomableScrollView {
+                        attachmentView
+                            .matchedGeometryDestination(id: attachment.id)
+                    }
+                }
+                
+                Spacer(minLength: 0)
+                
+                FocusedAttachmentDescriptionView(attachment: attachment)
+                    .environment(\.colorScheme, .dark)
+                    .matchedGeometryDestination(id: AttachmentDescriptionTextViewID(attachment))
+                    .frame(height: 150)
+                    .focused($textEditorFocused)
+            }
+            .background(.black)
+            .overlay(alignment: .topLeading, content: {
+                Button {
+                    // set the mode to dismissing immediately, so that layout changes due to the keyboard hiding
+                    // (which happens before the dismiss animation controller starts running) don't alter the destination frames
+                    if textEditorFocused {
+                        matchedGeomState.mode = .dismissing
+                    }
+                    dismiss()
+                } label: {
+                    Image(systemName: "arrow.down.forward.and.arrow.up.backward")
+                }
+                .buttonStyle(DismissFocusedAttachmentButtonStyle())
+                .padding([.top, .leading], 4)
+            })
+        }
+        
+        private var attachmentView: some View {
+            ControllerView(controller: { controller.thumbnailController })
+                .environment(\.attachmentThumbnailConfiguration, .init(contentMode: .fit, fullSize: true))
+        }
+    }
+}
+
+private struct DismissFocusedAttachmentButtonStyle: ButtonStyle {
+    func makeBody(configuration: Configuration) -> some View {
+        ZStack {
+            RoundedRectangle(cornerRadius: 4)
+                .fill(.black.opacity(0.5))
+            
+            configuration.label
+                .foregroundColor(.white)
+                .imageScale(.large)
+        }
+        .frame(width: 40, height: 40)
+    }
+}
+
+struct AttachmentDescriptionTextViewID: Hashable {
+    let attachmentID: UUID!
+    
+    init(_ attachment: DraftAttachment) {
+        self.attachmentID = attachment.id
+    }
+    
+    func hash(into hasher: inout Hasher) {
+        hasher.combine(attachmentID)
+        hasher.combine("descriptionTextView")
+    }
+}
+

Packages/ComposeUI/Sources/ComposeUI/Controllers/PlaceholderController.swift

@@ -0,0 +1,48 @@
+//
+//  PlaceholderController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/6/23.
+//
+
+import SwiftUI
+
+final class PlaceholderController: ViewController, PlaceholderViewProvider {
+    
+    private let placeholderView: PlaceholderView = PlaceholderController.makePlaceholderView()
+        
+    static func makePlaceholderView() -> some View {
+        let components = Calendar.current.dateComponents([.month, .day], from: Date())
+        if components.month == 3 && components.day == 14,
+           Date().formatted(date: .numeric, time: .omitted).starts(with: "3") {
+            Text("Happy π day!")
+        } else if components.month == 4 && components.day == 1 {
+            Text("April Fool's!").rotationEffect(.radians(.pi), anchor: .center)
+        } else if components.month == 9 && components.day == 5 {
+            // https://weirder.earth/@noracodes/109276419847254552
+            // https://retrocomputing.stackexchange.com/questions/14763/what-warning-was-given-on-attempting-to-post-to-usenet-circa-1990
+            Text("This program posts news to thousands of machines throughout the entire populated world. Please be sure you know what you are doing.").italic()
+        } else if components.month == 9 && components.day == 21 {
+            Text("Do you remember?")
+        } else if components.month == 10 && components.day == 31 {
+            if .random() {
+                Text("Post something spooky!")
+            } else {
+                Text("Any questions?")
+            }
+        } else {
+            Text("What's on your mind?")
+        }
+    }
+    
+    var view: some View {
+        placeholderView
+    }
+}
+
+// exists to provide access to the type alias since the @State property needs it to be explicit
+private protocol PlaceholderViewProvider {
+    associatedtype PlaceholderView: View
+    @ViewBuilder
+    static func makePlaceholderView() -> PlaceholderView
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/PollController.swift

@@ -0,0 +1,195 @@
+//
+//  PollController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/25/23.
+//
+
+import SwiftUI
+import TuskerComponents
+
+class PollController: ViewController {
+    
+    unowned let parent: ComposeController
+    var draft: Draft { parent.draft }
+    let poll: Poll
+    
+    @Published var duration: Duration
+    
+    init(parent: ComposeController, poll: Poll) {
+        self.parent = parent
+        self.poll = poll
+        self.duration = .fromTimeInterval(poll.duration) ?? .oneDay
+    }
+    
+    var view: some View {
+        PollView()
+            .environmentObject(poll)
+    }
+    
+    private func removePoll() {
+        withAnimation {
+            draft.poll = nil
+        }
+    }
+    
+    private func moveOptions(indices: IndexSet, newIndex: Int) {
+        // see AttachmentsListController.moveAttachments
+        var array = poll.pollOptions
+        array.move(fromOffsets: indices, toOffset: newIndex)
+        poll.options = NSMutableOrderedSet(array: array)
+    }
+    
+    private func removeOption(_ option: PollOption) {
+        var array = poll.pollOptions
+        array.remove(at: poll.options.index(of: option))
+        poll.options = NSMutableOrderedSet(array: array)
+    }
+    
+    private var canAddOption: Bool {
+        if let max = parent.mastodonController.instanceFeatures.maxPollOptionsCount {
+            return poll.options.count < max
+        } else {
+            return true
+        }
+    }
+    
+    private func addOption() {
+        let option = PollOption(context: DraftsPersistentContainer.shared.viewContext)
+        option.poll = poll
+        poll.options.add(option)
+    }
+    
+    struct PollView: View {
+        @EnvironmentObject private var controller: PollController
+        @EnvironmentObject private var poll: Poll
+        @Environment(\.colorScheme) private var colorScheme
+        
+        var body: some View {
+            VStack {
+                HStack {
+                    Text("Poll")
+                        .font(.headline)
+                    
+                    Spacer()
+                    
+                    Button(action: controller.removePoll) {
+                        Image(systemName: "xmark")
+                            .imageScale(.small)
+                            .padding(4)
+                    }
+                    .accessibilityLabel("Remove poll")
+                    .buttonStyle(.plain)
+                    .accentColor(buttonForegroundColor)
+                    .background(Circle().foregroundColor(buttonBackgroundColor))
+                    .hoverEffect()
+                }
+                
+                List {
+                    ForEach($poll.pollOptions) { $option in
+                        PollOptionView(option: option, remove: { controller.removeOption(option) })
+                            .frame(height: 36)
+                            .listRowInsets(EdgeInsets(top: 4, leading: 0, bottom: 4, trailing: 0))
+                            .listRowSeparator(.hidden)
+                            .listRowBackground(Color.clear)
+                    }
+                    .onMove(perform: controller.moveOptions)
+                }
+                .listStyle(.plain)
+                .scrollDisabled(true)
+                .frame(height: 44 * CGFloat(poll.options.count))
+                
+                Button(action: controller.addOption) {
+                    Label {
+                        Text("Add Option")
+                    } icon: {
+                        Image(systemName: "plus")
+                            .foregroundColor(.accentColor)
+                    }
+                }
+                .buttonStyle(.borderless)
+                .disabled(!controller.canAddOption)
+                
+                HStack {
+                    MenuPicker(selection: $poll.multiple, options: [
+                        .init(value: true, title: "Allow multiple"),
+                        .init(value: false, title: "Single choice"),
+                    ])
+                    .frame(maxWidth: .infinity)
+                    
+                    MenuPicker(selection: $controller.duration, options: Duration.allCases.map {
+                        .init(value: $0, title: Duration.formatter.string(from: $0.timeInterval)!)
+                    })
+                    .frame(maxWidth: .infinity)
+                }
+            }
+            .padding(8)
+            .background(
+                RoundedRectangle(cornerRadius: 10, style: .continuous)
+                    .foregroundColor(backgroundColor)
+            )
+            #if os(visionOS)
+            .onChange(of: controller.duration) {
+                poll.duration = controller.duration.timeInterval
+            }
+            #else
+            .onChange(of: controller.duration) { newValue in
+                poll.duration = newValue.timeInterval
+            }
+            #endif
+        }
+        
+        private var backgroundColor: Color {
+            // in light mode, .secondarySystemBackground has a blue-ish hue, which we don't want
+            colorScheme == .dark ? controller.parent.config.fillColor : Color(white: 0.95)
+        }
+        
+        private var buttonForegroundColor: Color {
+            Color(uiColor: .label)
+        }
+        
+        private var buttonBackgroundColor: Color {
+            Color(white: colorScheme == .dark ? 0.1 : 0.8)
+        }
+    }
+}
+
+extension PollController {
+    enum Duration: Hashable, Equatable, CaseIterable {
+        case fiveMinutes, thirtyMinutes, oneHour, sixHours, oneDay, threeDays, sevenDays
+        
+        static let formatter: DateComponentsFormatter = {
+            let f = DateComponentsFormatter()
+            f.maximumUnitCount = 1
+            f.unitsStyle = .full
+            f.allowedUnits = [.weekOfMonth, .day, .hour, .minute]
+            return f
+        }()
+        
+        static func fromTimeInterval(_ ti: TimeInterval) -> Duration? {
+            for it in allCases where it.timeInterval == ti {
+                return it
+            }
+            return nil
+        }
+        
+        var timeInterval: TimeInterval {
+            switch self {
+            case .fiveMinutes:
+                return 5 * 60
+            case .thirtyMinutes:
+                return 30 * 60
+            case .oneHour:
+                return 60 * 60
+            case .sixHours:
+                return 6 * 60 * 60
+            case .oneDay:
+                return 24 * 60 * 60
+            case .threeDays:
+                return 3 * 24 * 60 * 60
+            case .sevenDays:
+                return 7 * 24 * 60 * 60
+            }
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Controllers/ToolbarController.swift

@@ -0,0 +1,200 @@
+//
+//  ToolbarController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/7/23.
+//
+
+import SwiftUI
+import Pachyderm
+import TuskerComponents
+
+class ToolbarController: ViewController {
+    static let height: CGFloat = 44
+    
+    unowned let parent: ComposeController
+    
+    @Published var minWidth: CGFloat?
+    @Published var realWidth: CGFloat?
+    
+    init(parent: ComposeController) {
+        self.parent = parent
+    }
+    
+    var view: some View {
+        ToolbarView()
+    }
+    
+    func showEmojiPicker() {
+        guard parent.currentInput?.autocompleteState == nil else {
+            return
+        }
+        parent.shouldEmojiAutocompletionBeginExpanded = true
+        parent.currentInput?.beginAutocompletingEmoji()
+    }
+    
+    func formatAction(_ format: StatusFormat) -> () -> Void {
+        { [weak self] in
+            self?.parent.currentInput?.applyFormat(format)
+        }
+    }
+    
+    struct ToolbarView: View {
+        @EnvironmentObject private var draft: Draft
+        @EnvironmentObject private var controller: ToolbarController
+        @EnvironmentObject private var composeController: ComposeController
+        @ScaledMetric(relativeTo: .body) private var imageSize: CGFloat = 22
+        
+        #if !os(visionOS)
+        @State private var minWidth: CGFloat?
+        @State private var realWidth: CGFloat?
+        #endif
+        
+        var body: some View {
+            #if os(visionOS)
+            buttons
+            #else
+            ScrollView(.horizontal, showsIndicators: false) {
+                buttons
+                    .padding(.horizontal, 16)
+                    .frame(minWidth: minWidth)
+                    .background(GeometryReader { proxy in
+                        Color.clear
+                            .preference(key: ToolbarWidthPrefKey.self, value: proxy.size.width)
+                            .onPreferenceChange(ToolbarWidthPrefKey.self) { width in
+                                realWidth = width
+                            }
+                    })
+            }
+            .scrollDisabled(realWidth ?? 0 <= minWidth ?? 0)
+            .frame(height: ToolbarController.height)
+            .frame(maxWidth: .infinity)
+            .background(.regularMaterial, ignoresSafeAreaEdges: [.bottom, .leading, .trailing])
+            .overlay(alignment: .top) {
+                Divider()
+                    .edgesIgnoringSafeArea([.leading, .trailing])
+            }
+            .background(GeometryReader { proxy in
+                Color.clear
+                    .preference(key: ToolbarWidthPrefKey.self, value: proxy.size.width)
+                    .onPreferenceChange(ToolbarWidthPrefKey.self) { width in
+                        minWidth = width
+                    }
+            })
+            #endif
+        }
+        
+        @ViewBuilder
+        private var buttons: some View {
+            HStack(spacing: 0) {
+                cwButton
+                
+                MenuPicker(selection: visibilityBinding, options: visibilityOptions, buttonStyle: .iconOnly)
+                    #if !targetEnvironment(macCatalyst) && !os(visionOS)
+                    // the button has a bunch of extra space by default, but combined with what we add it's too much
+                    .padding(.horizontal, -8)
+                    #endif
+                    .disabled(draft.editedStatusID != nil)
+                    .disabled(composeController.mastodonController.instanceFeatures.localOnlyPostsVisibility && draft.localOnly)
+                
+                if composeController.mastodonController.instanceFeatures.localOnlyPosts {
+                    localOnlyPicker
+                        #if targetEnvironment(macCatalyst)
+                        .padding(.leading, 4)
+                        #elseif !os(visionOS)
+                        .padding(.horizontal, -8)
+                        #endif
+                        .disabled(draft.editedStatusID != nil)
+                }
+                
+                if let currentInput = composeController.currentInput,
+                   currentInput.toolbarElements.contains(.emojiPicker) {
+                    customEmojiButton
+                }
+                
+                if let currentInput = composeController.currentInput,
+                   currentInput.toolbarElements.contains(.formattingButtons),
+                   composeController.config.contentType != .plain {
+                    
+                    Spacer()
+                    formatButtons
+                }
+                
+                Spacer()
+                
+                if composeController.mastodonController.instanceFeatures.createStatusWithLanguage {
+                    LanguagePicker(draftLanguage: $draft.language, hasChangedSelection: $composeController.hasChangedLanguageSelection)
+                }
+            }
+        }
+        
+        private var cwButton: some View {
+            Button("CW", action: controller.parent.toggleContentWarning)
+                .accessibilityLabel(draft.contentWarningEnabled ? "Remove content warning" : "Add content warning")
+                .padding(5)
+                .hoverEffect()
+        }
+        
+        private var visibilityBinding: Binding<Pachyderm.Visibility> {
+            // On instances that conflate visibliity and local only, we still show two separate controls but don't allow
+            // changing the visibility when local-only.
+            if draft.localOnly,
+               composeController.mastodonController.instanceFeatures.localOnlyPostsVisibility {
+                return .constant(.public)
+            } else {
+                return $draft.visibility
+            }
+        }
+        
+        private var visibilityOptions: [MenuPicker<Pachyderm.Visibility>.Option] {
+            let visibilities: [Pachyderm.Visibility]
+            if !composeController.mastodonController.instanceFeatures.composeDirectStatuses {
+                visibilities = [.public, .unlisted, .private]
+            } else {
+                visibilities = Pachyderm.Visibility.allCases
+            }
+            return visibilities.map { vis in
+                    .init(value: vis, title: vis.displayName, subtitle: vis.subtitle, image: UIImage(systemName: vis.unfilledImageName), accessibilityLabel: "Visibility: \(vis.displayName)")
+            }
+        }
+        
+        private var localOnlyPicker: some View {
+            let domain = composeController.mastodonController.accountInfo!.instanceURL.host!
+            return MenuPicker(selection: $draft.localOnly, options: [
+                .init(value: true, title: "Local-only", subtitle: "Only \(domain)", image: UIImage(named: "link.broken")),
+                .init(value: false, title: "Federated", image: UIImage(systemName: "link")),
+            ], buttonStyle: .iconOnly)
+        }
+        
+        private var customEmojiButton: some View {
+            Button(action: controller.showEmojiPicker) {
+                Label("Insert custom emoji", systemImage: "face.smiling")
+            }
+            .labelStyle(.iconOnly)
+            .font(.system(size: imageSize))
+            .padding(5)
+            .hoverEffect()
+            .transition(.opacity.animation(.linear(duration: 0.2)))
+        }
+        
+        private var formatButtons: some View {
+            ForEach(StatusFormat.allCases, id: \.rawValue) { format in
+                Button(action: controller.formatAction(format)) {
+                    Image(systemName: format.imageName)
+                        .font(.system(size: imageSize))
+                }
+                .accessibilityLabel(format.accessibilityLabel)
+                .padding(5)
+                .hoverEffect()
+                .transition(.opacity.animation(.linear(duration: 0.2)))
+            }
+        }
+    }
+}
+
+private struct ToolbarWidthPrefKey: PreferenceKey {
+    static var defaultValue: CGFloat? = nil
+    static func reduce(value: inout CGFloat?, nextValue: () -> CGFloat?) {
+        value = nextValue()
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/CoreData/Draft.swift

@@ -0,0 +1,73 @@
+//
+//  Draft.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/22/23.
+//
+
+import CoreData
+import Pachyderm
+
+@objc
+public class Draft: NSManagedObject, Identifiable {
+    @nonobjc public class func fetchRequest() -> NSFetchRequest<Draft> {
+        return NSFetchRequest<Draft>(entityName: "Draft")
+    }
+    
+    @nonobjc public class func fetchRequest(id: UUID) -> NSFetchRequest<Draft> {
+        let req = NSFetchRequest<Draft>(entityName: "Draft")
+        req.predicate = NSPredicate(format: "id = %@", id as NSUUID)
+        return req
+    }
+    
+    @NSManaged public var accountID: String
+    @NSManaged public var contentWarning: String
+    @NSManaged public var contentWarningEnabled: Bool
+    @NSManaged public var editedStatusID: String?
+    @NSManaged public var id: UUID
+    @NSManaged public var initialContentWarning: String?
+    @NSManaged public var initialText: String
+    @NSManaged public var inReplyToID: String?
+    @NSManaged public var language: String? // ISO 639 language code
+    @NSManaged public var lastModified: Date!
+    @NSManaged public var localOnly: Bool
+    @NSManaged public var text: String
+    @NSManaged private var visibilityStr: String
+    
+    @NSManaged internal var attachments: NSMutableOrderedSet
+    @NSManaged public var poll: Poll?
+    
+    public var visibility: Visibility {
+        get {
+            Visibility(rawValue: visibilityStr) ?? .public
+        }
+        set {
+            visibilityStr = newValue.rawValue
+        }
+    }
+    
+    public var draftAttachments: [DraftAttachment] {
+        get {
+            attachments.array as! [DraftAttachment]
+        }
+        set {
+            attachments = NSMutableOrderedSet(array: newValue)
+        }
+    }
+    
+    public override func awakeFromInsert() {
+        super.awakeFromInsert()
+        id = UUID()
+        lastModified = Date()
+    }
+    
+}
+
+extension Draft {
+    public var hasContent: Bool {
+        (!text.isEmpty && text != initialText) ||
+            (contentWarningEnabled && !contentWarning.isEmpty && contentWarning != initialContentWarning) ||
+            attachments.count > 0 ||
+            poll?.hasContent == true
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/CoreData/DraftAttachment.swift

@@ -0,0 +1,341 @@
+//
+//  DraftAttachment.swift
+//  CoreData
+//
+//  Created by Shadowfacts on 4/22/23.
+//
+
+import CoreData
+import PencilKit
+import UniformTypeIdentifiers
+import Photos
+import InstanceFeatures
+import Pachyderm
+
+private let decoder = PropertyListDecoder()
+private let encoder = PropertyListEncoder()
+
+@objc
+public final class DraftAttachment: NSManagedObject, Identifiable {
+    
+    @nonobjc public class func fetchRequest() -> NSFetchRequest<DraftAttachment> {
+        return NSFetchRequest<DraftAttachment>(entityName: "DraftAttachment")
+    }
+    
+    @NSManaged internal var assetID: String?
+    @NSManaged public var attachmentDescription: String
+    @NSManaged internal private(set) var drawingData: Data?
+    @NSManaged public var editedAttachmentID: String?
+    @NSManaged private var editedAttachmentKindString: String?
+    @NSManaged public var editedAttachmentURL: URL?
+    @NSManaged public var fileURL: URL?
+    @NSManaged internal var fileType: String?
+    @NSManaged public var id: UUID!
+    
+    @NSManaged internal var draft: Draft
+    
+    public var drawing: PKDrawing? {
+        get {
+            if let drawingData,
+               let drawing = try? decoder.decode(PKDrawing.self, from: drawingData) {
+                return drawing
+            } else {
+                return nil
+            }
+        }
+        set {
+            drawingData = try! encoder.encode(newValue)
+        }
+    }
+    
+    public var data: AttachmentData {
+        if let editedAttachmentID {
+            return .editing(editedAttachmentID, editedAttachmentKind!, editedAttachmentURL!)
+        } else if let assetID {
+            return .asset(assetID)
+        } else if let drawing {
+            return .drawing(drawing)
+        } else if let fileURL, let fileType {
+            return .file(fileURL, UTType(fileType)!)
+        } else {
+            return .none
+        }
+    }
+    
+    public var editedAttachmentKind: Attachment.Kind? {
+        get {
+            editedAttachmentKindString.flatMap(Attachment.Kind.init(rawValue:))
+        }
+        set {
+            editedAttachmentKindString = newValue?.rawValue
+        }
+    }
+    
+    public enum AttachmentData {
+        case asset(String)
+        case drawing(PKDrawing)
+        case file(URL, UTType)
+        case editing(String, Attachment.Kind, URL)
+        case none
+    }
+    
+    public override func prepareForDeletion() {
+        super.prepareForDeletion()
+        if let fileURL {
+            try? FileManager.default.removeItem(at: fileURL)
+        }
+    }
+    
+}
+
+extension DraftAttachment {
+    var type: AttachmentType {
+        if let editedAttachmentKind {
+            switch editedAttachmentKind {
+            case .image:
+                return .image
+            case .video:
+                return .video
+            case .gifv:
+                return .video
+            case .audio, .unknown:
+                return .unknown
+            }
+        } else if let assetID {
+            guard let asset = PHAsset.fetchAssets(withLocalIdentifiers: [assetID], options: nil).firstObject else {
+                return .unknown
+            }
+            switch asset.mediaType {
+            case .image:
+                return .image
+            case .video:
+                return .video
+            default:
+                return .unknown
+            }
+        } else if drawingData != nil {
+            return .image
+        } else if let fileType,
+                  let type = UTType(fileType) {
+            if type.conforms(to: .image) {
+                return .image
+            } else if type.conforms(to: .movie) {
+                return .video
+            } else {
+                return .unknown
+            }
+        } else {
+            return .unknown
+        }
+    }
+    
+    enum AttachmentType {
+        case image, video, unknown
+    }
+}
+
+//private let attachmentTypeIdentifier = "space.vaccor.Tusker.composition-attachment"
+
+private let imageType = UTType.image.identifier
+private let heifType = UTType.heif.identifier
+private let heicType = UTType.heic.identifier
+private let jpegType = UTType.jpeg.identifier
+private let pngType = UTType.png.identifier
+private let mp4Type = UTType.mpeg4Movie.identifier
+private let quickTimeType = UTType.quickTimeMovie.identifier
+private let gifType = UTType.gif.identifier
+
+extension DraftAttachment: NSItemProviderReading {
+    public static var readableTypeIdentifiersForItemProvider: [String] {
+        // todo: is there a better way of handling movies than manually adding all possible UTI types?
+        // just using kUTTypeMovie doesn't work, because we need the actually type in order to get the file extension
+        // without the file extension, getting the thumbnail and exporting the video for attachment upload fails
+        [/*typeIdentifier, */ gifType, heifType, heicType, jpegType, pngType, imageType, mp4Type, quickTimeType]
+    }
+    
+    public static func object(withItemProviderData data: Data, typeIdentifier: String) throws -> DraftAttachment {
+        var data = data
+        var type = UTType(typeIdentifier)!
+        
+        // the type is .image in certain circumstances:
+        // - macOS: image copied from macOS Safari -> only UIImage(data: data) works
+        // - iOS: sharing screenshot from markup -> only NSKeyedUnarchiver works
+        if type == .image,
+           let image = UIImage(data: data) ?? (try? NSKeyedUnarchiver.unarchivedObject(ofClass: UIImage.self, from: data)),
+           let pngData = image.pngData() {
+            data = pngData
+            type = .png
+        }
+        
+        // Read the caption from the image itself, if there is one.
+        let caption: String
+        if let source = CGImageSourceCreateWithData(data as CFData, [kCGImageSourceTypeIdentifierHint: typeIdentifier as CFString] as CFDictionary),
+           let properties = CGImageSourceCopyPropertiesAtIndex(source, 0, nil) as? [String: Any],
+           // This is the dictionary for TIFF properties, but it's present for other image types too
+           let tiffProperties = properties[kCGImagePropertyTIFFDictionary as String] as? [String: Any],
+           let imageDescription = tiffProperties[kCGImagePropertyTIFFImageDescription as String] as? String {
+            caption = imageDescription
+        } else {
+            caption = ""
+        }
+        
+        let attachment = DraftAttachment(entity: DraftsPersistentContainer.shared.persistentStoreCoordinator.managedObjectModel.entitiesByName["DraftAttachment"]!, insertInto: nil)
+        attachment.id = UUID()
+        attachment.fileURL = try writeDataToFile(data, id: attachment.id, type: type)
+        attachment.fileType = type.identifier
+        attachment.attachmentDescription = caption
+        return attachment
+    }
+    
+    static var attachmentsDirectory: URL {
+        let containerURL = FileManager.default.containerURL(forSecurityApplicationGroupIdentifier: "group.space.vaccor.Tusker")!
+        return containerURL.appendingPathComponent("Documents").appendingPathComponent("attachments")
+    }
+    
+    static func writeDataToFile(_ data: Data, id: UUID, type: UTType) throws -> URL {
+        let directoryURL = attachmentsDirectory
+        try FileManager.default.createDirectory(at: directoryURL, withIntermediateDirectories: true)
+        let attachmentURL = directoryURL.appendingPathComponent(id.uuidString, conformingTo: type)
+        try data.write(to: attachmentURL)
+        return attachmentURL
+    }
+}
+
+// MARK: Exporting
+
+extension DraftAttachment {
+    func getData(features: InstanceFeatures, skipAllConversion: Bool = false, completion: @escaping (Result<(Data, UTType), ExportError>) -> Void) {
+        if let assetID {
+            guard let asset = PHAsset.fetchAssets(withLocalIdentifiers: [assetID], options: nil).firstObject else {
+                completion(.failure(.noAsset))
+                return
+            }
+            if asset.mediaType == .image {
+                let options = PHImageRequestOptions()
+                options.version = .current
+                options.deliveryMode = .highQualityFormat
+                options.resizeMode = .none
+                options.isNetworkAccessAllowed = true
+                PHImageManager.default().requestImageDataAndOrientation(for: asset, options: options) { data, dataUTI, orientation, info in
+                    guard let data, let dataUTI else {
+                        completion(.failure(.missingAssetData))
+                        return
+                    }
+                    let processed = Self.processImageData(data, type: UTType(dataUTI)!, features: features, skipAllConversion: skipAllConversion)
+                    completion(.success(processed))
+                }
+            } else if asset.mediaType == .video {
+                let options = PHVideoRequestOptions()
+                options.version = .current
+                options.deliveryMode = .automatic
+                options.isNetworkAccessAllowed = true
+                PHImageManager.default().requestExportSession(forVideo: asset, options: options, exportPreset: AVAssetExportPresetHighestQuality) { exportSession, info in
+                    if let exportSession {
+                        Self.exportVideoData(session: exportSession, features: features, completion: completion)
+                    } else if let error = info?[PHImageErrorKey] as? Error {
+                        completion(.failure(.videoExport(error)))
+                    } else {
+                        completion(.failure(.noVideoExportSession))
+                    }
+                }
+            } else {
+                completion(.failure(.unknownAssetType))
+            }
+        } else if let drawingData {
+            guard let drawing = try? decoder.decode(PKDrawing.self, from: drawingData) else {
+                completion(.failure(.loadingDrawing))
+                return
+            }
+            let image = drawing.imageInLightMode(from: drawing.bounds, scale: 1)
+            completion(.success((image.pngData()!, .png)))
+        } else if let fileURL, let fileType {
+            let type = UTType(fileType)!
+            
+            if type.conforms(to: .movie) {
+                let asset = AVURLAsset(url: fileURL)
+                guard let session = AVAssetExportSession(asset: asset, presetName: AVAssetExportPresetHighestQuality) else {
+                    completion(.failure(.noVideoExportSession))
+                    return
+                }
+                Self.exportVideoData(session: session, features: features, completion: completion)
+            } else {
+                let fileData: Data
+                do {
+                    fileData = try Data(contentsOf: fileURL)
+                } catch {
+                    completion(.failure(.loadingData))
+                    return
+                }
+                
+                if type != .gif,
+                   type.conforms(to: .image) {
+                    let result = Self.processImageData(fileData, type: type, features: features, skipAllConversion: skipAllConversion)
+                    completion(.success(result))
+                } else {
+                    completion(.success((fileData, type)))
+                }
+            }
+        } else {
+            completion(.failure(.noData))
+        }
+    }
+    
+    private static func processImageData(_ data: Data, type: UTType, features: InstanceFeatures, skipAllConversion: Bool) -> (Data, UTType) {
+        guard !skipAllConversion else {
+            return (data, type)
+        }
+        
+        var data = data
+        var type = type
+        
+        let image = CIImage(data: data)!
+        let needsColorSpaceConversion = features.needsWideColorGamutHack && image.colorSpace?.name != CGColorSpace.sRGB
+        
+        // neither Mastodon nor Pleroma handles HEIC well, so convert to JPEG
+        // they also do a bad job converting wide color gamut images (they seem to just drop the profile, letting the wide-gamut values be reinterprete as sRGB)
+        // if that changes in the future, we'll need to pass the InstanceFeatures in here somehow and gate the conversion
+        if needsColorSpaceConversion || type == .heic || type == .heif {
+            let context = CIContext()
+            let colorSpace = needsColorSpaceConversion || image.colorSpace != nil ? CGColorSpace(name: CGColorSpace.sRGB)! : image.colorSpace!
+            if type == .png {
+                data = context.pngRepresentation(of: image, format: .ARGB8, colorSpace: colorSpace)!
+            } else {
+                data = context.jpegRepresentation(of: image, colorSpace: colorSpace)!
+                type = .jpeg
+            }
+        }
+        
+        return (data, type)
+    }
+    
+    private static func exportVideoData(session: AVAssetExportSession, features: InstanceFeatures, completion: @escaping (Result<(Data, UTType), ExportError>) -> Void) {
+        session.outputFileType = .mp4
+        session.outputURL = FileManager.default.temporaryDirectory.appendingPathComponent("exported_video_\(UUID())").appendingPathExtension("mp4")
+        if let configuration = features.mediaAttachmentsConfiguration {
+            session.fileLengthLimit = Int64(configuration.videoSizeLimit)
+        }
+        session.exportAsynchronously {
+            guard session.status == .completed else {
+                completion(.failure(.videoExport(session.error!)))
+                return
+            }
+            do {
+                let data = try Data(contentsOf: session.outputURL!)
+                completion(.success((data, .mpeg4Movie)))
+            } catch {
+                completion(.failure(.videoExport(error)))
+            }
+        }
+    }
+    
+    enum ExportError: Error {
+        case noAsset
+        case unknownAssetType
+        case missingAssetData
+        case videoExport(Error)
+        case noVideoExportSession
+        case loadingDrawing
+        case loadingData
+        case noData
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/CoreData/Drafts.xcdatamodeld/Drafts.xcdatamodel/contents

@@ -0,0 +1,42 @@
+<?xml version="1.0" encoding="UTF-8" standalone="yes"?>
+<model type="com.apple.IDECoreDataModeler.DataModel" documentVersion="1.0" lastSavedToolsVersion="22222" systemVersion="22G91" minimumToolsVersion="Automatic" sourceLanguage="Swift" userDefinedModelVersionIdentifier="">
+    <entity name="Draft" representedClassName="ComposeUI.Draft" syncable="YES">
+        <attribute name="accountID" attributeType="String"/>
+        <attribute name="contentWarning" attributeType="String" defaultValueString=""/>
+        <attribute name="contentWarningEnabled" attributeType="Boolean" defaultValueString="NO" usesScalarValueType="YES"/>
+        <attribute name="editedStatusID" optional="YES" attributeType="String"/>
+        <attribute name="id" attributeType="UUID" usesScalarValueType="NO"/>
+        <attribute name="initialContentWarning" optional="YES" attributeType="String"/>
+        <attribute name="initialText" attributeType="String"/>
+        <attribute name="inReplyToID" optional="YES" attributeType="String"/>
+        <attribute name="language" optional="YES" attributeType="String"/>
+        <attribute name="lastModified" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="localOnly" attributeType="Boolean" defaultValueString="NO" usesScalarValueType="YES"/>
+        <attribute name="text" attributeType="String" defaultValueString=""/>
+        <attribute name="visibilityStr" optional="YES" attributeType="String"/>
+        <relationship name="attachments" toMany="YES" deletionRule="Cascade" ordered="YES" destinationEntity="DraftAttachment" inverseName="draft" inverseEntity="DraftAttachment"/>
+        <relationship name="poll" optional="YES" maxCount="1" deletionRule="Cascade" destinationEntity="Poll" inverseName="draft" inverseEntity="Poll"/>
+    </entity>
+    <entity name="DraftAttachment" representedClassName="ComposeUI.DraftAttachment" syncable="YES">
+        <attribute name="assetID" optional="YES" attributeType="String"/>
+        <attribute name="attachmentDescription" attributeType="String" defaultValueString=""/>
+        <attribute name="drawingData" optional="YES" attributeType="Binary"/>
+        <attribute name="editedAttachmentID" optional="YES" attributeType="String"/>
+        <attribute name="editedAttachmentKindString" optional="YES" attributeType="String"/>
+        <attribute name="editedAttachmentURL" optional="YES" attributeType="URI"/>
+        <attribute name="fileType" optional="YES" attributeType="String"/>
+        <attribute name="fileURL" optional="YES" attributeType="URI"/>
+        <attribute name="id" attributeType="UUID" usesScalarValueType="NO"/>
+        <relationship name="draft" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="Draft" inverseName="attachments" inverseEntity="Draft"/>
+    </entity>
+    <entity name="Poll" representedClassName="ComposeUI.Poll" syncable="YES">
+        <attribute name="duration" optional="YES" attributeType="Double" defaultValueString="0.0" usesScalarValueType="YES"/>
+        <attribute name="multiple" attributeType="Boolean" usesScalarValueType="YES"/>
+        <relationship name="draft" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="Draft" inverseName="poll" inverseEntity="Draft"/>
+        <relationship name="options" toMany="YES" deletionRule="Cascade" ordered="YES" destinationEntity="PollOption" inverseName="poll" inverseEntity="PollOption"/>
+    </entity>
+    <entity name="PollOption" representedClassName="ComposeUI.PollOption" syncable="YES">
+        <attribute name="text" attributeType="String" defaultValueString=""/>
+        <relationship name="poll" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="Poll" inverseName="options" inverseEntity="Poll"/>
+    </entity>
+</model>

Packages/ComposeUI/Sources/ComposeUI/CoreData/DraftsPersistentContainer.swift

@@ -0,0 +1,217 @@
+//
+//  DraftsPersistentContainer.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/22/23.
+//
+
+import Foundation
+import CoreData
+import OSLog
+import Pachyderm
+
+private let logger = Logger(subsystem: Bundle.main.bundleIdentifier!, category: "DraftsPersistentContainer")
+
+public class DraftsPersistentContainer: NSPersistentContainer {
+    
+    public static let shared = DraftsPersistentContainer()
+    
+    public static var captureError: ((any Error) -> Void)?
+    
+    private static let managedObjectModel: NSManagedObjectModel = {
+        let url = Bundle.module.url(forResource: "Drafts", withExtension: "momd")!
+        return NSManagedObjectModel(contentsOf: url)!
+    }()
+    
+    private var lastHistoryToken: NSPersistentHistoryToken!
+    
+    init() {
+        super.init(name: "Drafts", managedObjectModel: DraftsPersistentContainer.managedObjectModel)
+        
+        let containerURL = FileManager.default.containerURL(forSecurityApplicationGroupIdentifier: "group.space.vaccor.Tusker")!
+        let documentsURL = containerURL.appendingPathComponent("Documents")
+        let storeDesc = NSPersistentStoreDescription(url: documentsURL.appendingPathComponent("drafts").appendingPathExtension("sqlite"))
+        storeDesc.type = NSSQLiteStoreType
+        storeDesc.setOption(true as NSNumber, forKey: NSPersistentHistoryTrackingKey)
+        storeDesc.setOption(true as NSNumber, forKey: NSPersistentStoreRemoteChangeNotificationPostOptionKey)
+        
+        persistentStoreDescriptions = [
+            storeDesc
+        ]
+        
+        loadPersistentStores { _, error in
+            if let error {
+                DraftsPersistentContainer.captureError?(error)
+                fatalError("Loading persistent store: \(error)")
+            }
+        }
+        
+        viewContext.automaticallyMergesChangesFromParent = true
+        viewContext.mergePolicy = NSMergePolicy.mergeByPropertyObjectTrump
+        
+        lastHistoryToken = persistentStoreCoordinator.currentPersistentHistoryToken(fromStores: nil)
+        
+        NotificationCenter.default.addObserver(self, selector: #selector(remoteChanges(_:)), name: .NSPersistentStoreRemoteChange, object: persistentStoreCoordinator)
+    }
+    
+    public func save() {
+        guard viewContext.hasChanges else {
+            return
+        }
+        do {
+            try viewContext.save()
+        } catch {
+            logger.error("Failed to save: \(String(describing: error))")
+        }
+    }
+    
+    public func migrate(from url: URL, completion: @escaping (Result<(), any Error>) -> Void) {
+        performBackgroundTask { context in
+            let result = DraftsMigrator.migrate(from: url, to: context)
+            completion(result)
+            try! context.save()
+        }
+    }
+    
+    public func getDraft(id: UUID) -> Draft? {
+        let req = Draft.fetchRequest(id: id)
+        return try? viewContext.fetch(req).first
+    }
+    
+    public func createDraft(
+        accountID: String,
+        text: String,
+        contentWarning: String,
+        inReplyToID: String?,
+        visibility: Visibility,
+        language: String?,
+        localOnly: Bool
+    ) -> Draft {
+        let draft = Draft(context: viewContext)
+        draft.accountID = accountID
+        draft.text = text
+        draft.initialText = text
+        draft.contentWarning = contentWarning
+        draft.initialContentWarning = contentWarning
+        draft.contentWarningEnabled = !contentWarning.isEmpty
+        draft.inReplyToID = inReplyToID
+        draft.visibility = visibility
+        draft.language = language
+        draft.localOnly = localOnly
+        save()
+        return draft
+    }
+    
+    public func createEditDraft(
+        accountID: String,
+        source: StatusSource,
+        inReplyToID: String?,
+        visibility: Visibility,
+        localOnly: Bool,
+        attachments: [Attachment],
+        poll: Pachyderm.Poll?
+    ) -> Draft {
+        let draft = Draft(context: viewContext)
+        draft.accountID = accountID
+        draft.editedStatusID = source.id
+        draft.text = source.text
+        draft.initialText = source.text
+        draft.contentWarning = source.spoilerText
+        draft.contentWarningEnabled = !source.spoilerText.isEmpty
+        draft.initialContentWarning = source.spoilerText
+        draft.inReplyToID = inReplyToID
+        draft.visibility = visibility
+        draft.localOnly = localOnly
+        for attachment in attachments {
+            createEditDraftAttachment(attachment, in: draft)
+        }
+        if let existingPoll = poll {
+            let poll = Poll(context: viewContext)
+            poll.draft = draft
+            draft.poll = poll
+            if let expiresAt = existingPoll.expiresAt,
+               !existingPoll.effectiveExpired {
+                poll.duration = PollController.Duration.allCases.max(by: {
+                    (expiresAt.timeIntervalSinceNow - $0.timeInterval) < (expiresAt.timeIntervalSinceNow - $1.timeInterval)
+                })!.timeInterval
+            } else {
+                poll.duration = PollController.Duration.oneDay.timeInterval
+            }
+            poll.multiple = existingPoll.multiple
+            // rmeove default empty options
+            for opt in poll.pollOptions {
+                viewContext.delete(opt)
+            }
+            for existingOpt in existingPoll.options {
+                let opt = PollOption(context: viewContext)
+                opt.poll = poll
+                poll.options.add(opt)
+                opt.text = existingOpt.title
+            }
+        }
+        save()
+        return draft
+    }
+    
+    private func createEditDraftAttachment(_ attachment: Attachment, in draft: Draft) {
+        let draftAttachment = DraftAttachment(context: viewContext)
+        draftAttachment.id = UUID()
+        draftAttachment.attachmentDescription = attachment.description ?? ""
+        draftAttachment.editedAttachmentID = attachment.id
+        draftAttachment.editedAttachmentKind = attachment.kind
+        draftAttachment.editedAttachmentURL = attachment.url
+        draftAttachment.draft = draft
+        draft.attachments.add(draftAttachment)
+    }
+    
+    public func removeOrphanedAttachments(completion: @escaping () -> Void) {
+        guard let files = try? FileManager.default.contentsOfDirectory(at: DraftAttachment.attachmentsDirectory, includingPropertiesForKeys: nil),
+              !files.isEmpty else {
+            return
+        }
+        performBackgroundTask { context in
+            let allAttachmentsReq = DraftAttachment.fetchRequest()
+            allAttachmentsReq.predicate = NSPredicate(format: "fileURL != nil")
+            guard let allAttachments = try? context.fetch(allAttachmentsReq) else {
+                return
+            }
+            let orphaned = Set(files).subtracting(allAttachments.lazy.compactMap(\.fileURL))
+            for url in orphaned {
+                do {
+                    try FileManager.default.removeItem(at: url)
+                } catch {
+                    logger.error("Failed to remove orphaned attachment: \(String(describing: error), privacy: .public)")
+                }
+            }
+            completion()
+        }
+    }
+    
+    @objc private func remoteChanges(_ notification: Foundation.Notification) {
+        guard let newHistoryToken = notification.userInfo?[NSPersistentHistoryTokenKey] as? NSPersistentHistoryToken else {
+            return
+        }
+        
+        // todo: should this be on a background context?
+        let context = viewContext
+        context.perform {
+            let predicate = NSPredicate(format: "(%@ < token) AND (token <= %@)", self.lastHistoryToken, newHistoryToken)
+            
+            let historyRequest = NSPersistentHistoryTransaction.fetchRequest!
+            historyRequest.predicate = predicate
+            let request = NSPersistentHistoryChangeRequest.fetchHistory(withFetch: historyRequest)
+            if let result = try? context.execute(request) as? NSPersistentHistoryResult,
+               let transactions = result.result as? [NSPersistentHistoryTransaction] {
+                for transaction in transactions {
+                    guard let userInfo = transaction.objectIDNotification().userInfo else {
+                        continue
+                    }
+                    NSManagedObjectContext.mergeChanges(fromRemoteContextSave: userInfo, into: [context])
+                }
+            }
+            
+            self.lastHistoryToken = newHistoryToken
+        }
+    }
+    
+}

Packages/ComposeUI/Sources/ComposeUI/CoreData/Poll.swift

@@ -0,0 +1,46 @@
+//
+//  Poll.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/22/23.
+//
+
+import CoreData
+
+@objc
+public class Poll: NSManagedObject {
+    
+    @NSManaged public var duration: TimeInterval
+    @NSManaged public var multiple: Bool
+    
+    @NSManaged public var draft: Draft
+    @NSManaged public var options: NSMutableOrderedSet
+    
+    public var pollOptions: [PollOption] {
+        get {
+            options.array as! [PollOption]
+        }
+        set {
+            options = NSMutableOrderedSet(array: newValue)
+        }
+    }
+    
+    public override func awakeFromInsert() {
+        super.awakeFromInsert()
+        self.multiple = false
+        self.duration = 24 * 60 * 60 // 1 day
+        if let managedObjectContext {
+            self.options = [
+                PollOption(context: managedObjectContext),
+                PollOption(context: managedObjectContext),
+            ]
+        }
+    }
+    
+}
+
+extension Poll {
+    public var hasContent: Bool {
+        pollOptions.allSatisfy { !$0.text.isEmpty }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/CoreData/PollOption.swift

@@ -0,0 +1,21 @@
+//
+//  PollOption.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/22/23.
+//
+
+import CoreData
+
+@objc
+public class PollOption: NSManagedObject, Identifiable {
+    
+    public var id: NSManagedObjectID {
+        objectID
+    }
+    
+    @NSManaged public var text: String
+    
+    @NSManaged public var poll: Poll
+    
+}

Packages/ComposeUI/Sources/ComposeUI/DraftsMigrator.swift

@@ -0,0 +1,255 @@
+//
+//  DraftsMigrator.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/22/23.
+//
+
+import Foundation
+import OSLog
+import UniformTypeIdentifiers
+import Pachyderm
+import PencilKit
+import CoreData
+
+struct DraftsMigrator {
+    private init() {}
+    
+    private static let logger = Logger(subsystem: Bundle.main.bundleIdentifier!, category: "DraftsMigrator")
+    private static let decoder = PropertyListDecoder()
+    
+    static func migrate(from url: URL, to context: NSManagedObjectContext) -> Result<(), any Error> {
+        do {
+            let data = try Data(contentsOf: url)
+            let container = try decoder.decode(DraftsContainer.self, from: data)
+            for old in container.drafts.values {
+                let new = Draft(context: context)
+                new.id = old.id
+                new.lastModified = old.lastModified
+                new.accountID = old.accountID
+                new.text = old.text
+                new.contentWarningEnabled = old.contentWarningEnabled
+                new.contentWarning = old.contentWarning
+                new.inReplyToID = old.inReplyToID
+                new.visibility = old.visibility
+                new.localOnly = old.localOnly
+                new.initialText = old.initialText
+                
+                if let oldPoll = old.poll {
+                    let newPoll = Poll(context: context)
+                    newPoll.draft = new
+                    new.poll = newPoll
+                    newPoll.multiple = oldPoll.multiple
+                    newPoll.duration = oldPoll.duration
+                    for oldOption in oldPoll.options {
+                        let newOption = PollOption(context: context)
+                        newOption.text = oldOption.text
+                        newOption.poll = newPoll
+                        newPoll.options.add(newOption)
+                    }
+                }
+                
+                for oldAttachment in old.attachments {
+                    let newAttachment = DraftAttachment(context: context)
+                    newAttachment.draft = new
+                    new.attachments.add(newAttachment)
+                    newAttachment.id = oldAttachment.id
+                    newAttachment.attachmentDescription = oldAttachment.attachmentDescription
+                    switch oldAttachment.data {
+                    case .asset(let assetID):
+                        newAttachment.assetID = assetID
+                    case .image(let data, originalType: let type):
+                        newAttachment.fileURL = try? DraftAttachment.writeDataToFile(data, id: newAttachment.id, type: type)
+                        newAttachment.fileType = type.identifier
+                    case .video(_):
+                        fatalError("unreachable, video attachments weren't encodable")
+                    case .drawing(let drawing):
+                        newAttachment.drawing = drawing
+                    case .gif(let data):
+                        newAttachment.fileURL = try? DraftAttachment.writeDataToFile(data, id: newAttachment.id, type: .gif)
+                        newAttachment.fileType = UTType.gif.identifier
+                    }
+                }
+            }
+            
+            try FileManager.default.removeItem(at: url)
+        } catch {
+            logger.error("Error migrating: \(String(describing: error))")
+            return .failure(error)
+        }
+        return .success(())
+    }
+    
+    // MARK: Supporting Types
+    
+    struct DraftsContainer: Decodable {
+        let drafts: [UUID: OldDraft]
+        
+        init(drafts: [UUID: OldDraft]) {
+            self.drafts = drafts
+        }
+        
+        init(from decoder: Decoder) throws {
+            let container = try decoder.container(keyedBy: CodingKeys.self)
+            self.drafts = try container.decode([UUID: SafeDraft].self, forKey: .drafts).compactMapValues(\.draft)
+        }
+        
+        enum CodingKeys: CodingKey {
+            case drafts
+        }
+    }
+    
+    // a container that always succeeds at decoding
+    // so if a single draft can't be decoded, we don't lose all drafts
+    struct SafeDraft: Decodable {
+        let draft: OldDraft?
+
+        init(from decoder: Decoder) throws {
+            let container = try decoder.singleValueContainer()
+            self.draft = try? container.decode(OldDraft.self)
+        }
+    }
+    
+    struct OldDraft: Decodable {
+        let id: UUID
+        let lastModified: Date
+        let accountID: String
+        let text: String
+        let contentWarningEnabled: Bool
+        let contentWarning: String
+        let attachments: [OldDraftAttachment]
+        let inReplyToID: String?
+        let visibility: Visibility
+        let poll: OldPoll?
+        let localOnly: Bool
+        let initialText: String
+        
+        init(from decoder: Decoder) throws {
+            let container = try decoder.container(keyedBy: CodingKeys.self)
+            
+            self.id = try container.decode(UUID.self, forKey: .id)
+            self.lastModified = try container.decode(Date.self, forKey: .lastModified)
+            
+            self.accountID = try container.decode(String.self, forKey: .accountID)
+            self.text = try container.decode(String.self, forKey: .text)
+            self.contentWarningEnabled = try container.decode(Bool.self, forKey: .contentWarningEnabled)
+            self.contentWarning = try container.decode(String.self, forKey: .contentWarning)
+            self.attachments = try container.decode([OldDraftAttachment].self, forKey: .attachments)
+            self.inReplyToID = try container.decode(String?.self, forKey: .inReplyToID)
+            self.visibility = try container.decode(Visibility.self, forKey: .visibility)
+            self.poll = try container.decode(OldPoll?.self, forKey: .poll)
+            self.localOnly = try container.decodeIfPresent(Bool.self, forKey: .localOnly) ?? false
+            
+            self.initialText = try container.decode(String.self, forKey: .initialText)
+        }
+        
+        enum CodingKeys: String, CodingKey {
+            case id
+            case lastModified
+            
+            case accountID
+            case text
+            case contentWarningEnabled
+            case contentWarning
+            case attachments
+            case inReplyToID
+            case visibility
+            case poll
+            case localOnly
+            
+            case initialText
+        }
+    }
+    
+    struct OldDraftAttachment: Decodable {
+        let id: UUID
+        let data: OldDraftAttachmentData
+        let attachmentDescription: String
+        
+        init(from decoder: Decoder) throws {
+            let container = try decoder.container(keyedBy: CodingKeys.self)
+            
+            self.id = try container.decode(UUID.self, forKey: .id)
+            self.data = try container.decode(OldDraftAttachmentData.self, forKey: .data)
+            self.attachmentDescription = try container.decode(String.self, forKey: .attachmentDescription)
+        }
+    
+        enum CodingKeys: String, CodingKey {
+            case id
+            case data
+            case attachmentDescription
+        }
+    }
+    
+    enum OldDraftAttachmentData: Decodable {
+        case asset(String)
+        case image(Data, originalType: UTType)
+        case video(URL)
+        case drawing(PKDrawing)
+        case gif(Data)
+        
+        init(from decoder: Decoder) throws {
+            let container = try decoder.container(keyedBy: CodingKeys.self)
+            
+            switch try container.decode(String.self, forKey: .type) {
+            case "asset":
+                let identifier = try container.decode(String.self, forKey: .assetIdentifier)
+                self = .asset(identifier)
+            case "image":
+                let data = try container.decode(Data.self, forKey: .imageData)
+                if let type = try container.decodeIfPresent(UTType.self, forKey: .imageType) {
+                    self = .image(data, originalType: type)
+                } else {
+                    guard let image = UIImage(data: data) else {
+                        throw DecodingError.dataCorruptedError(forKey: .imageData, in: container, debugDescription: "CompositionAttachment data could not be decoded into UIImage")
+                    }
+                    let jpegData = image.jpegData(compressionQuality: 1)!
+                    self = .image(jpegData, originalType: .jpeg)
+                }
+            case "drawing":
+                let drawingData = try container.decode(Data.self, forKey: .drawing)
+                let drawing = try PKDrawing(data: drawingData)
+                self = .drawing(drawing)
+            default:
+                throw DecodingError.dataCorruptedError(forKey: .type, in: container, debugDescription: "CompositionAttachment type must be one of image, asset, or drawing")
+            }
+        }
+        
+        enum CodingKeys: CodingKey {
+            case type
+            case imageData
+            case imageType
+            /// The local identifier of the PHAsset for this attachment
+            case assetIdentifier
+            /// The PKDrawing object for this attachment.
+            case drawing
+        }
+    }
+    
+    struct OldPoll: Decodable {
+        let options: [OldPollOption]
+        let multiple: Bool
+        let duration: TimeInterval
+        
+        init(from decoder: Decoder) throws {
+            let container = try decoder.container(keyedBy: CodingKeys.self)
+            self.options = try container.decode([OldPollOption].self, forKey: .options)
+            self.multiple = try container.decode(Bool.self, forKey: .multiple)
+            self.duration = try container.decode(TimeInterval.self, forKey: .duration)
+        }
+        
+        enum CodingKeys: String, CodingKey {
+            case options
+            case multiple
+            case duration
+        }
+    }
+    
+    struct OldPollOption: Decodable {
+        let text: String
+        
+        init(from decoder: Decoder) throws {
+            self.text = try decoder.singleValueContainer().decode(String.self)
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/KeyboardReader.swift

@@ -0,0 +1,42 @@
+//
+//  KeyboardReader.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/7/23.
+//
+
+#if !os(visionOS)
+
+import UIKit
+import Combine
+
+class KeyboardReader: ObservableObject {
+//    @Published var isVisible = false
+    @Published var keyboardHeight: CGFloat = 0
+    
+    var isVisible: Bool {
+        // when a hardware keyboard is connected, the height is very short, so we don't consider that being "visible"
+        keyboardHeight > 72
+    }
+    
+    init() {
+        NotificationCenter.default.addObserver(self, selector: #selector(willShow), name: UIResponder.keyboardWillShowNotification, object: nil)
+        NotificationCenter.default.addObserver(self, selector: #selector(willHide), name: UIResponder.keyboardWillHideNotification, object: nil)
+    }
+    
+    @objc func willShow(_ notification: Foundation.Notification) {
+        let endFrame = notification.userInfo![UIResponder.keyboardFrameEndUserInfoKey] as! CGRect
+//        isVisible = endFrame.height > 72
+        keyboardHeight = endFrame.height
+    }
+    
+    @objc func willHide() {
+        // sometimes willHide is called during a SwiftUI view update
+        DispatchQueue.main.async {
+//            self.isVisible = false
+            self.keyboardHeight = 0
+        }
+    }
+}
+
+#endif

Packages/ComposeUI/Sources/ComposeUI/Model/DismissMode.swift

@@ -0,0 +1,12 @@
+//
+//  DismissMode.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/7/23.
+//
+
+import Foundation
+
+public enum DismissMode {
+    case cancel, post
+}

Packages/ComposeUI/Sources/ComposeUI/Model/StatusFormat.swift

@@ -1,6 +1,6 @@
 //
 //  StatusFormat.swift
-//  Tusker
+//  ComposeUI
 //
 //  Created by Shadowfacts on 1/12/19.
 //  Copyright © 2019 Shadowfacts. All rights reserved.
@@ -12,8 +12,8 @@ import Pachyderm
 enum StatusFormat: Int, CaseIterable {
     case bold, italics, strikethrough, code
     
-    var insertionResult: FormatInsertionResult? {
-        switch Preferences.shared.statusContentType {
+    func insertionResult(for contentType: StatusContentType) -> FormatInsertionResult? {
+        switch contentType {
         case .plain:
             return nil
         case .markdown:
@@ -23,7 +23,7 @@ enum StatusFormat: Int, CaseIterable {
         }
     }
     
-    var imageName: String? {
+    var imageName: String {
         switch self {
         case .italics:
             return "italic"
@@ -31,16 +31,8 @@ enum StatusFormat: Int, CaseIterable {
             return "bold"
         case .strikethrough:
             return "strikethrough"
-        default:
-            return nil
-        }
-    }
-    
-    var title: (String, [NSAttributedString.Key: Any])? {
-        if self == .code {
-            return ("</>", [.font: UIFont(name: "Menlo", size: 17)!])
-        } else {
-            return nil
+        case .code:
+            return "chevron.left.forwardslash.chevron.right"
         }
     }
     
@@ -60,7 +52,7 @@ enum StatusFormat: Int, CaseIterable {
 
 typealias FormatInsertionResult = (prefix: String, suffix: String, insertionPoint: Int)
 
-protocol FormatType {
+fileprivate protocol FormatType {
     static func format(_ format: StatusFormat) -> FormatInsertionResult
 }
 

Packages/ComposeUI/Sources/ComposeUI/OptionalObservedObject.swift

@@ -0,0 +1,33 @@
+//
+//  OptionalObservedObject.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/15/23.
+//
+
+import SwiftUI
+import Combine
+
+@propertyWrapper
+struct OptionalObservedObject<T: ObservableObject>: DynamicProperty {
+    private class Republisher: ObservableObject {
+        var cancellable: AnyCancellable?
+        var wrapped: T? {
+            didSet {
+                cancellable?.cancel()
+                cancellable = wrapped?.objectWillChange
+                    .receive(on: RunLoop.main)
+                    .sink { [unowned self] _ in
+                        self.objectWillChange.send()
+                    }
+            }
+        }
+    }
+    
+    @StateObject private var republisher = Republisher()
+    var wrappedValue: T?
+    
+    func update() {
+        republisher.wrapped = wrappedValue
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/PKDrawing+Render.swift

@@ -1,6 +1,6 @@
 //
 //  PKDrawing+Render.swift
-//  Tusker
+//  ComposeUI
 //
 //  Created by Shadowfacts on 5/9/20.
 //  Copyright © 2020 Shadowfacts. All rights reserved.
@@ -11,7 +11,7 @@ import PencilKit
 
 extension PKDrawing {
     
-    func imageInLightMode(from rect: CGRect, scale: CGFloat = UIScreen.main.scale) -> UIImage {
+    func imageInLightMode(from rect: CGRect, scale: CGFloat = 1) -> UIImage {
         let lightTraitCollection = UITraitCollection(userInterfaceStyle: .light)
         var drawingImage: UIImage!
         lightTraitCollection.performAsCurrent {

Packages/ComposeUI/Sources/ComposeUI/TextViewCaretScrolling.swift

@@ -1,5 +1,5 @@
 //
-//  ComposeTextViewCaretScrolling.swift
+//  TextViewCaretScrolling.swift
 //  Tusker
 //
 //  Created by Shadowfacts on 11/11/20.
@@ -8,11 +8,11 @@
 
 import UIKit
 
-protocol ComposeTextViewCaretScrolling: AnyObject {
+protocol TextViewCaretScrolling: AnyObject {
     var caretScrollPositionAnimator: UIViewPropertyAnimator? { get set }
 }
 
-extension ComposeTextViewCaretScrolling {
+extension TextViewCaretScrolling {
     func ensureCursorVisible(textView: UITextView) {
         guard textView.isFirstResponder,
               let range = textView.selectedTextRange,
@@ -39,6 +39,7 @@ extension ComposeTextViewCaretScrolling {
         
         let animator = UIViewPropertyAnimator(duration: 0.2, curve: .easeInOut) {
             scrollView.scrollRectToVisible(rectToMakeVisible, animated: false)
+            scrollView.layoutIfNeeded()
         }
         self.caretScrollPositionAnimator = animator
         animator.startAnimation()

Packages/ComposeUI/Sources/ComposeUI/UITextInput+Autocomplete.swift

@@ -0,0 +1,183 @@
+//
+//  UITextInput+Autocomplete.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/5/23.
+//
+
+import UIKit
+import SwiftUI
+
+extension UITextInput {
+    func autocomplete(with string: String, permittedModes: AutocompleteModes, autocompleteState: inout AutocompleteState?) {
+        guard let selectedTextRange,
+              let wholeDocumentRange = self.textRange(from: self.beginningOfDocument, to: self.endOfDocument),
+              let text = self.text(in: wholeDocumentRange),
+              let (lastWordStartIndex, _) = findAutocompleteLastWord() else {
+            return
+        }
+        
+        let distanceToEnd = self.offset(from: selectedTextRange.start, to: self.endOfDocument)
+        
+        let selectedRangeStartUTF16 = self.offset(from: self.beginningOfDocument, to: selectedTextRange.start)
+        let characterBeforeCursorIndex = text.utf16.index(text.startIndex, offsetBy: selectedRangeStartUTF16)
+        
+        let insertSpace: Bool
+        if distanceToEnd > 0 {
+            let charAfterCursor = text[characterBeforeCursorIndex]
+            insertSpace = charAfterCursor != " " && charAfterCursor != "\n"
+        } else {
+            insertSpace = true
+        }
+        let string = insertSpace ? string + " " : string
+        
+        let startPosition = self.position(from: self.beginningOfDocument, offset: text.utf16.distance(from: text.startIndex, to: lastWordStartIndex))!
+        let lastWordRange = self.textRange(from: startPosition, to: selectedTextRange.start)!
+        replace(lastWordRange, withText: string)
+        
+        autocompleteState = updateAutocompleteState(permittedModes: permittedModes)
+        
+        // keep the cursor at the same position in the text, immediately after what was inserted
+        // if we inserted a space, move the cursor 1 farther so it's immediately after the pre-existing space
+        let insertSpaceOffset = insertSpace ? 0 : 1
+        let newCursorPosition = self.position(from: self.endOfDocument, offset: -distanceToEnd + insertSpaceOffset)!
+        self.selectedTextRange = self.textRange(from: newCursorPosition, to: newCursorPosition)
+    }
+    
+    func updateAutocompleteState(permittedModes: AutocompleteModes) -> AutocompleteState? {
+        guard let selectedTextRange,
+            let wholeDocumentRange = self.textRange(from: self.beginningOfDocument, to: self.endOfDocument),
+              let text = self.text(in: wholeDocumentRange),
+              !text.isEmpty,
+              let (lastWordStartIndex, foundFirstAtSign) = findAutocompleteLastWord() else {
+            return nil
+        }
+        
+        let triggerChars = permittedModes.triggerChars
+        
+        if lastWordStartIndex > text.startIndex {
+            // if the character before the "word" beginning is a valid part of a "word",
+            // we aren't able to autocomplete
+            let c = text[text.index(before: lastWordStartIndex)]
+            if isPermittedForAutocomplete(c) || triggerChars.contains(c) {
+                return nil
+            }
+        }
+        
+        let characterBeforeCursorIndex = text.utf16.index(text.startIndex, offsetBy: self.offset(from: self.beginningOfDocument, to: selectedTextRange.start))
+        
+        if lastWordStartIndex >= text.startIndex {
+            let lastWord = text[lastWordStartIndex..<characterBeforeCursorIndex]
+            let exceptFirst = lastWord[lastWord.index(after: lastWord.startIndex)...]
+            
+            // periods are only allowed in mentions in the domain part
+            if lastWord.contains(".") {
+                if lastWord.first == "@" && foundFirstAtSign && permittedModes.contains(.mentions) {
+                    return .mention(String(exceptFirst))
+                } else {
+                    return nil
+                }
+            }
+            
+            switch lastWord.first {
+            case "@" where permittedModes.contains(.mentions):
+                return .mention(String(exceptFirst))
+            case ":" where permittedModes.contains(.emojis):
+                return .emoji(String(exceptFirst))
+            case "#" where permittedModes.contains(.hashtags):
+                return .hashtag(String(exceptFirst))
+            default:
+                return nil
+            }
+        } else {
+            return nil
+        }
+    }
+    
+    private func findAutocompleteLastWord() -> (index: String.Index, foundFirstAtSign: Bool)? {
+        guard (self as? UIView)?.isFirstResponder == true,
+              let selectedTextRange,
+              selectedTextRange.isEmpty,
+              let wholeDocumentRange = self.textRange(from: self.beginningOfDocument, to: self.endOfDocument),
+              let text = self.text(in: wholeDocumentRange),
+              !text.isEmpty else {
+            return nil
+        }
+        
+        let selectedRangeStartUTF16 = self.offset(from: self.beginningOfDocument, to: selectedTextRange.start)
+        let cursorIndex = text.utf16.index(text.startIndex, offsetBy: selectedRangeStartUTF16)
+        
+        guard cursorIndex != text.startIndex else {
+            return nil
+        }
+        
+        var lastWordStartIndex = text.index(before: cursorIndex)
+        var foundFirstAtSign = false
+        while true {
+            let c = text[lastWordStartIndex]
+            
+            if !isPermittedForAutocomplete(c) {
+                if foundFirstAtSign {
+                    if c != "@" {
+                        // move the index forward by 1, so that the first char of the substring is the 1st @ instead of whatever comes before it
+                        lastWordStartIndex = text.index(after: lastWordStartIndex)
+                    }
+                    break
+                } else {
+                    if c == "@" {
+                        foundFirstAtSign = true
+                    } else if c != "." {
+                        // periods are allowed for domain names in mentions
+                        break
+                    }
+                }
+            }
+            
+            guard lastWordStartIndex > text.startIndex else {
+                break
+            }
+            
+            lastWordStartIndex = text.index(before: lastWordStartIndex)
+        }
+        
+        return (lastWordStartIndex, foundFirstAtSign)
+    }
+}
+
+enum AutocompleteState: Equatable {
+    case mention(String)
+    case emoji(String)
+    case hashtag(String)
+}
+
+struct AutocompleteModes: OptionSet {
+    static let mentions = AutocompleteModes(rawValue: 1 << 0)
+    static let hashtags = AutocompleteModes(rawValue: 1 << 2)
+    static let emojis   = AutocompleteModes(rawValue: 1 << 3)
+    
+    static let all: AutocompleteModes = [
+        .mentions,
+        .hashtags,
+        .emojis,
+    ]
+    
+    let rawValue: Int
+    
+    var triggerChars: [Character] {
+        var chars: [Character] = []
+        if contains(.mentions) {
+            chars.append("@")
+        }
+        if contains(.hashtags) {
+            chars.append("#")
+        }
+        if contains(.emojis) {
+            chars.append(":")
+        }
+        return chars
+    }
+}
+
+private func isPermittedForAutocomplete(_ c: Character) -> Bool {
+    return (c >= "a" && c <= "z") || (c >= "A" && c <= "Z") || (c >= "0" && c <= "9") || c == "_"
+}

Packages/ComposeUI/Sources/ComposeUI/ViewController.swift

@@ -0,0 +1,29 @@
+//
+//  ViewController.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/4/23.
+//
+
+import SwiftUI
+import Combine
+
+public protocol ViewController: ObservableObject {
+    associatedtype ContentView: View
+    
+    @ViewBuilder
+    var view: ContentView { get }
+}
+
+public struct ControllerView<Controller: ViewController>: View {
+    @StateObject private var controller: Controller
+    
+    public init(controller: @escaping () -> Controller) {
+        self._controller = StateObject(wrappedValue: controller())
+    }
+    
+    public var body: some View {
+        controller.view
+            .environmentObject(controller)
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/AttachmentDescriptionTextView.swift

@@ -0,0 +1,151 @@
+//
+//  AttachmentDescriptionTextView.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/12/23.
+//
+
+import SwiftUI
+
+private var placeholder: some View {
+    Text("Describe for the visually impaired…")
+}
+
+struct InlineAttachmentDescriptionView: View {
+    @ObservedObject private var attachment: DraftAttachment
+    private let minHeight: CGFloat
+    
+    @State private var height: CGFloat?
+    
+    init(attachment: DraftAttachment, minHeight: CGFloat) {
+        self.attachment = attachment
+        self.minHeight = minHeight
+    }
+    
+    private var placeholderOffset: CGSize {
+        #if os(visionOS)
+        CGSize(width: 8, height: 8)
+        #else
+        CGSize(width: 4, height: 8)
+        #endif
+    }
+    
+    var body: some View {
+        ZStack(alignment: .topLeading) {
+            if attachment.attachmentDescription.isEmpty {
+                placeholder
+                    .font(.body)
+                    .foregroundColor(.secondary)
+                    .offset(placeholderOffset)
+            }
+            
+            WrappedTextView(
+                text: $attachment.attachmentDescription,
+                backgroundColor: .clear,
+                textDidChange: self.textDidChange
+            )
+            .frame(height: height ?? minHeight)
+        }
+    }
+    
+    private func textDidChange(_ textView: UITextView) {
+        height = max(minHeight, textView.contentSize.height)
+    }
+}
+
+struct FocusedAttachmentDescriptionView: View {
+    @ObservedObject var attachment: DraftAttachment
+    
+    var body: some View {
+        ZStack(alignment: .topLeading) {
+            WrappedTextView(
+                text: $attachment.attachmentDescription,
+                backgroundColor: .secondarySystemBackground,
+                textDidChange: nil
+            )
+            .edgesIgnoringSafeArea([.bottom, .leading, .trailing])
+            
+            if attachment.attachmentDescription.isEmpty {
+                placeholder
+                    .font(.body)
+                    .foregroundColor(.secondary)
+                    .offset(x: 4, y: 8)
+                    .allowsHitTesting(false)
+            }
+        }
+    }
+}
+
+private struct WrappedTextView: UIViewRepresentable {
+    typealias UIViewType = UITextView
+    
+    @Binding var text: String
+    let backgroundColor: UIColor
+    let textDidChange: (((UITextView) -> Void))?
+    
+    @Environment(\.isEnabled) private var isEnabled
+    
+    func makeUIView(context: Context) -> UITextView {
+        let view = UITextView()
+        view.delegate = context.coordinator
+        view.backgroundColor = backgroundColor
+        view.font = .preferredFont(forTextStyle: .body)
+        view.adjustsFontForContentSizeCategory = true
+        view.textContainer.lineBreakMode = .byWordWrapping
+        #if os(visionOS)
+        view.borderStyle = .roundedRect
+        view.textContainerInset = UIEdgeInsets(top: 8, left: 4, bottom: 8, right: 4)
+        #endif
+        return view
+    }
+    
+    func updateUIView(_ uiView: UITextView, context: Context) {
+        uiView.text = text
+        uiView.isEditable = isEnabled
+        context.coordinator.textView = uiView
+        context.coordinator.text = $text
+        context.coordinator.didChange = textDidChange
+        if let textDidChange {
+            // wait until the next runloop iteration so that SwiftUI view updates have finished and
+            // the text view knows its new content size
+            DispatchQueue.main.async {
+                textDidChange(uiView)
+            }
+        }
+    }
+    
+    func makeCoordinator() -> Coordinator {
+        Coordinator(text: $text, didChange: textDidChange)
+    }
+    
+    class Coordinator: NSObject, UITextViewDelegate, TextViewCaretScrolling {
+        weak var textView: UITextView?
+        var text: Binding<String>
+        var didChange: ((UITextView) -> Void)?
+        var caretScrollPositionAnimator: UIViewPropertyAnimator?
+        
+        init(text: Binding<String>, didChange: ((UITextView) -> Void)?) {
+            self.text = text
+            self.didChange = didChange
+            
+            super.init()
+            
+            NotificationCenter.default.addObserver(self, selector: #selector(keyboardDidShow), name: UIResponder.keyboardDidShowNotification, object: nil)
+        }
+        
+        @objc private func keyboardDidShow() {
+            guard let textView,
+                  textView.isFirstResponder else {
+                return
+            }
+            ensureCursorVisible(textView: textView)
+        }
+        
+        func textViewDidChange(_ textView: UITextView) {
+            text.wrappedValue = textView.text
+            didChange?(textView)
+            
+            ensureCursorVisible(textView: textView)
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/CurrentAccountView.swift

@@ -0,0 +1,45 @@
+//
+//  CurrentAccountView.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/4/23.
+//
+
+import SwiftUI
+import Pachyderm
+import TuskerComponents
+
+struct CurrentAccountView: View {
+    let account: (any AccountProtocol)?
+    @EnvironmentObject private var controller: ComposeController
+    
+    var body: some View {
+        controller.currentAccountContainerView(AnyView(currentAccount))
+    }
+    
+    private var currentAccount: some View {
+        HStack(alignment: .top) {
+            AvatarImageView(
+                url: account?.avatar,
+                size: 50,
+                style: controller.config.avatarStyle,
+                fetchAvatar: controller.fetchAvatar
+            )
+            .accessibilityHidden(true)
+            
+            if let account {
+                VStack(alignment: .leading) {
+                    controller.displayNameLabel(account, .title2, 24)
+                        .lineLimit(1)
+                    
+                    Text(verbatim: "@\(account.acct)")
+                        .font(.body.weight(.light))
+                        .foregroundColor(.secondary)
+                        .lineLimit(1)
+                }
+            }
+            
+            Spacer()
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/EmojiTextField.swift

@@ -0,0 +1,148 @@
+//
+//  EmojiTextField.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/5/23.
+//
+
+import SwiftUI
+
+struct EmojiTextField: UIViewRepresentable {
+    typealias UIViewType = UITextField
+    
+    @EnvironmentObject private var controller: ComposeController
+    @Environment(\.colorScheme) private var colorScheme
+    
+    @Binding var text: String
+    let placeholder: String
+    let maxLength: Int?
+    let becomeFirstResponder: Binding<Bool>?
+    let focusNextView: Binding<Bool>?
+    
+    init(text: Binding<String>, placeholder: String, maxLength: Int?, becomeFirstResponder: Binding<Bool>? = nil, focusNextView: Binding<Bool>? = nil) {
+        self._text = text
+        self.placeholder = placeholder
+        self.maxLength = maxLength
+        self.becomeFirstResponder = becomeFirstResponder
+        self.focusNextView = focusNextView
+    }
+    
+    func makeUIView(context: Context) -> UITextField {
+        let view = UITextField()
+        view.borderStyle = .roundedRect
+        view.font = .preferredFont(forTextStyle: .body)
+        view.adjustsFontForContentSizeCategory = true
+        view.attributedPlaceholder = NSAttributedString(string: placeholder, attributes: [
+            .foregroundColor: UIColor.secondaryLabel,
+        ])
+        
+        context.coordinator.textField = view
+        
+        view.delegate = context.coordinator
+        view.addTarget(context.coordinator, action: #selector(Coordinator.didChange(_:)), for: .editingChanged)
+        view.addTarget(context.coordinator, action: #selector(Coordinator.returnKeyPressed), for: .primaryActionTriggered)
+        
+        // otherwise when the text gets too wide it starts expanding the ComposeView
+        view.setContentCompressionResistancePriority(.defaultLow, for: .horizontal)
+        
+        return view
+    }
+    
+    func updateUIView(_ uiView: UITextField, context: Context) {
+        if text != uiView.text {
+            uiView.text = text
+        }
+        if placeholder != uiView.attributedPlaceholder?.string {
+            uiView.attributedPlaceholder = NSAttributedString(string: placeholder, attributes: [
+                .foregroundColor: UIColor.secondaryLabel,
+            ])
+        }
+        
+        context.coordinator.text = $text
+        context.coordinator.maxLength = maxLength
+        context.coordinator.focusNextView = focusNextView
+        
+        #if !os(visionOS)
+        uiView.backgroundColor = colorScheme == .dark ? UIColor(controller.config.fillColor) : .secondarySystemBackground
+        #endif
+        
+        if becomeFirstResponder?.wrappedValue == true {
+            DispatchQueue.main.async {
+                uiView.becomeFirstResponder()
+                becomeFirstResponder!.wrappedValue = false
+            }
+        }
+    }
+    
+    func makeCoordinator() -> Coordinator {
+        Coordinator(controller: controller, text: $text, focusNextView: focusNextView)
+    }
+    
+    class Coordinator: NSObject, UITextFieldDelegate, ComposeInput {
+        let controller: ComposeController
+        var text: Binding<String>
+        var focusNextView: Binding<Bool>?
+        var maxLength: Int?
+        
+        @Published var autocompleteState: AutocompleteState?
+        var autocompleteStatePublisher: Published<AutocompleteState?>.Publisher { $autocompleteState }
+        
+        weak var textField: UITextField?
+        
+        init(controller: ComposeController, text: Binding<String>, focusNextView: Binding<Bool>?, maxLength: Int? = nil) {
+            self.controller = controller
+            self.text = text
+            self.focusNextView = focusNextView
+            self.maxLength = maxLength
+        }
+        
+        @objc func didChange(_ textField: UITextField) {
+            text.wrappedValue = textField.text ?? ""
+        }
+        
+        @objc func returnKeyPressed() {
+            focusNextView?.wrappedValue = true
+        }
+        
+        func textField(_ textField: UITextField, shouldChangeCharactersIn range: NSRange, replacementString string: String) -> Bool {
+            if let maxLength {
+                return ((textField.text ?? "") as NSString).replacingCharacters(in: range, with: string).count <= maxLength
+            } else {
+                return true
+            }
+        }
+        
+        func textFieldDidBeginEditing(_ textField: UITextField) {
+            controller.currentInput = self
+            autocompleteState = textField.updateAutocompleteState(permittedModes: .emojis)
+        }
+        
+        func textFieldDidEndEditing(_ textField: UITextField) {
+            controller.currentInput = nil
+            autocompleteState = textField.updateAutocompleteState(permittedModes: .emojis)
+        }
+        
+        func textFieldDidChangeSelection(_ textField: UITextField) {
+            autocompleteState = textField.updateAutocompleteState(permittedModes: .emojis)
+        }
+        
+        // MARK: ComposeInput
+        
+        var toolbarElements: [ToolbarElement] { [.emojiPicker] }
+        
+        var textInputMode: UITextInputMode? {
+            textField?.textInputMode
+        }
+        
+        func applyFormat(_ format: StatusFormat) {
+        }
+        
+        func beginAutocompletingEmoji() {
+            textField?.insertText(":")
+        }
+        
+        func autocomplete(with string: String) {
+            textField?.autocomplete(with: string, permittedModes: .emojis, autocompleteState: &autocompleteState)
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/HeaderView.swift

@@ -0,0 +1,31 @@
+//
+//  HeaderView.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/4/23.
+//
+
+import SwiftUI
+import Pachyderm
+import InstanceFeatures
+
+struct HeaderView: View {
+    let currentAccount: (any AccountProtocol)?
+    let charsRemaining: Int
+    
+    var body: some View {
+        HStack(alignment: .top) {
+            CurrentAccountView(account: currentAccount)
+                .accessibilitySortPriority(1)
+            
+            Spacer()
+            
+            Text(verbatim: charsRemaining.description)
+                .foregroundColor(charsRemaining < 0 ? .red : .secondary)
+                .font(Font.body.monospacedDigit())
+                .accessibility(label: Text(charsRemaining < 0 ? "\(-charsRemaining) characters too many" : "\(charsRemaining) characters remaining"))
+                // this should come first, so VO users can back to it from the main compose text view
+                .accessibilitySortPriority(0)
+        }.frame(height: 50)
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/LanguagePicker.swift

@@ -0,0 +1,221 @@
+//
+//  LanguagePicker.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 5/4/23.
+//
+
+import SwiftUI
+
+@available(iOS 16.0, *)
+struct LanguagePicker: View {
+    @Binding var draftLanguage: String?
+    @Binding var hasChangedSelection: Bool
+    @State private var isShowingSheet = false
+    
+    private var codeFromDraft: Locale.LanguageCode? {
+        draftLanguage.map(Locale.LanguageCode.init(_:))
+    }
+    
+    private var codeFromActiveInputMode: Locale.LanguageCode? {
+        UITextInputMode.activeInputModes.first.flatMap(Self.codeFromInputMode(_:))
+    }
+    
+    static func codeFromInputMode(_ mode: UITextInputMode) -> Locale.LanguageCode? {
+        guard let bcp47Lang = mode.primaryLanguage,
+              !bcp47Lang.isEmpty else {
+            return nil
+        }
+        var maybeIso639Code = bcp47Lang[..<bcp47Lang.index(bcp47Lang.startIndex, offsetBy: min(3, bcp47Lang.count))]
+        if maybeIso639Code.last == "-" {
+            maybeIso639Code = maybeIso639Code[..<maybeIso639Code.index(before: maybeIso639Code.endIndex)]
+        }
+        let identifier = String(maybeIso639Code)
+        // mul (for multiple languages) and unk (unknown) are ISO codes, but not ones that akkoma permits, so we ignore them on all platforms
+        guard identifier != "mul",
+              identifier != "und" else {
+            return nil
+        }
+        let code = Locale.LanguageCode(identifier)
+        if code.isISOLanguage {
+            return code
+        } else {
+            return nil
+        }
+    }
+    
+    private var codeFromPreferredLanguages: Locale.LanguageCode? {
+        if let identifier = Locale.preferredLanguages.first,
+           case let code = Locale.LanguageCode(identifier),
+           code.isISOLanguage {
+            return code
+        } else {
+            return nil
+        }
+    }
+    
+    private var languageCode: Binding<Locale.LanguageCode> {
+        Binding {
+            return codeFromDraft ?? codeFromActiveInputMode ?? codeFromPreferredLanguages ?? .english
+        } set: { newValue in
+            draftLanguage = newValue.identifier
+        }
+    }
+    
+    var body: some View {
+        Button {
+            isShowingSheet = true
+        } label: {
+            Text((languageCode.wrappedValue.identifier(.alpha2) ?? languageCode.wrappedValue.identifier).uppercased())
+        }
+        .accessibilityLabel("Post Language")
+        .padding(5)
+        .hoverEffect()
+        .sheet(isPresented: $isShowingSheet) {
+            NavigationStack {
+                LanguagePickerList(languageCode: languageCode, hasChangedSelection: $hasChangedSelection, isPresented: $isShowingSheet)
+            }
+            .presentationDetents([.large, .medium])
+        }
+    }
+}
+
+@available(iOS 16.0, *)
+private struct LanguagePickerList: View {
+    @Binding var languageCode: Locale.LanguageCode
+    @Binding var hasChangedSelection: Bool
+    @Binding var isPresented: Bool
+    @Environment(\.composeUIConfig.groupedBackgroundColor) private var groupedBackgroundColor
+    @Environment(\.composeUIConfig.groupedCellBackgroundColor) private var groupedCellBackgroundColor
+    @State private var recentLangs: [Lang] = []
+    @State private var langs: [Lang] = []
+    @State private var filteredLangs: [Lang]?
+    @State private var query = ""
+    
+    private var defaults: UserDefaults {
+        UserDefaults(suiteName: "group.space.vaccor.Tusker") ?? .standard
+    }
+    
+    private var recentIdentifiers: [String] {
+        get {
+            defaults.object(forKey: "LanguagePickerRecents") as? [String] ?? []
+        }
+        nonmutating set {
+            defaults.set(newValue, forKey: "LanguagePickerRecents")
+        }
+    }
+    
+    var body: some View {
+        List {
+            Section {
+                ForEach(recentLangs) { lang in
+                    button(for: lang)
+                }
+                .listRowBackground(groupedCellBackgroundColor)
+            } header: {
+                Text("Recently Used")
+            }
+            
+            Section {
+                ForEach(filteredLangs ?? langs) { lang in
+                    button(for: lang)
+                }
+                .listRowBackground(groupedCellBackgroundColor)
+            } header: {
+                Text("All Languages")
+            }
+        }
+        .listStyle(.insetGrouped)
+        .scrollContentBackground(.hidden)
+        .background(groupedBackgroundColor.edgesIgnoringSafeArea(.all))
+        .searchable(text: $query)
+        #if !os(visionOS)
+        .scrollDismissesKeyboard(.interactively)
+        #endif
+        .navigationTitle("Post Language")
+        .navigationBarTitleDisplayMode(.inline)
+        .toolbar {
+            ToolbarItem(placement: .confirmationAction) {
+                Button("Done") {
+                    isPresented = false
+                }
+            }
+        }
+        .onAppear {
+            // make sure recents always contains the currently selected lang
+            let recents = addRecentLang(languageCode)
+            recentLangs = recents
+                .filter { $0 != "mul" && $0 != "und" }
+                .map { Lang(code: .init($0)) }
+                .sorted { $0.name < $1.name }
+            
+            langs = Locale.LanguageCode.isoLanguageCodes
+                .filter { $0.identifier != "mul" && $0.identifier != "und" }
+                .map { Lang(code: $0) }
+                .sorted { $0.name < $1.name }
+        }
+        #if os(visionOS)
+        .onChange(of: query, initial: true) {
+            filteredLangsChanged(query: query)
+        }
+        #else
+        .onChange(of: query) { newValue in
+            filteredLangsChanged(query: newValue)
+        }
+        #endif
+    }
+    
+    private func filteredLangsChanged(query: String) {
+        if query.isEmpty {
+            filteredLangs = nil
+        } else {
+            filteredLangs = langs.filter {
+                $0.name.localizedCaseInsensitiveContains(query) || $0.code.identifier.localizedCaseInsensitiveContains(query)
+            }
+        }
+    }
+    
+    @discardableResult
+    private func addRecentLang(_ code: Locale.LanguageCode) -> [String] {
+        var recents = recentIdentifiers
+        if !recents.contains(languageCode.identifier) {
+            recents.insert(languageCode.identifier, at: 0)
+            if recents.count > 5 {
+                recents = Array(recents[..<5])
+            }
+            recentIdentifiers = recents
+        }
+        return recents
+    }
+    
+    private func button(for lang: Lang) -> some View {
+        Button {
+            languageCode = lang.code
+            hasChangedSelection = true
+            isPresented = false
+            addRecentLang(lang.code)
+        } label: {
+            HStack {
+                Text(lang.name)
+                Spacer()
+                if lang.code == languageCode {
+                    Image(systemName: "checkmark")
+                }
+            }
+        }
+    }
+    
+    struct Lang: Identifiable {
+        let code: Locale.LanguageCode
+        let name: String
+        
+        var id: String {
+            code.identifier
+        }
+        
+        init(code: Locale.LanguageCode) {
+            self.code = code
+            self.name = Locale.current.localizedString(forLanguageCode: code.identifier) ?? code.identifier
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/MainTextView.swift

@@ -0,0 +1,336 @@
+//
+//  MainTextView.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/6/23.
+//
+
+import SwiftUI
+
+struct MainTextView: View {
+    @EnvironmentObject private var controller: ComposeController
+    @EnvironmentObject private var draft: Draft
+    @Environment(\.colorScheme) private var colorScheme
+    @ScaledMetric private var fontSize = 20
+    
+    @State private var hasFirstAppeared = false
+    @State private var height: CGFloat?
+    @State private var updateSelection: ((UITextView) -> Void)?
+    private let minHeight: CGFloat = 150
+    private var effectiveHeight: CGFloat { height ?? minHeight }
+    
+    var config: ComposeUIConfig {
+        controller.config
+    }
+    
+    private var placeholderOffset: CGSize {
+        #if os(visionOS)
+        CGSize(width: 8, height: 8)
+        #else
+        CGSize(width: 4, height: 8)
+        #endif
+    }
+    
+    private var textViewBackgroundColor: UIColor? {
+        #if os(visionOS)
+        nil
+        #else
+        colorScheme == .dark ? UIColor(config.fillColor) : .secondarySystemBackground
+        #endif
+    }
+    
+    var body: some View {
+        ZStack(alignment: .topLeading) {
+            MainWrappedTextViewRepresentable(
+                text: $draft.text,
+                backgroundColor: textViewBackgroundColor,
+                becomeFirstResponder: $controller.mainComposeTextViewBecomeFirstResponder,
+                updateSelection: $updateSelection,
+                textDidChange: textDidChange
+            )
+            
+            if draft.text.isEmpty {
+                ControllerView(controller: { PlaceholderController() })
+                    .font(.system(size: fontSize))
+                    .foregroundColor(.secondary)
+                    .offset(placeholderOffset)
+                    .accessibilityHidden(true)
+                    .allowsHitTesting(false)
+            }
+            
+        }
+        .frame(height: effectiveHeight)
+        .onAppear(perform: becomeFirstResponderOnFirstAppearance)
+    }
+    
+    private func becomeFirstResponderOnFirstAppearance() {
+        if !hasFirstAppeared {
+            hasFirstAppeared = true
+            controller.mainComposeTextViewBecomeFirstResponder = true
+            if config.textSelectionStartsAtBeginning {
+                updateSelection = { textView in
+                    textView.selectedTextRange = textView.textRange(from: textView.beginningOfDocument, to: textView.beginningOfDocument)
+                }
+            }
+        }
+    }
+    
+    private func textDidChange(textView: UITextView) {
+        height = max(textView.contentSize.height, minHeight)
+    }
+}
+
+fileprivate struct MainWrappedTextViewRepresentable: UIViewRepresentable {
+    typealias UIViewType = UITextView
+    
+    @Binding var text: String
+    let backgroundColor: UIColor?
+    @Binding var becomeFirstResponder: Bool
+    @Binding var updateSelection: ((UITextView) -> Void)?
+    let textDidChange: (UITextView) -> Void
+    
+    @EnvironmentObject private var controller: ComposeController
+    @Environment(\.isEnabled) private var isEnabled: Bool
+    
+    func makeUIView(context: Context) -> UITextView {
+        let textView = WrappedTextView(composeController: controller)
+        context.coordinator.textView = textView
+        textView.delegate = context.coordinator
+        textView.isEditable = true
+        textView.font = UIFontMetrics.default.scaledFont(for: .systemFont(ofSize: 20))
+        textView.adjustsFontForContentSizeCategory = true
+        textView.textContainer.lineBreakMode = .byWordWrapping
+        
+        #if os(visionOS)
+        textView.borderStyle = .roundedRect
+        // yes, the X inset is 4 less than the placeholder offset
+        textView.textContainerInset = UIEdgeInsets(top: 8, left: 4, bottom: 8, right: 4)
+        #endif
+        
+        return textView
+    }
+    
+    func updateUIView(_ uiView: UITextView, context: Context) {
+        if text != uiView.text {
+            context.coordinator.skipNextSelectionChangedAutocompleteUpdate = true
+            uiView.text = text
+        }
+        
+        uiView.isEditable = isEnabled
+        uiView.keyboardType = controller.config.useTwitterKeyboard ? .twitter : .default
+        
+        uiView.backgroundColor = backgroundColor
+        
+        context.coordinator.text = $text
+        
+        if let updateSelection {
+            updateSelection(uiView)
+            self.updateSelection = nil
+        }
+        
+        // wait until the next runloop iteration so that SwiftUI view updates have finished and
+        // the text view knows its new content size
+        DispatchQueue.main.async {
+            textDidChange(uiView)
+            
+            if becomeFirstResponder {
+                // calling becomeFirstResponder during the SwiftUI update causes a crash on iOS 13
+                uiView.becomeFirstResponder()
+                // can't update @State vars during the SwiftUI update
+                becomeFirstResponder = false
+            }
+        }
+    }
+    
+    func makeCoordinator() -> Coordinator {
+        Coordinator(controller: controller, text: $text, textDidChange: textDidChange)
+    }
+    
+    class WrappedTextView: UITextView {
+        private let formattingActions = [#selector(toggleBoldface(_:)), #selector(toggleItalics(_:))]
+        private let composeController: ComposeController
+        
+        init(composeController: ComposeController) {
+            self.composeController = composeController
+            super.init(frame: .zero, textContainer: nil)
+        }
+        
+        required init?(coder: NSCoder) {
+            fatalError()
+        }
+        
+        override func canPerformAction(_ action: Selector, withSender sender: Any?) -> Bool {
+            if formattingActions.contains(action) {
+                return composeController.config.contentType != .plain
+            }
+            return super.canPerformAction(action, withSender: sender)
+        }
+        
+        override func toggleBoldface(_ sender: Any?) {
+            (delegate as! Coordinator).applyFormat(.bold)
+        }
+        
+        override func toggleItalics(_ sender: Any?) {
+            (delegate as! Coordinator).applyFormat(.italics)
+        }
+        
+        override func validate(_ command: UICommand) {
+            super.validate(command)
+            
+            if formattingActions.contains(command.action),
+               composeController.config.contentType != .plain {
+                command.attributes.remove(.disabled)
+            }
+        }
+        
+        override func paste(_ sender: Any?) {
+            // we deliberately exclude the other CompositionAttachment readable type identifiers, because that's too overzealous with the conversion
+            // and things like URLs end up pasting as attachments
+            if UIPasteboard.general.contains(pasteboardTypes: UIImage.readableTypeIdentifiersForItemProvider) {
+                composeController.paste(itemProviders: UIPasteboard.general.itemProviders)
+            } else {
+                super.paste(sender)
+            }
+        }
+    }
+    
+    class Coordinator: NSObject, UITextViewDelegate, ComposeInput, TextViewCaretScrolling {
+        weak var textView: UITextView?
+        
+        let controller: ComposeController
+        var text: Binding<String>
+        let textDidChange: (UITextView) -> Void
+        
+        var caretScrollPositionAnimator: UIViewPropertyAnimator?
+        
+        @Published var autocompleteState: AutocompleteState?
+        var autocompleteStatePublisher: Published<AutocompleteState?>.Publisher { $autocompleteState }
+        var skipNextSelectionChangedAutocompleteUpdate = false
+        
+        init(controller: ComposeController, text: Binding<String>, textDidChange: @escaping (UITextView) -> Void) {
+            self.controller = controller
+            self.text = text
+            self.textDidChange = textDidChange
+            
+            super.init()
+            
+            NotificationCenter.default.addObserver(self, selector: #selector(keyboardDidShow), name: UIResponder.keyboardDidShowNotification, object: nil)
+        }
+        
+        @objc private func keyboardDidShow() {
+            guard let textView,
+                  textView.isFirstResponder else {
+                return
+            }
+            ensureCursorVisible(textView: textView)
+        }
+        
+        // MARK: UITextViewDelegate
+        
+        func textViewDidChange(_ textView: UITextView) {
+            text.wrappedValue = textView.text
+            textDidChange(textView)
+            
+            ensureCursorVisible(textView: textView)
+        }
+        
+        func textViewDidBeginEditing(_ textView: UITextView) {
+            controller.currentInput = self
+            updateAutocompleteState()
+        }
+        
+        func textViewDidEndEditing(_ textView: UITextView) {
+            controller.currentInput = nil
+            updateAutocompleteState()
+        }
+        
+        func textViewDidChangeSelection(_ textView: UITextView) {
+            if skipNextSelectionChangedAutocompleteUpdate {
+                skipNextSelectionChangedAutocompleteUpdate = false
+            } else {
+                updateAutocompleteState()
+            }
+        }
+        
+        func textView(_ textView: UITextView, editMenuForTextIn range: NSRange, suggestedActions: [UIMenuElement]) -> UIMenu? {
+            var actions = suggestedActions
+            if controller.config.contentType != .plain,
+               let index = suggestedActions.firstIndex(where: { ($0 as? UIMenu)?.identifier.rawValue == "com.apple.menu.format" }) {
+                if range.length > 0 {
+                    let formatMenu = suggestedActions[index] as! UIMenu
+                    let newFormatMenu = formatMenu.replacingChildren(StatusFormat.allCases.map { fmt in
+                        return UIAction(title: fmt.accessibilityLabel, image: UIImage(systemName: fmt.imageName)) { [weak self] _ in
+                            self?.applyFormat(fmt)
+                        }
+                    })
+                    actions[index] = newFormatMenu
+                } else {
+                    actions.remove(at: index)
+                }
+            }
+            if range.length == 0 {
+                actions.append(UIAction(title: "Insert Emoji", image: UIImage(systemName: "face.smiling"), handler: { [weak self] _ in
+                    self?.controller.shouldEmojiAutocompletionBeginExpanded = true
+                    self?.beginAutocompletingEmoji()
+                }))
+            }
+            return UIMenu(children: actions)
+        }
+        
+        // MARK: ComposeInput
+        
+        var toolbarElements: [ToolbarElement] {
+            [.emojiPicker, .formattingButtons]
+        }
+        
+        var textInputMode: UITextInputMode? {
+            textView?.textInputMode
+        }
+        
+        func autocomplete(with string: String) {
+            textView?.autocomplete(with: string, permittedModes: .all, autocompleteState: &autocompleteState)
+        }
+        
+        func applyFormat(_ format: StatusFormat) {
+            guard let textView,
+                  textView.isFirstResponder,
+                  let insertionResult = format.insertionResult(for: controller.config.contentType) else {
+                return
+            }
+            
+            let currentSelectedRange = textView.selectedRange
+            if currentSelectedRange.length == 0 {
+                textView.insertText(insertionResult.prefix + insertionResult.suffix)
+                textView.selectedRange = NSRange(location: currentSelectedRange.location + insertionResult.insertionPoint, length: 0)
+            } else {
+                let start = textView.text.utf16.index(textView.text.utf16.startIndex, offsetBy: currentSelectedRange.lowerBound)
+                let end = textView.text.utf16.index(textView.text.utf16.startIndex, offsetBy: currentSelectedRange.upperBound)
+                let selectedText = textView.text.utf16[start..<end]
+                textView.insertText(insertionResult.prefix + String(Substring(selectedText)) + insertionResult.suffix)
+                textView.selectedRange = NSRange(location: currentSelectedRange.location + insertionResult.insertionPoint, length: currentSelectedRange.length)
+            }
+        }
+        
+        func beginAutocompletingEmoji() {
+            guard let textView else {
+                return
+            }
+            var insertSpace = false
+            if let text = textView.text,
+               textView.selectedRange.upperBound > 0 {
+                let characterBeforeCursorIndex = text.utf16.index(before: text.utf16.index(text.startIndex, offsetBy: textView.selectedRange.upperBound))
+                insertSpace = !text[characterBeforeCursorIndex].isWhitespace
+            }
+            textView.insertText((insertSpace ? " " : "") + ":")
+        }
+        
+        private func updateAutocompleteState() {
+            guard let textView else {
+                autocompleteState = nil
+                return
+            }
+            autocompleteState = textView.updateAutocompleteState(permittedModes: .all)
+        }
+        
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/PollOptionView.swift

@@ -0,0 +1,72 @@
+//
+//  PollOptionView.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 3/25/23.
+//
+
+import SwiftUI
+
+struct PollOptionView: View {
+    @EnvironmentObject private var controller: PollController
+    @EnvironmentObject private var poll: Poll
+    @ObservedObject private var option: PollOption
+    let remove: () -> Void
+    
+    init(option: PollOption, remove: @escaping () -> Void) {
+        self.option = option
+        self.remove = remove
+    }
+    
+    var body: some View {
+        HStack(spacing: 4) {
+            Checkbox(radiusFraction: poll.multiple ? 0.1 : 0.5, background: controller.parent.config.backgroundColor)
+                .animation(.default, value: poll.multiple)
+            
+            textField
+            
+            Button(action: remove) {
+                Image(systemName: "minus.circle.fill")
+            }
+            .accessibilityLabel("Remove option")
+            .buttonStyle(.plain)
+            .foregroundColor(poll.options.count == 1 ? .gray : .red)
+            .disabled(poll.options.count == 1)
+            .hoverEffect()
+        }
+    }
+    
+    private var textField: some View {
+        let index = poll.options.index(of: option)
+        let placeholder = index != NSNotFound ? "Option \(index + 1)" : ""
+        let maxLength = controller.parent.mastodonController.instanceFeatures.maxPollOptionChars
+        return EmojiTextField(text: $option.text, placeholder: placeholder, maxLength: maxLength)
+    }
+    
+    struct Checkbox: View {
+        private let radiusFraction: CGFloat
+        private let size: CGFloat = 20
+        private let innerSize: CGFloat
+        private let background: Color
+        
+        init(radiusFraction: CGFloat, background: Color) {
+            self.radiusFraction = radiusFraction
+            self.innerSize = self.size - 4
+            self.background = background
+        }
+        
+        var body: some View {
+            ZStack {
+                Rectangle()
+                    .foregroundColor(.gray)
+                    .frame(width: size, height: size)
+                    .cornerRadius(radiusFraction * size)
+                
+                Rectangle()
+                    .foregroundColor(background)
+                    .frame(width: innerSize, height: innerSize)
+                    .cornerRadius(radiusFraction * innerSize)
+            }
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/ReplyStatusView.swift

@@ -1,23 +1,23 @@
 //
-//  ComposeReplyView.swift
-//  Tusker
+//  ReplyStatusView.swift
+//  ComposeUI
 //
-//  Created by Shadowfacts on 8/22/20.
-//  Copyright © 2020 Shadowfacts. All rights reserved.
+//  Created by Shadowfacts on 3/25/23.
 //
 
 import SwiftUI
+import Pachyderm
+import TuskerComponents
 
-struct ComposeReplyView: View {
-    let status: StatusMO
+struct ReplyStatusView: View {
+    let status: any StatusProtocol
     let rowTopInset: CGFloat
     let globalFrameOutsideList: CGRect
     
+    @EnvironmentObject private var controller: ComposeController
     @State private var displayNameHeight: CGFloat?
     @State private var contentHeight: CGFloat?
     
-    @ObservedObject private var preferences = Preferences.shared
-    
     private let horizSpacing: CGFloat = 8
     
     var body: some View {
@@ -27,12 +27,12 @@ struct ComposeReplyView: View {
             
             VStack(alignment: .leading, spacing: 0) {
                 HStack {
-                    AccountDisplayNameLabel(account: status.account, textStyle: .body, emojiSize: 17)
+                    controller.displayNameLabel(status.account, .body, 17)
                         .lineLimit(1)
                         .layoutPriority(1)
                     
                     Text(verbatim: "@\(status.account.acct)")
-                        .font(.system(size: 17, weight: .light))
+                        .font(.body.weight(.light))
                         .foregroundColor(.secondary)
                         .lineLimit(1)
                     
@@ -46,7 +46,7 @@ struct ComposeReplyView: View {
                         }
                 })
                 
-                ComposeReplyContentView(status: status) { newHeight in
+                controller.replyContentView(status) { newHeight in
                     // otherwise, with long in-reply-to statuses, the main content text view position seems not to update
                     // and it ends up  partially behind the header
                     DispatchQueue.main.async {
@@ -76,11 +76,16 @@ struct ComposeReplyView: View {
         // once you scroll past the in-reply-to-content, the bottom of the avatar should be pinned to the bottom of the content
         offset = min(offset, maxOffset)
 
-        return ComposeAvatarImageView(url: status.account.avatar)
-            .frame(width: 50, height: 50)
-            .cornerRadius(preferences.avatarStyle.cornerRadiusFraction * 50)
-            .offset(x: 0, y: offset)
-            .accessibilityHidden(true)
+        return AvatarContainerRepresentable(offset: offset) {
+            AvatarImageView(
+                url: status.account.avatar,
+                size: 50,
+                style: controller.config.avatarStyle,
+                fetchAvatar: controller.fetchAvatar
+            )
+        }
+        .frame(width: 50, height: 50)
+        .accessibilityHidden(true)
     }
 
 }
@@ -92,8 +97,38 @@ private struct DisplayNameHeightPrefKey: PreferenceKey {
     }
 }
 
-//struct ComposeReplyView_Previews: PreviewProvider {
-//    static var previews: some View {
-//        ComposeReplyView()
-//    }
-//}
+// This whole dance is necessary so that the offset can be animatable from
+// UIKit animations, like TextViewCaretScrolling.
+private struct AvatarContainerRepresentable<Content: View>: UIViewControllerRepresentable {
+    let offset: CGFloat
+    @ViewBuilder let content: Content
+
+    func makeUIViewController(context: Context) -> Controller {
+        Controller(host: UIHostingController(rootView: content))
+    }
+    
+    func updateUIViewController(_ uiViewController: Controller, context: Context) {
+        uiViewController.host.rootView = content
+        uiViewController.host.view.transform = CGAffineTransform(translationX: 0, y: offset)
+    }
+ 
+    // This extra layer is necessary because applying a transform to the
+    // representable's VC's view doesn't seem to have an effect.
+    class Controller: UIViewController {
+        let host: UIHostingController<Content>
+        
+        init(host: UIHostingController<Content>) {
+            self.host = host
+            super.init(nibName: nil, bundle: nil)
+            addChild(host)
+            host.view.autoresizingMask = [.flexibleWidth, .flexibleHeight]
+            view.addSubview(host.view)
+            host.view.frame = view.bounds
+            host.didMove(toParent: self)
+        }
+        
+        required init?(coder: NSCoder) {
+            fatalError("init(coder:) has not been implemented")
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/WrappedProgressView.swift

@@ -0,0 +1,29 @@
+//
+//  WrappedProgressView.swift
+//  Tusker
+//
+//  Created by Shadowfacts on 8/30/20.
+//  Copyright © 2020 Shadowfacts. All rights reserved.
+//
+
+import SwiftUI
+
+struct WrappedProgressView: UIViewRepresentable {
+    typealias UIViewType = UIProgressView
+    
+    let value: Int
+    let total: Int
+    
+    func makeUIView(context: Context) -> UIProgressView {
+        return UIProgressView(progressViewStyle: .bar)
+    }
+    
+    func updateUIView(_ uiView: UIProgressView, context: Context) {
+        if total > 0 {
+            let progress = Float(value) / Float(total)
+            uiView.setProgress(progress, animated: true)
+        } else {
+            uiView.setProgress(0, animated: true)
+        }
+    }
+}

Packages/ComposeUI/Sources/ComposeUI/Views/ZoomableScrollView.swift

@@ -0,0 +1,111 @@
+//
+//  ZoomableScrollView.swift
+//  ComposeUI
+//
+//  Created by Shadowfacts on 4/29/23.
+//
+
+import SwiftUI
+
+@available(iOS 16.0, *)
+struct ZoomableScrollView<Content: View>: UIViewControllerRepresentable {
+    let content: Content
+    
+    init(@ViewBuilder content: () -> Content) {
+        self.content = content()
+    }
+    
+    func makeUIViewController(context: Context) -> Controller {
+        return Controller(content: content)
+    }
+
+    func updateUIViewController(_ uiViewController: Controller, context: Context) {
+        uiViewController.host.rootView = content
+    }
+    
+    class Controller: UIViewController, UIScrollViewDelegate {
+        let scrollView = UIScrollView()
+        let host: UIHostingController<Content>
+        
+        private var lastIntrinsicSize: CGSize?
+        private var contentViewTopConstraint: NSLayoutConstraint!
+        private var contentViewLeadingConstraint: NSLayoutConstraint!
+        private var hostBoundsObservation: NSKeyValueObservation?
+        
+        init(content: Content) {
+            self.host = UIHostingController(rootView: content)
+            
+            super.init(nibName: nil, bundle: nil)
+        }
+        
+        required init?(coder: NSCoder) {
+            fatalError("init(coder:) has not been implemented")
+        }
+        
+        override func viewDidLoad() {
+            super.viewDidLoad()
+            
+            scrollView.delegate = self
+            scrollView.bouncesZoom = true
+            scrollView.translatesAutoresizingMaskIntoConstraints = false
+            view.addSubview(scrollView)
+            
+            host.sizingOptions = .intrinsicContentSize
+            host.view.backgroundColor = .clear
+            host.view.translatesAutoresizingMaskIntoConstraints = false
+            addChild(host)
+            scrollView.addSubview(host.view)
+            host.didMove(toParent: self)
+            
+            contentViewLeadingConstraint = host.view.leadingAnchor.constraint(equalTo: scrollView.contentLayoutGuide.leadingAnchor)
+            contentViewTopConstraint = host.view.topAnchor.constraint(equalTo: scrollView.contentLayoutGuide.topAnchor)
+            
+            NSLayoutConstraint.activate([
+                scrollView.frameLayoutGuide.leadingAnchor.constraint(equalTo: view.leadingAnchor),
+                scrollView.frameLayoutGuide.trailingAnchor.constraint(equalTo: view.trailingAnchor),
+                scrollView.frameLayoutGuide.topAnchor.constraint(equalTo: view.topAnchor),
+                scrollView.frameLayoutGuide.bottomAnchor.constraint(equalTo: view.bottomAnchor),
+                
+                contentViewLeadingConstraint,
+                contentViewTopConstraint,
+            ])
+        }
+        
+        override func viewDidLayoutSubviews() {
+            super.viewDidLayoutSubviews()
+            
+            if !host.view.intrinsicContentSize.equalTo(.zero),
+               host.view.intrinsicContentSize != lastIntrinsicSize {
+                self.lastIntrinsicSize = host.view.intrinsicContentSize
+                
+                let maxHeight = view.bounds.height - view.safeAreaInsets.top - view.safeAreaInsets.bottom
+                let maxWidth = view.bounds.width - view.safeAreaInsets.left - view.safeAreaInsets.right
+                let heightScale = maxHeight / host.view.intrinsicContentSize.height
+                let widthScale = maxWidth / host.view.intrinsicContentSize.width
+                let minScale = min(widthScale, heightScale)
+                let maxScale = minScale >= 1 ? minScale + 2 : 2
+                scrollView.minimumZoomScale = minScale
+                scrollView.maximumZoomScale = maxScale
+                scrollView.zoomScale = minScale
+            }
+            
+            centerImage()
+        }
+        
+        func viewForZooming(in scrollView: UIScrollView) -> UIView? {
+            return host.view
+        }
+        
+        func scrollViewDidZoom(_ scrollView: UIScrollView) {
+            centerImage()
+        }
+        
+        func centerImage() {
+            let yOffset = max(0, (view.bounds.size.height - host.view.bounds.height * scrollView.zoomScale) / 2)
+            contentViewTopConstraint.constant = yOffset
+
+            let xOffset = max(0, (view.bounds.size.width - host.view.bounds.width * scrollView.zoomScale) / 2)
+            contentViewLeadingConstraint.constant = xOffset
+        }
+    }
+}

Packages/ComposeUI/Tests/ComposeUITests/CharacterCounterTests.swift

@@ -1,13 +1,14 @@
 //
 //  CharacterCounterTests.swift
-//  PachydermTests
+//  ComposeUITests
 //
 //  Created by Shadowfacts on 9/29/18.
 //  Copyright © 2018 Shadowfacts. All rights reserved.
 //
 
 import XCTest
-@testable import Pachyderm
+@testable import ComposeUI
+import InstanceFeatures
 
 class CharacterCounterTests: XCTestCase {
 
@@ -17,31 +18,33 @@ class CharacterCounterTests: XCTestCase {
     override func tearDown() {
     }
     
+    let features = InstanceFeatures()
+
     func testCountEmpty() {
-        XCTAssertEqual(CharacterCounter.count(text: ""), 0)
+        XCTAssertEqual(CharacterCounter.count(text: "", for: features), 0)
     }
     
     func testCountPlainText() {
-        XCTAssertEqual(CharacterCounter.count(text: "This is an example message"), 26)
-        XCTAssertEqual(CharacterCounter.count(text: "This is an example message with an Emoji: 😄"), 43)
-        XCTAssertEqual(CharacterCounter.count(text: "😄😄😄😄😄😄😄"), 7)
+        XCTAssertEqual(CharacterCounter.count(text: "This is an example message", for: features), 26)
+        XCTAssertEqual(CharacterCounter.count(text: "This is an example message with an Emoji: 😄", for: features), 43)
+        XCTAssertEqual(CharacterCounter.count(text: "😄😄😄😄😄😄😄", for: features), 7)
     }
     
     func testCountLinks() {
-        XCTAssertEqual(CharacterCounter.count(text: "This is an example with a link: https://example.com"), 55)
-        XCTAssertEqual(CharacterCounter.count(text: "This is an example with a link 😄: https://example.com"), 57)
-        XCTAssertEqual(CharacterCounter.count(text: "😄😄😄😄😄😄😄: https://example.com"), 32)
-        XCTAssertEqual(CharacterCounter.count(text: "This is an example with a link: https://a.much.longer.example.com/link?foo=bar#baz"), 55)
+        XCTAssertEqual(CharacterCounter.count(text: "This is an example with a link: https://example.com", for: features), 55)
+        XCTAssertEqual(CharacterCounter.count(text: "This is an example with a link 😄: https://example.com", for: features), 57)
+        XCTAssertEqual(CharacterCounter.count(text: "😄😄😄😄😄😄😄: https://example.com", for: features), 32)
+        XCTAssertEqual(CharacterCounter.count(text: "This is an example with a link: https://a.much.longer.example.com/link?foo=bar#baz", for: features), 55)
     }
     
     func testCountLocalMentions() {
-        XCTAssertEqual(CharacterCounter.count(text: "hello @example"), 14)
-        XCTAssertEqual(CharacterCounter.count(text: "@some_really_long_name"), 22)
+        XCTAssertEqual(CharacterCounter.count(text: "hello @example", for: features), 14)
+        XCTAssertEqual(CharacterCounter.count(text: "@some_really_long_name", for: features), 22)
     }
     
     func testCountRemoteMentions() {
-        XCTAssertEqual(CharacterCounter.count(text: "hello @example@some.remote.social"), 14)
-        XCTAssertEqual(CharacterCounter.count(text: "hello @some_really_long_name@some-long.remote-instance.social"), 28)
+        XCTAssertEqual(CharacterCounter.count(text: "hello @example@some.remote.social", for: features), 14)
+        XCTAssertEqual(CharacterCounter.count(text: "hello @some_really_long_name@some-long.remote-instance.social", for: features), 28)
     }
 
 }

Packages/ComposeUI/Tests/ComposeUITests/FuzzyMatcherTests.swift

@@ -0,0 +1,25 @@
+//
+//  FuzzyMatcherTests.swift
+//  ComposeUITests
+//
+//  Created by Shadowfacts on 10/11/20.
+//  Copyright © 2020 Shadowfacts. All rights reserved.
+//
+
+import XCTest
+@testable import ComposeUI
+
+class FuzzyMatcherTests: XCTestCase {
+
+    func testExample() throws {
+        XCTAssertEqual(FuzzyMatcher.match(pattern: "foo", str: "foo").score, 6)
+        XCTAssertEqual(FuzzyMatcher.match(pattern: "foo", str: "faoao").score, 4)
+        XCTAssertEqual(FuzzyMatcher.match(pattern: "foo", str: "aaa").score, -6)
+        
+        XCTAssertEqual(FuzzyMatcher.match(pattern: "bar", str: "baz").score, 2)
+        XCTAssertEqual(FuzzyMatcher.match(pattern: "bar", str: "bur").score, 1)
+        
+        XCTAssertGreaterThan(FuzzyMatcher.match(pattern: "sir", str: "sir").score, FuzzyMatcher.match(pattern: "sir", str: "georgespolitzer").score)
+    }
+
+}

Packages/Duckable/Package.swift

@@ -1,4 +1,4 @@
-// swift-tools-version: 5.7
+// swift-tools-version: 6.0
 // The swift-tools-version declares the minimum version of Swift required to build this package.
 
 import PackageDescription
@@ -6,7 +6,7 @@ import PackageDescription
 let package = Package(
     name: "Duckable",
     platforms: [
-        .iOS(.v15),
+        .iOS(.v16),
     ],
     products: [
         // Products define the executables and libraries a package produces, and make them visible to other packages.
@@ -23,9 +23,12 @@ let package = Package(
         // Targets can depend on other targets in this package, and on products in packages this package depends on.
         .target(
             name: "Duckable",
-            dependencies: []),
-        .testTarget(
-            name: "DuckableTests",
-            dependencies: ["Duckable"]),
+            dependencies: [],
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
+            ]),
+//        .testTarget(
+//            name: "DuckableTests",
+//            dependencies: ["Duckable"]),
     ]
 )

Packages/Duckable/Sources/Duckable/API.swift

@@ -7,8 +7,9 @@
 
 import UIKit
 
+@MainActor
 public protocol DuckableViewController: UIViewController {
-    var duckableDelegate: DuckableViewControllerDelegate? { get set }
+    func duckableViewControllerShouldDuck() -> DuckAttemptAction
     
     func duckableViewControllerMayAttemptToDuck()
     
@@ -18,22 +19,25 @@ public protocol DuckableViewController: UIViewController {
 }
 
 extension DuckableViewController {
+    public func duckableViewControllerShouldDuck() -> DuckAttemptAction { .duck }
     public func duckableViewControllerMayAttemptToDuck() {}
     public func duckableViewControllerWillAnimateDuck(withDuration duration: CGFloat, afterDelay delay: CGFloat) {}
     public func duckableViewControllerDidFinishAnimatingDuck() {}
 }
 
-public protocol DuckableViewControllerDelegate: AnyObject {
-    func duckableViewControllerWillDismiss(animated: Bool)
+public enum DuckAttemptAction {
+    case duck
+    case dismiss
+    case block
 }
 
 extension UIViewController {
     @available(iOS 16.0, *)
-    public func presentDuckable(_ viewController: DuckableViewController, animated: Bool, isDucked: Bool = false) -> Bool {
+    public func presentDuckable(_ viewController: DuckableViewController, animated: Bool, isDucked: Bool = false, completion: (() -> Void)? = nil) -> Bool {
         var cur: UIViewController? = self
         while let vc = cur {
             if let container = vc as? DuckableContainerViewController {
-                container.presentDuckable(viewController, animated: animated, isDucked: isDucked, completion: nil)
+                container._presentDuckable(viewController, animated: animated, isDucked: isDucked, completion: completion)
                 return true
             } else {
                 cur = vc.parent

Packages/Duckable/Sources/Duckable/DuckAnimationController.swift

@@ -63,6 +63,9 @@ class DuckAnimationController: NSObject, UIViewControllerAnimatedTransitioning {
             let fadeAnimator = UIViewPropertyAnimator(duration: 0.1, curve: .linear) {
                 presented.view.layer.opacity = 0
             }
+            fadeAnimator.addCompletion { _ in
+                presented.view.layer.opacity = 1
+            }
             fadeAnimator.startAnimation(afterDelay: 0.3)
 
         } else {
@@ -80,6 +83,7 @@ class DuckAnimationController: NSObject, UIViewControllerAnimatedTransitioning {
                 presented.view.layer.opacity = 0
             }
             fadeAnimator.addCompletion { _ in
+                presented.view.layer.opacity = 1
                 duckable.duckableViewControllerDidFinishAnimatingDuck()
                 transitionContext.completeTransition(true)
             }

Packages/Duckable/Sources/Duckable/DuckableContainerViewController.swift

@@ -11,7 +11,7 @@ let duckedCornerRadius: CGFloat = 10
 let detentHeight: CGFloat = 44
 
 @available(iOS 16.0, *)
-public class DuckableContainerViewController: UIViewController, DuckableViewControllerDelegate {
+public class DuckableContainerViewController: UIViewController {
     
     public let child: UIViewController
     private var bottomConstraint: NSLayoutConstraint!
@@ -58,11 +58,13 @@ public class DuckableContainerViewController: UIViewController, DuckableViewCont
         ])
     }
     
-    func presentDuckable(_ viewController: DuckableViewController, animated: Bool, isDucked: Bool, completion: (() -> Void)?) {
+    func _presentDuckable(_ viewController: DuckableViewController, animated: Bool, isDucked: Bool, completion: (() -> Void)?) {
         guard case .idle = state else {
             if animated,
                case .ducked(_, placeholder: let placeholder) = state {
-                UIImpactFeedbackGenerator(style: .soft).impactOccurred()
+                #if !os(visionOS)
+                UIImpactFeedbackGenerator(style: .light).impactOccurred()
+                #endif
                 let origConstant = placeholder.topConstraint.constant
                 UIView.animateKeyframes(withDuration: 0.4, delay: 0) {
                     UIView.addKeyframe(withRelativeStartTime: 0, relativeDuration: 0.5) {
@@ -87,17 +89,18 @@ public class DuckableContainerViewController: UIViewController, DuckableViewCont
     }
     
     private func doPresentDuckable(_ viewController: DuckableViewController, animated: Bool, completion: (() -> Void)?) {
-        viewController.duckableDelegate = self
-        let nav = UINavigationController(rootViewController: viewController)
-        nav.modalPresentationStyle = .custom
-        nav.transitioningDelegate = self
-        present(nav, animated: animated) {
+        viewController.modalPresentationStyle = .custom
+        viewController.transitioningDelegate = self
+        present(viewController, animated: animated) {
             self.configureChildForDuckedPlaceholder()
             completion?()
         }
     }
     
-    public func duckableViewControllerWillDismiss(animated: Bool) {
+    func dismissalTransitionWillBegin() {
+        guard case .presentingDucked(_, _) = state else {
+            return
+        }
         state = .idle
         bottomConstraint.isActive = false
         bottomConstraint = child.view.bottomAnchor.constraint(equalTo: view.bottomAnchor)
@@ -136,10 +139,18 @@ public class DuckableContainerViewController: UIViewController, DuckableViewCont
         guard case .presentingDucked(let viewController, isFirstPresentation: _) = state else {
             return
         }
-        let placeholder = createPlaceholderForDuckedViewController(viewController)
-        state = .ducked(viewController, placeholder: placeholder)
-        configureChildForDuckedPlaceholder()
-        dismiss(animated: true)
+        switch viewController.duckableViewControllerShouldDuck() {
+        case .duck:
+            let placeholder = createPlaceholderForDuckedViewController(viewController)
+            state = .ducked(viewController, placeholder: placeholder)
+            configureChildForDuckedPlaceholder()
+            dismiss(animated: true)
+        case .block:
+            viewController.sheetPresentationController!.selectedDetentIdentifier = .large
+        case .dismiss:
+//            duckableViewControllerWillDismiss()
+            dismiss(animated: true)
+        }
     }
     
     private func configureChildForDuckedPlaceholder() {
@@ -148,6 +159,7 @@ public class DuckableContainerViewController: UIViewController, DuckableViewCont
         bottomConstraint.isActive = true
         
         child.view.layer.cornerRadius = duckedCornerRadius
+        child.view.layer.cornerCurve = .continuous
         child.view.layer.maskedCorners = [.layerMinXMaxYCorner, .layerMaxXMaxYCorner]
         child.view.layer.masksToBounds = true
     }
@@ -181,7 +193,7 @@ public class DuckableContainerViewController: UIViewController, DuckableViewCont
 @available(iOS 16.0, *)
 extension DuckableContainerViewController: UIViewControllerTransitioningDelegate {
     public func presentationController(forPresented presented: UIViewController, presenting: UIViewController?, source: UIViewController) -> UIPresentationController? {
-        let controller = UISheetPresentationController(presentedViewController: presented, presenting: presenting)
+        let controller = DuckableSheetPresentationController(presentedViewController: presented, presenting: presenting)
         controller.delegate = self
         controller.prefersGrabberVisible = true
         controller.selectedDetentIdentifier = .large
@@ -207,6 +219,14 @@ extension DuckableContainerViewController: UIViewControllerTransitioningDelegate
     }
 }
 
+@available(iOS 16.0, *)
+class DuckableSheetPresentationController: UISheetPresentationController {
+    override func dismissalTransitionWillBegin() {
+        super.dismissalTransitionWillBegin()
+        (self.delegate as! DuckableContainerViewController).dismissalTransitionWillBegin()
+    }
+}
+
 @available(iOS 16.0, *)
 extension DuckableContainerViewController: UISheetPresentationControllerDelegate {
     public func presentationController(_ presentationController: UIPresentationController, willPresentWithAdaptiveStyle style: UIModalPresentationStyle, transitionCoordinator: UIViewControllerTransitionCoordinator?) {
@@ -236,4 +256,3 @@ extension DuckableContainerViewController: UISheetPresentationControllerDelegate
         }
     }
 }
-

Packages/GalleryVC/.gitignore

@@ -0,0 +1,8 @@
+.DS_Store
+/.build
+/Packages
+xcuserdata/
+DerivedData/
+.swiftpm/configuration/registries.json
+.swiftpm/xcode/package.xcworkspace/contents.xcworkspacedata
+.netrc

Packages/GalleryVC/Package.swift

@@ -0,0 +1,32 @@
+// swift-tools-version: 6.0
+// The swift-tools-version declares the minimum version of Swift required to build this package.
+
+import PackageDescription
+
+let package = Package(
+    name: "GalleryVC",
+    platforms: [
+        .iOS(.v16),
+    ],
+    products: [
+        // Products define the executables and libraries a package produces, making them visible to other packages.
+        .library(
+            name: "GalleryVC",
+            targets: ["GalleryVC"]),
+    ],
+    targets: [
+        // Targets are the basic building blocks of a package, defining a module or a test suite.
+        // Targets can depend on other targets in this package and products from dependencies.
+        .target(
+            name: "GalleryVC",
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
+            ]),
+        .testTarget(
+            name: "GalleryVCTests",
+            dependencies: ["GalleryVC"],
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
+            ]),
+    ]
+)

Packages/GalleryVC/Sources/GalleryVC/GalleryContentViewController.swift

@@ -0,0 +1,46 @@
+//
+//  GalleryContentViewController.swift
+//  GalleryVC
+//
+//  Created by Shadowfacts on 3/17/24.
+//
+
+import UIKit
+
+@MainActor
+public protocol GalleryContentViewController: UIViewController {
+    var container: GalleryContentViewControllerContainer? { get set }
+    var contentSize: CGSize { get }
+    var activityItemsForSharing: [Any] { get }
+    var caption: String? { get }
+    var contentOverlayAccessoryViewController: UIViewController? { get }
+    var bottomControlsAccessoryViewController: UIViewController? { get }
+    var canAnimateFromSourceView: Bool { get }
+    
+    func setControlsVisible(_ visible: Bool, animated: Bool, dueToUserInteraction: Bool)
+    func galleryContentDidAppear()
+    func galleryContentWillDisappear()
+}
+
+public extension GalleryContentViewController {
+    var contentOverlayAccessoryViewController: UIViewController? {
+        nil
+    }
+
+    var bottomControlsAccessoryViewController: UIViewController? {
+        nil
+    }
+    
+    var canAnimateFromSourceView: Bool {
+        true
+    }
+    
+    func setControlsVisible(_ visible: Bool, animated: Bool, dueToUserInteraction: Bool) {
+    }
+    
+    func galleryContentDidAppear() {
+    }
+    
+    func galleryContentWillDisappear() {
+    }
+}

Packages/GalleryVC/Sources/GalleryVC/GalleryContentViewControllerContainer.swift

@@ -0,0 +1,18 @@
+//
+//  GalleryContentViewControllerContainer.swift
+//  GalleryVC
+//
+//  Created by Shadowfacts on 12/28/23.
+//
+
+import Foundation
+
+@MainActor
+public protocol GalleryContentViewControllerContainer: AnyObject {
+    var galleryControlsVisible: Bool { get }
+    
+    func setGalleryContentLoading(_ loading: Bool)
+    func galleryContentChanged()
+    func disableGalleryScrollAndZoom()
+    func setGalleryControlsVisible(_ visible: Bool, animated: Bool)
+}

Packages/GalleryVC/Sources/GalleryVC/GalleryDataSource.swift

@@ -0,0 +1,22 @@
+//
+//  GalleryDataSource.swift
+//  GalleryVC
+//
+//  Created by Shadowfacts on 12/28/23.
+//
+
+import UIKit
+
+@MainActor
+public protocol GalleryDataSource {
+    func galleryItemsCount() -> Int
+    func galleryContentViewController(forItemAt index: Int) -> GalleryContentViewController
+    func galleryContentTransitionSourceView(forItemAt index: Int) -> UIView?
+    func galleryApplicationActivities(forItemAt index: Int) -> [UIActivity]?
+}
+
+public extension GalleryDataSource {
+    func galleryApplicationActivities(forItemAt index: Int) -> [UIActivity]? {
+        nil
+    }
+}

Packages/GalleryVC/Sources/GalleryVC/GalleryDismissAnimationController.swift

@@ -0,0 +1,140 @@
+//
+//  GalleryDismissAnimationController.swift
+//  GalleryVC
+//
+//  Created by Shadowfacts on 3/1/24.
+//
+
+import UIKit
+
+class GalleryDismissAnimationController: NSObject, UIViewControllerAnimatedTransitioning {
+    private let sourceView: UIView
+    private let interactiveTranslation: CGPoint?
+    private let interactiveVelocity: CGPoint?
+    
+    init(sourceView: UIView, interactiveTranslation: CGPoint?, interactiveVelocity: CGPoint?) {
+        self.sourceView = sourceView
+        self.interactiveTranslation = interactiveTranslation
+        self.interactiveVelocity = interactiveVelocity
+    }
+    
+    func transitionDuration(using transitionContext: (any UIViewControllerContextTransitioning)?) -> TimeInterval {
+        return 0.3
+    }
+    
+    func animateTransition(using transitionContext: any UIViewControllerContextTransitioning) {
+        guard let to = transitionContext.viewController(forKey: .to),
+              let from = transitionContext.viewController(forKey: .from) as? GalleryViewController else {
+            fatalError()
+        }
+        
+        let itemViewController = from.currentItemViewController
+        
+        if !itemViewController.content.canAnimateFromSourceView || (UIAccessibility.prefersCrossFadeTransitions && interactiveVelocity == nil) {
+            animateCrossFadeTransition(using: transitionContext)
+            return
+        }
+        
+        let container = transitionContext.containerView
+        let sourceFrameInContainer = container.convert(sourceView.bounds, from: sourceView)
+        let destFrameInContainer = container.convert(itemViewController.content.view.bounds, from: itemViewController.content.view)
+        
+        let origSourceTransform = sourceView.transform
+        let appliedSourceToDestTransform: Bool
+        if destFrameInContainer.width > 0 && destFrameInContainer.height > 0 {
+            appliedSourceToDestTransform = true
+            let scale = min(destFrameInContainer.width / sourceFrameInContainer.width, destFrameInContainer.height / sourceFrameInContainer.height)
+            let sourceToDestTransform = origSourceTransform
+                .translatedBy(x: destFrameInContainer.midX - sourceFrameInContainer.midX, y: destFrameInContainer.midY - sourceFrameInContainer.midY)
+                .scaledBy(x: scale, y: scale)
+            sourceView.transform = sourceToDestTransform
+        } else {
+            appliedSourceToDestTransform = false
+        }
+        
+        // Moving `to.view` to the container is necessary when the presenting VC (i.e., `to`)
+        // is in the window's root presentation.
+        // But it breaks when the gallery is presented from a sheet-presented VC--in which case
+        // `to.view` is already in the view hierarchy at this point; and adding it to the
+        // container causees it to be removed when the transition completes.
+        if to.view.superview == nil {
+            to.view.frame = container.bounds
+            container.addSubview(to.view)
+        }
+        
+        from.view.frame = container.bounds
+        container.addSubview(from.view)
+
+        let content = itemViewController.takeContent()
+        content.view.translatesAutoresizingMaskIntoConstraints = true
+        content.view.layer.masksToBounds = true
+        container.addSubview(content.view)
+        
+        content.view.frame = destFrameInContainer
+        content.view.layer.opacity = 1
+        
+        container.layoutIfNeeded()
+        
+        let duration = self.transitionDuration(using: transitionContext)
+        var initialVelocity: CGVector
+        if let interactiveVelocity,
+           let interactiveTranslation,
+           // very short/fast flicks don't transfer their velocity, since it makes size change animation look wacky due to the springs initial undershoot
+           sqrt(pow(interactiveTranslation.x, 2) + pow(interactiveTranslation.y, 2)) > 100,
+           sqrt(pow(interactiveVelocity.x, 2) + pow(interactiveVelocity.y, 2)) < 2000 {
+            let xDistance = sourceFrameInContainer.midX - destFrameInContainer.midX
+            let yDistance = sourceFrameInContainer.midY - destFrameInContainer.midY
+            initialVelocity = CGVector(
+                dx: xDistance == 0 ? 0 : interactiveVelocity.x / xDistance,
+                dy: yDistance == 0 ? 0 : interactiveVelocity.y / yDistance
+            )
+        } else {
+            initialVelocity = .zero
+        }
+        initialVelocity.dx = max(-10, min(10, initialVelocity.dx))
+        initialVelocity.dy = max(-10, min(10, initialVelocity.dy))
+        // no bounce for the dismiss animation
+        let spring = UISpringTimingParameters(mass: 1, stiffness: 439, damping: 42, initialVelocity: initialVelocity)
+        let animator = UIViewPropertyAnimator(duration: duration, timingParameters: spring)
+        
+        animator.addAnimations {
+            from.view.layer.opacity = 0
+            
+            if appliedSourceToDestTransform {
+                self.sourceView.transform = origSourceTransform
+            }
+            content.view.frame = sourceFrameInContainer
+            content.view.layer.opacity = 0
+            
+            itemViewController.setControlsVisible(false, animated: false, dueToUserInteraction: false)
+        }
+        
+        animator.addCompletion { _ in
+            transitionContext.completeTransition(true)
+        }
+        
+        animator.startAnimation()
+    }
+    
+    private func animateCrossFadeTransition(using transitionContext: UIViewControllerContextTransitioning) {
+        guard let fromVC = transitionContext.viewController(forKey: .from),
+              let toVC = transitionContext.viewController(forKey: .to) else {
+            return
+        }
+        
+        toVC.view.frame = transitionContext.containerView.bounds
+        fromVC.view.frame = transitionContext.containerView.bounds
+        transitionContext.containerView.addSubview(toVC.view)
+        transitionContext.containerView.addSubview(fromVC.view)
+        
+        let duration = transitionDuration(using: transitionContext)
+        let animator = UIViewPropertyAnimator(duration: duration, curve: .easeInOut)
+        animator.addAnimations {
+            fromVC.view.alpha = 0
+        }
+        animator.addCompletion { _ in
+            transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
+        }
+        animator.startAnimation()
+    }
+}

Packages/GalleryVC/Sources/GalleryVC/GalleryDismissInteraction.swift

@@ -0,0 +1,83 @@
+//
+//  GalleryDismissInteraction.swift
+//  GalleryVC
+//
+//  Created by Shadowfacts on 3/1/24.
+//
+
+import UIKit
+
+@MainActor
+class GalleryDismissInteraction: NSObject {
+    
+    private unowned let viewController: GalleryViewController
+    
+    private var content: GalleryContentViewController?
+    private var origContentFrameInGallery: CGRect?
+    private var origControlsVisible: Bool?
+
+    private(set) var isActive = false
+    private(set) var dismissVelocity: CGPoint?
+    private(set) var dismissTranslation: CGPoint?
+    
+    init(viewController: GalleryViewController) {
+        self.viewController = viewController
+        super.init()
+        let panRecognizer = UIPanGestureRecognizer(target: self, action: #selector(panRecognized))
+        panRecognizer.delegate = self
+        panRecognizer.allowedScrollTypesMask = .continuous
+        viewController.view.addGestureRecognizer(panRecognizer)
+    }
+    
+    @objc private func panRecognized(_ recognizer: UIPanGestureRecognizer) {
+        switch recognizer.state {
+        case .began:
+            isActive = true
+            
+            origContentFrameInGallery = viewController.view.convert(viewController.currentItemViewController.content.view.bounds, from: viewController.currentItemViewController.content.view)
+            content = viewController.currentItemViewController.takeContent()
+            content!.view.translatesAutoresizingMaskIntoConstraints = true
+            content!.view.frame = origContentFrameInGallery!
+            viewController.view.addSubview(content!.view)
+            
+            origControlsVisible = viewController.currentItemViewController.controlsVisible
+            if origControlsVisible! {
+                viewController.currentItemViewController.setControlsVisible(false, animated: true, dueToUserInteraction: false)
+            }
+            
+        case .changed:
+            let translation = recognizer.translation(in: viewController.view)
+            content!.view.frame = origContentFrameInGallery!.offsetBy(dx: translation.x, dy: translation.y)
+            
+        case .ended:
+            let translation = recognizer.translation(in: viewController.view)
+            let velocity = recognizer.velocity(in: viewController.view)
+            
+            dismissVelocity = velocity
+            dismissTranslation = translation
+            viewController.dismiss(animated: true)
+
+            // don't unset this until after dismiss is called, so that the dismiss animation controller can read it
+            isActive = false
+            
+        default:
+            break
+        }
+    }
+    
+}
+
+extension GalleryDismissInteraction: UIGestureRecognizerDelegate {
+    func gestureRecognizerShouldBegin(_ gestureRecognizer: UIGestureRecognizer) -> Bool {
+        let itemVC = viewController.currentItemViewController
+        if viewController.galleryDataSource.galleryContentTransitionSourceView(forItemAt: itemVC.itemIndex) == nil {
+            return false
+        } else if itemVC.scrollView.zoomScale > itemVC.scrollView.minimumZoomScale {
+            return false
+        } else if !itemVC.scrollAndZoomEnabled {
+            return false
+        } else {
+            return true
+        }
+    }
+}

Packages/GalleryVC/Sources/GalleryVC/GalleryItemViewController.swift

@@ -0,0 +1,570 @@
+//
+//  GalleryItemViewController.swift
+//  GalleryVC
+//
+//  Created by Shadowfacts on 12/28/23.
+//
+
+import UIKit
+import AVFoundation
+
+@MainActor
+protocol GalleryItemViewControllerDelegate: AnyObject {
+    func isGalleryBeingPresented() -> Bool
+    func addPresentationAnimationCompletion(_ block: @escaping () -> Void)
+    func galleryItemClose(_ item: GalleryItemViewController)
+    func galleryItemApplicationActivities(_ item: GalleryItemViewController) -> [UIActivity]?
+}
+
+class GalleryItemViewController: UIViewController {
+    private weak var delegate: GalleryItemViewControllerDelegate?
+    
+    let itemIndex: Int
+    let content: GalleryContentViewController
+    private var overlayVC: UIViewController?
+    
+    private var activityIndicator: UIActivityIndicatorView?
+    private(set) var scrollView: UIScrollView!
+    private var topControlsView: UIView!
+    private var shareButton: UIButton!
+    private var shareButtonLeadingConstraint: NSLayoutConstraint!
+    private var shareButtonTopConstraint: NSLayoutConstraint!
+    private var closeButtonTrailingConstraint: NSLayoutConstraint!
+    private var closeButtonTopConstraint: NSLayoutConstraint!
+    private var bottomControlsView: UIStackView!
+    private(set) var captionTextView: UITextView!
+    
+    private var singleTap: UITapGestureRecognizer!
+    private var doubleTap: UITapGestureRecognizer!
+
+    private var contentViewLeadingConstraint: NSLayoutConstraint?
+    private var contentViewTopConstraint: NSLayoutConstraint?
+
+    private(set) var controlsVisible: Bool = true
+    private(set) var scrollAndZoomEnabled = true
+    
+    private var scrollViewSizeForLastZoomScaleUpdate: CGSize?
+    
+    override var prefersHomeIndicatorAutoHidden: Bool {
+        return !controlsVisible
+    }
+    
+    init(delegate: GalleryItemViewControllerDelegate, itemIndex: Int, content: GalleryContentViewController) {
+        self.delegate = delegate
+        self.itemIndex = itemIndex
+        self.content = content
+        
+        super.init(nibName: nil, bundle: nil)
+        
+        content.container = self
+    }
+    
+    required init?(coder: NSCoder) {
+        fatalError("init(coder:) has not been implemented")
+    }
+    
+    override func viewDidLoad() {
+        super.viewDidLoad()
+        
+        scrollView = UIScrollView()
+        scrollView.translatesAutoresizingMaskIntoConstraints = false
+        scrollView.delegate = self
+        
+        view.addSubview(scrollView)
+        
+        addContent()
+        centerContent()
+        
+        overlayVC = content.contentOverlayAccessoryViewController
+        if let overlayVC {
+            overlayVC.view.isHidden = activityIndicator != nil
+            overlayVC.view.translatesAutoresizingMaskIntoConstraints = false
+            view.addSubview(overlayVC.view)
+            NSLayoutConstraint.activate([
+                overlayVC.view.leadingAnchor.constraint(equalTo: view.leadingAnchor),
+                overlayVC.view.trailingAnchor.constraint(equalTo: view.trailingAnchor),
+                overlayVC.view.topAnchor.constraint(equalTo: view.topAnchor),
+                overlayVC.view.bottomAnchor.constraint(equalTo: view.bottomAnchor),
+            ])
+        }
+        
+        topControlsView = UIView()
+        topControlsView.translatesAutoresizingMaskIntoConstraints = false
+        view.addSubview(topControlsView)
+        
+        var shareConfig = UIButton.Configuration.gray()
+        shareConfig.cornerStyle = .dynamic
+        shareConfig.background.backgroundColor = .black.withAlphaComponent(0.25)
+        shareConfig.baseForegroundColor = .white
+        shareConfig.image = UIImage(systemName: "square.and.arrow.up")
+        shareConfig.contentInsets = NSDirectionalEdgeInsets(top: 4, leading: 4, bottom: 4, trailing: 4)
+        shareButton = UIButton(configuration: shareConfig)
+        shareButton.addTarget(self, action: #selector(shareButtonPressed), for: .touchUpInside)
+        shareButton.isPointerInteractionEnabled = true
+        shareButton.pointerStyleProvider = { button, effect, shape in
+            return UIPointerStyle(effect: .highlight(effect.preview), shape: .roundedRect(button.frame))
+        }
+        shareButton.preferredBehavioralStyle = .pad
+        shareButton.translatesAutoresizingMaskIntoConstraints = false
+        updateShareButton()
+        topControlsView.addSubview(shareButton)
+        
+        var closeConfig = UIButton.Configuration.gray()
+        closeConfig.cornerStyle = .dynamic
+        closeConfig.background.backgroundColor = .black.withAlphaComponent(0.25)
+        closeConfig.baseForegroundColor = .white
+        closeConfig.image = UIImage(systemName: "xmark")
+        closeConfig.contentInsets = NSDirectionalEdgeInsets(top: 4, leading: 4, bottom: 4, trailing: 4)
+        let closeButton = UIButton(configuration: closeConfig)
+        closeButton.addTarget(self, action: #selector(closeButtonPressed), for: .touchUpInside)
+        closeButton.isPointerInteractionEnabled = true
+        closeButton.pointerStyleProvider = { button, effect, shape in
+            return UIPointerStyle(effect: .highlight(effect.preview), shape: .roundedRect(button.frame))
+        }
+        closeButton.preferredBehavioralStyle = .pad
+        closeButton.translatesAutoresizingMaskIntoConstraints = false
+        topControlsView.addSubview(closeButton)
+        
+        bottomControlsView = UIStackView()
+        bottomControlsView.translatesAutoresizingMaskIntoConstraints = false
+        bottomControlsView.axis = .vertical
+        bottomControlsView.alignment = .fill
+        bottomControlsView.backgroundColor = .black.withAlphaComponent(0.5)
+        view.addSubview(bottomControlsView)
+        
+        if let controlsAccessory = content.bottomControlsAccessoryViewController {
+            addChild(controlsAccessory)
+            bottomControlsView.addArrangedSubview(controlsAccessory.view)
+            controlsAccessory.didMove(toParent: self)
+            
+            // Make sure the controls accessory is within the safe area.
+            let spacer = UIView()
+            bottomControlsView.addArrangedSubview(spacer)
+            let spacerTopConstraint = spacer.topAnchor.constraint(equalTo: view.safeAreaLayoutGuide.bottomAnchor)
+            spacerTopConstraint.priority = .init(999)
+            spacerTopConstraint.isActive = true
+        }
+        
+        captionTextView = UITextView()
+        captionTextView.backgroundColor = .clear
+        captionTextView.textColor = .white
+        captionTextView.isEditable = false
+        captionTextView.isSelectable = true
+        captionTextView.font = .preferredFont(forTextStyle: .body)
+        captionTextView.adjustsFontForContentSizeCategory = true
+        captionTextView.alwaysBounceVertical = true
+        updateCaptionTextView()
+        bottomControlsView.addArrangedSubview(captionTextView)
+        
+        #if targetEnvironment(macCatalyst)
+        closeButtonTopConstraint = closeButton.topAnchor.constraint(equalTo: topControlsView.safeAreaLayoutGuide.topAnchor)
+        shareButtonTopConstraint = shareButton.topAnchor.constraint(equalTo: topControlsView.safeAreaLayoutGuide.topAnchor)
+        #else
+        closeButtonTopConstraint = closeButton.topAnchor.constraint(equalTo: topControlsView.topAnchor)
+        shareButtonTopConstraint = shareButton.topAnchor.constraint(equalTo: topControlsView.topAnchor)
+        #endif
+        closeButtonTrailingConstraint = topControlsView.trailingAnchor.constraint(equalTo: closeButton.trailingAnchor)
+        shareButtonLeadingConstraint = shareButton.leadingAnchor.constraint(equalTo: topControlsView.leadingAnchor)
+
+        NSLayoutConstraint.activate([
+            scrollView.leadingAnchor.constraint(equalTo: view.leadingAnchor),
+            scrollView.trailingAnchor.constraint(equalTo: view.trailingAnchor),
+            scrollView.topAnchor.constraint(equalTo: view.topAnchor),
+            scrollView.bottomAnchor.constraint(equalTo: view.bottomAnchor),
+            
+            topControlsView.leadingAnchor.constraint(equalTo: view.leadingAnchor),
+            topControlsView.trailingAnchor.constraint(equalTo: view.trailingAnchor),
+            topControlsView.topAnchor.constraint(equalTo: view.topAnchor),
+
+            shareButtonLeadingConstraint,
+            shareButtonTopConstraint,
+            shareButton.bottomAnchor.constraint(equalTo: topControlsView.bottomAnchor),
+            shareButton.widthAnchor.constraint(equalTo: shareButton.heightAnchor),
+            
+            closeButtonTrailingConstraint,
+            closeButtonTopConstraint,
+            closeButton.bottomAnchor.constraint(equalTo: topControlsView.bottomAnchor),
+            closeButton.widthAnchor.constraint(equalTo: closeButton.heightAnchor),
+
+            bottomControlsView.leadingAnchor.constraint(equalTo: view.leadingAnchor),
+            bottomControlsView.trailingAnchor.constraint(equalTo: view.trailingAnchor),
+            bottomControlsView.bottomAnchor.constraint(equalTo: view.bottomAnchor),
+            
+            captionTextView.heightAnchor.constraint(equalToConstant: 150),
+        ])
+        
+        updateTopControlsInsets()
+        
+        singleTap = UITapGestureRecognizer(target: self, action: #selector(viewPressed))
+        singleTap.delegate = self
+        doubleTap = UITapGestureRecognizer(target: self, action: #selector(viewDoublePressed))
+        doubleTap.delegate = self
+        doubleTap.numberOfTapsRequired = 2
+        // This is needed to prevent a delay between tapping a button on and the action firing on Catalyst and Designed for iPad
+        doubleTap.delaysTouchesEnded = false
+        // this requirement is needed to make sure the double tap is ever recognized
+        singleTap.require(toFail: doubleTap)
+        view.addGestureRecognizer(singleTap)
+        view.addGestureRecognizer(doubleTap)
+    }
+    
+    override func viewSafeAreaInsetsDidChange() {
+        super.viewSafeAreaInsetsDidChange()
+        
+        updateZoomScale(resetZoom: false)
+        // Ensure the transform is correct if the controls are hidden
+        setControlsVisible(controlsVisible, animated: false, dueToUserInteraction: false)
+        
+        updateTopControlsInsets()
+    }
+    
+    override func viewDidLayoutSubviews() {
+        super.viewDidLayoutSubviews()
+        
+        // When the scrollView size changes, make sure the zoom scale is up-to-date since it depends on the scrollView's bounds.
+        // This might also fix an issue on macOS (Designed for iPad) where the content isn't placed correctly. See #446
+        if scrollViewSizeForLastZoomScaleUpdate != scrollView.bounds.size {
+            scrollViewSizeForLastZoomScaleUpdate = scrollView.bounds.size
+            updateZoomScale(resetZoom: true)
+        }
+        centerContent()
+        // Ensure the transform is correct if the controls are hidden and their size changed.
+        setControlsVisible(controlsVisible, animated: false, dueToUserInteraction: false)
+    }
+    
+    override func viewDidAppear(_ animated: Bool) {
+        super.viewDidAppear(animated)
+        
+        if controlsVisible && !captionTextView.isHidden {
+            captionTextView.flashScrollIndicators()
+        }
+    }
+    
+    func takeContent() -> GalleryContentViewController {
+        content.willMove(toParent: nil)
+        content.removeFromParent()
+        content.view.removeFromSuperview()
+        return content
+    }
+    
+    func addContent() {
+        content.loadViewIfNeeded()
+        
+        content.setControlsVisible(controlsVisible, animated: false, dueToUserInteraction: false)
+        
+        content.view.translatesAutoresizingMaskIntoConstraints = false
+        if content.parent != self {
+            addChild(content)
+            content.didMove(toParent: self)
+        }
+        if scrollAndZoomEnabled {
+            scrollView.addSubview(content.view)
+            contentViewLeadingConstraint = content.view.leadingAnchor.constraint(equalTo: scrollView.leadingAnchor)
+            contentViewLeadingConstraint!.isActive = true
+            contentViewTopConstraint = content.view.topAnchor.constraint(equalTo: scrollView.topAnchor)
+            contentViewTopConstraint!.isActive = true
+            updateZoomScale(resetZoom: true)
+        } else {
+            // If the content was previously added, deactivate the old constraints.
+            contentViewLeadingConstraint?.isActive = false
+            contentViewTopConstraint?.isActive = false
+            
+            view.addSubview(content.view)
+            NSLayoutConstraint.activate([
+                content.view.leadingAnchor.constraint(equalTo: view.leadingAnchor),
+                content.view.trailingAnchor.constraint(equalTo: view.trailingAnchor),
+                content.view.topAnchor.constraint(equalTo: view.topAnchor),
+                content.view.bottomAnchor.constraint(equalTo: view.bottomAnchor),
+            ])
+        }
+        
+        if let overlayVC {
+            NSLayoutConstraint.activate([
+                overlayVC.view.leadingAnchor.constraint(equalTo: view.leadingAnchor),
+                overlayVC.view.trailingAnchor.constraint(equalTo: view.trailingAnchor),
+                overlayVC.view.topAnchor.constraint(equalTo: view.topAnchor),
+                overlayVC.view.bottomAnchor.constraint(equalTo: view.bottomAnchor),
+            ])
+        }
+        
+        content.view.layoutIfNeeded()
+    }
+    
+    func setControlsVisible(_ visible: Bool, animated: Bool, dueToUserInteraction: Bool) {
+        controlsVisible = visible
+        
+        guard let topControlsView,
+              let bottomControlsView else {
+            return
+        }
+        
+        func updateControlsViews() {
+            topControlsView.transform = CGAffineTransform(translationX: 0, y: visible ? 0 : -topControlsView.bounds.height)
+            bottomControlsView.transform = CGAffineTransform(translationX: 0, y: visible ? 0 : bottomControlsView.bounds.height)
+            content.setControlsVisible(visible, animated: animated, dueToUserInteraction: dueToUserInteraction)
+        }
+        if animated {
+            let animator = UIViewPropertyAnimator(duration: 0.2, timingParameters: UISpringTimingParameters())
+            animator.addAnimations(updateControlsViews)
+            animator.startAnimation()
+        } else {
+            updateControlsViews()
+        }
+        
+        setNeedsUpdateOfHomeIndicatorAutoHidden()
+    }
+    
+    func updateZoomScale(resetZoom: Bool) {
+        scrollView.contentSize = content.contentSize
+        
+        guard scrollAndZoomEnabled else {
+            scrollView.maximumZoomScale = 1
+            scrollView.minimumZoomScale = 1
+            scrollView.zoomScale = 1
+            return
+        }
+        
+        guard content.contentSize.width > 0 && content.contentSize.height > 0 else {
+            return
+        }
+        
+        let heightScale = view.bounds.height / content.contentSize.height
+        let widthScale = view.bounds.width / content.contentSize.width
+        let minScale = min(widthScale, heightScale)
+        let maxScale = minScale >= 1 ? minScale + 2 : 2
+        
+        scrollView.minimumZoomScale = minScale
+        scrollView.maximumZoomScale = maxScale
+        if resetZoom {
+            scrollView.zoomScale = minScale
+        } else {
+            scrollView.zoomScale = max(minScale, min(maxScale, scrollView.zoomScale))
+        }
+        
+        centerContent()
+    }
+    
+    private func centerContent() {
+        guard scrollAndZoomEnabled else {
+            return
+        }
+        
+        // Note: use frame for the content.view, because that's in the coordinate space of the scroll view
+        // which means it's already been scaled by the zoom factor.
+        let yOffset = max(0, (view.bounds.height - content.view.frame.height) / 2)
+        contentViewTopConstraint!.constant = yOffset
+        
+        let xOffset = max(0, (view.bounds.width - content.view.frame.width) / 2)
+        contentViewLeadingConstraint!.constant = xOffset
+    }
+    
+    private func updateShareButton() {
+        shareButton.isEnabled = !content.activityItemsForSharing.isEmpty
+    }
+    
+    private func updateCaptionTextView() {
+        guard let caption = content.caption,
+              !caption.isEmpty else {
+            captionTextView.isHidden = true
+            return
+        }
+        captionTextView.text = caption
+    }
+    
+    private func updateTopControlsInsets() {
+        let notchedDeviceTopInsets: [CGFloat] = [
+            44, // iPhone X, Xs, Xs Max, 11 Pro, 11 Pro Max
+            48, // iPhone XR, 11
+            47, // iPhone 12, 12 Pro, 12 Pro Max, 13, 13 Pro, 13 Pro Max, 14, 14 Plus
+            50, // iPhone 12 mini, 13 mini
+        ]
+        if notchedDeviceTopInsets.contains(view.safeAreaInsets.top) {
+            // the notch width is not the same for the iPhones 13,
+            // but what we actually want is the same offset from the edges
+            // since the corner radius didn't change
+            let notchWidth: CGFloat = 210
+            let earWidth = (view.bounds.width - notchWidth) / 2
+            let offset = (earWidth - (shareButton.imageView?.bounds.width ?? 0)) / 2
+            shareButtonLeadingConstraint.constant = offset
+            closeButtonTrailingConstraint.constant = offset
+        } else if view.safeAreaInsets.top == 0 {
+            // square corner devices
+            shareButtonLeadingConstraint.constant = 8
+            shareButtonTopConstraint.constant = 8
+            closeButtonTrailingConstraint.constant = 8
+            closeButtonTopConstraint.constant = 8
+        } else {
+            // dynamic island devices
+            shareButtonLeadingConstraint.constant = 24
+            shareButtonTopConstraint.constant = 24
+            closeButtonTrailingConstraint.constant = 24
+            closeButtonTopConstraint.constant = 24
+        }
+    }
+    
+    private func zoomRectFor(scale: CGFloat, center: CGPoint) -> CGRect {
+        var zoomRect = CGRect.zero
+        zoomRect.size.width = content.view.frame.width / scale
+        zoomRect.size.height = content.view.frame.height / scale
+        let newCenter = scrollView.convert(center, to: content.view)
+        zoomRect.origin.x = newCenter.x - (zoomRect.width / 2)
+        zoomRect.origin.y = newCenter.y - (zoomRect.height / 2)
+        return zoomRect
+    }
+    
+    private func animateZoomOut() {
+        let animator = UIViewPropertyAnimator(duration: 0.3, timingParameters: UISpringTimingParameters())
+        animator.addAnimations {
+            self.scrollView.zoomScale = self.scrollView.minimumZoomScale
+            self.scrollView.layoutIfNeeded()
+        }
+        animator.startAnimation()
+    }
+
+    // MARK: Interaction
+    
+    @objc private func viewPressed() {
+        if scrollAndZoomEnabled,
+           scrollView.zoomScale > scrollView.minimumZoomScale {
+            animateZoomOut()
+        } else {
+            setControlsVisible(!controlsVisible, animated: true, dueToUserInteraction: true)
+        }
+    }
+    
+    @objc private func viewDoublePressed(_ recognizer: UITapGestureRecognizer) {
+        guard scrollAndZoomEnabled else {
+            return
+        }
+        if scrollView.zoomScale <= scrollView.minimumZoomScale {
+            let point = recognizer.location(in: recognizer.view)
+            let scale = min(
+                max(
+                    scrollView.bounds.width / content.contentSize.width,
+                    scrollView.bounds.height / content.contentSize.height,
+                    scrollView.zoomScale + 0.75
+                ),
+                scrollView.maximumZoomScale
+            )
+            let rect = zoomRectFor(scale: scale, center: point)
+            let animator = UIViewPropertyAnimator(duration: 0.3, timingParameters: UISpringTimingParameters())
+            animator.addAnimations {
+                self.scrollView.zoom(to: rect, animated: false)
+                self.view.layoutIfNeeded()
+            }
+            animator.startAnimation()
+        } else {
+            animateZoomOut()
+        }
+    }
+    
+    @objc private func closeButtonPressed() {
+        delegate?.galleryItemClose(self)
+    }
+    
+    @objc private func shareButtonPressed() {
+        let items = content.activityItemsForSharing
+        guard !items.isEmpty else {
+            return
+        }
+        let activityVC = UIActivityViewController(activityItems: items, applicationActivities: delegate?.galleryItemApplicationActivities(self))
+        activityVC.popoverPresentationController?.sourceView = shareButton
+        present(activityVC, animated: true)
+    }
+    
+}
+
+extension GalleryItemViewController: GalleryContentViewControllerContainer {
+    var galleryControlsVisible: Bool {
+        controlsVisible
+    }
+    
+    func setGalleryContentLoading(_ loading: Bool) {
+        if loading {
+            overlayVC?.view.isHidden = true
+            if activityIndicator == nil {
+                let activityIndicator = UIActivityIndicatorView(style: .large)
+                self.activityIndicator = activityIndicator
+                activityIndicator.startAnimating()
+                activityIndicator.translatesAutoresizingMaskIntoConstraints = false
+                view.addSubview(activityIndicator)
+                NSLayoutConstraint.activate([
+                    activityIndicator.centerXAnchor.constraint(equalTo: view.centerXAnchor),
+                    activityIndicator.centerYAnchor.constraint(equalTo: view.centerYAnchor),
+                ])
+            }
+        } else {
+            if let activityIndicator {
+                // If we're in the middle of the presentation animation,
+                // wait until it finishes to hide the loading indicator.
+                // Since the updated content frame won't affect the animation,
+                // make sure the loading indicator remains visible.
+                if let delegate,
+                   delegate.isGalleryBeingPresented() {
+                    delegate.addPresentationAnimationCompletion { [unowned self] in
+                        self.setGalleryContentLoading(false)
+                    }
+                } else {
+                    activityIndicator.removeFromSuperview()
+                    self.activityIndicator = nil
+                    self.overlayVC?.view.isHidden = false
+                }
+            }
+        }
+    }
+    
+    func galleryContentChanged() {
+        updateZoomScale(resetZoom: true)
+        updateShareButton()
+        updateCaptionTextView()
+    }
+    
+    func disableGalleryScrollAndZoom() {
+        scrollAndZoomEnabled = false
+        updateZoomScale(resetZoom: true)
+        scrollView.isScrollEnabled = false
+        // Make sure the content is re-added with the correct constraints
+        if content.parent == self {
+            addContent()
+        }
+    }
+    
+    func setGalleryControlsVisible(_ visible: Bool, animated: Bool) {
+        setControlsVisible(visible, animated: animated, dueToUserInteraction: false)
+    }
+}
+
+extension GalleryItemViewController: UIScrollViewDelegate {
+    func viewForZooming(in scrollView: UIScrollView) -> UIView? {
+        if scrollAndZoomEnabled {
+            return content.view
+        } else {
+            return nil
+        }
+    }
+    
+    func scrollViewDidZoom(_ scrollView: UIScrollView) {
+        if scrollView.zoomScale <= scrollView.minimumZoomScale {
+            setControlsVisible(true, animated: true, dueToUserInteraction: true)
+        } else {
+            setControlsVisible(false, animated: true, dueToUserInteraction: true)
+        }
+        
+        centerContent()
+        scrollView.layoutIfNeeded()
+    }
+}
+
+extension GalleryItemViewController: UIGestureRecognizerDelegate {
+    func gestureRecognizerShouldBegin(_ gestureRecognizer: UIGestureRecognizer) -> Bool {
+        if gestureRecognizer == singleTap {
+            let loc = gestureRecognizer.location(in: view)
+            return !topControlsView.frame.contains(loc) && !bottomControlsView.frame.contains(loc)
+        } else if gestureRecognizer == doubleTap {
+            let loc = gestureRecognizer.location(in: content.view)
+            return content.view.bounds.contains(loc)
+        } else {
+            return true
+        }
+    }
+}

Packages/GalleryVC/Sources/GalleryVC/GalleryPresentationAnimationController.swift

@@ -0,0 +1,136 @@
+//
+//  GalleryPresentationAnimationController.swift
+//  GalleryVC
+//
+//  Created by Shadowfacts on 12/28/23.
+//
+
+import UIKit
+
+class GalleryPresentationAnimationController: NSObject, UIViewControllerAnimatedTransitioning {
+    private let sourceView: UIView
+    
+    init(sourceView: UIView) {
+        self.sourceView = sourceView
+    }
+    
+    func transitionDuration(using transitionContext: UIViewControllerContextTransitioning?) -> TimeInterval {
+        return 0.4
+    }
+    
+    func animateTransition(using transitionContext: UIViewControllerContextTransitioning) {
+        guard let to = transitionContext.viewController(forKey: .to) as? GalleryViewController else {
+            fatalError()
+        }
+        
+        let itemViewController = to.currentItemViewController
+
+        if !itemViewController.content.canAnimateFromSourceView || UIAccessibility.prefersCrossFadeTransitions {
+            animateCrossFadeTransition(using: transitionContext)
+            return
+        }
+        
+        let container = transitionContext.containerView
+        to.view.frame = container.bounds
+        container.addSubview(to.view)
+        
+        container.layoutIfNeeded()
+        // Make sure the zoom scale is updated before getting the content view frame, since it needs to take into account the correct transform.
+        itemViewController.updateZoomScale(resetZoom: true)
+        
+        let sourceFrameInContainer = container.convert(sourceView.bounds, from: sourceView)
+        let destFrameInContainer = container.convert(itemViewController.content.view.bounds, from: itemViewController.content.view)
+
+        // Use a transformation to make the actual source view appear to move into the destination frame.
+        // Doing this while having the content view fade-in papers over the z-index change when
+        // there was something overlapping the source view.
+        let origSourceTransform = sourceView.transform
+        let sourceToDestTransform: CGAffineTransform?
+        if destFrameInContainer.width > 0 && destFrameInContainer.height > 0 {
+            // Scale evenly in both dimensions, to prevent the source view appearing to stretch/distort during the animation.
+            let scale = min(destFrameInContainer.width / sourceFrameInContainer.width, destFrameInContainer.height / sourceFrameInContainer.height)
+            sourceToDestTransform = origSourceTransform
+                .translatedBy(x: destFrameInContainer.midX - sourceFrameInContainer.midX, y: destFrameInContainer.midY - sourceFrameInContainer.midY)
+                .scaledBy(x: scale, y: scale)
+        } else {
+            sourceToDestTransform = nil
+        }
+        
+        let content = itemViewController.takeContent()
+        content.view.translatesAutoresizingMaskIntoConstraints = true
+        container.insertSubview(content.view, belowSubview: to.view)
+
+        // Use a separate dimming view from to.view, so that the gallery controls can be in front of the moving content.
+        let dimmingView = UIView()
+        dimmingView.backgroundColor = .black
+        dimmingView.frame = container.bounds
+        dimmingView.layer.opacity = 0
+        container.insertSubview(dimmingView, belowSubview: content.view)
+
+        to.view.backgroundColor = nil
+        to.view.layer.opacity = 0
+        content.view.frame = sourceFrameInContainer
+        content.view.layer.opacity = 0
+        
+        container.layoutIfNeeded()
+        
+        // This needs to take place after the layout, so that the transform is correct.
+        itemViewController.setControlsVisible(false, animated: false, dueToUserInteraction: false)
+
+        let duration = self.transitionDuration(using: transitionContext)
+        // rougly equivalent to duration: 0.35, bounce: 0.3
+        let spring = UISpringTimingParameters(mass: 1, stiffness: 322, damping: 25, initialVelocity: .zero)
+        let animator = UIViewPropertyAnimator(duration: duration, timingParameters: spring)
+        
+        animator.addAnimations {
+            dimmingView.layer.opacity = 1
+            
+            to.view.layer.opacity = 1
+            
+            content.view.frame = destFrameInContainer
+            content.view.layer.opacity = 1
+            
+            itemViewController.setControlsVisible(true, animated: false, dueToUserInteraction: false)
+
+            if let sourceToDestTransform {
+                self.sourceView.transform = sourceToDestTransform
+            }
+        }
+        
+        animator.addCompletion { _ in
+            dimmingView.removeFromSuperview()
+            
+            to.view.backgroundColor = .black
+            
+            if sourceToDestTransform != nil {
+                self.sourceView.transform = origSourceTransform
+            }
+            
+            itemViewController.addContent()
+            
+            transitionContext.completeTransition(true)
+        }
+        
+        animator.startAnimation()
+    }
+    
+    private func animateCrossFadeTransition(using transitionContext: UIViewControllerContextTransitioning) {
+        guard let to = transitionContext.viewController(forKey: .to) as? GalleryViewController else {
+            return
+        }
+        
+        to.view.alpha = 0
+        to.view.frame = transitionContext.containerView.bounds
+        transitionContext.containerView.addSubview(to.view)
+        
+        let duration = transitionDuration(using: transitionContext)
+        let animator = UIViewPropertyAnimator(duration: duration, curve: .easeInOut)
+        animator.addAnimations {
+            to.view.alpha = 1
+        }
+        animator.addCompletion { _ in
+            transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
+        }
+        animator.startAnimation()
+    }
+}

Packages/GalleryVC/Sources/GalleryVC/GalleryViewController.swift

@@ -0,0 +1,189 @@
+//
+//  GalleryViewController.swift
+//  GalleryVC
+//
+//  Created by Shadowfacts on 12/28/23.
+//
+
+import UIKit
+
+public class GalleryViewController: UIPageViewController {
+    
+    let galleryDataSource: GalleryDataSource
+    let initialItemIndex: Int
+    private let _itemsCount: Int
+    private var itemsCount: Int {
+        get {
+            precondition(_itemsCount == galleryDataSource.galleryItemsCount(), "GalleryDataSource item count cannot change")
+            return _itemsCount
+        }
+    }
+    
+    var currentItemViewController: GalleryItemViewController {
+        viewControllers![0] as! GalleryItemViewController
+    }
+    
+    private var dismissInteraction: GalleryDismissInteraction!
+    private var presentationAnimationCompletionHandlers: [() -> Void] = []
+    
+    override public var prefersStatusBarHidden: Bool {
+        true
+    }
+    override public var preferredStatusBarUpdateAnimation: UIStatusBarAnimation {
+        .none
+    }
+    override public var childForHomeIndicatorAutoHidden: UIViewController? {
+        currentItemViewController
+    }
+    
+    public init(dataSource: GalleryDataSource, initialItemIndex: Int) {
+        self.galleryDataSource = dataSource
+        self.initialItemIndex = initialItemIndex
+        self._itemsCount = dataSource.galleryItemsCount()
+        precondition(initialItemIndex >= 0 && initialItemIndex < _itemsCount, "initialItemIndex is out of bounds")
+        
+        super.init(transitionStyle: .scroll, navigationOrientation: .horizontal, options: [
+            .interPageSpacing: 50
+        ])
+        
+        modalPresentationStyle = .fullScreen
+        transitioningDelegate = self
+    }
+    
+    required init?(coder: NSCoder) {
+        fatalError("init(coder:) has not been implemented")
+    }
+    
+    public override func viewDidLoad() {
+        super.viewDidLoad()
+        
+        dismissInteraction = GalleryDismissInteraction(viewController: self)
+        
+        view.backgroundColor = .black
+        overrideUserInterfaceStyle = .dark
+        
+        dataSource = self
+        delegate = self
+        
+        setViewControllers([makeItemVC(index: initialItemIndex)], direction: .forward, animated: false)
+    }
+    
+    public override func viewDidAppear(_ animated: Bool) {
+        super.viewDidAppear(animated)
+        
+        if animated {
+            // Wait until the transition is no longer in-progress, otherwise things will just get deferred again.
+            DispatchQueue.main.async {
+                self.presentationAnimationCompleted()
+            }
+        }
+    }
+    
+    public override func viewWillDisappear(_ animated: Bool) {
+        super.viewWillDisappear(animated)
+        
+        if isBeingDismissed {
+            currentItemViewController.content.galleryContentWillDisappear()
+        }
+    }
+    
+    private func makeItemVC(index: Int) -> GalleryItemViewController {
+        let content = galleryDataSource.galleryContentViewController(forItemAt: index)
+        return GalleryItemViewController(delegate: self, itemIndex: index, content: content)
+    }
+    
+    func presentationAnimationCompleted() {
+        for block in presentationAnimationCompletionHandlers {
+            block()
+        }
+        currentItemViewController.content.galleryContentDidAppear()
+    }
+}
+
+extension GalleryViewController: UIPageViewControllerDataSource {
+    public func pageViewController(_ pageViewController: UIPageViewController, viewControllerBefore viewController: UIViewController) -> UIViewController? {
+        guard let viewController = viewController as? GalleryItemViewController else {
+            preconditionFailure("VC must be GalleryItemViewController")
+        }
+        guard viewController.itemIndex > 0 else {
+            return nil
+        }
+        return makeItemVC(index: viewController.itemIndex - 1)
+    }
+    
+    public func pageViewController(_ pageViewController: UIPageViewController, viewControllerAfter viewController: UIViewController) -> UIViewController? {
+        guard let viewController = viewController as? GalleryItemViewController else {
+            preconditionFailure("VC must be GalleryItemViewController")
+        }
+        guard viewController.itemIndex < itemsCount - 1 else {
+            return nil
+        }
+        return makeItemVC(index: viewController.itemIndex + 1)
+    }
+}
+
+extension GalleryViewController: UIPageViewControllerDelegate {
+    public func pageViewController(_ pageViewController: UIPageViewController, willTransitionTo pendingViewControllers: [UIViewController]) {
+        currentItemViewController.content.galleryContentWillDisappear()
+        let new = pendingViewControllers[0] as! GalleryItemViewController
+        new.setControlsVisible(currentItemViewController.controlsVisible, animated: false, dueToUserInteraction: false)
+    }
+    
+    public func pageViewController(_ pageViewController: UIPageViewController, didFinishAnimating finished: Bool, previousViewControllers: [UIViewController], transitionCompleted completed: Bool) {
+        currentItemViewController.content.galleryContentDidAppear()
+    }
+}
+
+extension GalleryViewController: GalleryItemViewControllerDelegate {
+    func isGalleryBeingPresented() -> Bool {
+        isBeingPresented
+    }
+    
+    func addPresentationAnimationCompletion(_ block: @escaping () -> Void) {
+        presentationAnimationCompletionHandlers.append(block)
+    }
+    
+    func galleryItemClose(_ item: GalleryItemViewController) {
+        dismiss(animated: true)
+    }
+    
+    func galleryItemApplicationActivities(_ item: GalleryItemViewController) -> [UIActivity]? {
+        galleryDataSource.galleryApplicationActivities(forItemAt: item.itemIndex)
+    }
+}
+
+extension GalleryViewController: UIViewControllerTransitioningDelegate {
+    public func animationController(forPresented presented: UIViewController, presenting: UIViewController, source: UIViewController) -> UIViewControllerAnimatedTransitioning? {
+        #if os(visionOS)
+        return nil
+        #else
+        if let sourceView = galleryDataSource.galleryContentTransitionSourceView(forItemAt: initialItemIndex) {
+            return GalleryPresentationAnimationController(sourceView: sourceView)
+        } else {
+            return nil
+        }
+        #endif
+    }
+    
+    public func animationController(forDismissed dismissed: UIViewController) -> UIViewControllerAnimatedTransitioning? {
+        #if os(visionOS)
+        return nil
+        #else
+        if let sourceView = galleryDataSource.galleryContentTransitionSourceView(forItemAt: currentItemViewController.itemIndex) {
+            let translation: CGPoint?
+            let velocity: CGPoint?
+            if let dismissInteraction,
+               dismissInteraction.isActive {
+                translation = dismissInteraction.dismissTranslation
+                velocity = dismissInteraction.dismissVelocity
+            } else {
+                translation = nil
+                velocity = nil
+            }
+            return GalleryDismissAnimationController(sourceView: sourceView, interactiveTranslation: translation, interactiveVelocity: velocity)
+        } else {
+            return nil
+        }
+        #endif
+    }
+}

Packages/GalleryVC/Tests/GalleryVCTests/GalleryVCTests.swift

@@ -0,0 +1,12 @@
+import XCTest
+@testable import GalleryVC
+
+final class GalleryVCTests: XCTestCase {
+    func testExample() throws {
+        // XCTest Documentation
+        // https://developer.apple.com/documentation/xctest
+
+        // Defining Test Cases and Test Methods
+        // https://developer.apple.com/documentation/xctest/defining_test_cases_and_test_methods
+    }
+}

Packages/InstanceFeatures/.gitignore

@@ -0,0 +1,9 @@
+.DS_Store
+/.build
+/Packages
+/*.xcodeproj
+xcuserdata/
+DerivedData/
+.swiftpm/config/registries.json
+.swiftpm/xcode/package.xcworkspace/contents.xcworkspacedata
+.netrc

Packages/InstanceFeatures/Package.resolved

@@ -0,0 +1,23 @@
+{
+  "pins" : [
+    {
+      "identity" : "swift-system",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/apple/swift-system.git",
+      "state" : {
+        "revision" : "025bcb1165deab2e20d4eaba79967ce73013f496",
+        "version" : "1.2.1"
+      }
+    },
+    {
+      "identity" : "swift-url",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/karwa/swift-url.git",
+      "state" : {
+        "branch" : "main",
+        "revision" : "220f6ab9d8a7e0742f85eb9f21b745942e001ae6"
+      }
+    }
+  ],
+  "version" : 2
+}

Packages/InstanceFeatures/Package.swift

@@ -0,0 +1,37 @@
+// swift-tools-version: 6.0
+// The swift-tools-version declares the minimum version of Swift required to build this package.
+
+import PackageDescription
+
+let package = Package(
+    name: "InstanceFeatures",
+    platforms: [
+        .iOS(.v16),
+    ],
+    products: [
+        // Products define the executables and libraries a package produces, and make them visible to other packages.
+        .library(
+            name: "InstanceFeatures",
+            targets: ["InstanceFeatures"]),
+    ],
+    dependencies: [
+        // Dependencies declare other packages that this package depends on.
+        .package(path: "../Pachyderm"),
+    ],
+    targets: [
+        // Targets are the basic building blocks of a package. A target can define a module or a test suite.
+        // Targets can depend on other targets in this package, and on products in packages this package depends on.
+        .target(
+            name: "InstanceFeatures",
+            dependencies: ["Pachyderm"],
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
+            ]),
+        .testTarget(
+            name: "InstanceFeaturesTests",
+            dependencies: ["InstanceFeatures"],
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
+            ]),
+    ]
+)

Packages/InstanceFeatures/README.md

@@ -0,0 +1,3 @@
+# InstanceFeatures
+
+A description of this package.

Packages/InstanceFeatures/Sources/InstanceFeatures/InstanceFeatures.swift

@@ -0,0 +1,397 @@
+//
+//  InstanceFeatures.swift
+//  Tusker
+//
+//  Created by Shadowfacts on 1/23/22.
+//  Copyright © 2022 Shadowfacts. All rights reserved.
+//
+
+import Foundation
+import Combine
+import Pachyderm
+
+public final class InstanceFeatures: ObservableObject {
+    private static let pleromaVersionRegex = try! NSRegularExpression(pattern: "\\(compatible; (pleroma|akkoma) (.*)\\)", options: .caseInsensitive)
+    
+    private let _featuresUpdated = PassthroughSubject<Void, Never>()
+    public var featuresUpdated: some Publisher<Void, Never> { _featuresUpdated }
+    
+    @Published @_spi(InstanceType) public private(set) var instanceType: InstanceType = .mastodon(.vanilla, nil)
+    @Published public private(set) var maxStatusChars = 500
+    @Published public private(set) var charsReservedPerURL = 23
+    @Published public private(set) var maxPollOptionChars: Int?
+    @Published public private(set) var maxPollOptionsCount: Int?
+    @Published public private(set) var mediaAttachmentsConfiguration: InstanceV1.MediaAttachmentsConfiguration?
+    @Published public private(set) var translation: Bool = false
+    
+    public var localOnlyPosts: Bool {
+        switch instanceType {
+        case .mastodon(.hometown(_), _), .mastodon(.glitch, _):
+            return true
+        case .pleroma(.akkoma(_)):
+            return true
+        default:
+            return false
+        }
+    }
+    
+    /// Instance types that use a separate visibility to indicate local-only posts.
+    public var localOnlyPostsVisibility: Bool {
+        if case .pleroma(.akkoma(_)) = instanceType {
+            return true
+        } else {
+            return false
+        }
+    }
+    
+    public var mastodonAttachmentRestrictions: Bool {
+        instanceType.isMastodon
+    }
+    
+    public var pollsAndAttachments: Bool {
+        instanceType.isPleroma
+    }
+    
+    public var boostToOriginalAudience: Bool {
+        instanceType.isPleroma || instanceType.isMastodon
+    }
+    
+    public var profilePinnedStatuses: Bool {
+        switch instanceType {
+        case .pixelfed:
+            return false
+        default:
+            return true
+        }
+    }
+    
+    public var trends: Bool {
+        instanceType.isMastodon
+    }
+    
+    public var profileSuggestions: Bool {
+        instanceType.isMastodon && hasMastodonVersion(3, 4, 0)
+    }
+    
+    public var trendingStatusesAndLinks: Bool {
+        instanceType.isMastodon && hasMastodonVersion(3, 5, 0)
+    }
+    
+    public var reblogVisibility: Bool {
+        (instanceType.isMastodon && hasMastodonVersion(2, 8, 0))
+            || (instanceType.isPleroma && hasPleromaVersion(2, 0, 0))
+    }
+    
+    public var probablySupportsMarkdown: Bool {
+        switch instanceType {
+        case .pleroma(_), .mastodon(.glitch, _), .mastodon(.hometown(_), _), .firefish(_):
+            return true
+        default:
+            return false
+        }
+    }
+    
+    public var needsLocalOnlyEmojiHack: Bool {
+        if case .mastodon(.glitch, _) = instanceType {
+            return true
+        } else {
+            return false
+        }
+    }
+    
+    public var needsWideColorGamutHack: Bool {
+        if case .mastodon(_, let version) = instanceType {
+            return version < Version(4, 0, 0)
+        } else {
+            return true
+        }
+    }
+    
+    public var canFollowHashtags: Bool {
+        if case .mastodon(_, let version) = instanceType {
+            return version >= Version(4, 0, 0)
+        } else if case .pleroma(.akkoma(let version)) = instanceType {
+            return version >= Version(3, 4, 0)
+        } else {
+            return false
+        }
+    }
+    
+    public var filtersV2: Bool {
+        hasMastodonVersion(4, 0, 0)
+    }
+    
+    public var notificationsAllowedTypes: Bool {
+        hasMastodonVersion(3, 5, 0)
+    }
+    
+    public var pollVotersCount: Bool {
+        instanceType.isMastodon
+    }
+    
+    public var createStatusWithLanguage: Bool {
+        instanceType.isMastodon || instanceType.isPleroma(.akkoma(nil))
+    }
+    
+    public var editStatuses: Bool {
+        switch instanceType {
+        case .mastodon(_, let v) where v >= Version(3, 5, 0):
+            return true
+        case .pleroma(.vanilla(let v)) where v >= Version(2, 5, 0):
+            return true
+        case .pleroma(.akkoma(_)):
+            return true
+        default:
+            return false
+        }
+    }
+    
+    public var statusEditNotifications: Bool {
+        // pleroma doesn't seem to support 'update' type notifications, even though it supports edits
+        hasMastodonVersion(3, 5, 0)
+    }
+    
+    public var statusNotifications: Bool {
+        // pleroma doesn't support notifications for new posts from an account
+        hasMastodonVersion(3, 3, 0)
+    }
+    
+    public var needsEditAttachmentsInSeparateRequest: Bool {
+        instanceType.isPleroma
+    }
+    
+    public var composeDirectStatuses: Bool {
+        if case .pixelfed = instanceType {
+            return false
+        } else {
+            return true
+        }
+    }
+    
+    public var searchOperators: Bool {
+        hasMastodonVersion(4, 2, 0)
+    }
+    
+    public var hasServerPreferences: Bool {
+        hasMastodonVersion(2, 8, 0)
+    }
+    
+    public var listRepliesPolicy: Bool {
+        hasMastodonVersion(3, 3, 0)
+    }
+    
+    public var exclusiveLists: Bool {
+        hasMastodonVersion(4, 2, 0) || instanceType.isMastodon(.hometown(nil))
+    }
+    
+    public var pushNotificationTypeStatus: Bool {
+        hasMastodonVersion(3, 3, 0)
+    }
+    
+    public var pushNotificationTypeFollowRequest: Bool {
+        hasMastodonVersion(3, 1, 0)
+    }
+    
+    public var pushNotificationTypeUpdate: Bool {
+        hasMastodonVersion(3, 5, 0)
+    }
+    
+    public var pushNotificationPolicy: Bool {
+        hasMastodonVersion(3, 5, 0)
+    }
+    
+    public var pushNotificationPolicyMissingFromResponse: Bool {
+        switch instanceType {
+        case .mastodon(_, let version):
+            return version >= Version(3, 5, 0) && version < Version(4, 1, 0)
+        default:
+            return false
+        }
+    }
+    
+    public var instanceAnnouncements: Bool {
+        hasMastodonVersion(3, 1, 0)
+    }
+    
+    public var emojiReactionNotifications: Bool {
+        instanceType.isPleroma
+    }
+    
+    public var muteNotifications: Bool {
+        !instanceType.isPixelfed
+    }
+    
+    public var blockDomains: Bool {
+        !instanceType.isPixelfed
+    }
+    
+    public var hideReblogs: Bool {
+        !instanceType.isPixelfed
+    }
+    
+    public init() {
+    }
+    
+    public func update(instance: InstanceInfo, nodeInfo: NodeInfo?) {
+        let ver = instance.version.lowercased()
+        // check glitch first b/c it still reports "mastodon" as the software in nodeinfo
+        if ver.contains("glitch") {
+            instanceType = .mastodon(.glitch, Version(string: ver))
+        } else if nodeInfo?.software.name == "mastodon" {
+            instanceType = .mastodon(.vanilla, Version(string: ver))
+        } else if nodeInfo?.software.name == "hometown" {
+            var mastoVersion: Version?
+            var hometownVersion: Version?
+            let parts = ver.split(separator: "+")
+            if parts.count == 2,
+               let first = Version(string: String(parts[0])) {
+                if first > Version(1, 0, 8) {
+                    // like 3.5.5+hometown-1.0.9
+                    mastoVersion = first
+                    if parts[1].starts(with: "hometown-") {
+                        hometownVersion = Version(string: String(parts[1][parts[1].index(parts[1].startIndex, offsetBy: "hometown-".count + 1)...]))
+                    }
+                } else {
+                    // like "1.0.6+3.5.2"
+                    hometownVersion = first
+                    mastoVersion = Version(string: String(parts[1]))
+                }
+            } else {
+                mastoVersion = Version(string: ver)
+            }
+            instanceType = .mastodon(.hometown(hometownVersion), mastoVersion)
+        } else if let match = InstanceFeatures.pleromaVersionRegex.firstMatch(in: ver, range: NSRange(location: 0, length: ver.utf16.count)) {
+            var pleromaVersion: Version?
+            let type = (ver as NSString).substring(with: match.range(at: 1))
+            pleromaVersion = Version(string: (ver as NSString).substring(with: match.range(at: 2)))
+            if type == "akkoma" {
+                instanceType = .pleroma(.akkoma(pleromaVersion))
+            } else {
+                instanceType = .pleroma(.vanilla(pleromaVersion))
+            }
+        } else if ver.contains("pixelfed") {
+            instanceType = .pixelfed
+        } else if nodeInfo?.software.name == "gotosocial" {
+            instanceType = .gotosocial
+        } else if ver.contains("firefish") || ver.contains("iceshrimp") || ver.contains("calckey") {
+            instanceType = .firefish(nodeInfo?.software.version)
+        } else {
+            instanceType = .mastodon(.vanilla, Version(string: ver))
+        }
+        
+        maxStatusChars = instance.maxStatusCharacters ?? 500
+        charsReservedPerURL = instance.configuration?.statuses.charactersReservedPerURL ?? 23 // default Mastodon link length
+        if let pollsConfig = instance.pollsConfiguration {
+            maxPollOptionChars = pollsConfig.maxCharactersPerOption
+            maxPollOptionsCount = pollsConfig.maxOptions
+        }
+        mediaAttachmentsConfiguration = instance.configuration?.mediaAttachments
+        translation = instance.translation
+        
+        _featuresUpdated.send()
+    }
+    
+    public func hasMastodonVersion(_ major: Int, _ minor: Int, _ patch: Int) -> Bool {
+        if case .mastodon(_, let version) = instanceType {
+            return version >= Version(major, minor, patch)
+        } else {
+            return false
+        }
+    }
+    
+    func hasPleromaVersion(_ major: Int, _ minor: Int, _ patch: Int) -> Bool {
+        switch instanceType {
+        case .pleroma(.vanilla(let version)), .pleroma(.akkoma(let version)):
+            return version >= Version(major, minor, patch)
+        default:
+            return false
+        }
+    }
+}
+
+extension InstanceFeatures {
+    @_spi(InstanceType) public enum InstanceType {
+        case mastodon(MastodonType, Version?)
+        case pleroma(PleromaType)
+        case pixelfed
+        case gotosocial
+        case firefish(String?)
+        
+        var isMastodon: Bool {
+            if case .mastodon(_, _) = self {
+                return true
+            } else {
+                return false
+            }
+        }
+        
+        func isMastodon(_ subtype: MastodonType) -> Bool {
+            if case .mastodon(let t, _) = self,
+               t.equalsIgnoreVersion(subtype) {
+                return true
+            } else {
+                return false
+            }
+        }
+        
+        var isPleroma: Bool {
+            if case .pleroma(_) = self {
+                return true
+            } else {
+                return false
+            }
+        }
+        
+        func isPleroma(_ subtype: PleromaType) -> Bool {
+            if case .pleroma(let t) = self,
+               t.equalsIgnoreVersion(subtype) {
+                return true
+            } else {
+                return false
+            }
+        }
+        
+        var isPixelfed: Bool {
+            if case .pixelfed = self {
+                return true
+            } else {
+                return false
+            }
+        }
+    }
+    
+    @_spi(InstanceType) public enum MastodonType {
+        case vanilla
+        case hometown(Version?)
+        case glitch
+        
+        func equalsIgnoreVersion(_ other: MastodonType) -> Bool {
+            switch (self, other) {
+            case (.vanilla, .vanilla):
+                return true
+            case (.hometown(_), .hometown(_)):
+                return true
+            case (.glitch, .glitch):
+                return true
+            default:
+                return false
+            }
+        }
+    }
+    
+    @_spi(InstanceType) public enum PleromaType {
+        case vanilla(Version?)
+        case akkoma(Version?)
+        
+        func equalsIgnoreVersion(_ other: PleromaType) -> Bool {
+            switch (self, other) {
+            case (.vanilla(_), .vanilla(_)):
+                return true
+            case (.akkoma(_), .akkoma(_)):
+                return true
+            default:
+                return false
+            }
+        }
+    }
+}

Packages/InstanceFeatures/Sources/InstanceFeatures/InstanceInfo.swift

@@ -0,0 +1,47 @@
+//
+//  InstanceInfo.swift
+//  InstanceFeatures
+//
+//  Created by Shadowfacts on 5/28/23.
+//
+
+import Foundation
+import Pachyderm
+
+public struct InstanceInfo {
+    public var version: String
+    public var maxStatusCharacters: Int?
+    public var configuration: InstanceV1.Configuration?
+    public var pollsConfiguration: InstanceV1.PollsConfiguration?
+    public var translation: Bool
+    
+    public init(
+        version: String,
+        maxStatusCharacters: Int?,
+        configuration: InstanceV1.Configuration?,
+        pollsConfiguration: InstanceV1.PollsConfiguration?,
+        translation: Bool
+    ) {
+        self.version = version
+        self.maxStatusCharacters = maxStatusCharacters
+        self.configuration = configuration
+        self.pollsConfiguration = pollsConfiguration
+        self.translation = translation
+    }
+}
+
+extension InstanceInfo {
+    public init(v1 instance: InstanceV1) {
+        self.init(
+            version: instance.version,
+            maxStatusCharacters: instance.maxStatusCharacters,
+            configuration: instance.configuration,
+            pollsConfiguration: instance.pollsConfiguration,
+            translation: false
+        )
+    }
+    
+    public mutating func update(v2: InstanceV2) {
+        translation = v2.configuration.translation.enabled
+    }
+}

Packages/InstanceFeatures/Sources/InstanceFeatures/Version.swift

@@ -0,0 +1,80 @@
+//
+//  Version.swift
+//  InstanceFeatures
+//
+//  Created by Shadowfacts on 5/14/23.
+//
+
+import Foundation
+
+@_spi(InstanceType) public struct Version: Equatable, Comparable, CustomStringConvertible {
+    private static let regex = try! NSRegularExpression(pattern: "^(\\d+)\\.(\\d+)\\.(\\d+).*$")
+    
+    let major: Int
+    let minor: Int
+    let patch: Int
+    
+    init(_ major: Int, _ minor: Int, _ patch: Int) {
+        self.major = major
+        self.minor = minor
+        self.patch = patch
+    }
+    
+    init?(string: String) {
+        guard let match = Version.regex.firstMatch(in: string, range: NSRange(location: 0, length: string.utf16.count)),
+              match.numberOfRanges == 4 else {
+            return nil
+        }
+        let majorStr = (string as NSString).substring(with: match.range(at: 1))
+        let minorStr = (string as NSString).substring(with: match.range(at: 2))
+        let patchStr = (string as NSString).substring(with: match.range(at: 3))
+        guard let major = Int(majorStr),
+              let minor = Int(minorStr),
+              let patch = Int(patchStr) else {
+            return nil
+        }
+        self.major = major
+        self.minor = minor
+        self.patch = patch
+    }
+    
+    public var description: String {
+        "\(major).\(minor).\(patch)"
+    }
+    
+    public static func ==(lhs: Version, rhs: Version) -> Bool {
+        return lhs.major == rhs.major && lhs.minor == rhs.minor && lhs.patch == rhs.patch
+    }
+    
+    public static func <(lhs: Version, rhs: Version) -> Bool {
+        if lhs.major < rhs.major {
+            return true
+        } else if lhs.major > rhs.major {
+            return false
+        } else if lhs.minor < rhs.minor {
+            return true
+        } else if lhs.minor > rhs.minor {
+            return false
+        } else if lhs.patch < rhs.patch {
+            return true
+        } else {
+            return false
+        }
+    }
+}
+
+func <(lhs: Version?, rhs: Version) -> Bool {
+    guard let lhs else {
+        // nil is less than or equal to everything
+        return true
+    }
+    return lhs < rhs
+}
+    
+func >=(lhs: Version?, rhs: Version) -> Bool {
+    guard let lhs else {
+        // nil is less than or equal to everything
+        return false
+    }
+    return lhs >= rhs
+}

Packages/InstanceFeatures/Tests/InstanceFeaturesTests/VersionTests.swift

@@ -1,13 +1,13 @@
 //
 //  VersionTests.swift
-//  TuskerTests
+//  InstanceFeaturesTests
 //
 //  Created by Shadowfacts on 4/2/22.
 //  Copyright © 2022 Shadowfacts. All rights reserved.
 //
 
 import XCTest
-@testable import Tusker
+@testable import InstanceFeatures
 
 class VersionTests: XCTestCase {
     

Packages/MatchedGeometryPresentation/.gitignore

@@ -0,0 +1,9 @@
+.DS_Store
+/.build
+/Packages
+/*.xcodeproj
+xcuserdata/
+DerivedData/
+.swiftpm/config/registries.json
+.swiftpm/xcode/package.xcworkspace/contents.xcworkspacedata
+.netrc

Packages/MatchedGeometryPresentation/Package.swift

@@ -0,0 +1,29 @@
+// swift-tools-version: 6.0
+// The swift-tools-version declares the minimum version of Swift required to build this package.
+
+import PackageDescription
+
+let package = Package(
+    name: "MatchedGeometryPresentation",
+    platforms: [
+        .iOS(.v16),
+    ],
+    products: [
+        // Products define the executables and libraries a package produces, making them visible to other packages.
+        .library(
+            name: "MatchedGeometryPresentation",
+            targets: ["MatchedGeometryPresentation"]),
+    ],
+    targets: [
+        // Targets are the basic building blocks of a package, defining a module or a test suite.
+        // Targets can depend on other targets in this package and products from dependencies.
+        .target(
+            name: "MatchedGeometryPresentation",
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
+            ]),
+        // .testTarget(
+        //     name: "MatchedGeometryPresentationTests",
+        //     dependencies: ["MatchedGeometryPresentation"]),
+    ]
+)

Packages/MatchedGeometryPresentation/Sources/MatchedGeometryPresentation/MatchedGeometryModifiers.swift

@@ -0,0 +1,125 @@
+//
+//  MatchedGeometryModifiers.swift
+//  MatchGeom
+//
+//  Created by Shadowfacts on 4/24/23.
+//
+
+import SwiftUI
+
+extension View {
+    public func matchedGeometryPresentation<ID: Hashable, Presented: View>(id: Binding<ID?>, backgroundColor: UIColor, @ViewBuilder presenting: () -> Presented) -> some View {
+        self.modifier(MatchedGeometryPresentationModifier(id: id, backgroundColor: backgroundColor, presented: presenting()))
+    }
+    
+    public func matchedGeometrySource<ID: Hashable, ID2: Hashable>(id: ID, presentationID: ID2) -> some View {
+        self.modifier(MatchedGeometrySourceModifier(id: AnyHashable(id), presentationID: AnyHashable(presentationID), matched: { AnyView(self) }))
+    }
+    
+    public func matchedGeometryDestination<ID: Hashable>(id: ID) -> some View {
+        self.modifier(MatchedGeometryDestinationModifier(id: AnyHashable(id), matched: self))
+    }
+}
+
+private struct MatchedGeometryPresentationModifier<ID: Hashable, Presented: View>: ViewModifier {
+    @Binding var id: ID?
+    let backgroundColor: UIColor
+    let presented: Presented
+    @StateObject private var state = MatchedGeometryState()
+    
+    private var isPresented: Binding<Bool> {
+        Binding {
+            id != nil
+        } set: {
+            if $0 {
+                fatalError()
+            } else {
+                id = nil
+            }
+        }
+    }
+    
+    func body(content: Content) -> some View {
+        content
+            .environmentObject(state)
+            .backgroundPreferenceValue(MatchedGeometrySourcesKey.self, { sources in
+                Color.clear
+                    .presentViewController(makeVC(allSources: sources), isPresented: isPresented)
+            })
+    }
+    
+    private func makeVC(allSources: [SourceKey: (AnyView, CGRect)]) -> () -> UIViewController {
+        return {
+            // force unwrap is safe, this closure is only called when being presented so we must have an id
+            let id = AnyHashable(id!)
+            return MatchedGeometryViewController(
+                presentationID: id,
+                content: presented,
+                state: state,
+                backgroundColor: backgroundColor
+            )
+        }
+    }
+}
+
+private struct MatchedGeometrySourceModifier: ViewModifier {
+    let id: AnyHashable
+    let presentationID: AnyHashable
+    let matched: () -> AnyView
+    @EnvironmentObject private var state: MatchedGeometryState
+    
+    func body(content: Content) -> some View {
+        content
+            .background(GeometryReader { proxy in
+                Color.clear
+                    .preference(key: MatchedGeometryDestinationFrameKey.self, value: proxy.frame(in: .global))
+                    .onPreferenceChange(MatchedGeometryDestinationFrameKey.self) { newValue in
+                        if let newValue {
+                            state.sources[SourceKey(presentationID: presentationID, matchedID: id)] = (matched, newValue)
+                        }
+                    }
+            })
+            .opacity(state.animating && state.presentationID == presentationID ? 0 : 1)
+    }
+}
+
+private struct MatchedGeometryDestinationModifier<Matched: View>: ViewModifier {
+    let id: AnyHashable
+    let matched: Matched
+    @EnvironmentObject private var state: MatchedGeometryState
+    
+    func body(content: Content) -> some View {
+        content
+            .background(GeometryReader { proxy in
+                Color.clear
+                    .preference(key: MatchedGeometryDestinationFrameKey.self, value: proxy.frame(in: .global))
+                    .onPreferenceChange(MatchedGeometryDestinationFrameKey.self) { newValue in
+                        if let newValue,
+                           // ignore intermediate layouts that may happen while the dismiss animation is happening
+                           state.mode != .dismissing {
+                            state.destinations[id] = (AnyView(matched), newValue)
+                        }
+                    }
+            })
+            .opacity(state.animating ? 0 : 1)
+    }
+}
+
+private struct MatchedGeometryDestinationFrameKey: PreferenceKey {
+    static let defaultValue: CGRect? = nil
+    static func reduce(value: inout CGRect?, nextValue: () -> CGRect?) {
+        value = nextValue()
+    }
+}
+
+private struct MatchedGeometrySourcesKey: PreferenceKey {
+    static let defaultValue: [SourceKey: (AnyView, CGRect)] = [:]
+    static func reduce(value: inout Value, nextValue: () -> Value) {
+        value.merge(nextValue(), uniquingKeysWith: { _, new in new })
+    }
+}
+
+struct SourceKey: Hashable {
+    let presentationID: AnyHashable
+    let matchedID: AnyHashable
+}

Packages/MatchedGeometryPresentation/Sources/MatchedGeometryPresentation/MatchedGeometryViewController.swift

@@ -0,0 +1,239 @@
+//
+//  MatchedGeometryViewController.swift
+//  MatchGeom
+//
+//  Created by Shadowfacts on 4/24/23.
+//
+
+import SwiftUI
+import Combine
+
+private let mass: CGFloat = 1
+private let presentStiffness: CGFloat = 300
+private let presentDamping: CGFloat = 20
+private let dismissStiffness: CGFloat = 200
+private let dismissDamping: CGFloat = 20
+
+public class MatchedGeometryState: ObservableObject {
+    @Published var presentationID: AnyHashable?
+    @Published var animating: Bool = false
+    @Published public var mode: Mode = .presenting
+    @Published var sources: [SourceKey: (() -> AnyView, CGRect)] = [:]
+    @Published var currentFrames: [AnyHashable: CGRect] = [:]
+    @Published var destinations: [AnyHashable: (AnyView, CGRect)] = [:]
+    
+    public enum Mode: Equatable {
+        case presenting
+        case idle
+        case dismissing
+    }
+}
+
+class MatchedGeometryViewController<Content: View>: UIViewController, UIViewControllerTransitioningDelegate {
+    
+    let presentationID: AnyHashable
+    let content: Content
+    let state: MatchedGeometryState
+    let backgroundColor: UIColor
+    var contentHost: UIHostingController<ContentContainerView>!
+    var matchedHost: UIHostingController<MatchedContainerView>!
+    
+    init(presentationID: AnyHashable, content: Content, state: MatchedGeometryState, backgroundColor: UIColor) {
+        self.presentationID = presentationID
+        self.content = content
+        self.state = state
+        self.backgroundColor = backgroundColor
+        
+        super.init(nibName: nil, bundle: nil)
+        
+        modalPresentationStyle = .custom
+        transitioningDelegate = self
+    }
+    
+    required init?(coder: NSCoder) {
+        fatalError("init(coder:) has not been implemented")
+    }
+    
+    override func viewDidLoad() {
+        super.viewDidLoad()
+        
+        contentHost = UIHostingController(rootView: ContentContainerView(content: content, state: state))
+        contentHost.view.autoresizingMask = [.flexibleWidth, .flexibleHeight]
+        contentHost.view.frame = view.bounds
+        contentHost.view.backgroundColor = backgroundColor
+        addChild(contentHost)
+        view.addSubview(contentHost.view)
+        contentHost.didMove(toParent: self)
+    }
+    
+    override func viewWillAppear(_ animated: Bool) {
+        super.viewWillAppear(animated)
+        
+        state.presentationID = presentationID
+    }
+    
+    var currentPresentationSources: [AnyHashable: (() -> AnyView, CGRect)] {
+        Dictionary(uniqueKeysWithValues: state.sources.filter { $0.key.presentationID == presentationID }.map { ($0.key.matchedID, $0.value) })
+    }
+    
+    func addMatchedHostingController() {
+        let sources = currentPresentationSources.map { (id: $0.key, view: $0.value.0) }
+        matchedHost = UIHostingController(rootView: MatchedContainerView(sources: sources, state: state))
+        matchedHost.view.autoresizingMask = [.flexibleWidth, .flexibleHeight]
+        matchedHost.view.frame = view.bounds
+        matchedHost.view.backgroundColor = .clear
+        matchedHost.view.layer.zPosition = 100
+        addChild(matchedHost)
+        view.addSubview(matchedHost.view)
+        matchedHost.didMove(toParent: self)
+    }
+    
+    struct ContentContainerView: View {
+        let content: Content
+        let state: MatchedGeometryState
+        
+        var body: some View {
+            content
+                .environmentObject(state)
+        }
+    }
+    
+    struct MatchedContainerView: View {
+        let sources: [(id: AnyHashable, view: () -> AnyView)]
+        @ObservedObject var state: MatchedGeometryState
+        
+        var body: some View {
+            ZStack {
+                ForEach(sources, id: \.id) { (id, view) in
+                    matchedView(id: id, source: view)
+                }
+            }
+        }
+        
+        @ViewBuilder
+        func matchedView(id: AnyHashable, source: () -> AnyView) -> some View {
+            if let frame = state.currentFrames[id],
+               let dest = state.destinations[id]?.0 {
+                ZStack {
+                    source()
+                    dest
+                        .opacity(state.mode == .presenting ? (state.animating ? 1 : 0) : (state.animating ? 0 : 1))
+                }
+                .frame(width: frame.width, height: frame.height)
+                .position(x: frame.midX, y: frame.midY)
+                .ignoresSafeArea()
+                .animation(.interpolatingSpring(mass: Double(mass), stiffness: Double(state.mode == .presenting ? presentStiffness : dismissStiffness), damping: Double(state.mode == .presenting ? presentDamping : dismissDamping), initialVelocity: 0), value: frame)
+            }
+        }
+    }
+    
+    // MARK: UIViewControllerTransitioningDelegate
+    func animationController(forPresented presented: UIViewController, presenting: UIViewController, source: UIViewController) -> UIViewControllerAnimatedTransitioning? {
+        return MatchedGeometryPresentationAnimationController<Content>()
+    }
+    
+    func animationController(forDismissed dismissed: UIViewController) -> UIViewControllerAnimatedTransitioning? {
+        return MatchedGeometryDismissAnimationController<Content>()
+    }
+    
+    func presentationController(forPresented presented: UIViewController, presenting: UIViewController?, source: UIViewController) -> UIPresentationController? {
+        return MatchedGeometryPresentationController(presentedViewController: presented, presenting: presenting)
+    }
+    
+}
+
+class MatchedGeometryPresentationAnimationController<Content: View>: NSObject, UIViewControllerAnimatedTransitioning {
+    func transitionDuration(using transitionContext: UIViewControllerContextTransitioning?) -> TimeInterval {
+        return 0.8
+    }
+
+    func animateTransition(using transitionContext: UIViewControllerContextTransitioning) {
+        let matchedGeomVC = transitionContext.viewController(forKey: .to) as! MatchedGeometryViewController<Content>
+        let container = transitionContext.containerView
+        
+        // add the VC to the container, which kicks off layout out the content hosting controller
+        matchedGeomVC.view.autoresizingMask = [.flexibleWidth, .flexibleHeight]
+        matchedGeomVC.view.frame = container.bounds
+        container.addSubview(matchedGeomVC.view)
+        
+        // layout out the content hosting controller and having enough destinations may take a while
+        // so listen for when it's ready, rather than trying to guess at the timing
+        let cancellable = matchedGeomVC.state.$destinations
+            .filter { destinations in matchedGeomVC.currentPresentationSources.allSatisfy { source in destinations.keys.contains(source.key) } }
+            .first()
+            .sink { destinations in
+                matchedGeomVC.addMatchedHostingController()
+                
+                // setup the initial state for the animation
+                matchedGeomVC.matchedHost.view.isHidden = true
+                matchedGeomVC.state.mode = .presenting
+                matchedGeomVC.state.currentFrames = matchedGeomVC.currentPresentationSources.mapValues(\.1)
+                
+                // wait one runloop iteration for the matched hosting controller to be setup
+                DispatchQueue.main.async {
+                    matchedGeomVC.matchedHost.view.isHidden = false
+                    matchedGeomVC.state.animating = true
+                    // get the now-current destinations, in case they've changed since the sunk value was published
+                    matchedGeomVC.state.currentFrames = matchedGeomVC.state.destinations.mapValues(\.1)
+                }
+            }
+        
+        matchedGeomVC.contentHost.view.layer.opacity = 0
+        let spring = UISpringTimingParameters(mass: mass, stiffness: presentStiffness, damping: presentDamping, initialVelocity: .zero)
+        let animator = UIViewPropertyAnimator(duration: self.transitionDuration(using: transitionContext), timingParameters: spring)
+        animator.addAnimations {
+            matchedGeomVC.contentHost.view.layer.opacity = 1
+        }
+        animator.addCompletion { _ in
+            transitionContext.completeTransition(true)
+            matchedGeomVC.state.animating = false
+            matchedGeomVC.state.mode = .idle
+            
+            matchedGeomVC.matchedHost?.view.removeFromSuperview()
+            matchedGeomVC.matchedHost?.removeFromParent()
+            cancellable.cancel()
+        }
+        animator.startAnimation()
+    }
+}
+
+class MatchedGeometryDismissAnimationController<Content: View>: NSObject, UIViewControllerAnimatedTransitioning {
+    func transitionDuration(using transitionContext: UIViewControllerContextTransitioning?) -> TimeInterval {
+        return 0.8
+    }
+    
+    func animateTransition(using transitionContext: UIViewControllerContextTransitioning) {
+        let matchedGeomVC = transitionContext.viewController(forKey: .from) as! MatchedGeometryViewController<Content>
+        
+        // recreate the matched host b/c using the current destinations doesn't seem to update the existing one
+        matchedGeomVC.addMatchedHostingController()
+        matchedGeomVC.matchedHost.view.isHidden = true
+        matchedGeomVC.state.mode = .dismissing
+        matchedGeomVC.state.currentFrames = matchedGeomVC.state.destinations.mapValues(\.1)
+        
+        DispatchQueue.main.async {
+            matchedGeomVC.matchedHost.view.isHidden = false
+            matchedGeomVC.state.animating = true
+            matchedGeomVC.state.currentFrames = matchedGeomVC.currentPresentationSources.mapValues(\.1)
+        }
+        
+        let spring = UISpringTimingParameters(mass: mass, stiffness: dismissStiffness, damping: dismissDamping, initialVelocity: .zero)
+        let animator = UIViewPropertyAnimator(duration: transitionDuration(using: transitionContext), timingParameters: spring)
+        animator.addAnimations {
+            matchedGeomVC.contentHost.view.layer.opacity = 0
+        }
+        animator.addCompletion { _ in
+            transitionContext.completeTransition(true)
+            matchedGeomVC.state.animating = false
+            matchedGeomVC.state.mode = .idle
+        }
+        animator.startAnimation()
+    }
+}
+
+class MatchedGeometryPresentationController: UIPresentationController {
+    override func dismissalTransitionWillBegin() {
+        super.dismissalTransitionWillBegin()
+        delegate?.presentationControllerWillDismiss?(self)
+    }
+}

Packages/MatchedGeometryPresentation/Sources/MatchedGeometryPresentation/View+PresentViewController.swift

@@ -0,0 +1,62 @@
+//
+//  View+PresentViewController.swift
+//  MatchGeom
+//
+//  Created by Shadowfacts on 4/24/23.
+//
+
+import SwiftUI
+
+extension View {
+    func presentViewController(_ makeVC: @escaping () -> UIViewController, isPresented: Binding<Bool>) -> some View {
+        self
+            .background(
+                ViewControllerPresenter(makeVC: makeVC, isPresented: isPresented)
+            )
+    }
+}
+
+private struct ViewControllerPresenter: UIViewControllerRepresentable {
+    let makeVC: () -> UIViewController
+    @Binding var isPresented: Bool
+    
+    func makeUIViewController(context: Context) -> UIViewController {
+        return UIViewController()
+    }
+    
+    func updateUIViewController(_ uiViewController: UIViewController, context: Context) {
+        if isPresented {
+            if uiViewController.presentedViewController == nil {
+                let presented = makeVC()
+                presented.presentationController!.delegate = context.coordinator
+                uiViewController.present(presented, animated: true)
+                context.coordinator.didPresent = true
+            }
+        } else {
+            if context.coordinator.didPresent,
+               let presentedViewController = uiViewController.presentedViewController,
+               !presentedViewController.isBeingDismissed {
+                uiViewController.dismiss(animated: true)
+                context.coordinator.didPresent = false
+            }
+        }
+    }
+    
+    func makeCoordinator() -> Coordinator {
+        return Coordinator(isPresented: $isPresented)
+    }
+    
+    class Coordinator: NSObject, UIAdaptivePresentationControllerDelegate {
+        @Binding var isPresented: Bool
+        var didPresent = false
+        
+        init(isPresented: Binding<Bool>) {
+            self._isPresented = isPresented
+        }
+        
+        func presentationControllerWillDismiss(_ presentationController: UIPresentationController) {
+            isPresented = false
+            didPresent = false
+        }
+    }
+}

Packages/Pachyderm/.swiftpm/xcode/xcshareddata/xcschemes/Pachyderm.xcscheme

@@ -1,6 +1,6 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <Scheme
-   LastUpgradeVersion = "1400"
+   LastUpgradeVersion = "1500"
    version = "1.3">
    <BuildAction
       parallelizeBuildables = "YES"
@@ -17,7 +17,7 @@
                BlueprintIdentifier = "D61099AA2144B0CC00432DC2"
                BuildableName = "Pachyderm.framework"
                BlueprintName = "Pachyderm"
-               ReferencedContainer = "container:Tusker.xcodeproj">
+               ReferencedContainer = "container:../../Tusker.xcodeproj">
             </BuildableReference>
          </BuildActionEntry>
       </BuildActionEntries>
@@ -35,7 +35,7 @@
                BlueprintIdentifier = "PachydermTests"
                BuildableName = "PachydermTests"
                BlueprintName = "PachydermTests"
-               ReferencedContainer = "container:Pachyderm">
+               ReferencedContainer = "container:">
             </BuildableReference>
          </TestableReference>
       </Testables>
@@ -56,7 +56,7 @@
             BlueprintIdentifier = "D61099AA2144B0CC00432DC2"
             BuildableName = "Pachyderm.framework"
             BlueprintName = "Pachyderm"
-            ReferencedContainer = "container:Tusker.xcodeproj">
+            ReferencedContainer = "container:../../Tusker.xcodeproj">
          </BuildableReference>
       </MacroExpansion>
    </LaunchAction>
@@ -72,7 +72,7 @@
             BlueprintIdentifier = "D61099AA2144B0CC00432DC2"
             BuildableName = "Pachyderm.framework"
             BlueprintName = "Pachyderm"
-            ReferencedContainer = "container:Tusker.xcodeproj">
+            ReferencedContainer = "container:../../Tusker.xcodeproj">
          </BuildableReference>
       </MacroExpansion>
    </ProfileAction>

Packages/Pachyderm/Package.swift

@@ -1,4 +1,4 @@
-// swift-tools-version: 5.6
+// swift-tools-version: 6.0
 // The swift-tools-version declares the minimum version of Swift required to build this package.
 
 import PackageDescription
@@ -6,7 +6,7 @@ import PackageDescription
 let package = Package(
     name: "Pachyderm",
     platforms: [
-        .iOS(.v14),
+        .iOS(.v16),
     ],
     products: [
         // Products define the executables and libraries a package produces, and make them visible to other packages.
@@ -16,7 +16,7 @@ let package = Package(
     ],
     dependencies: [
         // Dependencies declare other packages that this package depends on.
-        .package(url: "https://github.com/karwa/swift-url.git", branch: "main"),
+        .package(url: "https://github.com/karwa/swift-url.git", exact: "0.4.2"),
     ],
     targets: [
         // Targets are the basic building blocks of a package. A target can define a module or a test suite.
@@ -26,9 +26,15 @@ let package = Package(
             dependencies: [
                 .product(name: "WebURL", package: "swift-url"),
                 .product(name: "WebURLFoundationExtras", package: "swift-url"),
+            ],
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
             ]),
         .testTarget(
             name: "PachydermTests",
-            dependencies: ["Pachyderm"]),
+            dependencies: ["Pachyderm"],
+            swiftSettings: [
+                .swiftLanguageMode(.v5)
+            ]),
     ]
 )

Packages/Pachyderm/Sources/Pachyderm/Client.swift

@@ -7,11 +7,12 @@
 //
 
 import Foundation
+import WebURL
 
 /**
  The base Mastodon API client.
  */
-public class Client {
+public struct Client: Sendable {
     
     public typealias Callback<Result: Decodable> = (Response<Result>) -> Void
     
@@ -19,8 +20,6 @@ public class Client {
     let session: URLSession
     
     public var accessToken: String?
-    
-    public var appID: String?
     public var clientID: String?
     public var clientSecret: String?
     
@@ -43,7 +42,7 @@ public class Client {
             } else if let date = iso8601.date(from: str) {
                 return date
             } else {
-                throw DecodingError.typeMismatch(Date.self, .init(codingPath: container.codingPath, debugDescription: "unexpected date format"))
+                throw DecodingError.typeMismatch(Date.self, .init(codingPath: container.codingPath, debugDescription: "unexpected date format: \(str)"))
             }
         })
         
@@ -60,9 +59,11 @@ public class Client {
         return encoder
     }()
     
-    public init(baseURL: URL, accessToken: String? = nil, session: URLSession = .shared) {
+    public init(baseURL: URL, accessToken: String? = nil, clientID: String? = nil, clientSecret: String? = nil, session: URLSession = .shared) {
         self.baseURL = baseURL
         self.accessToken = accessToken
+        self.clientID = clientID
+        self.clientSecret = clientSecret
         self.session = session
     }
     
@@ -83,7 +84,7 @@ public class Client {
                     completion(.failure(Error(request: request, type: .invalidResponse)))
                     return
             }
-            guard response.statusCode == 200 else {
+            guard response.statusCode == 200 || request.additionalAcceptableHTTPCodes.contains(response.statusCode) else {
                 let mastodonError = try? Client.decoder.decode(MastodonError.self, from: data)
                 let type: ErrorType = mastodonError.flatMap { .mastodonError(response.statusCode, $0.description) } ?? .unexpectedStatus(response.statusCode)
                 completion(.failure(Error(request: request, type: type)))
@@ -104,6 +105,20 @@ public class Client {
         return task
     }
     
+    @discardableResult
+    public func run<Result: Sendable>(_ request: Request<Result>) async throws -> (Result, Pagination?) {
+        return try await withCheckedThrowingContinuation { continuation in
+            run(request) { response in
+                switch response {
+                case .failure(let error):
+                    continuation.resume(throwing: error)
+                case .success(let result, let pagination):
+                    continuation.resume(returning: (result, pagination))
+                }
+            }
+        }
+    }
+    
     func createURLRequest<Result>(request: Request<Result>) -> URLRequest? {
         guard var components = URLComponents(url: baseURL, resolvingAgainstBaseURL: true) else { return nil }
         components.path = request.endpoint.path
@@ -112,11 +127,17 @@ public class Client {
         var urlRequest = URLRequest(url: url, timeoutInterval: timeoutInterval)
         urlRequest.httpMethod = request.method.name
         urlRequest.httpBody = request.body.data
+        urlRequest.setValue("application/json", forHTTPHeaderField: "Accept")
+        for (name, value) in request.headers {
+            urlRequest.setValue(value, forHTTPHeaderField: name)
+        }
         if let mimeType = request.body.mimeType {
             urlRequest.setValue(mimeType, forHTTPHeaderField: "Content-Type")
         }
         if let accessToken = accessToken {
             urlRequest.setValue("Bearer \(accessToken)", forHTTPHeaderField: "Authorization")
+            // We consider authenticated requests to be user-initiated.
+            urlRequest.attribution = .user
         }
         return urlRequest
     }
@@ -129,47 +150,52 @@ public class Client {
                 "scopes" => scopes.scopeString,
                 "website" => website?.absoluteString
             ]))
-        run(request) { result in
-            defer { completion(result) }
-            guard case let .success(application, _) = result else { return }
-            
-            self.appID = application.id
-            self.clientID = application.clientID
-            self.clientSecret = application.clientSecret
-        }
+        run(request, completion: completion)
     }
     
-    public func getAccessToken(authorizationCode: String, redirectURI: String, completion: @escaping Callback<LoginSettings>) {
+    public func getAccessToken(authorizationCode: String, redirectURI: String, scopes: [Scope], completion: @escaping Callback<LoginSettings>) {
         let request = Request<LoginSettings>(method: .post, path: "/oauth/token", body: ParametersBody([
                 "client_id" => clientID,
                 "client_secret" => clientSecret,
                 "grant_type" => "authorization_code",
                 "code" => authorizationCode,
-                "redirect_uri" => redirectURI
+                "redirect_uri" => redirectURI,
+                "scope" => scopes.scopeString,
             ]))
-        run(request) { result in
-            defer { completion(result) }
-            guard case let .success(loginSettings, _) = result else { return }
-            
-            self.accessToken = loginSettings.accessToken
-        }
+        run(request, completion: completion)
     }
     
-    public func nodeInfo(completion: @escaping Callback<NodeInfo>) {
-        let wellKnown = Request<WellKnown>(method: .get, path: "/.well-known/nodeinfo")
-        run(wellKnown) { result in
-            switch result {
-            case let .failure(error):
-                completion(.failure(error))
-                
-            case let .success(wellKnown, _):
-                if let url = wellKnown.links.first(where: { $0.rel == "http://nodeinfo.diaspora.software/ns/schema/2.0" }),
-                   let components = URLComponents(string: url.href),
-                   components.host == self.baseURL.host {
-                    let nodeInfo = Request<NodeInfo>(method: .get, path: Endpoint(stringLiteral: components.path))
-                    self.run(nodeInfo, completion: completion)
+    public func revokeAccessToken() async throws {
+        guard let accessToken else {
+            return
+        }
+        let request = Request<Empty>(method: .post, path: "/oauth/revoke", body: ParametersBody([
+            "token" => accessToken,
+            "client_id" => clientID!,
+            "client_secret" => clientSecret!,
+        ]))
+        return try await withCheckedThrowingContinuation({ continuation in
+            self.run(request) { response in
+                switch response {
+                case .failure(let error):
+                    continuation.resume(throwing: error)
+                case .success(_, _):
+                    continuation.resume()
                 }
             }
+        })
+    }
+    
+    public func nodeInfo() async throws -> NodeInfo {
+        let wellKnown = Request<WellKnown>(method: .get, path: "/.well-known/nodeinfo")
+        let wellKnownResults = try await run(wellKnown).0
+        if let url = wellKnownResults.links.first(where: { $0.rel == "http://nodeinfo.diaspora.software/ns/schema/2.0" }),
+           let href = WebURL(url.href),
+           href.host == WebURL(self.baseURL)?.host {
+            let nodeInfo = Request<NodeInfo>(method: .get, path: Endpoint(stringLiteral: href.path))
+            return try await run(nodeInfo).0
+        } else {
+            throw NodeInfoError.noWellKnownLink
         }
     }
     
@@ -178,22 +204,32 @@ public class Client {
         return Request<Account>(method: .get, path: "/api/v1/accounts/verify_credentials")
     }
     
-    public static func getFavourites() -> Request<[Status]> {
-        return Request<[Status]>(method: .get, path: "/api/v1/favourites")
+    public static func getFavourites(range: RequestRange = .default) -> Request<[TryDecode<Status>]> {
+        var request = Request<[TryDecode<Status>]>(method: .get, path: "/api/v1/favourites")
+        request.range = range
+        return request
     }
     
     public static func getRelationships(accounts: [String]? = nil) -> Request<[Relationship]> {
         return Request<[Relationship]>(method: .get, path: "/api/v1/accounts/relationships", queryParameters: "id" => accounts)
     }
     
-    public static func getInstance() -> Request<Instance> {
-        return Request<Instance>(method: .get, path: "/api/v1/instance")
+    public static func getInstanceV1() -> Request<InstanceV1> {
+        return Request<InstanceV1>(method: .get, path: "/api/v1/instance")
+    }
+    
+    public static func getInstanceV2() -> Request<InstanceV2> {
+        return Request<InstanceV2>(method: .get, path: "/api/v2/instance")
     }
     
     public static func getCustomEmoji() -> Request<[Emoji]> {
         return Request<[Emoji]>(method: .get, path: "/api/v1/custom_emojis")
     }
     
+    public static func getPreferences() -> Request<Preferences> {
+        return Request(method: .get, path: "/api/v1/preferences")
+    }
+    
     // MARK: - Accounts
     public static func getAccount(id: String) -> Request<Account> {
         return Request<Account>(method: .get, path: "/api/v1/accounts/\(id)")
@@ -290,6 +326,13 @@ public class Client {
             ], attachment))
     }
     
+    public static func updateAttachment(id: String, description: String?, focus: (Float, Float)?) -> Request<Attachment> {
+        return Request(method: .put, path: "/api/v1/media/\(id)", body: FormDataBody([
+            "description" => description,
+            "focus" => focus
+        ], nil))
+    }
+    
     // MARK: - Mutes
     public static func getMutes(range: RequestRange) -> Request<[Account]> {
         var request = Request<[Account]>(method: .get, path: "/api/v1/mutes")
@@ -298,6 +341,10 @@ public class Client {
     }
     
     // MARK: - Notifications
+    public static func getNotification(id: String) -> Request<Notification> {
+        return Request(method: .get, path: "/api/v1/notifications/\(id)")
+    }
+    
     public static func getNotifications(allowedTypes: [Notification.Kind], range: RequestRange = .default) -> Request<[Notification]> {
         var request = Request<[Notification]>(method: .get, path: "/api/v1/notifications", queryParameters:
             "types" => allowedTypes.map { $0.rawValue }
@@ -357,69 +404,110 @@ public class Client {
     public static func createStatus(text: String,
                                     contentType: StatusContentType = .plain,
                                     inReplyTo: String? = nil,
-                                    media: [Attachment]? = nil,
+                                    mediaIDs: [String]? = nil,
                                     sensitive: Bool? = nil,
                                     spoilerText: String? = nil,
-                                    visibility: Status.Visibility? = nil,
-                                    language: String? = nil,
+                                    visibility: String? = nil,
+                                    language: String? = nil, // language supported by mastodon and akkoma
                                     pollOptions: [String]? = nil,
                                     pollExpiresIn: Int? = nil,
                                     pollMultiple: Bool? = nil,
-                                    localOnly: Bool? = nil /* hometown only, not glitch */) -> Request<Status> {
-        return Request<Status>(method: .post, path: "/api/v1/statuses", body: ParametersBody([
-                "status" => text,
-                "content_type" => contentType.mimeType,
-                "in_reply_to_id" => inReplyTo,
-                "sensitive" => sensitive,
-                "spoiler_text" => spoilerText,
-                "visibility" => visibility?.rawValue,
-                "language" => language,
-                "poll[expires_in]" => pollExpiresIn,
-                "poll[multiple]" => pollMultiple,
-                "local_only" => localOnly,
-            ] + "media_ids" => media?.map { $0.id } + "poll[options]" => pollOptions))
+                                    localOnly: Bool? = nil, /* hometown only, not glitch */
+                                    idempotencyKey: String) -> Request<Status> {
+        var req = Request<Status>(method: .post, path: "/api/v1/statuses", body: ParametersBody([
+            "status" => text,
+            "content_type" => contentType.mimeType,
+            "in_reply_to_id" => inReplyTo,
+            "sensitive" => sensitive,
+            "spoiler_text" => spoilerText,
+            "visibility" => visibility,
+            "language" => language,
+            "poll[expires_in]" => pollExpiresIn,
+            "poll[multiple]" => pollMultiple,
+            "local_only" => localOnly,
+        ] + "media_ids" => mediaIDs + "poll[options]" => pollOptions))
+        req.headers["Idempotency-Key"] = idempotencyKey
+        return req
+    }
+    
+    public static func editStatus(
+        id: String,
+        text: String,
+        contentType: StatusContentType = .plain,
+        spoilerText: String?,
+        sensitive: Bool,
+        language: String?,
+        mediaIDs: [String],
+        mediaAttributes: [EditStatusMediaAttributes],
+        poll: EditPollParameters?
+    ) -> Request<Status> {
+        let params = EditStatusParameters(
+            id: id,
+            text: text,
+            contentType: contentType,
+            spoilerText: spoilerText,
+            sensitive: sensitive,
+            language: language,
+            mediaIDs: mediaIDs,
+            mediaAttributes: mediaAttributes,
+            poll: poll
+        )
+        return Request(method: .put, path: "/api/v1/statuses/\(id)", body: JsonBody(params))
     }
     
     // MARK: - Timelines
-    public static func getStatuses(timeline: Timeline, range: RequestRange = .default) -> Request<[Status]> {
+    public static func getStatuses(timeline: Timeline, range: RequestRange = .default) -> Request<[TryDecode<Status>]> {
         return timeline.request(range: range)
     }
     
-    
     // MARK: - Bookmarks
-    public static func getBookmarks(range: RequestRange = .default) -> Request<[Status]> {
-        var request = Request<[Status]>(method: .get, path: "/api/v1/bookmarks")
+    public static func getBookmarks(range: RequestRange = .default) -> Request<[TryDecode<Status>]> {
+        var request = Request<[TryDecode<Status>]>(method: .get, path: "/api/v1/bookmarks")
         request.range = range
         return request
     }
     
     // MARK: - Instance
-    public static func getTrendingHashtags(limit: Int? = nil) -> Request<[Hashtag]> {
-        let parameters: [Parameter]
-        if let limit = limit {
-            parameters = ["limit" => limit]
-        } else {
-            parameters = []
+    public static func getTrendingHashtagsDeprecated(limit: Int? = nil, offset: Int? = nil) -> Request<[Hashtag]> {
+        var parameters: [Parameter] = []
+        if let limit {
+            parameters.append("limit" => limit)
+        }
+        if let offset {
+            parameters.append("offset" => offset)
         }
         return Request<[Hashtag]>(method: .get, path: "/api/v1/trends", queryParameters: parameters)
     }
     
-    public static func getTrendingStatuses(limit: Int? = nil) -> Request<[Status]> {
-        let parameters: [Parameter]
-        if let limit = limit {
-            parameters = ["limit" => limit]
-        } else {
-            parameters = []
+    public static func getTrendingHashtags(limit: Int? = nil, offset: Int? = nil) -> Request<[Hashtag]> {
+        var parameters: [Parameter] = []
+        if let limit {
+            parameters.append("limit" => limit)
+        }
+        if let offset {
+            parameters.append("offset" => offset)
+        }
+        return Request<[Hashtag]>(method: .get, path: "/api/v1/trends/tags", queryParameters: parameters)
+    }
+    
+    public static func getTrendingStatuses(limit: Int? = nil, offset: Int? = nil) -> Request<[TryDecode<Status>]> {
+        var parameters: [Parameter] = []
+        if let limit {
+            parameters.append("limit" => limit)
+        }
+        if let offset {
+            parameters.append("offset" => offset)
         }
         return Request(method: .get, path: "/api/v1/trends/statuses", queryParameters: parameters)
     }
     
-    public static func getTrendingLinks(limit: Int? = nil) -> Request<[Card]> {
-        let parameters: [Parameter]
-        if let limit = limit {
-            parameters = ["limit" => limit]
-        } else {
-            parameters = []
+    public static func getTrendingLinks(limit: Int? = nil, offset: Int? = nil) -> Request<[Card]> {
+        var parameters: [Parameter] = []
+        if let limit {
+            parameters.append("limit" => limit)
+        }
+        if let offset {
+            parameters.append("offset" => offset)
         }
         return Request(method: .get, path: "/api/v1/trends/links", queryParameters: parameters)
     }
@@ -444,10 +532,16 @@ public class Client {
         ])
     }
     
+    // MARK: - Hashtags
+    /// Requires Mastodon 4.0.0+
+    public static func getHashtag(name: String) -> Request<Hashtag> {
+        return Request(method: .get, path: "/api/v1/tags/\(name)")
+    }
+
 }
 
 extension Client {
-    public struct Error: LocalizedError {
+    public struct Error: LocalizedError, Sendable {
         public let requestMethod: Method
         public let requestEndpoint: Endpoint
         public let type: ErrorType
@@ -462,13 +556,15 @@ extension Client {
             self.type = type
         }
         
-        public var localizedDescription: String {
+        public var errorDescription: String? {
             switch type {
             case .networkError(let error):
                 return "Network Error: \(error.localizedDescription)"
             // todo: support more status codes
             case .unexpectedStatus(413):
                 return "HTTP 413: Payload Too Large"
+            case .unexpectedStatus(429):
+                return "HTTP 429: Rate Limit Exceeded"
             case .unexpectedStatus(let code):
                 return "HTTP Code \(code)"
             case .invalidRequest:
@@ -482,7 +578,7 @@ extension Client {
             }
         }
     }
-    public enum ErrorType: LocalizedError {
+    public enum ErrorType: LocalizedError, Sendable {
         case networkError(Swift.Error)
         case unexpectedStatus(Int)
         case invalidRequest
@@ -490,4 +586,15 @@ extension Client {
         case invalidModel(Swift.Error)
         case mastodonError(Int, String)
     }
+    
+    enum NodeInfoError: LocalizedError {
+        case noWellKnownLink
+        
+        var errorDescription: String? {
+            switch self {
+            case .noWellKnownLink:
+                return "No well-known link"
+            }
+        }
+    }
 }

Packages/Pachyderm/Sources/Pachyderm/Model/Account.swift

@@ -8,7 +8,7 @@
 
 import Foundation
 
-public final class Account: AccountProtocol, Decodable {
+public final class Account: AccountProtocol, Decodable, Sendable {
     public let id: String
     public let username: String
     public let acct: String
@@ -25,7 +25,7 @@ public final class Account: AccountProtocol, Decodable {
     public let avatarStatic: URL?
     public let header: URL?
     public let headerStatic: URL?
-    public private(set) var emojis: [Emoji]
+    public let emojis: [Emoji]
     public let moved: Bool?
     public let movedTo: Account?
     public let fields: [Field]
@@ -40,8 +40,9 @@ public final class Account: AccountProtocol, Decodable {
         self.displayName = try container.decode(String.self, forKey: .displayName)
         self.locked = try container.decode(Bool.self, forKey: .locked)
         self.createdAt = try container.decode(Date.self, forKey: .createdAt)
-        self.followersCount = try container.decode(Int.self, forKey: .followersCount)
-        self.followingCount = try container.decode(Int.self, forKey: .followingCount)
+        // some instance types (pixelfed, firefish) seem to sometimes send null for these fields, so just fallback to 0
+        self.followersCount = try container.decodeIfPresent(Int.self, forKey: .followersCount) ?? 0
+        self.followingCount = try container.decodeIfPresent(Int.self, forKey: .followingCount) ?? 0
         self.statusesCount = try container.decode(Int.self, forKey: .statusesCount)
         self.note = try container.decode(String.self, forKey: .note)
         self.url = try container.decode(URL.self, forKey: .url)
@@ -70,12 +71,12 @@ public final class Account: AccountProtocol, Decodable {
         }
     }
     
-    public static func authorizeFollowRequest(_ account: Account) -> Request<Relationship> {
-        return Request<Relationship>(method: .post, path: "/api/v1/follow_requests/\(account.id)/authorize")
+    public static func authorizeFollowRequest(_ accountID: String) -> Request<Relationship> {
+        return Request<Relationship>(method: .post, path: "/api/v1/follow_requests/\(accountID)/authorize")
     }
     
-    public static func rejectFollowRequest(_ account: Account) -> Request<Relationship> {
-        return Request<Relationship>(method: .post, path: "/api/v1/follow_requests/\(account.id)/reject")
+    public static func rejectFollowRequest(_ accountID: String) -> Request<Relationship> {
+        return Request<Relationship>(method: .post, path: "/api/v1/follow_requests/\(accountID)/reject")
     }
     
     public static func removeFromFollowRequests(_ account: Account) -> Request<Empty> {
@@ -94,8 +95,8 @@ public final class Account: AccountProtocol, Decodable {
         return request
     }
     
-    public static func getStatuses(_ accountID: String, range: RequestRange = .default, onlyMedia: Bool? = nil, pinned: Bool? = nil, excludeReplies: Bool? = nil, excludeReblogs: Bool? = nil) -> Request<[Status]> {
-        var request = Request<[Status]>(method: .get, path: "/api/v1/accounts/\(accountID)/statuses", queryParameters: [
+    public static func getStatuses(_ accountID: String, range: RequestRange = .default, onlyMedia: Bool? = nil, pinned: Bool? = nil, excludeReplies: Bool? = nil, excludeReblogs: Bool? = nil) -> Request<[TryDecode<Status>]> {
+        var request = Request<[TryDecode<Status>]>(method: .get, path: "/api/v1/accounts/\(accountID)/statuses", queryParameters: [
                 "only_media" => onlyMedia,
                 "pinned" => pinned,
                 "exclude_replies" => excludeReplies,
@@ -109,6 +110,12 @@ public final class Account: AccountProtocol, Decodable {
         return Request<Relationship>(method: .post, path: "/api/v1/accounts/\(accountID)/follow")
     }
     
+    public static func setShowReblogs(_ accountID: String, showReblogs: Bool) -> Request<Relationship> {
+        return Request(method: .post, path: "/api/v1/accounts/\(accountID)/follow", body: ParametersBody([
+            "reblogs" => showReblogs
+        ]))
+    }
+    
     public static func unfollow(_ accountID: String) -> Request<Relationship> {
         return Request<Relationship>(method: .post, path: "/api/v1/accounts/\(accountID)/unfollow")
     }
@@ -165,7 +172,7 @@ extension Account: CustomDebugStringConvertible {
 }
 
 extension Account {
-    public struct Field: Codable {
+    public struct Field: Codable, Equatable, Sendable {
         public let name: String
         public let value: String
         public let verifiedAt: Date?

Packages/Pachyderm/Sources/Pachyderm/Model/Announcement.swift

@@ -0,0 +1,99 @@
+//
+//  Announcement.swift
+//  Pachyderm
+//
+//  Created by Shadowfacts on 4/16/24.
+//
+
+import Foundation
+import WebURL
+
+public struct Announcement: Decodable, Sendable, Hashable, Identifiable {
+    public let id: String
+    public let content: String
+    public let startsAt: Date?
+    public let endsAt: Date?
+    public let allDay: Bool
+    public let publishedAt: Date
+    public let updatedAt: Date
+    public let read: Bool?
+    public let mentions: [Account]
+    public let statuses: [Status]
+    public let tags: [Hashtag]
+    public let emojis: [Emoji]
+    public var reactions: [Reaction]
+    
+    public static func all() -> Request<[Announcement]> {
+        return Request(method: .get, path: "/api/v1/announcements")
+    }
+    
+    public static func dismiss(id: String) -> Request<Empty> {
+        return Request(method: .post, path: "/api/v1/announcements/\(id)/dismiss")
+    }
+    
+    public static func react(id: String, name: String) -> Request<Empty> {
+        return Request(method: .put, path: "/api/v1/announcements/\(id)/reactions/\(name)")
+    }
+    
+    public static func unreact(id: String, name: String) -> Request<Empty> {
+        return Request(method: .delete, path: "/api/v1/announcements/\(id)/reactions/\(name)")
+    }
+
+    enum CodingKeys: String, CodingKey {
+        case id
+        case content
+        case startsAt = "starts_at"
+        case endsAt = "ends_at"
+        case allDay = "all_day"
+        case publishedAt = "published_at"
+        case updatedAt = "updated_at"
+        case read
+        case mentions
+        case statuses
+        case tags
+        case emojis
+        case reactions
+    }
+}
+
+extension Announcement {
+    public struct Account: Decodable, Sendable, Hashable {
+        public let id: String
+        public let username: String
+        public let url: WebURL
+        public let acct: String
+    }
+}
+
+extension Announcement {
+    public struct Status: Decodable, Sendable, Hashable {
+        public let id: String
+        public let url: WebURL
+    }
+}
+
+extension Announcement {
+    public struct Reaction: Decodable, Sendable, Hashable {
+        public let name: String
+        public var count: Int
+        public var me: Bool?
+        public let url: URL?
+        public let staticURL: URL?
+        
+        public init(name: String, count: Int, me: Bool?, url: URL?, staticURL: URL?) {
+            self.name = name
+            self.count = count
+            self.me = me
+            self.url = url
+            self.staticURL = staticURL
+        }
+        
+        enum CodingKeys: String, CodingKey {
+            case name
+            case count
+            case me
+            case url
+            case staticURL = "static_url"
+        }
+    }
+}

Packages/Pachyderm/Sources/Pachyderm/Model/Application.swift

@@ -8,11 +8,11 @@
 
 import Foundation
 
-public class Application: Decodable {
+public struct Application: Decodable, Sendable {
     public let name: String
     public let website: URL?
     
-    public required init(from decoder: Decoder) throws {
+    public init(from decoder: Decoder) throws {
         let container = try decoder.container(keyedBy: CodingKeys.self)
         
         self.name = try container.decode(String.self, forKey: .name)

Packages/Pachyderm/Sources/Pachyderm/Model/Attachment.swift

@@ -8,7 +8,7 @@
 
 import Foundation
 
-public class Attachment: Codable {
+public struct Attachment: Codable, Sendable {
     public let id: String
     public let kind: Kind
     public let url: URL
@@ -25,7 +25,18 @@ public class Attachment: Codable {
             ], nil))
     }
     
-    required public init(from decoder: Decoder) throws {
+    public init(id: String, kind: Attachment.Kind, url: URL, remoteURL: URL? = nil, previewURL: URL? = nil, meta: Attachment.Metadata? = nil, description: String? = nil, blurHash: String? = nil) {
+        self.id = id
+        self.kind = kind
+        self.url = url
+        self.remoteURL = remoteURL
+        self.previewURL = previewURL
+        self.meta = meta
+        self.description = description
+        self.blurHash = blurHash
+    }
+    
+    public init(from decoder: Decoder) throws {
         let container = try decoder.container(keyedBy: CodingKeys.self)
         self.id = try container.decode(String.self, forKey: .id)
         self.kind = try container.decode(Kind.self, forKey: .kind)
@@ -50,7 +61,7 @@ public class Attachment: Codable {
 }
 
 extension Attachment {
-    public enum Kind: String, Codable {
+    public enum Kind: String, Codable, Sendable {
         case image
         case video
         case gifv
@@ -77,7 +88,7 @@ extension Attachment {
 }
 
 extension Attachment {
-    public struct Metadata: Codable {
+    public struct Metadata: Codable, Sendable {
         public let length: String?
         public let duration: Float?
         public let audioEncoding: String?
@@ -108,7 +119,7 @@ extension Attachment {
         }
     }
     
-    public struct ImageMetadata: Codable {
+    public struct ImageMetadata: Codable, Sendable {
         public let width: Int?
         public let height: Int?
         public let size: String?

Packages/Pachyderm/Sources/Pachyderm/Model/Card.swift

@@ -9,7 +9,7 @@
 import Foundation
 import WebURL
 
-public class Card: Codable {
+public struct Card: Codable, Sendable {
     public let url: WebURL
     public let title: String
     public let description: String
@@ -26,7 +26,39 @@ public class Card: Codable {
     /// Only present when returned from the trending links endpoint
     public let history: [History]?
     
-    public required init(from decoder: Decoder) throws {
+    public init(
+        url: WebURL,
+        title: String,
+        description: String,
+        image: WebURL? = nil,
+        kind: Card.Kind,
+        authorName: String? = nil,
+        authorURL: WebURL? = nil,
+        providerName: String? = nil,
+        providerURL: WebURL? = nil,
+        html: String? = nil,
+        width: Int? = nil,
+        height: Int? = nil,
+        blurhash: String? = nil,
+        history: [History]? = nil
+    ) {
+        self.url = url
+        self.title = title
+        self.description = description
+        self.image = image
+        self.kind = kind
+        self.authorName = authorName
+        self.authorURL = authorURL
+        self.providerName = providerName
+        self.providerURL = providerURL
+        self.html = html
+        self.width = width
+        self.height = height
+        self.blurhash = blurhash
+        self.history = history
+    }
+
+    public init(from decoder: Decoder) throws {
         let container = try decoder.container(keyedBy: CodingKeys.self)
         
         self.url = try container.decode(WebURL.self, forKey: .url)
@@ -75,7 +107,7 @@ public class Card: Codable {
 }
 
 extension Card {
-    public enum Kind: String, Codable {
+    public enum Kind: String, Codable, Sendable {
         case link
         case photo
         case video

Packages/Pachyderm/Sources/Pachyderm/Model/ConversationContext.swift

@@ -8,7 +8,7 @@
 
 import Foundation
 
-public class ConversationContext: Decodable {
+public struct ConversationContext: Decodable, Sendable {
     public let ancestors: [Status]
     public let descendants: [Status]
     

Packages/Pachyderm/Sources/Pachyderm/Model/DirectoryOrder.swift

@@ -8,7 +8,7 @@
 
 import Foundation
 
-public enum DirectoryOrder: String, CaseIterable {
+public enum DirectoryOrder: String, CaseIterable, Sendable {
     case active
     case new
 }

Packages/Pachyderm/Sources/Pachyderm/Model/EditStatusParameters.swift

@@ -0,0 +1,97 @@
+//
+//  EditStatusParameters.swift
+//  Pachyderm
+//
+//  Created by Shadowfacts on 5/10/23.
+//
+
+import Foundation
+
+struct EditStatusParameters: Encodable, Sendable {
+    let id: String
+    let text: String
+    let contentType: StatusContentType
+    let spoilerText: String?
+    let sensitive: Bool
+    let language: String?
+    let mediaIDs: [String]
+    let mediaAttributes: [EditStatusMediaAttributes]
+    let poll: EditPollParameters?
+    
+    func encode(to encoder: Encoder) throws {
+        var container = encoder.container(keyedBy: CodingKeys.self)
+        try container.encode(self.id, forKey: .id)
+        try container.encode(self.text, forKey: .text)
+        try container.encode(self.contentType.mimeType, forKey: .contentType)
+        try container.encodeIfPresent(self.spoilerText, forKey: .spoilerText)
+        try container.encode(self.sensitive, forKey: .sensitive)
+        try container.encodeIfPresent(self.language, forKey: .language)
+        try container.encode(self.mediaIDs, forKey: .mediaIDs)
+        try container.encode(self.mediaAttributes, forKey: .mediaAttributes)
+        try container.encodeIfPresent(self.poll, forKey: .poll)
+    }
+    
+    enum CodingKeys: String, CodingKey {
+        case id
+        case text = "status"
+        case contentType = "content_type"
+        case spoilerText = "spoiler_text"
+        case sensitive
+        case language
+        case mediaIDs = "media_ids"
+        case mediaAttributes = "media_attributes"
+        case poll
+    }
+}
+
+public struct EditPollParameters: Encodable, Sendable {
+    let options: [String]
+    let expiresIn: Int
+    let multiple: Bool
+    
+    public init(options: [String], expiresIn: Int, multiple: Bool) {
+        self.options = options
+        self.expiresIn = expiresIn
+        self.multiple = multiple
+    }
+    
+    public func encode(to encoder: Encoder) throws {
+        var container = encoder.container(keyedBy: CodingKeys.self)
+        try container.encode(self.options, forKey: .options)
+        try container.encode(self.expiresIn, forKey: .expiresIn)
+        try container.encode(self.multiple, forKey: .multiple)
+    }
+    
+    enum CodingKeys: String, CodingKey {
+        case options
+        case expiresIn = "expires_in"
+        case multiple
+    }
+}
+
+public struct EditStatusMediaAttributes: Encodable, Sendable {
+    let id: String
+    let description: String
+    let focus: (Float, Float)?
+    
+    public init(id: String, description: String, focus: (Float, Float)?) {
+        self.id = id
+        self.description = description
+        self.focus = focus
+    }
+    
+    public func encode(to encoder: Encoder) throws {
+        var container = encoder.container(keyedBy: CodingKeys.self)
+        try container.encode(id, forKey: .id)
+        try container.encode(description, forKey: .description)
+        if let focus {
+            try container.encode("\(focus.0),\(focus.1)", forKey: .focus)
+        }
+    }
+    
+    enum CodingKeys: String, CodingKey {
+        case id
+        case description
+        case focus
+    }
+}